--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.ControlView;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ITraceControlComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ITraceControlComponentChangedListener;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TargetNodeState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceControlComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceControlRoot;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.ILttngControlService;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.LTTngControlService;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.component;
+
+import java.util.LinkedList;
+import java.util.List;
+
+import junit.framework.Test;
+import junit.framework.TestCase;
+import junit.framework.TestSuite;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponentChangedListener;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlRoot;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.LTTngControlService;
+import org.eclipse.linuxtools.lttng.stubs.service.TestRemoteSystemProxy;
+import org.eclipse.linuxtools.lttng.ui.tests.control.model.impl.ListenerValidator;
+import org.eclipse.swt.graphics.Image;
+import org.eclipse.ui.ISharedImages;
+import org.eclipse.ui.PlatformUI;
+import org.junit.After;
+import org.junit.Before;
+
+/**
+ * The class <code>TraceControlComponentTest</code> contains tests for the class <code>{@link TraceControlComponent}</code>.
+ *
+ */
+@SuppressWarnings("nls")
+public class TraceControlComponentTest extends TestCase {
+
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+
+ // ------------------------------------------------------------------------
+ // Static methods
+ // ------------------------------------------------------------------------
+
+ /**
+ * Returns test setup used when executing test case stand-alone.
+ * @return Test setup class
+ */
+ public static Test suite() {
+ return new ModelImplTestSetup(new TestSuite(TraceControlComponentTest.class));
+ }
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception
+ * if the initialization fails for some reason
+ *
+ */
+ @Override
+ @Before
+ public void setUp() throws Exception {
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception
+ * if the clean-up fails for some reason
+ *
+ */
+ @Override
+ @After
+ public void tearDown() throws Exception {
+ }
+
+ /**
+ * Run the TraceControlComponent(String) constructor test.
+ */
+ public void testTraceControlComponent_1()
+ throws Exception {
+
+ String name = "node";
+
+ TraceControlComponent result = new TraceControlComponent(name);
+
+ assertNotNull(result);
+ assertEquals(name, result.getName());
+ assertEquals(null, result.getParent());
+ assertEquals(false, result.hasChildren());
+ assertEquals(null, result.getImage());
+ assertEquals(null, result.getControlService());
+ assertEquals(null, result.getToolTip());
+ }
+
+ /**
+ * Run the TraceControlComponent(String,ITraceControlComponent) constructor test.
+ *
+ */
+ public void testTraceControlComponent_2()
+ throws Exception {
+ String name = "node";
+
+ ITraceControlComponent parent = new TraceControlRoot();
+ TraceControlComponent result = new TraceControlComponent(name, parent);
+
+ assertNotNull(result);
+ assertEquals(name, result.getName());
+ assertEquals(false, result.hasChildren());
+ assertEquals(null, result.getImage());
+ assertEquals(null, result.getControlService());
+ assertEquals(null, result.getToolTip());
+ }
+
+ /**
+ * Run the void addChild(ITraceControlComponent) method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testAddAndGetChild1()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("node", new TraceControlRoot());
+ fixture.setToolTip("This is the test node");
+ fixture.addChild(new TraceControlRoot());
+ ITraceControlComponent component = new TraceControlRoot();
+ fixture.addChild(component);
+
+ ITraceControlComponent child = fixture.getChild(TraceControlRoot.TRACE_CONTROL_ROOT_NAME);
+ assertNotNull(child);
+ assertEquals(TraceControlRoot.TRACE_CONTROL_ROOT_NAME, child.getName());
+ }
+
+ /**
+ * Run the void addChild(ITraceControlComponent) method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testAddAndGetChild2()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ ITraceControlComponent component = null;
+
+ fixture.addChild(component);
+ assertFalse(fixture.hasChildren());
+ }
+
+ /**
+ * Run the void addComponentListener(ITraceControlComponentChangedListener) method test.
+ *
+ * @throws Exception
+ *
+ */
+
+ public void testAddComponentListener_1()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", (ITraceControlComponent) null);
+ fixture.setToolTip("");
+
+ ListenerValidator validator = new ListenerValidator();
+ fixture.addComponentListener(validator);
+
+ TraceControlRoot root = new TraceControlRoot();
+ fixture.addChild(root);
+ assertTrue(validator.isAddedCalled());
+
+ fixture.removeChild(root);
+ assertTrue(validator.isRemovedCalled());
+
+ fixture.fireComponentChanged(fixture);
+ assertTrue(validator.isChangedCalled());
+ }
+
+ /**
+ * Run the boolean containsChild(String) method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testContainsChild_1()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ fixture.addChild(new TraceControlRoot());
+ String name = "node";
+
+ boolean result = fixture.containsChild(name);
+
+ assertEquals(false, result);
+ }
+
+ /**
+ * Run the boolean containsChild(String) method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testContainsChild_2()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("name", new TraceControlRoot());
+ fixture.setToolTip("");
+
+ boolean result = fixture.containsChild(TraceControlRoot.TRACE_CONTROL_ROOT_NAME);
+
+ assertEquals(false, result);
+ }
+
+ /**
+ * Run the void fireCompenentAdded(ITraceControlComponent,ITraceControlComponent) method test.
+ * Run the void fireCompenentRemoved(ITraceControlComponent,ITraceControlComponent) method test.
+ * Run the void fireCompenentChanged(ITraceControlComponent) method test
+ *
+ * @throws Exception
+ *
+ */
+
+ public void testFireCompenentUpdated()
+ throws Exception {
+ ITraceControlComponent parent = new TraceControlRoot();
+
+ TraceControlComponent fixture = new TraceControlComponent("node", parent);
+ fixture.setToolTip("");
+
+ ITraceControlComponent component = new TraceControlComponent("child");
+ fixture.addChild(component);
+
+ ListenerValidator validator = new ListenerValidator();
+ fixture.addComponentListener(validator);
+
+ fixture.fireComponentAdded(parent, component);
+ assertTrue(validator.isAddedCalled());
+ assertEquals(parent.getName(), validator.getSavedParent().getName());
+ assertEquals(component.getName(), validator.getSavedChild().getName());
+
+ validator.initialize();
+
+ fixture.fireComponentRemoved(parent, component);
+ assertTrue(validator.isRemovedCalled());
+ assertEquals(parent.getName(), validator.getSavedParent().getName());
+ assertEquals(component.getName(), validator.getSavedChild().getName());
+
+ validator.initialize();
+ fixture.fireComponentChanged(fixture);
+ assertTrue(validator.isChangedCalled());
+ assertEquals(fixture.getName(), validator.getSavedComponent().getName());
+ }
+
+ /**
+ * Run the Object getAdapter(Class) method test.
+ *
+ * @throws Exception
+ *
+ */
+
+ public void testGetAdapter()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ fixture.addChild(new TraceControlRoot());
+ Class<Object> adapter = Object.class;
+
+ Object result = fixture.getAdapter(adapter);
+
+ assertEquals(null, result);
+ }
+
+ /**
+ * Run the ITraceControlComponent[] getChildren() method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testGetChildren_1()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ fixture.addChild(new TraceControlRoot());
+
+ ITraceControlComponent[] result = fixture.getChildren();
+
+ assertNotNull(result);
+ assertEquals(1, result.length);
+ assertNotNull(result[0]);
+ assertEquals("trace_control_root", result[0].getName());
+ assertEquals(null, result[0].getParent());
+ assertEquals(false, result[0].hasChildren());
+ assertEquals(null, result[0].getImage());
+ assertEquals(null, result[0].getControlService());
+ assertEquals(null, result[0].getToolTip());
+ }
+
+ /**
+ * Run the ILttngControlService getControlService()/setControlService() method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testGetAndSetControlService_1()
+ throws Exception {
+
+ TraceControlComponent parent = new TraceControlComponent("parent") {
+ ILttngControlService fService = null;
+
+ @Override
+ public void setControlService(ILttngControlService service ) {
+ fService = service;
+ }
+
+ @Override
+ public ILttngControlService getControlService() {
+ return fService;
+ }
+ };
+
+ TraceControlComponent fixture = new TraceControlComponent("", parent);
+ parent.addChild(fixture);
+ fixture.setToolTip("");
+ TraceControlComponent child = new TraceControlComponent("child", fixture);
+ fixture.addChild(child);
+
+ ILttngControlService result = fixture.getControlService();
+ assertEquals(null, result);
+
+ TestRemoteSystemProxy proxy = new TestRemoteSystemProxy();
+ ILttngControlService service = new LTTngControlService(proxy.createCommandShell());
+ fixture.setControlService(service);
+ result = fixture.getControlService();
+ assertNotNull(service);
+ assertEquals(service, result);
+
+ result = fixture.getChildren()[0].getControlService();
+ assertNotNull(service);
+ assertEquals(service, result);
+ }
+
+ /**
+ * Run the Image getImage() method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testGetImage_1()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ fixture.addChild(new TraceControlRoot());
+
+ Image result = fixture.getImage();
+ assertEquals(null, result);
+
+ fixture.setImage(PlatformUI.getWorkbench().getSharedImages().getImage(ISharedImages.IMG_OBJ_FOLDER));
+ assertNotNull(fixture.getImage());
+ }
+
+ /**
+ * Run the boolean hasChildren() method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testHasChildren_1()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ fixture.addChild(new TraceControlRoot());
+
+ boolean result = fixture.hasChildren();
+
+ assertTrue(result);
+ }
+
+ /**
+ * Run the boolean hasChildren() method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testHasChildren_2()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+
+ boolean result = fixture.hasChildren();
+
+ assertFalse(result);
+ }
+
+ /**
+ * Run the void removeAllChildren() method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testRemoveAllChildren_2()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+
+ fixture.addChild(new TraceControlRoot());
+ fixture.addChild(new TraceControlComponent("child"));
+
+ fixture.removeAllChildren();
+ assertFalse(fixture.hasChildren());
+ }
+
+ /**
+ * Run the void removeChild(ITraceControlComponent) method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testRemoveChild_1()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ TraceControlComponent child = new TraceControlComponent("child", fixture);
+
+ fixture.addChild(child);
+ fixture.removeChild(child);
+ assertFalse(fixture.hasChildren());
+ }
+
+ /**
+ * Run the void removeChild(ITraceControlComponent) method test.
+ *
+ * @throws Exception
+ *
+ */
+
+ public void testRemoveChild_2()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ fixture.addChild(new TraceControlRoot());
+ ITraceControlComponent component = null;
+
+ fixture.removeChild(component);
+ assertTrue(fixture.hasChildren());
+ }
+
+ /**
+ * Run the void removeComponentListener(ITraceControlComponentChangedListener) method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testRemoveComponentListener_1()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", (ITraceControlComponent) null);
+ fixture.setToolTip("");
+
+ ListenerValidator validator = new ListenerValidator();
+ fixture.addComponentListener(validator);
+
+ // Remove listener and check that validator is not called anymore
+ validator.initialize();
+ fixture.removeComponentListener(validator);
+ TraceControlRoot root = new TraceControlRoot();
+ fixture.addChild(root);
+ assertFalse(validator.isAddedCalled());
+
+ fixture.removeChild(root);
+ assertFalse(validator.isRemovedCalled());
+
+ fixture.fireComponentChanged(fixture);
+ assertFalse(validator.isChangedCalled());
+ }
+
+ /**
+ * Run the void removeComponentListener(ITraceControlComponentChangedListener) method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testRemoveComponentListener_2()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ fixture.addChild(new TraceControlRoot());
+ ITraceControlComponentChangedListener listener = new ControlView();
+
+ fixture.removeComponentListener(listener);
+
+ }
+
+ /**
+ * Run the void setChildren(List<ITraceControlComponent>)/ITraceControlComponent[] getChildren() method test.
+ *
+ *
+ * @throws Exception
+ *
+ */
+ public void testGetAndSetChildren()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ List<ITraceControlComponent> children = new LinkedList<ITraceControlComponent>();
+ children.add(new TraceControlComponent("child1"));
+ children.add(new TraceControlComponent("child2"));
+
+ fixture.setChildren(children);
+
+ ITraceControlComponent[] result = fixture.getChildren();
+ assertEquals(2, result.length);
+ assertEquals("child1", result[0].getName());
+ assertEquals("child2", result[1].getName());
+ }
+
+ /**
+ * Run the void String getName()/setName(String) method tests.
+ *
+ * @throws Exception
+ *
+ */
+ public void testGetAndSetName()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ fixture.addChild(new TraceControlRoot());
+ String name = "node";
+
+ fixture.setName(name);
+ assertEquals(name,fixture.getName());
+
+ }
+
+ /**
+ * Run the void ITraceControlComponent getParent()/setParent(ITraceControlComponent) method tests.
+ *
+ * @throws Exception
+ *
+ */
+ public void testGetAndSetParent()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("");
+ fixture.addChild(new TraceControlRoot());
+ ITraceControlComponent parent = new TraceControlRoot();
+ parent.addChild(fixture);
+
+ fixture.setParent(parent);
+ ITraceControlComponent retrievedParent = fixture.getParent();
+ assertNotNull(retrievedParent);
+ assertEquals(parent.getName(), retrievedParent.getName());
+ assertEquals(TraceControlRoot.TRACE_CONTROL_ROOT_NAME, retrievedParent.getName());
+ assertEquals(null, retrievedParent.getParent());
+ assertEquals(true, retrievedParent.hasChildren());
+ }
+
+ /**
+ * Run the void TargetNodeState getTargetNodeState()/etTargetNodeState(TargetNodeState) method tests.
+ *
+ * @throws Exception
+ *
+ */
+ public void testGetAndSetTargetNodeState_1()
+ throws Exception {
+
+ TraceControlComponent parent = new TraceControlComponent("parent") {
+ private TargetNodeState fState;
+
+ @Override
+ public void setTargetNodeState(TargetNodeState state ) {
+ fState = state;
+ }
+
+ @Override
+ public TargetNodeState getTargetNodeState() {
+ return fState;
+ }
+ };
+
+ TraceControlComponent fixture = new TraceControlComponent("", parent);
+ parent.addChild(fixture);
+
+ fixture.setToolTip("");
+ TargetNodeState state = TargetNodeState.CONNECTED;
+
+ fixture.setTargetNodeState(state);
+ TargetNodeState result = fixture.getTargetNodeState();
+
+ assertNotNull(result);
+ assertEquals(state, result);
+ // Check also parent
+ assertEquals(state, fixture.getParent().getTargetNodeState());
+ assertEquals("CONNECTED", result.name());
+ assertEquals("CONNECTED", result.toString());
+ assertEquals(2, result.ordinal());
+
+ fixture.setTargetNodeState(TargetNodeState.DISCONNECTED);
+ result = fixture.getTargetNodeState();
+ assertNotNull(result);
+ assertEquals("DISCONNECTED", result.name());
+ assertEquals("DISCONNECTED", result.toString());
+ assertEquals(0, result.ordinal());
+
+ state = TargetNodeState.CONNECTING;
+
+ fixture.setTargetNodeState(state);
+ result = fixture.getTargetNodeState();
+ assertNotNull(result);
+ assertEquals("CONNECTING", result.name());
+ assertEquals("CONNECTING", result.toString());
+ assertEquals(3, result.ordinal());
+
+ fixture.setTargetNodeState(TargetNodeState.DISCONNECTING);
+ result = fixture.getTargetNodeState();
+ assertNotNull(result);
+ assertEquals("DISCONNECTING", result.name());
+ assertEquals("DISCONNECTING", result.toString());
+ assertEquals(1, result.ordinal());
+
+ }
+
+ /**
+ * Run the void setToolTip(String) method test.
+ *
+ * @throws Exception
+ *
+
+ */
+
+ public void testGetSndSetToolTip()
+ throws Exception {
+ TraceControlComponent fixture = new TraceControlComponent("", new TraceControlRoot());
+ fixture.setToolTip("This is a tooltip");
+ fixture.addChild(new TraceControlRoot());
+
+ String result = fixture.getToolTip();
+
+ assertEquals("This is a tooltip", result);
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ITraceControlComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TargetNodeState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEnablement;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEventType;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceLogLevel;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceSessionState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.KernelProviderComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TargetNodeComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceChannelComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceDomainComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceEventComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceProbeEventComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.UstProviderComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.property.BaseEventPropertySource;
- import org.eclipse.linuxtools.lttng.ui.views.control.property.KernelProviderPropertySource;
- import org.eclipse.linuxtools.lttng.ui.views.control.property.TargetNodePropertySource;
- import org.eclipse.linuxtools.lttng.ui.views.control.property.TraceChannelPropertySource;
- import org.eclipse.linuxtools.lttng.ui.views.control.property.TraceDomainPropertySource;
- import org.eclipse.linuxtools.lttng.ui.views.control.property.TraceEventPropertySource;
- import org.eclipse.linuxtools.lttng.ui.views.control.property.TraceProbeEventPropertySource;
- import org.eclipse.linuxtools.lttng.ui.views.control.property.TraceSessionPropertySource;
- import org.eclipse.linuxtools.lttng.ui.views.control.property.UstProviderPropertySource;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.component;
+
+import java.io.File;
+import java.net.URL;
+
+import junit.framework.Test;
+import junit.framework.TestCase;
+import junit.framework.TestSuite;
+
+import org.eclipse.core.runtime.FileLocator;
+import org.eclipse.core.runtime.Path;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.KernelProviderComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProbeEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.UstProviderComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BaseEventPropertySource;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.KernelProviderPropertySource;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TargetNodePropertySource;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceChannelPropertySource;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceDomainPropertySource;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceEventPropertySource;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceProbeEventPropertySource;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceSessionPropertySource;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.UstProviderPropertySource;
+import org.eclipse.linuxtools.lttng.stubs.service.TestRemoteSystemProxy;
+import org.eclipse.linuxtools.lttng.ui.tests.LTTngUITestPlugin;
+import org.eclipse.rse.core.model.Host;
+import org.eclipse.rse.core.model.IHost;
+import org.eclipse.rse.internal.core.model.SystemProfile;
+import org.eclipse.ui.views.properties.IPropertySource;
+import org.junit.After;
+import org.junit.Before;
+
+/**
+ * The class <code>TraceControlPropertiesTest</code> contains tests for the all property class</code>.
+ *
+ */
+@SuppressWarnings("nls")
+public class TraceControlPropertiesTest extends TestCase {
+
+ // ------------------------------------------------------------------------
+ // Constants
+ // ------------------------------------------------------------------------
+ private static final String DIRECTORY = "testfiles";
+ private static final String TEST_STREAM = "ListInfoTest.cfg";
+ private static final String SCEN_LIST_INFO_TEST = "ListInfoTest";
+
+
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+
+ // ------------------------------------------------------------------------
+ // Static methods
+ // ------------------------------------------------------------------------
+
+ /**
+ * Returns test setup used when executing test case stand-alone.
+ * @return Test setup class
+ */
+ public static Test suite() {
+ return new ModelImplTestSetup(new TestSuite(TraceControlPropertiesTest.class));
+ }
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception
+ * if the initialization fails for some reason
+ *
+ */
+ @Override
+ @Before
+ public void setUp() throws Exception {
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception
+ * if the clean-up fails for some reason
+ *
+ */
+ @Override
+ @After
+ public void tearDown() throws Exception {
+ }
+
+ /**
+ * Run the TraceControlComponent.
+ */
+ public void testTraceControlComponents()
+ throws Exception {
+
+ TestRemoteSystemProxy proxy = new TestRemoteSystemProxy();
+
+ URL location = FileLocator.find(LTTngUITestPlugin.getDefault().getBundle(), new Path(DIRECTORY + File.separator + TEST_STREAM), null);
+ File testfile = new File(FileLocator.toFileURL(location).toURI());
+ proxy.setTestFile(testfile.getAbsolutePath());
+ proxy.setScenario(SCEN_LIST_INFO_TEST);
+
+ ITraceControlComponent root = TraceControlTestFacility.getInstance().getControlView().getTraceControlRoot();
+
+ @SuppressWarnings("restriction")
+ IHost host = new Host(new SystemProfile("myProfile", true));
+ host.setHostName("127.0.0.1");
+
+ TargetNodeComponent node = new TargetNodeComponent("myNode", root, host, proxy);
+
+ root.addChild(node);
+ node.connect();
+
+ TraceControlTestFacility.getInstance().waitForJobs();
+
+ // ------------------------------------------------------------------------
+ // Verify Node Properties (adapter)
+ // ------------------------------------------------------------------------
+ Object adapter = node.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof TargetNodePropertySource);
+
+ TargetNodePropertySource source = (TargetNodePropertySource)adapter;
+
+ assertNull(source.getEditableValue());
+ assertFalse(source.isPropertySet(TargetNodePropertySource.TARGET_NODE_NAME_PROPERTY_ID));
+ assertNotNull(source.getPropertyDescriptors());
+
+ assertEquals("myNode", source.getPropertyValue(TargetNodePropertySource.TARGET_NODE_NAME_PROPERTY_ID));
+ assertEquals("127.0.0.1", source.getPropertyValue(TargetNodePropertySource.TARGET_NODE_ADDRESS_PROPERTY_ID));
+ assertEquals(TargetNodeState.CONNECTED.name(), source.getPropertyValue(TargetNodePropertySource.TARGET_NODE_STATE_PROPERTY_ID));
+ assertNull(source.getPropertyValue("test"));
+
+ adapter = node.getAdapter(IChannelInfo.class);
+ assertNull(adapter);
+
+ ITraceControlComponent[] groups = node.getChildren();
+ assertNotNull(groups);
+ assertEquals(2, groups.length);
+
+ ITraceControlComponent[] providers = groups[0].getChildren();
+
+ assertNotNull(providers);
+ assertEquals(3, providers.length);
+
+ // ------------------------------------------------------------------------
+ // Verify Kernel Provider Properties (adapter)
+ // ------------------------------------------------------------------------
+ KernelProviderComponent kernelProvider = (KernelProviderComponent) providers[0];
+
+ adapter = kernelProvider.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof KernelProviderPropertySource);
+
+ KernelProviderPropertySource kernelSource = (KernelProviderPropertySource)adapter;
+ assertNotNull(kernelSource.getPropertyDescriptors());
+
+ assertEquals("Kernel", kernelSource.getPropertyValue(KernelProviderPropertySource.KERNEL_PROVIDER_NAME_PROPERTY_ID));
+
+ // ------------------------------------------------------------------------
+ // Verify UST Provider Properties (adapter)
+ // ------------------------------------------------------------------------
+ UstProviderComponent ustProvider = (UstProviderComponent) providers[1];
+
+ adapter = ustProvider.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof UstProviderPropertySource);
+
+ UstProviderPropertySource ustSource = (UstProviderPropertySource)adapter;
+ assertNotNull(ustSource.getPropertyDescriptors());
+
+ assertEquals("/home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello", ustSource.getPropertyValue(UstProviderPropertySource.UST_PROVIDER_NAME_PROPERTY_ID));
+ assertEquals(String.valueOf(9379), ustSource.getPropertyValue(UstProviderPropertySource.UST_PROVIDER_PID_PROPERTY_ID));
+
+ // ------------------------------------------------------------------------
+ // Verify Base Event Properties (adapter)
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] events = ustProvider.getChildren();
+ assertNotNull(events);
+ assertEquals(2, events.length);
+
+ BaseEventComponent baseEventInfo = (BaseEventComponent) events[0];
+ assertNotNull(baseEventInfo);
+
+ adapter = baseEventInfo.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof BaseEventPropertySource);
+
+ BaseEventPropertySource baseSource = (BaseEventPropertySource)adapter;
+ assertNotNull(baseSource.getPropertyDescriptors());
+
+ assertEquals("ust_tests_hello:tptest_sighandler", baseSource.getPropertyValue(BaseEventPropertySource.BASE_EVENT_NAME_PROPERTY_ID));
+ assertEquals(TraceEventType.TRACEPOINT.name(), baseSource.getPropertyValue(BaseEventPropertySource.BASE_EVENT_TYPE_PROPERTY_ID));
+ assertEquals(TraceLogLevel.TRACE_DEBUG_MODULE.name(), baseSource.getPropertyValue(BaseEventPropertySource.BASE_EVENT_LOGLEVEL_PROPERTY_ID));
+
+ // ------------------------------------------------------------------------
+ // Verify Session Properties (adapter)
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] sessions = groups[1].getChildren();
+ assertNotNull(sessions);
+ assertEquals(2, sessions.length);
+
+ TraceSessionComponent session = (TraceSessionComponent)sessions[1];
+
+ adapter = session.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof TraceSessionPropertySource);
+
+ TraceSessionPropertySource sessionSource = (TraceSessionPropertySource)adapter;
+ assertNotNull(sessionSource.getPropertyDescriptors());
+
+ assertEquals("mysession", sessionSource.getPropertyValue(TraceSessionPropertySource.TRACE_SESSION_NAME_PROPERTY_ID));
+ assertEquals("/home/user/lttng-traces/mysession-20120129-084256", sessionSource.getPropertyValue(TraceSessionPropertySource.TRACE_SESSION_PATH_PROPERTY_ID));
+ assertEquals(TraceSessionState.ACTIVE.name(), sessionSource.getPropertyValue(TraceSessionPropertySource.TRACE_SESSION_STATE_PROPERTY_ID));
+
+ // ------------------------------------------------------------------------
+ // Verify Domain Provider Properties (adapter)
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] domains = session.getChildren();
+ assertNotNull(domains);
+ assertEquals(2, domains.length);
+
+ TraceDomainComponent domain = (TraceDomainComponent) domains[0];
+ adapter = domain.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof TraceDomainPropertySource);
+
+ TraceDomainPropertySource domainSource = (TraceDomainPropertySource)adapter;
+ assertNotNull(domainSource.getPropertyDescriptors());
+
+ assertEquals("Kernel", domainSource.getPropertyValue(TraceDomainPropertySource.TRACE_DOMAIN_NAME_PROPERTY_ID));
+
+ ITraceControlComponent[] channels = domains[0].getChildren();
+ assertNotNull(channels);
+ assertEquals(2, channels.length);
+
+ // ------------------------------------------------------------------------
+ // Verify Channel Properties (adapter)
+ // ------------------------------------------------------------------------
+ assertTrue(channels[0] instanceof TraceChannelComponent);
+ TraceChannelComponent channel = (TraceChannelComponent) channels[0];
+
+ adapter = channel.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof TraceChannelPropertySource);
+
+ TraceChannelPropertySource channelSource = (TraceChannelPropertySource)adapter;
+ assertNotNull(channelSource.getPropertyDescriptors());
+
+ assertEquals("channel0", channelSource.getPropertyValue(TraceChannelPropertySource.TRACE_CHANNEL_NAME_PROPERTY_ID));
+ assertEquals(String.valueOf(4), channelSource.getPropertyValue(TraceChannelPropertySource.TRACE_CHANNEL_NO_SUBBUFFERS_PROPERTY_ID));
+ assertEquals(TraceEnablement.ENABLED.name(), channelSource.getPropertyValue(TraceChannelPropertySource.TRACE_CHANNEL_STATE_PROPERTY_ID));
+ assertEquals(String.valueOf(false), channelSource.getPropertyValue(TraceChannelPropertySource.TRACE_CHANNEL_OVERWRITE_MODE_PROPERTY_ID));
+ assertEquals("splice()", channelSource.getPropertyValue(TraceChannelPropertySource.TRACE_CHANNEL_OUTPUT_TYPE_PROPERTY_ID));
+ assertEquals(String.valueOf(200), channelSource.getPropertyValue(TraceChannelPropertySource.TRACE_CHANNEL_READ_TIMER_PROPERTY_ID));
+ assertEquals(String.valueOf(262144), channelSource.getPropertyValue(TraceChannelPropertySource.TRACE_CHANNEL_SUBBUFFER_SIZE_PROPERTY_ID));
+ assertEquals(String.valueOf(0), channelSource.getPropertyValue(TraceChannelPropertySource.TRACE_CHANNEL_SWITCH_TIMER_PROPERTY_ID));
+
+ // ------------------------------------------------------------------------
+ // Verify Event Properties (adapter)
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] channel0Events = channel.getChildren();
+ assertNotNull(channel0Events);
+ assertEquals(5, channel0Events.length);
+ assertTrue(channel0Events[0] instanceof TraceEventComponent);
+
+ TraceEventComponent event = (TraceEventComponent) channel0Events[0];
+
+ adapter = event.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof TraceEventPropertySource);
+
+ TraceEventPropertySource eventSource = (TraceEventPropertySource)adapter;
+ assertNotNull(eventSource.getPropertyDescriptors());
+
+ assertEquals("block_rq_remap", eventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_NAME_PROPERTY_ID));
+ assertEquals(TraceLogLevel.TRACE_EMERG.name(), eventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_LOGLEVEL_PROPERTY_ID));
+ assertEquals(TraceEventType.TRACEPOINT.name(), eventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_TYPE_PROPERTY_ID));
+ assertEquals(TraceEnablement.ENABLED.name(), eventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_STATE_PROPERTY_ID));
+
+ // ------------------------------------------------------------------------
+ // Verify Probe Event Properties (adapter)
+ // ------------------------------------------------------------------------
+ assertTrue(channel0Events[2] instanceof TraceProbeEventComponent);
+
+ TraceProbeEventComponent probeEvent = (TraceProbeEventComponent) channel0Events[2];
+
+ adapter = probeEvent.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof TraceProbeEventPropertySource);
+
+ TraceProbeEventPropertySource probeEventSource = (TraceProbeEventPropertySource)adapter;
+ assertNotNull(probeEventSource.getPropertyDescriptors());
+ assertEquals(4, probeEventSource.getPropertyDescriptors().length);
+
+ assertEquals("myevent2", probeEventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_NAME_PROPERTY_ID));
+ assertEquals(TraceEventType.PROBE.name(), probeEventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_TYPE_PROPERTY_ID));
+ assertEquals(TraceEnablement.ENABLED.name(), probeEventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_STATE_PROPERTY_ID));
+ assertEquals("0xc0101340", probeEventSource.getPropertyValue(TraceProbeEventPropertySource.TRACE_EVENT_PROBE_ADDRESS_PROPERTY_ID));
+
+ assertTrue(channel0Events[3] instanceof TraceProbeEventComponent);
+
+ probeEvent = (TraceProbeEventComponent) channel0Events[3];
+
+ adapter = probeEvent.getAdapter(IPropertySource.class);
+ assertNotNull(adapter);
+ assertTrue(adapter instanceof TraceProbeEventPropertySource);
+
+ probeEventSource = (TraceProbeEventPropertySource)adapter;
+ assertNotNull(probeEventSource.getPropertyDescriptors());
+ assertEquals(5, probeEventSource.getPropertyDescriptors().length);
+
+ assertEquals("myevent0", probeEventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_NAME_PROPERTY_ID));
+ assertEquals(TraceEventType.PROBE.name(), probeEventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_TYPE_PROPERTY_ID));
+ assertEquals(TraceEnablement.ENABLED.name(), probeEventSource.getPropertyValue(TraceEventPropertySource.TRACE_EVENT_STATE_PROPERTY_ID));
+ assertEquals("0x0", probeEventSource.getPropertyValue(TraceProbeEventPropertySource.TRACE_EVENT_PROBE_OFFSET_PROPERTY_ID));
+ assertEquals("init_post", probeEventSource.getPropertyValue(TraceProbeEventPropertySource.TRACE_EVENT_PROBE_SYMBOL_PROPERTY_ID));
+
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.dialogs.IConfirmDialog;
- import org.eclipse.linuxtools.lttng.ui.views.control.dialogs.ICreateChannelOnSessionDialog;
- import org.eclipse.linuxtools.lttng.ui.views.control.dialogs.ICreateSessionDialog;
- import org.eclipse.linuxtools.lttng.ui.views.control.dialogs.IGetEventInfoDialog;
- import org.eclipse.linuxtools.lttng.ui.views.control.dialogs.TraceControlDialogFactory;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ITraceControlComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TargetNodeState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEnablement;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEventType;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceLogLevel;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceSessionState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.ChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.KernelProviderComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TargetNodeComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceChannelComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceDomainComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceEventComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionGroup;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.UstProviderComponent;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.component;
+
+import java.io.File;
+import java.net.URL;
+
+import junit.framework.Test;
+import junit.framework.TestCase;
+import junit.framework.TestSuite;
+
+import org.eclipse.core.commands.ExecutionException;
+import org.eclipse.core.commands.NotEnabledException;
+import org.eclipse.core.commands.NotHandledException;
+import org.eclipse.core.commands.common.NotDefinedException;
+import org.eclipse.core.runtime.FileLocator;
+import org.eclipse.core.runtime.Path;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IConfirmDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateChannelOnSessionDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateSessionDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IGetEventInfoDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.TraceControlDialogFactory;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.ChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.KernelProviderComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionGroup;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.UstProviderComponent;
+import org.eclipse.linuxtools.lttng.stubs.service.TestRemoteSystemProxy;
+import org.eclipse.linuxtools.lttng.ui.tests.LTTngUITestPlugin;
+import org.eclipse.rse.core.model.Host;
+import org.eclipse.rse.core.model.IHost;
+import org.eclipse.rse.internal.core.model.SystemProfile;
+import org.eclipse.swt.widgets.Shell;
+import org.junit.After;
+import org.junit.Before;
+
+/**
+ * The class <code>TraceControlTreeModelTest</code> contains tests for the tree component classes.
+ */
+@SuppressWarnings("nls")
+public class TraceControlProviderTests extends TestCase {
+
+ private static final String DIRECTORY = "testfiles";
+ private static final String TEST_STREAM = "CreateTreeTest.cfg";
+ private static final String SCEN_INIT_TEST = "Initialize";
+ private static final String SCEN_SCENARIO1_TEST = "Scenario1";
+ private static final String SCEN_SCENARIO2_TEST = "Scenario2";
+
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private TraceControlTestFacility fFacility;
+ private TestRemoteSystemProxy fProxy;
+ private String fTestFile;
+
+ // ------------------------------------------------------------------------
+ // Static methods
+ // ------------------------------------------------------------------------
+
+ /**
+ * Returns test setup used when executing test case stand-alone.
+ * @return Test setup class
+ */
+ public static Test suite() {
+ return new ModelImplTestSetup(new TestSuite(TraceControlProviderTests.class));
+ }
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception
+ * if the initialization fails for some reason
+ *
+ */
+ @Override
+ @Before
+ public void setUp() throws Exception {
+ fFacility = TraceControlTestFacility.getInstance();
+ fProxy = new TestRemoteSystemProxy();
+ URL location = FileLocator.find(LTTngUITestPlugin.getDefault().getBundle(), new Path(DIRECTORY + File.separator + TEST_STREAM), null);
+ File testfile = new File(FileLocator.toFileURL(location).toURI());
+ fTestFile = testfile.getAbsolutePath();
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception
+ * if the clean-up fails for some reason
+ *
+ */
+ @Override
+ @After
+ public void tearDown() throws Exception {
+ }
+
+ /**
+ * Run the TraceControlComponent.
+ */
+ public void testTraceControlComponents()
+ throws Exception {
+
+ fProxy.setTestFile(fTestFile);
+ fProxy.setScenario(SCEN_INIT_TEST);
+
+ ITraceControlComponent root = TraceControlTestFacility.getInstance().getControlView().getTraceControlRoot();
+
+ @SuppressWarnings("restriction")
+ IHost host = new Host(new SystemProfile("myProfile", true));
+ host.setHostName("127.0.0.1");
+
+ TargetNodeComponent node = new TargetNodeComponent("myNode", root, host, fProxy);
+
+ root.addChild(node);
+ node.connect();
+
+ fFacility.waitForJobs();
+
+ // Verify that node is connected
+ assertEquals(TargetNodeState.CONNECTED, node.getTargetNodeState());
+
+ // Get provider groups
+ ITraceControlComponent[] groups = node.getChildren();
+ assertNotNull(groups);
+ assertEquals(2, groups.length);
+
+ // Get kernel provider
+ ITraceControlComponent[] providers = groups[0].getChildren();
+ KernelProviderComponent kernelProvider = (KernelProviderComponent) providers[0];
+
+ // Get kernel provider events and select 2 events
+ ITraceControlComponent[] events = kernelProvider.getChildren();
+ assertNotNull(events);
+ assertEquals(3, events.length);
+
+ BaseEventComponent baseEventInfo0 = (BaseEventComponent) events[0];
+ BaseEventComponent baseEventInfo1 = (BaseEventComponent) events[1];
+
+ // Initialize dialog implementations for command execution
+ TraceControlDialogFactory.getInstance().setCreateSessionDialog(new CreateSessionDialogStub());
+ TraceControlDialogFactory.getInstance().setGetEventInfoDialog(new GetEventInfoDialogStub());
+ TraceControlDialogFactory.getInstance().setConfirmDialog(new DestroyConfirmDialogStub());
+
+ // Initialize scenario
+ fProxy.setScenario(SCEN_SCENARIO1_TEST);
+
+ // ------------------------------------------------------------------------
+ // Create session
+ // ------------------------------------------------------------------------
+ TraceSessionComponent session = createSession(groups[1]);
+
+ // Verify that session was created
+ assertNotNull(session);
+ assertEquals("mysession", session.getName());
+ assertEquals("/home/user/lttng-traces/mysession-20120314-132824", session.getSessionPath());
+ assertEquals(TraceSessionState.INACTIVE, session.getSessionState());
+
+ // ------------------------------------------------------------------------
+ // Enable event on default channel on created session above
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] components = { baseEventInfo0, baseEventInfo1 };
+
+ fFacility.getControlView().setSelection(components);
+ // Give GUI time to actually execute refresh
+ fFacility.delay(TraceControlTestFacility.GUI_REFESH_DELAY);
+
+ fFacility.executeCommand("assign.event");
+ fFacility.waitForJobs();
+
+ // Verify that kernel domain was created
+ ITraceControlComponent[] domains = session.getChildren();
+ assertNotNull(domains);
+ assertEquals(1, domains.length);
+
+ assertEquals("Kernel", domains[0].getName());
+
+ // Verify that channel0 was created with default values
+ ITraceControlComponent[] channels = domains[0].getChildren();
+ assertNotNull(channels);
+ assertEquals(1, channels.length);
+
+ assertTrue(channels[0] instanceof TraceChannelComponent);
+ TraceChannelComponent channel = (TraceChannelComponent) channels[0];
+ assertEquals("channel0", channel.getName());
+ assertEquals(4, channel.getNumberOfSubBuffers());
+ assertEquals("splice()", channel.getOutputType());
+ assertEquals(false, channel.isOverwriteMode());
+ assertEquals(200, channel.getReadTimer());
+ assertEquals(TraceEnablement.ENABLED, channel.getState());
+ assertEquals(262144, channel.getSubBufferSize());
+ assertEquals(0, channel.getSwitchTimer());
+
+ // Verify that event components were created
+ ITraceControlComponent[] channel0Events = channel.getChildren();
+ assertNotNull(channel0Events);
+ assertEquals(2, channel0Events.length);
+ assertTrue(channel0Events[0] instanceof TraceEventComponent);
+ assertTrue(channel0Events[1] instanceof TraceEventComponent);
+
+ TraceEventComponent event = (TraceEventComponent) channel0Events[0];
+ assertEquals("sched_kthread_stop_ret", event.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, event.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+ assertEquals(TraceEnablement.ENABLED, event.getState());
+
+ TraceEventComponent event1 = (TraceEventComponent) channel0Events[1];
+ assertEquals("sched_kthread_stop", event1.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, event1.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, event1.getEventType());
+ assertEquals(TraceEnablement.ENABLED, event1.getState());
+
+ // ------------------------------------------------------------------------
+ // Disable event components
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] selection = { event, event1 };
+ fFacility.getControlView().setSelection(selection);
+ // Give GUI time to actually execute the selection
+ fFacility.delay(TraceControlTestFacility.GUI_REFESH_DELAY);
+ fFacility.executeCommand("disable.event");
+ fFacility.waitForJobs();
+
+ assertEquals(TraceEnablement.DISABLED, event.getState());
+ assertEquals(TraceEnablement.DISABLED, event1.getState());
+
+ // ------------------------------------------------------------------------
+ // Enable event component
+ // ------------------------------------------------------------------------
+ fFacility.getControlView().setSelection(event1);
+ fFacility.executeCommand("enable.event");
+ fFacility.waitForJobs();
+
+ // Verify event state
+ assertEquals(TraceEnablement.ENABLED, event1.getState());
+
+ // ------------------------------------------------------------------------
+ // Destroy session
+ // ------------------------------------------------------------------------
+ destroySession(session);
+
+ // Verify that no more session components exist
+ assertEquals(0, groups[1].getChildren().length);
+
+
+ // ------------------------------------------------------------------------
+ // Create session
+ // ------------------------------------------------------------------------
+ fProxy.setScenario(SCEN_SCENARIO2_TEST);
+
+ CreateSessionDialogStub sessionDialogStub = new CreateSessionDialogStub();
+ sessionDialogStub.setSessionPath("/home/user/temp");
+ TraceControlDialogFactory.getInstance().setCreateSessionDialog(sessionDialogStub);
+
+ session = createSession(groups[1]);
+
+ // Verify that session was created
+ assertNotNull(session);
+ assertEquals("mysession", session.getName());
+ assertEquals("/home/user/temp", session.getSessionPath());
+ assertEquals(TraceSessionState.INACTIVE, session.getSessionState());
+
+ // ------------------------------------------------------------------------
+ // Create Channel on UST global domain
+ // ------------------------------------------------------------------------
+ TraceControlDialogFactory.getInstance().setCreateChannelOnSessionDialog(new CreateChannelOnSessionDialogStub());
+
+ fFacility.getControlView().setSelection(session);
+ // Give GUI time to actually execute refresh
+ fFacility.delay(TraceControlTestFacility.GUI_REFESH_DELAY);
+
+ fFacility.executeCommand("createChannelOnSession");
+ fFacility.waitForJobs();
+
+ // Verify that UST domain was created
+ domains = session.getChildren();
+ assertNotNull(domains);
+ assertEquals(1, domains.length);
+
+ assertEquals("UST global", domains[0].getName());
+
+ // Verify that channel was created with correct data
+ channels = domains[0].getChildren();
+ assertNotNull(channels);
+ assertEquals(1, channels.length);
+
+ assertTrue(channels[0] instanceof TraceChannelComponent);
+ channel = (TraceChannelComponent) channels[0];
+ assertEquals("mychannel", channel.getName());
+ assertEquals(2, channel.getNumberOfSubBuffers());
+ assertEquals("mmap()", channel.getOutputType());
+ assertEquals(false, channel.isOverwriteMode());
+ assertEquals(100, channel.getReadTimer());
+ assertEquals(TraceEnablement.ENABLED, channel.getState());
+ assertEquals(16384, channel.getSubBufferSize());
+ assertEquals(200, channel.getSwitchTimer());
+
+ // ------------------------------------------------------------------------
+ // Enable event on default channel on created session above
+ // ------------------------------------------------------------------------
+ // Get first UST provider
+ UstProviderComponent ustProvider = (UstProviderComponent) providers[1];
+ assertEquals("/home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello", ustProvider.getName());
+ assertEquals(9379, ustProvider.getPid());
+
+ // Get events
+ events = ustProvider.getChildren();
+ assertNotNull(events);
+ assertEquals(2, events.length);
+
+ baseEventInfo0 = (BaseEventComponent) events[0];
+ baseEventInfo1 = (BaseEventComponent) events[1];
+
+ ITraceControlComponent[] ustSelection = { baseEventInfo0, baseEventInfo1 };
+
+ fFacility.getControlView().setSelection(ustSelection);
+ // Give GUI time to actually execute refresh
+ fFacility.delay(TraceControlTestFacility.GUI_REFESH_DELAY);
+ fFacility.executeCommand("assign.event");
+ fFacility.waitForJobs();
+
+ // verify that events were created under the channel
+ // Note that domain and channel has to be re-read because the tree is re-created
+
+ domains = session.getChildren();
+
+ // Verify that channel was created with correct data
+ channels = domains[0].getChildren();
+
+ ITraceControlComponent[] ustEvents = channels[0].getChildren();
+ assertEquals(2, ustEvents.length);
+
+ event = (TraceEventComponent) ustEvents[0];
+ assertEquals("ust_tests_hello:tptest_sighandler", event.getName());
+ assertEquals(TraceLogLevel.TRACE_DEBUG_LINE, event.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+ assertEquals(TraceEnablement.ENABLED, event.getState());
+
+ event = (TraceEventComponent) ustEvents[1];
+ assertEquals("ust_tests_hello:tptest", ustEvents[1].getName());
+ assertEquals(TraceLogLevel.TRACE_DEBUG_LINE, event.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+ assertEquals(TraceEnablement.ENABLED, event.getState());
+
+ // ------------------------------------------------------------------------
+ // Disable event components
+ // ------------------------------------------------------------------------
+ fFacility.getControlView().setSelection(event);
+ // Give GUI time to actually execute the selection
+ fFacility.delay(TraceControlTestFacility.GUI_REFESH_DELAY);
+ fFacility.executeCommand("disable.event");
+ fFacility.waitForJobs();
+
+ assertEquals(TraceEnablement.DISABLED, event.getState());
+
+ // ------------------------------------------------------------------------
+ // Enable event component
+ // ------------------------------------------------------------------------
+ fFacility.getControlView().setSelection(event);
+ fFacility.executeCommand("enable.event");
+ fFacility.waitForJobs();
+
+ // Verify event state
+ assertEquals(TraceEnablement.ENABLED, event.getState());
+
+ // ------------------------------------------------------------------------
+ // Destroy session
+ // ------------------------------------------------------------------------
+ destroySession(session);
+
+ // Verify that no more session components exist
+ assertEquals(0, groups[1].getChildren().length);
+
+
+// fFacility.delay(60000);
+ }
+
+ private TraceSessionComponent createSession(ITraceControlComponent group) throws ExecutionException, NotDefinedException, NotEnabledException, NotHandledException {
+ fFacility.getControlView().setSelection(group);
+ // Give GUI time to actually execute the selection
+ fFacility.delay(TraceControlTestFacility.GUI_REFESH_DELAY);
+ fFacility.executeCommand("createSession");
+ fFacility.waitForJobs();
+
+ ITraceControlComponent[] sessions = group.getChildren();
+ if ((sessions == null) || (sessions.length == 0)) {
+ return null;
+ }
+ return (TraceSessionComponent)sessions[0];
+ }
+
+ private void destroySession(TraceSessionComponent session) throws ExecutionException, NotDefinedException, NotEnabledException, NotHandledException {
+ fFacility.getControlView().setSelection(session);
+ // Give GUI time to actually execute the selection
+ fFacility.delay(TraceControlTestFacility.GUI_REFESH_DELAY);
+ fFacility.executeCommand("destroySession");
+ fFacility.waitForJobs();
+ }
+
+// assertEquals("sched_kthread_stop_ret", baseEventInfo.getName());
+// assertEquals(TraceLogLevel.TRACE_EMERG, baseEventInfo.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+//
+// baseEventInfo = (BaseEventComponent) events[2];
+// assertEquals("sched_wakeup_new", baseEventInfo.getName());
+// assertEquals(TraceLogLevel.TRACE_EMERG, baseEventInfo.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+//
+// // ------------------------------------------------------------------------
+// // Verify UstProviderComponent
+// // ------------------------------------------------------------------------
+// UstProviderComponent ustProvider = (UstProviderComponent) providers[1];
+// assertEquals("/home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello", ustProvider.getName());
+// assertEquals(9379, ustProvider.getPid());
+//
+// // ------------------------------------------------------------------------
+// // Verify event info (UST provider)
+// // ------------------------------------------------------------------------
+// events = ustProvider.getChildren();
+// assertNotNull(events);
+// assertEquals(2, events.length);
+//
+// baseEventInfo = (BaseEventComponent) events[0];
+// assertNotNull(baseEventInfo);
+// assertEquals("ust_tests_hello:tptest_sighandler", baseEventInfo.getName());
+// assertEquals(TraceLogLevel.TRACE_DEBUG_MODULE, baseEventInfo.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+//
+// baseEventInfo = (BaseEventComponent) events[1];
+// assertEquals("ust_tests_hello:tptest", baseEventInfo.getName());
+// assertEquals(TraceLogLevel.TRACE_INFO, baseEventInfo.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+//
+// // ------------------------------------------------------------------------
+// // Verify UstProviderComponent
+// // ------------------------------------------------------------------------
+// ustProvider = (UstProviderComponent) providers[2];
+// assertEquals("/home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello", ustProvider.getName());
+// assertEquals(4852, ustProvider.getPid());
+//
+// // verify getters and setter
+// verifyUstProviderGettersSetters(ustProvider);
+//
+// // ------------------------------------------------------------------------
+// // Verify event info (UST provider)
+// // ------------------------------------------------------------------------
+// events = ustProvider.getChildren();
+// assertNotNull(events);
+// assertEquals(2, events.length);
+//
+// baseEventInfo = (BaseEventComponent) events[0];
+// assertNotNull(baseEventInfo);
+// assertEquals("ust_tests_hello:tptest_sighandler", baseEventInfo.getName());
+// assertEquals(TraceLogLevel.TRACE_WARNING, baseEventInfo.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+//
+// baseEventInfo = (BaseEventComponent) events[1];
+// assertEquals("ust_tests_hello:tptest", baseEventInfo.getName());
+// assertEquals(TraceLogLevel.TRACE_DEBUG_FUNCTION, baseEventInfo.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+//
+// // verify getters and setters
+// verifyBaseEventGettersSetters(baseEventInfo);
+//
+// // ------------------------------------------------------------------------
+// // Verify TraceSessionGroup
+// // ------------------------------------------------------------------------
+// ITraceControlComponent[] sessions = groups[1].getChildren();
+// assertNotNull(sessions);
+// assertEquals(2, sessions.length);
+// for (int i = 0; i < sessions.length; i++) {
+// assertTrue(sessions[i] instanceof TraceSessionComponent);
+// }
+// assertEquals("mysession1", sessions[0].getName());
+// assertEquals("mysession", sessions[1].getName());
+//
+// // ------------------------------------------------------------------------
+// // Verify TraceSessionComponent
+// // ------------------------------------------------------------------------
+// TraceSessionComponent session = (TraceSessionComponent)sessions[1];
+// assertEquals("mysession", session.getName());
+// assertEquals("/home/user/lttng-traces/mysession-20120129-084256", session.getSessionPath());
+// assertEquals(TraceSessionState.ACTIVE, session.getSessionState());
+//
+// // Verify setters and setters
+// verifySessionGetterSetters(session);
+//
+// ITraceControlComponent[] domains = session.getChildren();
+// assertNotNull(domains);
+// assertEquals(2, domains.length);
+//
+// // ------------------------------------------------------------------------
+// // Verify Kernel domain
+// // ------------------------------------------------------------------------
+// assertEquals("Kernel", domains[0].getName());
+// ITraceControlComponent[] channels = domains[0].getChildren();
+// assertNotNull(channels);
+// assertEquals(2, channels.length);
+//
+// // ------------------------------------------------------------------------
+// // Verify Kernel's channel0
+// // ------------------------------------------------------------------------
+// assertTrue(channels[0] instanceof TraceChannelComponent);
+// TraceChannelComponent channel = (TraceChannelComponent) channels[0];
+// assertEquals("channel0", channel.getName());
+// assertEquals(4, channel.getNumberOfSubBuffers());
+// assertEquals("splice()", channel.getOutputType());
+// assertEquals(false, channel.isOverwriteMode());
+// assertEquals(200, channel.getReadTimer());
+// assertEquals(TraceEnablement.ENABLED, channel.getState());
+// assertEquals(262144, channel.getSubBufferSize());
+// assertEquals(0, channel.getSwitchTimer());
+//
+// // ------------------------------------------------------------------------
+// // Verify event info (kernel, channel0)
+// // ------------------------------------------------------------------------
+// ITraceControlComponent[] channel0Events = channel.getChildren();
+// assertNotNull(channel0Events);
+// assertEquals(5, channel0Events.length);
+// assertTrue(channel0Events[0] instanceof TraceEventComponent);
+// assertTrue(channel0Events[1] instanceof TraceEventComponent);
+// assertTrue(channel0Events[2] instanceof TraceProbeEventComponent);
+// assertTrue(channel0Events[3] instanceof TraceProbeEventComponent);
+// assertTrue(channel0Events[4] instanceof TraceEventComponent);
+//
+// TraceEventComponent event = (TraceEventComponent) channel0Events[0];
+// assertEquals("block_rq_remap", event.getName());
+// assertEquals(TraceLogLevel.TRACE_EMERG, event.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+// assertEquals(TraceEnablement.ENABLED, event.getState());
+//
+// event = (TraceEventComponent) channel0Events[1];
+// assertEquals("block_bio_remap", event.getName());
+// assertEquals(TraceLogLevel.TRACE_EMERG, event.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+// assertEquals(TraceEnablement.DISABLED, event.getState());
+//
+// TraceProbeEventComponent probeEvent = (TraceProbeEventComponent) channel0Events[2];
+// assertEquals("myevent2", probeEvent.getName());
+// assertEquals(TraceLogLevel.LEVEL_UNKNOWN, probeEvent.getLogLevel());
+// assertEquals(TraceEventType.PROBE, probeEvent.getEventType());
+// assertEquals(TraceEnablement.ENABLED, probeEvent.getState());
+// assertEquals("0xc0101340", probeEvent.getAddress());
+// assertNull(probeEvent.getOffset());
+// assertNull(probeEvent.getSymbol());
+//
+// probeEvent = (TraceProbeEventComponent) channel0Events[3];
+// assertEquals("myevent0", probeEvent.getName());
+// assertEquals(TraceLogLevel.LEVEL_UNKNOWN, probeEvent.getLogLevel());
+// assertEquals(TraceEventType.PROBE, probeEvent.getEventType());
+// assertEquals(TraceEnablement.ENABLED, probeEvent.getState());
+// assertNull(probeEvent.getAddress());
+// assertEquals("0x0", probeEvent.getOffset());
+// assertEquals("init_post", probeEvent.getSymbol());
+//
+// event = (TraceEventComponent) channel0Events[4];
+// assertEquals("syscalls", event.getName());
+// assertEquals(TraceLogLevel.LEVEL_UNKNOWN, event.getLogLevel());
+// assertEquals(TraceEventType.SYSCALL, event.getEventType());
+// assertEquals(TraceEnablement.ENABLED, event.getState());
+//
+// // ------------------------------------------------------------------------
+// // Verify Kernel's channel1
+// // ------------------------------------------------------------------------
+// assertEquals("channel1", channels[1].getName());
+// channel = (TraceChannelComponent) channels[1];
+// assertEquals(4, channel.getNumberOfSubBuffers());
+// assertEquals("splice()", channel.getOutputType());
+// assertEquals(true, channel.isOverwriteMode());
+// assertEquals(400, channel.getReadTimer());
+// assertEquals(TraceEnablement.DISABLED, channel.getState());
+// assertEquals(524288, channel.getSubBufferSize());
+// assertEquals(100, channel.getSwitchTimer());
+//
+// // ------------------------------------------------------------------------
+// // Verify event info (kernel, channel1)
+// // ------------------------------------------------------------------------
+// ITraceControlComponent[] channel1Events = channels[1].getChildren();
+// assertEquals(0, channel1Events.length);
+//
+// // ------------------------------------------------------------------------
+// // Verify domain UST global
+// // ------------------------------------------------------------------------
+// assertEquals("UST global", domains[1].getName());
+//
+// ITraceControlComponent[] ustChannels = domains[1].getChildren();
+//
+// for (int i = 0; i < ustChannels.length; i++) {
+// assertTrue(ustChannels[i] instanceof TraceChannelComponent);
+// }
+//
+// // ------------------------------------------------------------------------
+// // Verify UST global's mychannel1
+// // ------------------------------------------------------------------------
+// channel = (TraceChannelComponent) ustChannels[0];
+// assertEquals("mychannel1", channel.getName());
+// assertEquals(8, channel.getNumberOfSubBuffers());
+// assertEquals("mmap()", channel.getOutputType());
+// assertEquals(true, channel.isOverwriteMode());
+// assertEquals(100, channel.getReadTimer());
+// assertEquals(TraceEnablement.DISABLED, channel.getState());
+// assertEquals(8192, channel.getSubBufferSize());
+// assertEquals(200, channel.getSwitchTimer());
+//
+// // verify getters and setters
+// verifyChannelGettersSetters(channel);
+//
+// // ------------------------------------------------------------------------
+// // Verify event info (UST global, mychannel1)
+// // ------------------------------------------------------------------------
+// ITraceControlComponent[] ustEvents = channel.getChildren();
+// assertEquals(0, ustEvents.length);
+//
+// // ------------------------------------------------------------------------
+// // Verify UST global's channel0
+// // ------------------------------------------------------------------------
+// channel = (TraceChannelComponent) ustChannels[1];
+// assertEquals("channel0", channel.getName());
+// assertEquals(4, channel.getNumberOfSubBuffers());
+// assertEquals("mmap()", channel.getOutputType());
+// assertEquals(false, channel.isOverwriteMode());
+// assertEquals(200, channel.getReadTimer());
+// assertEquals(TraceEnablement.ENABLED, channel.getState());
+// assertEquals(4096, channel.getSubBufferSize());
+// assertEquals(0, channel.getSwitchTimer());
+//
+// // ------------------------------------------------------------------------
+// // Verify event info (UST global, channel0)
+// // ------------------------------------------------------------------------
+// ustEvents = channel.getChildren();
+// assertEquals(2, ustEvents.length);
+//
+// event = (TraceEventComponent) ustEvents[0];
+// assertEquals("ust_tests_hello:tptest_sighandler", event.getName());
+// assertEquals(TraceLogLevel.TRACE_DEBUG_LINE, event.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+// assertEquals(TraceEnablement.DISABLED, event.getState());
+//
+// event = (TraceEventComponent) ustEvents[1];
+// assertEquals("*", ustEvents[1].getName());
+// assertEquals(TraceLogLevel.LEVEL_UNKNOWN, event.getLogLevel());
+// assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+// assertEquals(TraceEnablement.ENABLED, event.getState());
+//
+// // verify getters and setters
+// verifyEventGettersSetters(event);
+//
+// // disconnect
+// node.disconnect();
+// assertEquals(TargetNodeState.DISCONNECTED, node.getTargetNodeState());
+// assertNotNull(node.getImage());
+// assertNotSame(connectedImage, node.getImage());
+// }
+//
+// private void verifySessionGetterSetters(TraceSessionComponent session) {
+// // save original values
+// String name = session.getName();
+// String origPath = session.getSessionPath();
+// TraceSessionState origState = session.getSessionState();
+//
+// // test cases
+// session.setName("newName");
+// assertEquals("newName", session.getName());
+//
+// session.setSessionPath("/home/user/tmp");
+// assertEquals("/home/user/tmp", session.getSessionPath());
+//
+// session.setSessionState(TraceSessionState.INACTIVE);
+// assertEquals(TraceSessionState.INACTIVE, session.getSessionState());
+// Image inactiveImage = session.getImage();
+// assertNotNull(inactiveImage);
+//
+// session.setSessionState("active");
+// assertEquals(TraceSessionState.ACTIVE, session.getSessionState());
+//
+// Image activeImage = session.getImage();
+// assertNotNull(activeImage);
+// assertNotSame(activeImage, inactiveImage);
+//
+//
+// // restore original values
+// session.setName(name);
+// session.setSessionPath(origPath);
+// session.setSessionState(origState);
+// }
+//
+// private void verifyBaseEventGettersSetters(BaseEventComponent event) {
+// // save original values
+// String name = event.getName();
+// TraceLogLevel level = event.getLogLevel();
+// TraceEventType type = event.getEventType();
+//
+// // test cases
+// event.setName("newName");
+// assertEquals("newName", event.getName());
+//
+// event.setLogLevel(TraceLogLevel.TRACE_INFO);
+// assertEquals(TraceLogLevel.TRACE_INFO, event.getLogLevel());
+// event.setLogLevel("TRACE_ALERT");
+// assertEquals(TraceLogLevel.TRACE_ALERT, event.getLogLevel());
+//
+// event.setEventType(TraceEventType.UNKNOWN);
+// assertEquals(TraceEventType.UNKNOWN, event.getEventType());
+// event.setEventType("tracepoint");
+// assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+//
+// // restore original values
+// event.setName(name);
+// event.setLogLevel(level);
+// event.setEventType(type);
+// }
+//
+// private void verifyEventGettersSetters(TraceEventComponent event) {
+// // save original values
+// String name = event.getName();
+// TraceLogLevel level = event.getLogLevel();
+// TraceEventType type = event.getEventType();
+// TraceEnablement state = event.getState();
+//
+// // test cases
+// event.setName("newName");
+// assertEquals("newName", event.getName());
+//
+// event.setLogLevel(TraceLogLevel.TRACE_INFO);
+// assertEquals(TraceLogLevel.TRACE_INFO, event.getLogLevel());
+// event.setLogLevel("TRACE_ALERT");
+// assertEquals(TraceLogLevel.TRACE_ALERT, event.getLogLevel());
+//
+// event.setEventType(TraceEventType.UNKNOWN);
+// assertEquals(TraceEventType.UNKNOWN, event.getEventType());
+// event.setEventType("tracepoint");
+// assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+//
+// event.setState("disabled");
+// assertEquals(TraceEnablement.DISABLED, event.getState());
+//
+// Image disabledImage = event.getImage();
+// assertNotNull(disabledImage);
+//
+// event.setState(TraceEnablement.ENABLED);
+// assertEquals(TraceEnablement.ENABLED, event.getState());
+//
+// Image enabledImage = event.getImage();
+// assertNotNull(enabledImage);
+// assertNotSame(enabledImage, disabledImage);
+//
+// // restore original values
+// event.setName(name);
+// event.setLogLevel(level);
+// event.setEventType(type);
+// event.setState(state);
+// }
+//
+// private void verifyChannelGettersSetters(TraceChannelComponent channel) {
+// // save original values
+// String name = channel.getName();
+// int nbSubBuffers = channel.getNumberOfSubBuffers();
+// String type = channel.getOutputType();
+// boolean mode = channel.isOverwriteMode();
+// long readTimer = channel.getReadTimer();
+// TraceEnablement state = channel.getState();
+// long subBufferSize = channel.getSubBufferSize();
+// long switchTimer = channel.getSwitchTimer();
+//
+// // test cases
+// channel.setName("newName");
+// assertEquals("newName", channel.getName());
+//
+// channel.setNumberOfSubBuffers(2);
+// assertEquals(2, channel.getNumberOfSubBuffers());
+//
+// channel.setOutputType("splice()");
+// assertEquals("splice()", channel.getOutputType());
+//
+// channel.setOverwriteMode(false);
+// assertEquals(false, channel.isOverwriteMode());
+//
+// channel.setReadTimer(250);
+// assertEquals(250, channel.getReadTimer());
+//
+// channel.setState("enabled");
+// assertEquals(TraceEnablement.ENABLED, channel.getState());
+//
+// Image enabledImage = channel.getImage();
+// assertNotNull(enabledImage);
+// channel.setState(TraceEnablement.DISABLED);
+// assertEquals(TraceEnablement.DISABLED, channel.getState());
+//
+// Image disabledImage = channel.getImage();
+// assertNotNull(disabledImage);
+// assertNotSame(enabledImage, disabledImage);
+//
+// channel.setSubBufferSize(1024);
+// assertEquals(1024, channel.getSubBufferSize());
+//
+// channel.setSwitchTimer(1000);
+// assertEquals(1000, channel.getSwitchTimer());
+//
+// // restore original values
+// channel.setName(name);
+// channel.setNumberOfSubBuffers(nbSubBuffers);
+// channel.setOutputType(type);
+// channel.setOverwriteMode(mode);
+// channel.setReadTimer(readTimer);
+// channel.setState(state);
+// channel.setSubBufferSize(subBufferSize);
+// channel.setSwitchTimer(switchTimer);
+// }
+//
+// private void verifyUstProviderGettersSetters(UstProviderComponent ustProvider) {
+// // save original values
+// String name = ustProvider.getName();
+// int pid = ustProvider.getPid();
+//
+// // test cases
+// ustProvider.setName("newName");
+// assertEquals("newName", ustProvider.getName());
+//
+// ustProvider.setPid(9876);
+// assertEquals(9876, ustProvider.getPid());
+//
+// // restore original values
+// ustProvider.setName(name);
+// ustProvider.setPid(pid);
+// }
+
+ public class CreateSessionDialogStub implements ICreateSessionDialog {
+ public String fPath = null;
+
+ @Override
+ public String getSessionName() {
+ return "mysession";
+ }
+
+ @Override
+ public String getSessionPath() {
+ return fPath;
+ }
+
+ @Override
+ public boolean isDefaultSessionPath() {
+ return fPath == null;
+ }
+
+ @Override
+ public void setTraceSessionGroup(TraceSessionGroup group) {
+
+ }
+
+ @Override
+ public int open() {
+ return 0;
+ }
+
+ public void setSessionPath(String path) {
+ fPath = path;
+ }
+ }
+
+ public class GetEventInfoDialogStub implements IGetEventInfoDialog {
+
+ private TraceSessionComponent[] fSessions;
+
+ @Override
+ public TraceSessionComponent getSession() {
+ return fSessions[0];
+ }
+
+ @Override
+ public TraceChannelComponent getChannel() {
+ return null;
+ }
+
+ @Override
+ public void setIsKernel(boolean isKernel) {
+ }
+
+ @Override
+ public void setSessions(TraceSessionComponent[] sessions) {
+ fSessions = sessions;
+ }
+
+ @Override
+ public int open() {
+ return 0;
+ }
+ }
+
+ public class DestroyConfirmDialogStub implements IConfirmDialog {
+
+ @Override
+ public boolean openConfirm(Shell parent, String title, String message) {
+ return true;
+ }
+ }
+
+ public class CreateChannelOnSessionDialogStub implements ICreateChannelOnSessionDialog {
+
+ @Override
+ public IChannelInfo getChannelInfo() {
+ ChannelInfo info = new ChannelInfo("mychannel");
+ info.setNumberOfSubBuffers(2);
+ info.setOverwriteMode(false);
+ info.setReadTimer(100);
+ info.setSwitchTimer(200);
+ info.setSubBufferSize(16384);
+ return info;
+ }
+
+ @Override
+ public void setDomainComponent(TraceDomainComponent domain) {
+ }
+
+ @Override
+ public int open() {
+ return 0;
+ }
+
+ @Override
+ public boolean isKernel() {
+ return false;
+ }
+
+ }
+}
--- /dev/null
- import org.eclipse.core.commands.Command;
+/*******************************************************************************
+ * Copyright (c) 2011 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ *******************************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.component;
+
- import org.eclipse.linuxtools.lttng.ui.views.control.ControlView;
+import org.eclipse.core.commands.ExecutionException;
+import org.eclipse.core.commands.NotEnabledException;
+import org.eclipse.core.commands.NotHandledException;
+import org.eclipse.core.commands.common.NotDefinedException;
+import org.eclipse.core.runtime.jobs.Job;
- import org.eclipse.ui.commands.ICommandService;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
+import org.eclipse.swt.widgets.Display;
+import org.eclipse.ui.IViewPart;
+import org.eclipse.ui.PartInitException;
+import org.eclipse.ui.PlatformUI;
- final static public String COMMAND_CATEGORY_PREFIX = "org.eclipse.linuxtools.lttng.ui.commands.control."; //$NON-NLS-1$
+import org.eclipse.ui.handlers.IHandlerService;
+
+/**
+ * Singleton class to facilitate the test cases. Creates UML2SD view and loader objects as well as provides
+ * utility methods for interacting with the loader/view.
+ */
+public class TraceControlTestFacility {
+
+ // ------------------------------------------------------------------------
+ // Constants
+ // ------------------------------------------------------------------------
+
+ final static public int WAIT_FOR_JOBS_DELAY = 1000;
+ final static public int GUI_REFESH_DELAY = 500;
+
++ final static public String COMMAND_CATEGORY_PREFIX = "org.eclipse.linuxtools.internal.lttng.ui.commands.control."; //$NON-NLS-1$
+
+ // ------------------------------------------------------------------------
+ // Attributes
+ // ------------------------------------------------------------------------
+ private static TraceControlTestFacility fInstance = null;
+ private ControlView fControlView = null;
+ private boolean fIsInitialized = false;
+
+ // ------------------------------------------------------------------------
+ // Constructors
+ // ------------------------------------------------------------------------
+ private TraceControlTestFacility() {
+ }
+
+ // ------------------------------------------------------------------------
+ // Operations
+ // ------------------------------------------------------------------------
+ public static TraceControlTestFacility getInstance() {
+ if (fInstance == null) {
+ fInstance = new TraceControlTestFacility();
+ }
+ return fInstance;
+ }
+
+ /**
+ * Initial the test facility.
+ */
+ public void init() {
+
+ if (!fIsInitialized) {
+
+ IViewPart view;
+ try {
+ view = PlatformUI.getWorkbench()
+ .getActiveWorkbenchWindow()
+ .getActivePage()
+ .showView(ControlView.ID);
+
+ } catch (PartInitException e) {
+ throw new RuntimeException(e);
+ }
+
+ fControlView = (ControlView) view;
+
+ delay(3000);
+ fIsInitialized = true;
+ }
+ }
+
+
+ public void dispose() {
+ if (fIsInitialized) {
+ waitForJobs();
+
+ PlatformUI.getWorkbench().getActiveWorkbenchWindow().getActivePage().hideView(fControlView);
+ fIsInitialized = false;
+ }
+ }
+
+ public void delay(long waitTimeMillis) {
+ Display display = Display.getCurrent();
+ if (display != null) {
+ long endTimeMillis = System.currentTimeMillis() + waitTimeMillis;
+ while(System.currentTimeMillis() < endTimeMillis) {
+ if (!display.readAndDispatch()) {
+ display.sleep();
+ }
+ display.update();
+ }
+ } else {
+ try {
+ Thread.sleep(waitTimeMillis);
+ } catch (InterruptedException e) {
+ // Ignored
+ }
+ }
+ }
+
+ /**
+ * Waits for all Eclipse jobs to finish
+ */
+ public void waitForJobs() {
+ while (!Job.getJobManager().isIdle()) {
+ delay(WAIT_FOR_JOBS_DELAY);
+ }
+ }
+
+
+ /**
+ * @return current control view
+ */
+ public ControlView getControlView() {
+ return fControlView;
+ }
+
+ public void executeCommand(String commandId) throws ExecutionException, NotDefinedException, NotEnabledException, NotHandledException {
+// ICommandService commandService = (ICommandService) fControlView.getSite().getService(ICommandService.class);
+ IHandlerService handlerService = (IHandlerService) fControlView.getSite().getService(IHandlerService.class);
+ handlerService.executeCommand(COMMAND_CATEGORY_PREFIX + commandId, null);
+ }
+
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ITraceControlComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TargetNodeState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEnablement;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEventType;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceLogLevel;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceSessionState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.KernelProviderComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TargetNodeComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceChannelComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceEventComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceProbeEventComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceProviderGroup;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionGroup;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.UstProviderComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.ILttngControlService;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.LTTngControlService;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.component;
+
+import java.io.File;
+import java.net.URL;
+
+import junit.framework.Test;
+import junit.framework.TestCase;
+import junit.framework.TestSuite;
+
+import org.eclipse.core.runtime.FileLocator;
+import org.eclipse.core.runtime.Path;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.KernelProviderComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProbeEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProviderGroup;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionGroup;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.UstProviderComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.LTTngControlService;
+import org.eclipse.linuxtools.lttng.stubs.service.TestRemoteSystemProxy;
+import org.eclipse.linuxtools.lttng.ui.tests.LTTngUITestPlugin;
+import org.eclipse.rse.core.model.Host;
+import org.eclipse.rse.core.model.IHost;
+import org.eclipse.rse.internal.core.model.SystemProfile;
+import org.eclipse.swt.graphics.Image;
+import org.junit.After;
+import org.junit.Before;
+
+/**
+ * The class <code>TraceControlTreeModelTest</code> contains tests for the tree component classes.
+ */
+@SuppressWarnings("nls")
+public class TraceControlTreeModelTest extends TestCase {
+
+ private static final String DIRECTORY = "testfiles";
+ private static final String TEST_STREAM = "ListInfoTest.cfg";
+ private static final String SCEN_LIST_INFO_TEST = "ListInfoTest";
+
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+
+ private TestRemoteSystemProxy fProxy;
+ private String fTestFile;
+
+ // ------------------------------------------------------------------------
+ // Static methods
+ // ------------------------------------------------------------------------
+
+ /**
+ * Returns test setup used when executing test case stand-alone.
+ * @return Test setup class
+ */
+ public static Test suite() {
+ return new ModelImplTestSetup(new TestSuite(TraceControlTreeModelTest.class));
+ }
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception
+ * if the initialization fails for some reason
+ *
+ */
+ @Override
+ @Before
+ public void setUp() throws Exception {
+ fProxy = new TestRemoteSystemProxy();
+ URL location = FileLocator.find(LTTngUITestPlugin.getDefault().getBundle(), new Path(DIRECTORY + File.separator + TEST_STREAM), null);
+ File testfile = new File(FileLocator.toFileURL(location).toURI());
+ fTestFile = testfile.getAbsolutePath();
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception
+ * if the clean-up fails for some reason
+ *
+ */
+ @Override
+ @After
+ public void tearDown() throws Exception {
+ }
+
+ /**
+ * Run the TraceControlComponent.
+ */
+ public void testTraceControlComponents()
+ throws Exception {
+
+ fProxy.setTestFile(fTestFile);
+ fProxy.setScenario(SCEN_LIST_INFO_TEST);
+
+ ITraceControlComponent root = TraceControlTestFacility.getInstance().getControlView().getTraceControlRoot();
+
+ @SuppressWarnings("restriction")
+ IHost host = new Host(new SystemProfile("myProfile", true));
+ host.setHostName("127.0.0.1");
+
+ TargetNodeComponent node = new TargetNodeComponent("myNode", root, host, fProxy);
+
+ root.addChild(node);
+ node.connect();
+
+ TraceControlTestFacility.getInstance().waitForJobs();
+
+ // ------------------------------------------------------------------------
+ // Verify Parameters of TargetNodeComponent
+ // ------------------------------------------------------------------------
+ assertEquals("127.0.0.1", node.getHostName());
+ assertEquals("127.0.0.1", node.getToolTip());
+ Image connectedImage = node.getImage();
+ assertNotNull(connectedImage);
+ assertEquals(TargetNodeState.CONNECTED, node.getTargetNodeState());
+ assertNotNull(node.getControlService());
+ ILttngControlService service = node.getControlService();
+ assertTrue(service instanceof LTTngControlService);
+ node.setControlService(service);
+ assertTrue(node.getControlService() instanceof LTTngControlService);
+
+ assertTrue(node.isPassiveCommunicationsListener());
+
+ // ------------------------------------------------------------------------
+ // Verify Children of TargetNodeComponent
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] groups = node.getChildren();
+ assertNotNull(groups);
+ assertEquals(2, groups.length);
+
+ assertTrue(groups[0] instanceof TraceProviderGroup);
+ assertTrue(groups[1] instanceof TraceSessionGroup);
+
+ assertEquals("Provider", groups[0].getName());
+ assertEquals("Sessions", groups[1].getName());
+
+ // ------------------------------------------------------------------------
+ // Verify TraceProviderGroup
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] providers = groups[0].getChildren();
+
+ assertNotNull(providers);
+ assertEquals(3, providers.length);
+
+ // ------------------------------------------------------------------------
+ // Verify UstProviderComponent
+ // ------------------------------------------------------------------------
+ KernelProviderComponent kernelProvider = (KernelProviderComponent) providers[0];
+
+ // ------------------------------------------------------------------------
+ // Verify event info (kernel provider)
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] events = kernelProvider.getChildren();
+ assertNotNull(events);
+ assertEquals(3, events.length);
+
+ BaseEventComponent baseEventInfo = (BaseEventComponent) events[0];
+ assertNotNull(baseEventInfo);
+ assertEquals("sched_kthread_stop", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ baseEventInfo = (BaseEventComponent) events[1];
+ assertEquals("sched_kthread_stop_ret", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ baseEventInfo = (BaseEventComponent) events[2];
+ assertEquals("sched_wakeup_new", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ // ------------------------------------------------------------------------
+ // Verify UstProviderComponent
+ // ------------------------------------------------------------------------
+ UstProviderComponent ustProvider = (UstProviderComponent) providers[1];
+ assertEquals("/home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello", ustProvider.getName());
+ assertEquals(9379, ustProvider.getPid());
+
+ // ------------------------------------------------------------------------
+ // Verify event info (UST provider)
+ // ------------------------------------------------------------------------
+ events = ustProvider.getChildren();
+ assertNotNull(events);
+ assertEquals(2, events.length);
+
+ baseEventInfo = (BaseEventComponent) events[0];
+ assertNotNull(baseEventInfo);
+ assertEquals("ust_tests_hello:tptest_sighandler", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_DEBUG_MODULE, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ baseEventInfo = (BaseEventComponent) events[1];
+ assertEquals("ust_tests_hello:tptest", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_INFO, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ // ------------------------------------------------------------------------
+ // Verify UstProviderComponent
+ // ------------------------------------------------------------------------
+ ustProvider = (UstProviderComponent) providers[2];
+ assertEquals("/home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello", ustProvider.getName());
+ assertEquals(4852, ustProvider.getPid());
+
+ // verify getters and setter
+ verifyUstProviderGettersSetters(ustProvider);
+
+ // ------------------------------------------------------------------------
+ // Verify event info (UST provider)
+ // ------------------------------------------------------------------------
+ events = ustProvider.getChildren();
+ assertNotNull(events);
+ assertEquals(2, events.length);
+
+ baseEventInfo = (BaseEventComponent) events[0];
+ assertNotNull(baseEventInfo);
+ assertEquals("ust_tests_hello:tptest_sighandler", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_WARNING, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ baseEventInfo = (BaseEventComponent) events[1];
+ assertEquals("ust_tests_hello:tptest", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_DEBUG_FUNCTION, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ // verify getters and setters
+ verifyBaseEventGettersSetters(baseEventInfo);
+
+ // ------------------------------------------------------------------------
+ // Verify TraceSessionGroup
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] sessions = groups[1].getChildren();
+ assertNotNull(sessions);
+ assertEquals(2, sessions.length);
+ for (int i = 0; i < sessions.length; i++) {
+ assertTrue(sessions[i] instanceof TraceSessionComponent);
+ }
+ assertEquals("mysession1", sessions[0].getName());
+ assertEquals("mysession", sessions[1].getName());
+
+ // ------------------------------------------------------------------------
+ // Verify TraceSessionComponent
+ // ------------------------------------------------------------------------
+ TraceSessionComponent session = (TraceSessionComponent)sessions[1];
+ assertEquals("mysession", session.getName());
+ assertEquals("/home/user/lttng-traces/mysession-20120129-084256", session.getSessionPath());
+ assertEquals(TraceSessionState.ACTIVE, session.getSessionState());
+
+ // Verify setters and setters
+ verifySessionGetterSetters(session);
+
+ ITraceControlComponent[] domains = session.getChildren();
+ assertNotNull(domains);
+ assertEquals(2, domains.length);
+
+ // ------------------------------------------------------------------------
+ // Verify Kernel domain
+ // ------------------------------------------------------------------------
+ assertEquals("Kernel", domains[0].getName());
+ ITraceControlComponent[] channels = domains[0].getChildren();
+ assertNotNull(channels);
+ assertEquals(2, channels.length);
+
+ // ------------------------------------------------------------------------
+ // Verify Kernel's channel0
+ // ------------------------------------------------------------------------
+ assertTrue(channels[0] instanceof TraceChannelComponent);
+ TraceChannelComponent channel = (TraceChannelComponent) channels[0];
+ assertEquals("channel0", channel.getName());
+ assertEquals(4, channel.getNumberOfSubBuffers());
+ assertEquals("splice()", channel.getOutputType());
+ assertEquals(false, channel.isOverwriteMode());
+ assertEquals(200, channel.getReadTimer());
+ assertEquals(TraceEnablement.ENABLED, channel.getState());
+ assertEquals(262144, channel.getSubBufferSize());
+ assertEquals(0, channel.getSwitchTimer());
+
+ // ------------------------------------------------------------------------
+ // Verify event info (kernel, channel0)
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] channel0Events = channel.getChildren();
+ assertNotNull(channel0Events);
+ assertEquals(5, channel0Events.length);
+ assertTrue(channel0Events[0] instanceof TraceEventComponent);
+ assertTrue(channel0Events[1] instanceof TraceEventComponent);
+ assertTrue(channel0Events[2] instanceof TraceProbeEventComponent);
+ assertTrue(channel0Events[3] instanceof TraceProbeEventComponent);
+ assertTrue(channel0Events[4] instanceof TraceEventComponent);
+
+ TraceEventComponent event = (TraceEventComponent) channel0Events[0];
+ assertEquals("block_rq_remap", event.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, event.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+ assertEquals(TraceEnablement.ENABLED, event.getState());
+
+ event = (TraceEventComponent) channel0Events[1];
+ assertEquals("block_bio_remap", event.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, event.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+ assertEquals(TraceEnablement.DISABLED, event.getState());
+
+ TraceProbeEventComponent probeEvent = (TraceProbeEventComponent) channel0Events[2];
+ assertEquals("myevent2", probeEvent.getName());
+ assertEquals(TraceLogLevel.LEVEL_UNKNOWN, probeEvent.getLogLevel());
+ assertEquals(TraceEventType.PROBE, probeEvent.getEventType());
+ assertEquals(TraceEnablement.ENABLED, probeEvent.getState());
+ assertEquals("0xc0101340", probeEvent.getAddress());
+ assertNull(probeEvent.getOffset());
+ assertNull(probeEvent.getSymbol());
+
+ probeEvent = (TraceProbeEventComponent) channel0Events[3];
+ assertEquals("myevent0", probeEvent.getName());
+ assertEquals(TraceLogLevel.LEVEL_UNKNOWN, probeEvent.getLogLevel());
+ assertEquals(TraceEventType.PROBE, probeEvent.getEventType());
+ assertEquals(TraceEnablement.ENABLED, probeEvent.getState());
+ assertNull(probeEvent.getAddress());
+ assertEquals("0x0", probeEvent.getOffset());
+ assertEquals("init_post", probeEvent.getSymbol());
+
+ event = (TraceEventComponent) channel0Events[4];
+ assertEquals("syscalls", event.getName());
+ assertEquals(TraceLogLevel.LEVEL_UNKNOWN, event.getLogLevel());
+ assertEquals(TraceEventType.SYSCALL, event.getEventType());
+ assertEquals(TraceEnablement.ENABLED, event.getState());
+
+ // ------------------------------------------------------------------------
+ // Verify Kernel's channel1
+ // ------------------------------------------------------------------------
+ assertEquals("channel1", channels[1].getName());
+ channel = (TraceChannelComponent) channels[1];
+ assertEquals(4, channel.getNumberOfSubBuffers());
+ assertEquals("splice()", channel.getOutputType());
+ assertEquals(true, channel.isOverwriteMode());
+ assertEquals(400, channel.getReadTimer());
+ assertEquals(TraceEnablement.DISABLED, channel.getState());
+ assertEquals(524288, channel.getSubBufferSize());
+ assertEquals(100, channel.getSwitchTimer());
+
+ // ------------------------------------------------------------------------
+ // Verify event info (kernel, channel1)
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] channel1Events = channels[1].getChildren();
+ assertEquals(0, channel1Events.length);
+
+ // ------------------------------------------------------------------------
+ // Verify domain UST global
+ // ------------------------------------------------------------------------
+ assertEquals("UST global", domains[1].getName());
+
+ ITraceControlComponent[] ustChannels = domains[1].getChildren();
+
+ for (int i = 0; i < ustChannels.length; i++) {
+ assertTrue(ustChannels[i] instanceof TraceChannelComponent);
+ }
+
+ // ------------------------------------------------------------------------
+ // Verify UST global's mychannel1
+ // ------------------------------------------------------------------------
+ channel = (TraceChannelComponent) ustChannels[0];
+ assertEquals("mychannel1", channel.getName());
+ assertEquals(8, channel.getNumberOfSubBuffers());
+ assertEquals("mmap()", channel.getOutputType());
+ assertEquals(true, channel.isOverwriteMode());
+ assertEquals(100, channel.getReadTimer());
+ assertEquals(TraceEnablement.DISABLED, channel.getState());
+ assertEquals(8192, channel.getSubBufferSize());
+ assertEquals(200, channel.getSwitchTimer());
+
+ // verify getters and setters
+ verifyChannelGettersSetters(channel);
+
+ // ------------------------------------------------------------------------
+ // Verify event info (UST global, mychannel1)
+ // ------------------------------------------------------------------------
+ ITraceControlComponent[] ustEvents = channel.getChildren();
+ assertEquals(0, ustEvents.length);
+
+ // ------------------------------------------------------------------------
+ // Verify UST global's channel0
+ // ------------------------------------------------------------------------
+ channel = (TraceChannelComponent) ustChannels[1];
+ assertEquals("channel0", channel.getName());
+ assertEquals(4, channel.getNumberOfSubBuffers());
+ assertEquals("mmap()", channel.getOutputType());
+ assertEquals(false, channel.isOverwriteMode());
+ assertEquals(200, channel.getReadTimer());
+ assertEquals(TraceEnablement.ENABLED, channel.getState());
+ assertEquals(4096, channel.getSubBufferSize());
+ assertEquals(0, channel.getSwitchTimer());
+
+ // ------------------------------------------------------------------------
+ // Verify event info (UST global, channel0)
+ // ------------------------------------------------------------------------
+ ustEvents = channel.getChildren();
+ assertEquals(2, ustEvents.length);
+
+ event = (TraceEventComponent) ustEvents[0];
+ assertEquals("ust_tests_hello:tptest_sighandler", event.getName());
+ assertEquals(TraceLogLevel.TRACE_DEBUG_LINE, event.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+ assertEquals(TraceEnablement.DISABLED, event.getState());
+
+ event = (TraceEventComponent) ustEvents[1];
+ assertEquals("*", ustEvents[1].getName());
+ assertEquals(TraceLogLevel.LEVEL_UNKNOWN, event.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+ assertEquals(TraceEnablement.ENABLED, event.getState());
+
+ // verify getters and setters
+ verifyEventGettersSetters(event);
+
+ // disconnect
+ node.disconnect();
+ assertEquals(TargetNodeState.DISCONNECTED, node.getTargetNodeState());
+ assertNotNull(node.getImage());
+ assertNotSame(connectedImage, node.getImage());
+ }
+
+ private void verifySessionGetterSetters(TraceSessionComponent session) {
+ // save original values
+ String name = session.getName();
+ String origPath = session.getSessionPath();
+ TraceSessionState origState = session.getSessionState();
+
+ // test cases
+ session.setName("newName");
+ assertEquals("newName", session.getName());
+
+ session.setSessionPath("/home/user/tmp");
+ assertEquals("/home/user/tmp", session.getSessionPath());
+
+ session.setSessionState(TraceSessionState.INACTIVE);
+ assertEquals(TraceSessionState.INACTIVE, session.getSessionState());
+ Image inactiveImage = session.getImage();
+ assertNotNull(inactiveImage);
+
+ session.setSessionState("active");
+ assertEquals(TraceSessionState.ACTIVE, session.getSessionState());
+
+ Image activeImage = session.getImage();
+ assertNotNull(activeImage);
+ assertNotSame(activeImage, inactiveImage);
+
+
+ // restore original values
+ session.setName(name);
+ session.setSessionPath(origPath);
+ session.setSessionState(origState);
+ }
+
+ private void verifyBaseEventGettersSetters(BaseEventComponent event) {
+ // save original values
+ String name = event.getName();
+ TraceLogLevel level = event.getLogLevel();
+ TraceEventType type = event.getEventType();
+
+ // test cases
+ event.setName("newName");
+ assertEquals("newName", event.getName());
+
+ event.setLogLevel(TraceLogLevel.TRACE_INFO);
+ assertEquals(TraceLogLevel.TRACE_INFO, event.getLogLevel());
+ event.setLogLevel("TRACE_ALERT");
+ assertEquals(TraceLogLevel.TRACE_ALERT, event.getLogLevel());
+
+ event.setEventType(TraceEventType.UNKNOWN);
+ assertEquals(TraceEventType.UNKNOWN, event.getEventType());
+ event.setEventType("tracepoint");
+ assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+
+ // restore original values
+ event.setName(name);
+ event.setLogLevel(level);
+ event.setEventType(type);
+ }
+
+ private void verifyEventGettersSetters(TraceEventComponent event) {
+ // save original values
+ String name = event.getName();
+ TraceLogLevel level = event.getLogLevel();
+ TraceEventType type = event.getEventType();
+ TraceEnablement state = event.getState();
+
+ // test cases
+ event.setName("newName");
+ assertEquals("newName", event.getName());
+
+ event.setLogLevel(TraceLogLevel.TRACE_INFO);
+ assertEquals(TraceLogLevel.TRACE_INFO, event.getLogLevel());
+ event.setLogLevel("TRACE_ALERT");
+ assertEquals(TraceLogLevel.TRACE_ALERT, event.getLogLevel());
+
+ event.setEventType(TraceEventType.UNKNOWN);
+ assertEquals(TraceEventType.UNKNOWN, event.getEventType());
+ event.setEventType("tracepoint");
+ assertEquals(TraceEventType.TRACEPOINT, event.getEventType());
+
+ event.setState("disabled");
+ assertEquals(TraceEnablement.DISABLED, event.getState());
+
+ Image disabledImage = event.getImage();
+ assertNotNull(disabledImage);
+
+ event.setState(TraceEnablement.ENABLED);
+ assertEquals(TraceEnablement.ENABLED, event.getState());
+
+ Image enabledImage = event.getImage();
+ assertNotNull(enabledImage);
+ assertNotSame(enabledImage, disabledImage);
+
+ // restore original values
+ event.setName(name);
+ event.setLogLevel(level);
+ event.setEventType(type);
+ event.setState(state);
+ }
+
+ private void verifyChannelGettersSetters(TraceChannelComponent channel) {
+ // save original values
+ String name = channel.getName();
+ int nbSubBuffers = channel.getNumberOfSubBuffers();
+ String type = channel.getOutputType();
+ boolean mode = channel.isOverwriteMode();
+ long readTimer = channel.getReadTimer();
+ TraceEnablement state = channel.getState();
+ long subBufferSize = channel.getSubBufferSize();
+ long switchTimer = channel.getSwitchTimer();
+
+ // test cases
+ channel.setName("newName");
+ assertEquals("newName", channel.getName());
+
+ channel.setNumberOfSubBuffers(2);
+ assertEquals(2, channel.getNumberOfSubBuffers());
+
+ channel.setOutputType("splice()");
+ assertEquals("splice()", channel.getOutputType());
+
+ channel.setOverwriteMode(false);
+ assertEquals(false, channel.isOverwriteMode());
+
+ channel.setReadTimer(250);
+ assertEquals(250, channel.getReadTimer());
+
+ channel.setState("enabled");
+ assertEquals(TraceEnablement.ENABLED, channel.getState());
+
+ Image enabledImage = channel.getImage();
+ assertNotNull(enabledImage);
+ channel.setState(TraceEnablement.DISABLED);
+ assertEquals(TraceEnablement.DISABLED, channel.getState());
+
+ Image disabledImage = channel.getImage();
+ assertNotNull(disabledImage);
+ assertNotSame(enabledImage, disabledImage);
+
+ channel.setSubBufferSize(1024);
+ assertEquals(1024, channel.getSubBufferSize());
+
+ channel.setSwitchTimer(1000);
+ assertEquals(1000, channel.getSwitchTimer());
+
+ // restore original values
+ channel.setName(name);
+ channel.setNumberOfSubBuffers(nbSubBuffers);
+ channel.setOutputType(type);
+ channel.setOverwriteMode(mode);
+ channel.setReadTimer(readTimer);
+ channel.setState(state);
+ channel.setSubBufferSize(subBufferSize);
+ channel.setSwitchTimer(switchTimer);
+ }
+
+ private void verifyUstProviderGettersSetters(UstProviderComponent ustProvider) {
+ // save original values
+ String name = ustProvider.getName();
+ int pid = ustProvider.getPid();
+
+ // test cases
+ ustProvider.setName("newName");
+ assertEquals("newName", ustProvider.getName());
+
+ ustProvider.setPid(9876);
+ assertEquals(9876, ustProvider.getPid());
+
+ // restore original values
+ ustProvider.setName(name);
+ ustProvider.setPid(pid);
+ }
+
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IBaseEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEventType;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceLogLevel;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventInfo;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
+import junit.framework.TestCase;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo;
+
+/**
+ * The class <code>BaseEventInfoTest</code> contains test for the class <code>{@link BaseEventInfo}</code>.
+ */
+@SuppressWarnings("nls")
+public class BaseEventInfoTest extends TestCase {
+
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private IBaseEventInfo fEventInfo1 = null;
+ private IBaseEventInfo fEventInfo2 = null;
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception if the initialization fails for some reason
+ *
+ */
+ @Override
+ public void setUp() throws Exception {
+ super.setUp();
+ ModelImplFactory factory = new ModelImplFactory();
+ fEventInfo1 = factory.getBaseEventInfo1();
+ fEventInfo2 = factory.getBaseEventInfo2();
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception if the clean-up fails for some reason
+ *
+ */
+ @Override
+ public void tearDown() throws Exception {
+ }
+
+ // ------------------------------------------------------------------------
+ // Tests
+ // ------------------------------------------------------------------------
+
+ /**
+ * Run the BaseEventInfo() constructor test.
+ *
+ */
+ public void testBaseEventInfo() {
+ BaseEventInfo fixture = new BaseEventInfo("event");
+ assertNotNull(fixture);
+
+ TraceEventType result = fixture.getEventType();
+
+ assertEquals("event", fixture.getName());
+ assertEquals("unknown", result.getInName());
+ assertEquals("UNKNOWN", result.name());
+ assertEquals("UNKNOWN", result.toString());
+ assertEquals(3, result.ordinal());
+
+ TraceLogLevel level = fixture.getLogLevel();
+ assertEquals("TRACE_DEBUG", level.getInName());
+ assertEquals("TRACE_DEBUG", level.name());
+ assertEquals("TRACE_DEBUG", level.toString());
+ assertEquals(14, level.ordinal());
+ }
+
+ /**
+ * Test Copy Constructor
+ */
+ public void testEventInfoCopy() {
+ BaseEventInfo info = new BaseEventInfo((BaseEventInfo)fEventInfo1);
+
+ assertEquals(fEventInfo1.getName(), info.getName());
+ assertEquals(fEventInfo1.getEventType(), info.getEventType());
+ assertEquals(fEventInfo1.getLogLevel(), info.getLogLevel());
+ }
+
+ /**
+ * Test Copy Constructor
+ */
+ public void testEventCopy2() {
+ try {
+ BaseEventInfo info = null;
+ new BaseEventInfo(info);
+ fail("null copy");
+ }
+ catch (IllegalArgumentException e) {
+ // Success
+ }
+ }
+
+ /**
+ * Run the TraceEventType getEventType() method test.
+ *
+ * @throws Exception
+ *
+ */
+ public void testGetEventType_1() {
+ BaseEventInfo fixture = new BaseEventInfo("event");
+ fixture.setEventType("unknown");
+
+ TraceEventType result = fixture.getEventType();
+
+ assertNotNull(result);
+ assertEquals("unknown", result.getInName());
+ assertEquals("UNKNOWN", result.name());
+ assertEquals("UNKNOWN", result.toString());
+ assertEquals(3, result.ordinal());
+
+ fixture.setEventType("");
+ result = fixture.getEventType();
+ assertEquals("unknown", result.getInName());
+ assertEquals("UNKNOWN", result.name());
+ assertEquals("UNKNOWN", result.toString());
+ assertEquals(3, result.ordinal());
+
+ fixture.setEventType("tracepoint");
+ result = fixture.getEventType();
+ assertNotNull(result);
+ assertEquals("tracepoint", result.getInName());
+ assertEquals("TRACEPOINT", result.name());
+ assertEquals("TRACEPOINT", result.toString());
+ assertEquals(0, result.ordinal());
+
+ fixture.setEventType("syscall");
+ result = fixture.getEventType();
+ assertNotNull(result);
+ assertEquals("syscall", result.getInName());
+ assertEquals("SYSCALL", result.name());
+ assertEquals("SYSCALL", result.toString());
+ assertEquals(1, result.ordinal());
+
+ fixture.setEventType("probe");
+ result = fixture.getEventType();
+ assertNotNull(result);
+ assertEquals("probe", result.getInName());
+ assertEquals("PROBE", result.name());
+ assertEquals("PROBE", result.toString());
+ assertEquals(2, result.ordinal());
+
+ }
+
+ /**
+ * Run the void setEventType(TraceEventType) method test.
+ *
+ */
+ public void testSetEventType_2() {
+ BaseEventInfo fixture = new BaseEventInfo("event");
+ fixture.setEventType(TraceEventType.TRACEPOINT);
+
+ TraceEventType result = fixture.getEventType();
+
+ assertNotNull(result);
+ assertEquals("tracepoint", result.getInName());
+ assertEquals("TRACEPOINT", result.name());
+ assertEquals("TRACEPOINT", result.toString());
+ assertEquals(0, result.ordinal());
+
+ fixture.setEventType(TraceEventType.UNKNOWN);
+ result = fixture.getEventType();
+
+ assertNotNull(result);
+ assertEquals("unknown", result.getInName());
+ assertEquals("UNKNOWN", result.name());
+ assertEquals("UNKNOWN", result.toString());
+ assertEquals(3, result.ordinal());
+
+ fixture.setEventType(TraceEventType.SYSCALL);
+ result = fixture.getEventType();
+ assertNotNull(result);
+ assertEquals("syscall", result.getInName());
+ assertEquals("SYSCALL", result.name());
+ assertEquals("SYSCALL", result.toString());
+ assertEquals(1, result.ordinal());
+
+ fixture.setEventType(TraceEventType.PROBE);
+ result = fixture.getEventType();
+ assertNotNull(result);
+ assertEquals("probe", result.getInName());
+ assertEquals("PROBE", result.name());
+ assertEquals("PROBE", result.toString());
+ assertEquals(2, result.ordinal());
+
+ }
+
+ /**
+ * Run the void setLogLevel(TraceLogLevel) method test.
+ * Run the TraceLogLevel getLogLevel() method test
+ *
+ */
+ public void testSetLogLevel1() {
+ BaseEventInfo fixture = new BaseEventInfo("event");
+ fixture.setEventType(TraceEventType.TRACEPOINT);
+ fixture.setLogLevel(TraceLogLevel.TRACE_CRIT);
+
+ // 2 set/get-operations are enough to test the method
+ TraceLogLevel result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_CRIT", result.getInName());
+ assertEquals("TRACE_CRIT", result.name());
+ assertEquals("TRACE_CRIT", result.toString());
+ assertEquals(2, result.ordinal());
+
+ fixture.setLogLevel(TraceLogLevel.TRACE_DEBUG_FUNCTION);
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG_FUNCTION", result.getInName());
+ assertEquals("TRACE_DEBUG_FUNCTION", result.name());
+ assertEquals("TRACE_DEBUG_FUNCTION", result.toString());
+ assertEquals(12, result.ordinal());
+ }
+
+ /**
+ * Run the void setLogLevel(String) method test.
+ * Run the TraceLogLevel getLogLevel() method test
+ *
+ */
+ public void testSetLogLevel2() {
+ BaseEventInfo fixture = new BaseEventInfo("event");
+ fixture.setEventType(TraceEventType.TRACEPOINT);
+ fixture.setLogLevel("TRACE_EMERG");
+
+ TraceLogLevel result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_EMERG", result.getInName());
+ assertEquals("TRACE_EMERG", result.name());
+ assertEquals(0, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_ALERT");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_ALERT", result.getInName());
+ assertEquals("TRACE_ALERT", result.name());
+ assertEquals(1, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_CRIT");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_CRIT", result.getInName());
+ assertEquals("TRACE_CRIT", result.name());
+ assertEquals(2, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_ERR");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_ERR", result.getInName());
+ assertEquals("TRACE_ERR", result.name());
+ assertEquals(3, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_WARNING");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_WARNING", result.getInName());
+ assertEquals("TRACE_WARNING", result.name());
+ assertEquals(4, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_NOTICE");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_NOTICE", result.getInName());
+ assertEquals("TRACE_NOTICE", result.name());
+ assertEquals(5, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_INFO");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_INFO", result.getInName());
+ assertEquals("TRACE_INFO", result.name());
+ assertEquals(6, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_DEBUG_SYSTEM");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG_SYSTEM", result.getInName());
+ assertEquals("TRACE_DEBUG_SYSTEM", result.name());
+ assertEquals(7, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_DEBUG_PROGRAM");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG_PROGRAM", result.getInName());
+ assertEquals("TRACE_DEBUG_PROGRAM", result.name());
+ assertEquals(8, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_DEBUG_PROCESS");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG_PROCESS", result.getInName());
+ assertEquals("TRACE_DEBUG_PROCESS", result.name());
+ assertEquals(9, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_DEBUG_MODULE");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG_MODULE", result.getInName());
+ assertEquals("TRACE_DEBUG_MODULE", result.name());
+ assertEquals(10, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_DEBUG_UNIT");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG_UNIT", result.getInName());
+ assertEquals("TRACE_DEBUG_UNIT", result.name());
+ assertEquals(11, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_DEBUG_FUNCTION");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG_FUNCTION", result.getInName());
+ assertEquals("TRACE_DEBUG_FUNCTION", result.name());
+ assertEquals(12, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_DEBUG_LINE");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG_LINE", result.getInName());
+ assertEquals("TRACE_DEBUG_LINE", result.name());
+ assertEquals(13, result.ordinal());
+
+ //------------------------
+ fixture.setLogLevel("TRACE_DEBUG");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG", result.getInName());
+ assertEquals("TRACE_DEBUG", result.name());
+ assertEquals(14, result.ordinal());
+
+ //-------------------------
+ fixture.setLogLevel("LEVEL_UNKNOWN");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("LEVEL_UNKNOWN", result.getInName());
+ assertEquals("LEVEL_UNKNOWN", result.name());
+ assertEquals(15, result.ordinal());
+
+ fixture.setLogLevel("garbage");
+
+ result = fixture.getLogLevel();
+ assertNotNull(result);
+ assertEquals("TRACE_DEBUG", result.getInName());
+ assertEquals("TRACE_DEBUG", result.name());
+ assertEquals(14, result.ordinal());
+ }
+
+
+ /**
+ * Run the String toString() method test.
+ *
+ */
+ public void testToString_1() {
+ BaseEventInfo fixture = new BaseEventInfo("event");
+ fixture.setName("testName");
+ fixture.setEventType(TraceEventType.TRACEPOINT);
+ fixture.setLogLevel(TraceLogLevel.TRACE_ERR);
+
+ String result = fixture.toString();
+
+ // add additional test code here
+ assertEquals("[BaseEventInfo([TraceInfo(Name=testName)],type=TRACEPOINT,level=TRACE_ERR)]", result);
+ }
+
+ // ------------------------------------------------------------------------
+ // equals
+ // ------------------------------------------------------------------------
+
+ public void testEqualsReflexivity() {
+ assertTrue("equals", fEventInfo1.equals(fEventInfo1));
+ assertTrue("equals", fEventInfo2.equals(fEventInfo2));
+
+ assertTrue("equals", !fEventInfo1.equals(fEventInfo2));
+ assertTrue("equals", !fEventInfo2.equals(fEventInfo1));
+ }
+
+ public void testEqualsSymmetry() {
+ BaseEventInfo info1 = new BaseEventInfo((BaseEventInfo)fEventInfo1);
+ BaseEventInfo info2 = new BaseEventInfo((BaseEventInfo)fEventInfo2);
+
+ assertTrue("equals", info1.equals(fEventInfo1));
+ assertTrue("equals", fEventInfo1.equals(info1));
+
+ assertTrue("equals", info2.equals(fEventInfo2));
+ assertTrue("equals", fEventInfo2.equals(info2));
+ }
+
+ public void testEqualsTransivity() {
+ BaseEventInfo info1 = new BaseEventInfo((BaseEventInfo)fEventInfo1);
+ BaseEventInfo info2 = new BaseEventInfo((BaseEventInfo)fEventInfo1);
+ BaseEventInfo info3 = new BaseEventInfo((BaseEventInfo)fEventInfo1);
+
+ assertTrue("equals", info1.equals(info2));
+ assertTrue("equals", info2.equals(info3));
+ assertTrue("equals", info1.equals(info3));
+ }
+
+ public void testEqualsNull() {
+ assertTrue("equals", !fEventInfo1.equals(null));
+ assertTrue("equals", !fEventInfo2.equals(null));
+ }
+
+ // ------------------------------------------------------------------------
+ // hashCode
+ // ------------------------------------------------------------------------
+
+ public void testHashCode() {
+ BaseEventInfo info1 = new BaseEventInfo((BaseEventInfo)fEventInfo1);
+ BaseEventInfo info2 = new BaseEventInfo((BaseEventInfo)fEventInfo2);
+
+ assertTrue("hashCode", fEventInfo1.hashCode() == info1.hashCode());
+ assertTrue("hashCode", fEventInfo2.hashCode() == info2.hashCode());
+
+ assertTrue("hashCode", fEventInfo1.hashCode() != info2.hashCode());
+ assertTrue("hashCode", fEventInfo2.hashCode() != info1.hashCode());
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEnablement;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.ChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.EventInfo;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
+import java.util.LinkedList;
+import java.util.List;
+
+import junit.framework.TestCase;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.ChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.EventInfo;
+
+/**
+ * The class <code>ChannelInfoTest</code> contains tests for the class <code>{@link ChannelInfo}</code>.
+ *
+ */
+@SuppressWarnings("nls")
+public class ChannelInfoTest extends TestCase {
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private IChannelInfo fChannelInfo1 = null;
+ private IChannelInfo fChannelInfo2 = null;
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception
+ * if the initialization fails for some reason
+ *
+ */
+ @Override
+ public void setUp() {
+ ModelImplFactory factory = new ModelImplFactory();
+ fChannelInfo1 = factory.getChannel1();
+ fChannelInfo2 = factory.getChannel2();
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception
+ * if the clean-up fails for some reason
+ *
+ */
+ @Override
+ public void tearDown() {
+ }
+
+ // ------------------------------------------------------------------------
+ // Tests
+ // ------------------------------------------------------------------------
+
+ // ------------------------------------------------------------------------
+ // Constructors
+ // ------------------------------------------------------------------------
+
+ /**
+ * Run the ChannelInfo() constructor test.
+ *
+ */
+ public void testChannelInfo() {
+ ChannelInfo result = new ChannelInfo("test");
+ assertNotNull(result);
+
+ assertEquals("test", result.getName());
+ assertEquals(0, result.getNumberOfSubBuffers());
+ assertEquals("", result.getOutputType());
+ assertEquals(false, result.isOverwriteMode());
+ assertEquals(0, result.getReadTimer());
+ assertEquals("disabled", result.getState().getInName());
+ assertEquals(0, result.getSubBufferSize());
+ assertEquals(0, result.getSwitchTimer());
+ }
+
+ public void testChannelInfoCopy() {
+ ChannelInfo channelInfo = new ChannelInfo((ChannelInfo)fChannelInfo1);
+
+ assertEquals(fChannelInfo1.getName(), channelInfo.getName());
+ assertEquals(fChannelInfo1.getNumberOfSubBuffers(), channelInfo.getNumberOfSubBuffers());
+ assertEquals(fChannelInfo1.getOutputType(), channelInfo.getOutputType());
+ assertEquals(fChannelInfo1.isOverwriteMode(), channelInfo.isOverwriteMode());
+ assertEquals(fChannelInfo1.getReadTimer(), channelInfo.getReadTimer());
+ assertEquals(fChannelInfo1.getState(), channelInfo.getState());
+ assertEquals(fChannelInfo1.getSwitchTimer(), channelInfo.getSwitchTimer());
+ assertEquals(fChannelInfo1.getEvents().length, channelInfo.getEvents().length);
+
+ IEventInfo[] orignalEvents = fChannelInfo1.getEvents();
+ IEventInfo[] resultEvents = channelInfo.getEvents();
+ for (int i = 0; i < orignalEvents.length; i++) {
+ assertEquals(orignalEvents[i], resultEvents[i]);
+ }
+ }
+
+ public void testChannelCopy2() {
+ try {
+ ChannelInfo channel = null;
+ new ChannelInfo(channel);
+ fail("null copy");
+ }
+ catch (IllegalArgumentException e) {
+ // Success
+ }
+ }
+
+ /**
+ * Run the IEventInfo[] getEvents() method test.
+ *
+ */
+ public void testAddAndGetEvents_1() {
+ ChannelInfo fixture = new ChannelInfo("test");
+ fixture.setSwitchTimer(1L);
+ fixture.setOverwriteMode(true);
+ fixture.setReadTimer(1L);
+ fixture.setState(TraceEnablement.DISABLED);
+ fixture.setNumberOfSubBuffers(1);
+ fixture.setOutputType("");
+ fixture.setSubBufferSize(1L);
+
+ // add an event
+ IEventInfo event = new EventInfo("event");
+ fixture.addEvent(event);
+
+ // Verify the stored events
+ IEventInfo[] result = fixture.getEvents();
+
+ assertNotNull(result);
+ assertEquals(1, result.length);
+ assertNotNull(result[0]);
+ assertTrue(event.equals(result[0]));
+ }
+
+ /**
+ * Run the long getNumberOfSubBuffers() method test.
+ *
+ */
+ public void testGetAndSetters() {
+ ChannelInfo fixture = new ChannelInfo("test");
+ fixture.setSwitchTimer(2L);
+ fixture.setOverwriteMode(true);
+ fixture.setReadTimer(3L);
+ fixture.setState(TraceEnablement.DISABLED);
+ fixture.setNumberOfSubBuffers(4);
+ fixture.setOutputType("splice()");
+ fixture.setSubBufferSize(1L);
+ fixture.addEvent(new EventInfo("event"));
+
+ long switchTimer = fixture.getSwitchTimer();
+ assertEquals(2L, switchTimer);
+
+ boolean mode = fixture.isOverwriteMode();
+ assertTrue(mode);
+
+ long readTimer = fixture.getReadTimer();
+ assertEquals(3L, readTimer);
+
+ TraceEnablement state = fixture.getState();
+ assertEquals("disabled", state.getInName());
+
+ long numSubBuffers = fixture.getNumberOfSubBuffers();
+ assertEquals(4, numSubBuffers);
+
+ String outputType = fixture.getOutputType();
+ assertEquals("splice()", outputType);
+
+ long subBufferSize = fixture.getSubBufferSize();
+ assertEquals(1L, subBufferSize);
+
+ fixture.setSwitchTimer(5L);
+ fixture.setOverwriteMode(false);
+ fixture.setReadTimer(6L);
+ fixture.setState(TraceEnablement.ENABLED);
+ fixture.setNumberOfSubBuffers(7);
+ fixture.setOutputType("mmap()");
+ fixture.setSubBufferSize(8L);
+
+ switchTimer = fixture.getSwitchTimer();
+ assertEquals(5L, switchTimer);
+
+ mode = fixture.isOverwriteMode();
+ assertFalse(mode);
+
+ readTimer = fixture.getReadTimer();
+ assertEquals(6L, readTimer);
+
+ state = fixture.getState();
+ assertEquals("enabled", state.getInName());
+
+ numSubBuffers = fixture.getNumberOfSubBuffers();
+ assertEquals(7, numSubBuffers);
+
+ outputType = fixture.getOutputType();
+ assertEquals("mmap()", outputType);
+
+ subBufferSize = fixture.getSubBufferSize();
+ assertEquals(8L, subBufferSize);
+ }
+
+ /**
+ * Run the void setEvents(List<IEventInfo>) method test.
+ *
+ */
+ public void testSetEvents_1() {
+ ChannelInfo fixture = new ChannelInfo("test");
+ fixture.setSwitchTimer(1L);
+ fixture.setOverwriteMode(true);
+ fixture.setReadTimer(1L);
+ fixture.setState(TraceEnablement.DISABLED);
+ fixture.setNumberOfSubBuffers(1);
+ fixture.setOutputType("");
+ fixture.setSubBufferSize(1L);
+ List<IEventInfo> events = new LinkedList<IEventInfo>();
+
+ for (int i = 0; i < 2; i++) {
+ IEventInfo info = new EventInfo("event" + i);
+ info.setEventType("tracepoint");
+ info.setState((i % 2 == 0 ? "enabled" : "disabled"));
+ events.add(info);
+ }
+
+ fixture.setEvents(events);
+
+ IEventInfo[] infos = fixture.getEvents();
+
+ assertEquals(events.size(), infos.length);
+
+ for (int i = 0; i < infos.length; i++) {
+ assertEquals(events.get(i), infos[i]);
+ }
+ }
+
+ public void testToString_1() {
+ ChannelInfo fixture = new ChannelInfo("channel");
+ fixture.setSwitchTimer(1L);
+ fixture.setOverwriteMode(true);
+ fixture.setReadTimer(1L);
+ fixture.setState(TraceEnablement.DISABLED);
+ fixture.setNumberOfSubBuffers(1);
+ fixture.setOutputType("splice()");
+ fixture.setSubBufferSize(1L);
+
+ String result = fixture.toString();
+
+ // add additional test code here
+ assertEquals("[ChannelInfo([TraceInfo(Name=channel)],State=DISABLED,OverwriteMode=true,SubBuffersSize=1,NumberOfSubBuffers=1,SwitchTimer=1,ReadTimer=1,output=splice(),Events=None)]", result);
+ }
+
+ /**
+ * Run the String toString() method test.
+ *
+ */
+ public void testToString_2() {
+ String result = fChannelInfo1.toString();
+
+ // add additional test code here
+ assertEquals("[ChannelInfo([TraceInfo(Name=channel1)],State=DISABLED,OverwriteMode=true,SubBuffersSize=13,NumberOfSubBuffers=12,SwitchTimer=10,ReadTimer=11,output=splice(),Events=[EventInfo([BaseEventInfo([TraceInfo(Name=event1)],type=TRACEPOINT,level=TRACE_DEBUG)],State=ENABLED)])]", result);
+ }
+
+ // ------------------------------------------------------------------------
+ // equals
+ // ------------------------------------------------------------------------
+
+ public void testEqualsReflexivity() {
+ assertTrue("equals", fChannelInfo1.equals(fChannelInfo1));
+ assertTrue("equals", fChannelInfo2.equals(fChannelInfo2));
+
+ assertTrue("equals", !fChannelInfo1.equals(fChannelInfo2));
+ assertTrue("equals", !fChannelInfo2.equals(fChannelInfo1));
+ }
+
+ public void testEqualsSymmetry() {
+ ChannelInfo event1 = new ChannelInfo((ChannelInfo)fChannelInfo1);
+ ChannelInfo event2 = new ChannelInfo((ChannelInfo)fChannelInfo2);
+
+ assertTrue("equals", event1.equals(fChannelInfo1));
+ assertTrue("equals", fChannelInfo1.equals(event1));
+
+ assertTrue("equals", event2.equals(fChannelInfo2));
+ assertTrue("equals", fChannelInfo2.equals(event2));
+ }
+
+ public void testEqualsTransivity() {
+ ChannelInfo channel1 = new ChannelInfo((ChannelInfo)fChannelInfo1);
+ ChannelInfo channel2 = new ChannelInfo((ChannelInfo)fChannelInfo1);
+ ChannelInfo channel3 = new ChannelInfo((ChannelInfo)fChannelInfo1);
+
+ assertTrue("equals", channel1.equals(channel2));
+ assertTrue("equals", channel2.equals(channel3));
+ assertTrue("equals", channel1.equals(channel3));
+ }
+
+ public void testEqualsNull() throws Exception {
+ assertTrue("equals", !fChannelInfo1.equals(null));
+ assertTrue("equals", !fChannelInfo2.equals(null));
+ }
+
+ // ------------------------------------------------------------------------
+ // hashCode
+ // ------------------------------------------------------------------------
+
+ public void testHashCode() {
+ ChannelInfo channel1 = new ChannelInfo((ChannelInfo)fChannelInfo1);
+ ChannelInfo channel2 = new ChannelInfo((ChannelInfo)fChannelInfo2);
+
+ assertTrue("hashCode", fChannelInfo1.hashCode() == channel1.hashCode());
+ assertTrue("hashCode", fChannelInfo2.hashCode() == channel2.hashCode());
+
+ assertTrue("hashCode", fChannelInfo1.hashCode() != channel2.hashCode());
+ assertTrue("hashCode", fChannelInfo2.hashCode() != channel1.hashCode());
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IDomainInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.DomainInfo;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
+import java.util.LinkedList;
+import java.util.List;
+
+import junit.framework.TestCase;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.DomainInfo;
+
+/**
+ * The class <code>ChannelInfoTest</code> contains tests for the class <code>{@link DomainInfo}</code>.
+ *
+ */
+@SuppressWarnings("nls")
+public class DomainInfoTest extends TestCase {
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private IDomainInfo fDomainInfo1 = null;
+ private IDomainInfo fDomainInfo2 = null;
+ private IChannelInfo fChannelInfo1 = null;
+ private IChannelInfo fChannelInfo2 = null;
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception
+ * if the initialization fails for some reason
+ *
+ */
+ @Override
+ public void setUp() {
+ // Get test instances from the factory
+ ModelImplFactory factory = new ModelImplFactory();
+ fChannelInfo1 = factory.getChannel1();
+ fChannelInfo2 = factory.getChannel2();
+ fDomainInfo1 = factory.getDomainInfo1();
+ fDomainInfo2 = factory.getDomainInfo2();
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception
+ * if the clean-up fails for some reason
+ *
+ */
+ @Override
+ public void tearDown() {
+ }
+
+ // ------------------------------------------------------------------------
+ // Tests
+ // ------------------------------------------------------------------------
+
+ // ------------------------------------------------------------------------
+ // Constructors
+ // ------------------------------------------------------------------------
+
+ /**
+ * Run the ChannelInfo() constructor test.
+ *
+ */
+ public void testDomainInfo() {
+ DomainInfo result = new DomainInfo("test");
+ assertNotNull(result);
+
+ assertEquals("test", result.getName());
+ assertEquals(0, result.getChannels().length);
+ }
+
+ public void testDomainInfoCopy() {
+ DomainInfo channelInfo = new DomainInfo((DomainInfo)fDomainInfo1);
+ IChannelInfo[] orignalEvents = fDomainInfo1.getChannels();
+ IChannelInfo[] resultEvents = channelInfo.getChannels();
+ for (int i = 0; i < orignalEvents.length; i++) {
+ assertEquals(orignalEvents[i], resultEvents[i]);
+ }
+ }
+
+ public void testDomainlCopy2() {
+ try {
+ DomainInfo domain = null;
+ new DomainInfo(domain);
+ fail("null copy");
+ }
+ catch (IllegalArgumentException e) {
+ // Success
+ }
+ }
+
+ /**
+ * Run the long getNumberOfSubBuffers() method test.
+ *
+ */
+ public void testGetAndSetters() {
+
+ // Note that addChannel() has been executed in setUp()
+ // check get method here
+ assertEquals(1, fDomainInfo1.getChannels().length);
+ assertNotNull(fDomainInfo1.getChannels()[0]);
+ assertEquals(fChannelInfo1, fDomainInfo1.getChannels()[0]);
+
+ IDomainInfo domain = new DomainInfo("domain");
+ List<IChannelInfo> list = new LinkedList<IChannelInfo>();
+ list.add(fChannelInfo1);
+ list.add(fChannelInfo2);
+ domain.setChannels(list);
+
+ IChannelInfo[] result = domain.getChannels();
+ assertEquals(2, result.length);
+ assertEquals(fChannelInfo1, result[0]);
+ assertEquals(fChannelInfo2, result[1]);
+ }
+
+ public void testToString_1() {
+ DomainInfo fixture = new DomainInfo("domain");
+
+ String result = fixture.toString();
+
+ assertEquals("[DomainInfo([TraceInfo(Name=domain)],Channels=None,isKernel=false)]", result);
+ }
+
+ /**
+ * Run the String toString() method test.
+ *
+ */
+ public void testToString_2() {
+ String result = fDomainInfo1.toString();
+
+ assertEquals("[DomainInfo([TraceInfo(Name=test1)],Channels=[ChannelInfo([TraceInfo(Name=channel1)],State=DISABLED,OverwriteMode=true,SubBuffersSize=13,NumberOfSubBuffers=12,SwitchTimer=10,ReadTimer=11,output=splice(),Events=[EventInfo([BaseEventInfo([TraceInfo(Name=event1)],type=TRACEPOINT,level=TRACE_DEBUG)],State=ENABLED)])],isKernel=false)]", result);
+ }
+
+ // ------------------------------------------------------------------------
+ // equals
+ // ------------------------------------------------------------------------
+
+ public void testEqualsReflexivity() {
+ assertTrue("equals", fDomainInfo1.equals(fDomainInfo1));
+ assertTrue("equals", fDomainInfo2.equals(fDomainInfo2));
+
+ assertTrue("equals", !fDomainInfo1.equals(fDomainInfo2));
+ assertTrue("equals", !fDomainInfo2.equals(fDomainInfo1));
+ }
+
+ public void testEqualsSymmetry() {
+ DomainInfo event1 = new DomainInfo((DomainInfo)fDomainInfo1);
+ DomainInfo event2 = new DomainInfo((DomainInfo)fDomainInfo2);
+
+ assertTrue("equals", event1.equals(fDomainInfo1));
+ assertTrue("equals", fDomainInfo1.equals(event1));
+
+ assertTrue("equals", event2.equals(fDomainInfo2));
+ assertTrue("equals", fDomainInfo2.equals(event2));
+ }
+
+ public void testEqualsTransivity() {
+ DomainInfo channel1 = new DomainInfo((DomainInfo)fDomainInfo1);
+ DomainInfo channel2 = new DomainInfo((DomainInfo)fDomainInfo1);
+ DomainInfo channel3 = new DomainInfo((DomainInfo)fDomainInfo1);
+
+ assertTrue("equals", channel1.equals(channel2));
+ assertTrue("equals", channel2.equals(channel3));
+ assertTrue("equals", channel1.equals(channel3));
+ }
+
+ public void testEqualsNull() throws Exception {
+ assertTrue("equals", !fDomainInfo1.equals(null));
+ assertTrue("equals", !fDomainInfo2.equals(null));
+ }
+
+ // ------------------------------------------------------------------------
+ // hashCode
+ // ------------------------------------------------------------------------
+
+ public void testHashCode() {
+ DomainInfo channel1 = new DomainInfo((DomainInfo)fDomainInfo1);
+ DomainInfo channel2 = new DomainInfo((DomainInfo)fDomainInfo2);
+
+ assertTrue("hashCode", fDomainInfo1.hashCode() == channel1.hashCode());
+ assertTrue("hashCode", fDomainInfo2.hashCode() == channel2.hashCode());
+
+ assertTrue("hashCode", fDomainInfo1.hashCode() != channel2.hashCode());
+ assertTrue("hashCode", fDomainInfo2.hashCode() != channel1.hashCode());
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEnablement;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEventType;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.EventInfo;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
+import junit.framework.TestCase;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.EventInfo;
+
+/**
+ * The class <code>BaseEventInfoTest</code> contains test for the class <code>{@link BaseEventInfo}</code>.
+ */
+@SuppressWarnings("nls")
+public class EventInfoTest extends TestCase {
+
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private IEventInfo fEventInfo1 = null;
+ private IEventInfo fEventInfo2 = null;
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception if the initialization fails for some reason
+ *
+ */
+ @Override
+ public void setUp() throws Exception {
+ ModelImplFactory factory = new ModelImplFactory();
+ fEventInfo1 = factory.getEventInfo1();
+ fEventInfo2 = factory.getEventInfo2();
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception if the clean-up fails for some reason
+ *
+ */
+ @Override
+ public void tearDown() throws Exception {
+ }
+
+ // ------------------------------------------------------------------------
+ // Tests
+ // ------------------------------------------------------------------------
+
+ /**
+ * Run the BaseEventInfo() constructor test.
+ *
+ */
+ public void testBaseEventInfo() {
+ EventInfo fixture = new EventInfo("event");
+ assertNotNull(fixture);
+
+ TraceEventType result = fixture.getEventType();
+
+ assertEquals("event", fixture.getName());
+ assertEquals("unknown", result.getInName());
+ assertEquals("UNKNOWN", result.name());
+ assertEquals("UNKNOWN", result.toString());
+ assertEquals(3, result.ordinal());
+
+ TraceEnablement state = fixture.getState();
+ assertEquals("disabled", state.getInName());
+ assertEquals("DISABLED", state.name());
+ assertEquals("DISABLED", state.toString());
+ assertEquals(0, state.ordinal());
+
+ }
+
+ /**
+ * Test Copy Constructor
+ */
+ public void testEventInfoCopy() {
+ EventInfo info = new EventInfo((EventInfo)fEventInfo1);
+
+ assertEquals(fEventInfo1.getName(), info.getName());
+ assertEquals(fEventInfo1.getEventType(), info.getEventType());
+ assertEquals(fEventInfo1.getState(), info.getState());
+ }
+
+ /**
+ * Test Copy Constructor
+ */
+ public void testEventCopy2() {
+ try {
+ EventInfo info = null;
+ new EventInfo(info);
+ fail("null copy");
+ }
+ catch (IllegalArgumentException e) {
+ // Success
+ }
+ }
+
+ /**
+ * Getter/Setter tests
+ */
+ public void testGetAndSetter() {
+ EventInfo fixture = new EventInfo("event");
+
+ fixture.setEventType(TraceEventType.TRACEPOINT);
+ TraceEventType result = fixture.getEventType();
+
+ // setEventType(TraceEventType type)
+ assertNotNull(result);
+ assertEquals("tracepoint", result.getInName());
+ assertEquals("TRACEPOINT", result.name());
+ assertEquals("TRACEPOINT", result.toString());
+ assertEquals(0, result.ordinal());
+
+ fixture.setEventType(TraceEventType.UNKNOWN);
+ result = fixture.getEventType();
+ assertEquals("unknown", result.getInName());
+ assertEquals("UNKNOWN", result.name());
+ assertEquals("UNKNOWN", result.toString());
+ assertEquals(3, result.ordinal());
+
+ // setEventType(String typeName)
+ String typeName = "";
+ fixture.setEventType(typeName);
+ result = fixture.getEventType();
+
+ assertEquals("unknown", result.getInName());
+ assertEquals("UNKNOWN", result.name());
+ assertEquals("UNKNOWN", result.toString());
+ assertEquals(3, result.ordinal());
+
+ typeName = "unknown";
+
+ fixture.setEventType(typeName);
+ result = fixture.getEventType();
+
+ assertEquals("unknown", result.getInName());
+ assertEquals("UNKNOWN", result.name());
+ assertEquals("UNKNOWN", result.toString());
+ assertEquals(3, result.ordinal());
+
+ // setState(String stateName)
+ fixture.setState("disabled");
+ TraceEnablement state = fixture.getState();
+ assertEquals("disabled", state.getInName());
+ assertEquals("DISABLED", state.name());
+ assertEquals("DISABLED", state.toString());
+ assertEquals(0, state.ordinal());
+
+ fixture.setState("bla");
+ state = fixture.getState();
+ assertEquals("disabled", state.getInName());
+ assertEquals("DISABLED", state.name());
+ assertEquals("DISABLED", state.toString());
+ assertEquals(0, state.ordinal());
+
+ fixture.setState("enabled");
+ state = fixture.getState();
+ assertEquals("enabled", state.getInName());
+ assertEquals("ENABLED", state.name());
+ assertEquals("ENABLED", state.toString());
+ assertEquals(1, state.ordinal());
+
+ // setState(TraceEnablement state)
+ fixture.setState(TraceEnablement.DISABLED);
+ state = fixture.getState();
+ assertEquals("disabled", state.getInName());
+ assertEquals("DISABLED", state.name());
+ assertEquals("DISABLED", state.toString());
+ assertEquals(0, state.ordinal());
+
+ fixture.setState(TraceEnablement.ENABLED);
+ state = fixture.getState();
+ assertEquals("enabled", state.getInName());
+ assertEquals("ENABLED", state.name());
+ assertEquals("ENABLED", state.toString());
+ assertEquals(1, state.ordinal());
+ }
+
+ /**
+ * Run the String toString() method test.
+ */
+ public void testToString_1() {
+ EventInfo fixture = new EventInfo("event");
+ fixture.setName("testName");
+ fixture.setEventType(TraceEventType.TRACEPOINT);
+
+ String result = fixture.toString();
+
+ // add additional test code here
+ assertEquals("[EventInfo([BaseEventInfo([TraceInfo(Name=testName)],type=TRACEPOINT,level=TRACE_DEBUG)],State=DISABLED)]", result);
+ }
+
+ // ------------------------------------------------------------------------
+ // equals
+ // ------------------------------------------------------------------------
+ public void testEqualsReflexivity() {
+ assertTrue("equals", fEventInfo1.equals(fEventInfo1));
+ assertTrue("equals", fEventInfo2.equals(fEventInfo2));
+
+ assertTrue("equals", !fEventInfo1.equals(fEventInfo2));
+ assertTrue("equals", !fEventInfo2.equals(fEventInfo1));
+ }
+
+ public void testEqualsSymmetry() {
+ EventInfo info1 = new EventInfo((EventInfo)fEventInfo1);
+ EventInfo info2 = new EventInfo((EventInfo)fEventInfo2);
+
+ assertTrue("equals", info1.equals(fEventInfo1));
+ assertTrue("equals", fEventInfo1.equals(info1));
+
+ assertTrue("equals", info2.equals(fEventInfo2));
+ assertTrue("equals", fEventInfo2.equals(info2));
+ }
+
+ public void testEqualsTransivity() {
+ EventInfo info1 = new EventInfo((EventInfo)fEventInfo1);
+ EventInfo info2 = new EventInfo((EventInfo)fEventInfo1);
+ EventInfo info3 = new EventInfo((EventInfo)fEventInfo1);
+
+ assertTrue("equals", info1.equals(info2));
+ assertTrue("equals", info2.equals(info3));
+ assertTrue("equals", info1.equals(info3));
+ }
+
+ public void testEqualsNull() {
+ assertTrue("equals", !fEventInfo1.equals(null));
+ assertTrue("equals", !fEventInfo2.equals(null));
+ }
+
+ // ------------------------------------------------------------------------
+ // hashCode
+ // ------------------------------------------------------------------------
+
+ public void testHashCode() {
+ EventInfo info1 = new EventInfo((EventInfo)fEventInfo1);
+ EventInfo info2 = new EventInfo((EventInfo)fEventInfo2);
+
+ assertTrue("hashCode", fEventInfo1.hashCode() == info1.hashCode());
+ assertTrue("hashCode", fEventInfo2.hashCode() == info2.hashCode());
+
+ assertTrue("hashCode", fEventInfo1.hashCode() != info2.hashCode());
+ assertTrue("hashCode", fEventInfo2.hashCode() != info1.hashCode());
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ITraceControlComponent;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ITraceControlComponentChangedListener;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponentChangedListener;
+
+/**
+ * The class can be used to validate the listener interface.
+ *
+ */
+public class ListenerValidator implements ITraceControlComponentChangedListener {
+
+ // ------------------------------------------------------------------------
+ // Attributes
+ // ------------------------------------------------------------------------
+ private boolean fisAddedCalled = false;
+ private boolean fisRemoveCalled = false;
+ private boolean fisChangedCalled = false;
+
+ private ITraceControlComponent fParent = null;
+ private ITraceControlComponent fChild = null;
+ private ITraceControlComponent fChangedComponent = null;
+
+ // ------------------------------------------------------------------------
+ // Accessors
+ // ------------------------------------------------------------------------
+ public boolean isAddedCalled() {
+ return fisAddedCalled;
+ }
+
+ public boolean isRemovedCalled() {
+ return fisRemoveCalled;
+ }
+
+ public boolean isChangedCalled() {
+ return fisChangedCalled;
+ }
+
+ public ITraceControlComponent getSavedParent() {
+ return fParent;
+ }
+
+ public ITraceControlComponent getSavedChild() {
+ return fChild;
+ }
+
+ public ITraceControlComponent getSavedComponent() {
+ return fChangedComponent;
+ }
+
+ // ------------------------------------------------------------------------
+ // Operations
+ // ------------------------------------------------------------------------
+ public void initialize() {
+ fisAddedCalled = false;
+ fisRemoveCalled = false;
+ fisChangedCalled = false;
+ fParent = null;
+ fChild = null;
+ fChangedComponent = null;
+ }
+
+ @Override
+ public void componentAdded(ITraceControlComponent parent, ITraceControlComponent component) {
+ fisAddedCalled = true;
+ fParent = parent;
+ fChild = component;
+ }
+
+ @Override
+ public void componentRemoved(ITraceControlComponent parent, ITraceControlComponent component) {
+ fisRemoveCalled = true;
+ fParent = parent;
+ fChild = component;
+ }
+
+ @Override
+ public void componentChanged(ITraceControlComponent component) {
+ fisChangedCalled = true;
+ fParent = null;
+ fChangedComponent = component;
+ }
+
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IBaseEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IDomainInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IProbeEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ISessionInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IUstProviderInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEnablement;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEventType;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceLogLevel;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceSessionState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.ChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.DomainInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.EventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.ProbeEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.SessionInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.UstProviderInfo;
+/*******************************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ *******************************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.ChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.DomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.EventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.ProbeEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.SessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.UstProviderInfo;
+
+/**
+ * Test facility to constants across test case
+ */
+@SuppressWarnings("nls")
+public class ModelImplFactory {
+
+ private ISessionInfo fSessionInfo1 = null;
+ private ISessionInfo fSessionInfo2 = null;
+ private IDomainInfo fDomainInfo1 = null;
+ private IDomainInfo fDomainInfo2 = null;
+ private IChannelInfo fChannelInfo1 = null;
+ private IChannelInfo fChannelInfo2 = null;
+ private IEventInfo fEventInfo1 = null;
+ private IEventInfo fEventInfo2 = null;
+ private IEventInfo fEventInfo3 = null;
+ private IBaseEventInfo fBaseEventInfo1 = null;
+ private IBaseEventInfo fBaseEventInfo2 = null;
+ private IUstProviderInfo fUstProviderInfo1 = null;
+ private IUstProviderInfo fUstProviderInfo2 = null;
+ private IProbeEventInfo fProbeEventInfo1 = null;
+ private IProbeEventInfo fProbeEventInfo2 = null;
+
+ public ModelImplFactory() {
+ fBaseEventInfo1 = new BaseEventInfo("event1");
+ fBaseEventInfo1.setEventType(TraceEventType.UNKNOWN);
+ fBaseEventInfo1.setLogLevel(TraceLogLevel.TRACE_ERR);
+ fBaseEventInfo2 = new BaseEventInfo("event2");
+ fBaseEventInfo2.setEventType(TraceEventType.TRACEPOINT);
+ fBaseEventInfo1.setLogLevel(TraceLogLevel.TRACE_DEBUG);
+
+ fEventInfo1 = new EventInfo("event1");
+ fEventInfo1.setEventType(TraceEventType.TRACEPOINT);
+ fEventInfo1.setState(TraceEnablement.ENABLED);
+
+ fEventInfo2 = new EventInfo("event2");
+ fEventInfo2.setEventType(TraceEventType.UNKNOWN);
+ fEventInfo2.setState(TraceEnablement.DISABLED);
+
+ fEventInfo3 = new EventInfo("event3");
+ fEventInfo3.setEventType(TraceEventType.TRACEPOINT);
+ fEventInfo3.setState(TraceEnablement.DISABLED);
+
+ fUstProviderInfo1 = new UstProviderInfo("myUST1");
+ fUstProviderInfo1.setPid(1234);
+ fUstProviderInfo1.addEvent(fBaseEventInfo1);
+
+ fUstProviderInfo2 = new UstProviderInfo("myUST2");
+ fUstProviderInfo2.setPid(2345);
+ fUstProviderInfo2.addEvent(fBaseEventInfo1);
+ fUstProviderInfo2.addEvent(fBaseEventInfo2);
+
+ fChannelInfo1 = new ChannelInfo("channel1");
+ fChannelInfo1.setSwitchTimer(10L);
+ fChannelInfo1.setOverwriteMode(true);
+ fChannelInfo1.setReadTimer(11L);
+ fChannelInfo1.setState(TraceEnablement.DISABLED);
+ fChannelInfo1.setNumberOfSubBuffers(12);
+ fChannelInfo1.setOutputType("splice()");
+ fChannelInfo1.setSubBufferSize(13L);
+ fChannelInfo1.addEvent(fEventInfo1);
+
+ fChannelInfo2 = new ChannelInfo("channel2");
+ fChannelInfo2.setSwitchTimer(1L);
+ fChannelInfo2.setOverwriteMode(false);
+ fChannelInfo2.setReadTimer(2L);
+ fChannelInfo2.setState(TraceEnablement.ENABLED);
+ fChannelInfo2.setNumberOfSubBuffers(3);
+ fChannelInfo2.setOutputType("mmap()");
+ fChannelInfo2.setSubBufferSize(4L);
+ fChannelInfo2.addEvent(fEventInfo2);
+ fChannelInfo2.addEvent(fEventInfo3);
+
+ fDomainInfo1 = new DomainInfo("test1");
+ fDomainInfo1.addChannel(fChannelInfo1);
+
+ fDomainInfo2 = new DomainInfo("test2");
+ fDomainInfo2.addChannel(fChannelInfo1);
+ fDomainInfo2.addChannel(fChannelInfo2);
+
+ fSessionInfo1 = new SessionInfo("session1");
+ fSessionInfo1.setSessionPath("/home/user");
+ fSessionInfo1.setSessionState(TraceSessionState.ACTIVE);
+ fSessionInfo1.addDomain(fDomainInfo1);
+
+ fSessionInfo2 = new SessionInfo("session2");
+ fSessionInfo2.setSessionPath("/home/user1");
+ fSessionInfo2.setSessionState(TraceSessionState.INACTIVE);
+ fSessionInfo2.addDomain(fDomainInfo1);
+ fSessionInfo2.addDomain(fDomainInfo2);
+
+ fProbeEventInfo1 = new ProbeEventInfo("probeEvent1");
+ fProbeEventInfo1.setEventType(TraceEventType.TRACEPOINT);
+ fProbeEventInfo1.setState(TraceEnablement.ENABLED);
+ fProbeEventInfo1.setAddress("0xc1231234");
+
+ fProbeEventInfo2 = new ProbeEventInfo("probeEvent2");
+ fProbeEventInfo2.setEventType(TraceEventType.UNKNOWN);
+ fProbeEventInfo2.setState(TraceEnablement.DISABLED);
+ fProbeEventInfo2.setOffset("0x100");
+ fProbeEventInfo2.setSymbol("init_post");
+ }
+
+ public ISessionInfo getSessionInfo1() {
+ return fSessionInfo1;
+ }
+
+ public ISessionInfo getSessionInfo2() {
+ return fSessionInfo2;
+ }
+
+ public IDomainInfo getDomainInfo1() {
+ return fDomainInfo1;
+ }
+
+ public IDomainInfo getDomainInfo2() {
+ return fDomainInfo2;
+ }
+
+ public IChannelInfo getChannel1() {
+ return fChannelInfo1;
+ }
+
+ public IChannelInfo getChannel2() {
+ return fChannelInfo2;
+ }
+
+ public IEventInfo getEventInfo1() {
+ return fEventInfo1;
+ }
+
+ public IEventInfo getEventInfo2() {
+ return fEventInfo2;
+ }
+
+ public IEventInfo getEventInfo3() {
+ return fEventInfo3;
+ }
+
+ public IBaseEventInfo getBaseEventInfo1() {
+ return fBaseEventInfo1;
+ }
+
+ public IBaseEventInfo getBaseEventInfo2() {
+ return fBaseEventInfo2;
+ }
+
+ public IUstProviderInfo getUstProviderInfo1() {
+ return fUstProviderInfo1;
+ }
+
+ public IUstProviderInfo getUstProviderInfo2() {
+ return fUstProviderInfo2;
+ }
+
+ public IProbeEventInfo getProbeEventInfo1() {
+ return fProbeEventInfo1;
+ }
+
+ public IProbeEventInfo getProbeEventInfo2() {
+ return fProbeEventInfo2;
+ }
+
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IProbeEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEnablement;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEventType;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.EventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.ProbeEventInfo;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
+import junit.framework.TestCase;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.EventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.ProbeEventInfo;
+
+/**
+ * The class <code>BaseEventInfoTest</code> contains test for the class <code>{@link BaseEventInfo}</code>.
+ */
+@SuppressWarnings("nls")
+public class ProbeEventInfoTest extends TestCase {
+
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private IProbeEventInfo fEventInfo1 = null;
+ private IProbeEventInfo fEventInfo2 = null;
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception if the initialization fails for some reason
+ *
+ */
+ @Override
+ public void setUp() throws Exception {
+ ModelImplFactory factory = new ModelImplFactory();
+ fEventInfo1 = factory.getProbeEventInfo1();
+ fEventInfo2 = factory.getProbeEventInfo2();
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception if the clean-up fails for some reason
+ *
+ */
+ @Override
+ public void tearDown() throws Exception {
+ }
+
+ // ------------------------------------------------------------------------
+ // Tests
+ // ------------------------------------------------------------------------
+
+ /**
+ * Run the BaseEventInfo() constructor test.
+ *
+ */
+ public void testBaseEventInfo() {
+ ProbeEventInfo fixture = new ProbeEventInfo("event");
+ assertNotNull(fixture);
+
+ TraceEventType result = fixture.getEventType();
+
+ assertEquals("event", fixture.getName());
+ assertEquals("unknown", result.getInName());
+ assertEquals("UNKNOWN", result.name());
+ assertEquals("UNKNOWN", result.toString());
+ assertEquals(3, result.ordinal());
+
+ TraceEnablement state = fixture.getState();
+ assertEquals("disabled", state.getInName());
+ assertEquals("DISABLED", state.name());
+ assertEquals("DISABLED", state.toString());
+ assertEquals(0, state.ordinal());
+
+ assertNull(fixture.getAddress());
+ assertNull(fixture.getOffset());
+ assertNull(fixture.getSymbol());
+ }
+
+ /**
+ * Test Copy Constructor
+ */
+ public void testEventInfoCopy() {
+ ProbeEventInfo info = new ProbeEventInfo((ProbeEventInfo)fEventInfo1);
+
+ assertEquals(fEventInfo1.getName(), info.getName());
+ assertEquals(fEventInfo1.getEventType(), info.getEventType());
+ assertEquals(fEventInfo1.getState(), info.getState());
+ assertEquals(fEventInfo1.getAddress(), info.getAddress());
+ assertEquals(fEventInfo1.getOffset(), info.getOffset());
+ assertEquals(fEventInfo1.getSymbol(), info.getSymbol());
+ }
+
+ /**
+ * Test Copy Constructor
+ */
+ public void testEventCopy2() {
+ try {
+ ProbeEventInfo info = null;
+ new ProbeEventInfo(info);
+ fail("null copy");
+ }
+ catch (IllegalArgumentException e) {
+ // Success
+ }
+ }
+
+ /**
+ * Getter/Setter tests
+ */
+ public void testGetAndSetter() {
+ ProbeEventInfo fixture = new ProbeEventInfo("event");
+
+ // Make sure that ProbeEventInfo extends EventInfo
+ // -> so we don't need to re-test common parts
+ assertTrue(fixture instanceof EventInfo);
+
+ fixture.setAddress("0xc12344321");
+ String result = fixture.getAddress();
+
+ assertNotNull(result);
+ assertEquals("0xc12344321", result);
+
+ fixture.setOffset("0x1000");
+ result = fixture.getOffset();
+
+ assertNotNull(result);
+ assertEquals("0x1000", result);
+
+ fixture.setSymbol("cpu_idle");
+ result = fixture.getSymbol();
+
+ assertNotNull(result);
+ assertEquals("cpu_idle", result);
+ }
+
+ /**
+ * Run the String toString() method test.
+ */
+ public void testToString_1() {
+ assertEquals("[ProbeEventInfo([EventInfo([BaseEventInfo([TraceInfo(Name=probeEvent1)],type=TRACEPOINT,level=TRACE_DEBUG)],State=ENABLED)],fAddress=0xc1231234)]", fEventInfo1.toString());
+ assertEquals("[ProbeEventInfo([EventInfo([BaseEventInfo([TraceInfo(Name=probeEvent2)],type=UNKNOWN,level=TRACE_DEBUG)],State=DISABLED)],fOffset=0x100,fSymbol=init_post)]", fEventInfo2.toString());
+ }
+
+ // ------------------------------------------------------------------------
+ // equals
+ // ------------------------------------------------------------------------
+ public void testEqualsReflexivity() {
+ assertTrue("equals", fEventInfo1.equals(fEventInfo1));
+ assertTrue("equals", fEventInfo2.equals(fEventInfo2));
+
+ assertTrue("equals", !fEventInfo1.equals(fEventInfo2));
+ assertTrue("equals", !fEventInfo2.equals(fEventInfo1));
+ }
+
+ public void testEqualsSymmetry() {
+ ProbeEventInfo info1 = new ProbeEventInfo((ProbeEventInfo)fEventInfo1);
+ ProbeEventInfo info2 = new ProbeEventInfo((ProbeEventInfo)fEventInfo2);
+
+ assertTrue("equals", info1.equals(fEventInfo1));
+ assertTrue("equals", fEventInfo1.equals(info1));
+
+ assertTrue("equals", info2.equals(fEventInfo2));
+ assertTrue("equals", fEventInfo2.equals(info2));
+ }
+
+ public void testEqualsTransivity() {
+ ProbeEventInfo info1 = new ProbeEventInfo((ProbeEventInfo)fEventInfo1);
+ ProbeEventInfo info2 = new ProbeEventInfo((ProbeEventInfo)fEventInfo1);
+ ProbeEventInfo info3 = new ProbeEventInfo((ProbeEventInfo)fEventInfo1);
+
+ assertTrue("equals", info1.equals(info2));
+ assertTrue("equals", info2.equals(info3));
+ assertTrue("equals", info1.equals(info3));
+ }
+
+ public void testEqualsNull() {
+ assertTrue("equals", !fEventInfo1.equals(null));
+ assertTrue("equals", !fEventInfo2.equals(null));
+ }
+
+ // ------------------------------------------------------------------------
+ // hashCode
+ // ------------------------------------------------------------------------
+
+ public void testHashCode() {
+ ProbeEventInfo info1 = new ProbeEventInfo((ProbeEventInfo)fEventInfo1);
+ ProbeEventInfo info2 = new ProbeEventInfo((ProbeEventInfo)fEventInfo2);
+
+ assertTrue("hashCode", fEventInfo1.hashCode() == info1.hashCode());
+ assertTrue("hashCode", fEventInfo2.hashCode() == info2.hashCode());
+
+ assertTrue("hashCode", fEventInfo1.hashCode() != info2.hashCode());
+ assertTrue("hashCode", fEventInfo2.hashCode() != info1.hashCode());
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IDomainInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ISessionInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceSessionState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.SessionInfo;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
+import java.util.LinkedList;
+import java.util.List;
+
+import junit.framework.TestCase;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.SessionInfo;
+
+/**
+ * The class <code>ChannelInfoTest</code> contains tests for the class <code>{@link SessionInfo}</code>.
+ *
+ */
+@SuppressWarnings("nls")
+public class SessionInfoTest extends TestCase {
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private ISessionInfo fSessionInfo1 = null;
+ private ISessionInfo fSessionInfo2 = null;
+
+ private IDomainInfo fDomainInfo1 = null;
+ private IDomainInfo fDomainInfo2 = null;
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception
+ * if the initialization fails for some reason
+ *
+ */
+ @Override
+ public void setUp() {
+ ModelImplFactory factory = new ModelImplFactory();
+ fSessionInfo1 = factory.getSessionInfo1();
+ fDomainInfo1 = factory.getDomainInfo1();
+ fSessionInfo2 = factory.getSessionInfo2();
+ fDomainInfo2 = factory.getDomainInfo2();
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception
+ * if the clean-up fails for some reason
+ *
+ */
+ @Override
+ public void tearDown() {
+ }
+
+ // ------------------------------------------------------------------------
+ // Tests
+ // ------------------------------------------------------------------------
+
+ // ------------------------------------------------------------------------
+ // Constructors
+ // ------------------------------------------------------------------------
+
+ /**
+ * Run the ChannelInfo() constructor test.
+ *
+ */
+ public void testSessionInfo() {
+ ISessionInfo result = new SessionInfo("test");
+ assertNotNull(result);
+
+ assertEquals("test", result.getName());
+ assertEquals("", result.getSessionPath());
+ TraceSessionState state = result.getSessionState();
+ assertEquals("inactive", state.getInName());
+ assertEquals("INACTIVE", state.name());
+ assertEquals("INACTIVE", state.toString());
+ assertEquals(0, state.ordinal());
+ assertEquals(0, result.getDomains().length);
+ }
+
+ public void testSessionInfoCopy() {
+ SessionInfo sessionInfo = new SessionInfo((SessionInfo)fSessionInfo1);
+
+ assertEquals(sessionInfo.getName(), fSessionInfo1.getName());
+ assertEquals(sessionInfo.getSessionPath(), fSessionInfo1.getSessionPath());
+ assertEquals(sessionInfo.getSessionState(), fSessionInfo1.getSessionState());
+
+ IDomainInfo[] orignalDomains = fSessionInfo1.getDomains();
+ IDomainInfo[] resultDomains = sessionInfo.getDomains();
+ for (int i = 0; i < orignalDomains.length; i++) {
+ assertEquals(orignalDomains[i], resultDomains[i]);
+ }
+ }
+
+ public void testSessionCopy2() {
+ try {
+ SessionInfo session = null;
+ new SessionInfo(session);
+ fail("null copy");
+ }
+ catch (IllegalArgumentException e) {
+ // Success
+ }
+ }
+
+ /**
+ * Run the long getNumberOfSubBuffers() method test.
+ *
+ */
+ public void testGetAndSetters() {
+
+ // Note that addDomain() has been executed in setUp()
+ // check get method here
+ assertEquals(1, fSessionInfo1.getDomains().length);
+ assertNotNull(fSessionInfo1.getDomains()[0]);
+ assertEquals(fDomainInfo1, fSessionInfo1.getDomains()[0]);
+
+ ISessionInfo session = new SessionInfo("session");
+ List<IDomainInfo> list = new LinkedList<IDomainInfo>();
+ list.add(fDomainInfo1);
+ list.add(fDomainInfo2);
+ session.setDomains(list);
+
+ IDomainInfo[] result = session.getDomains();
+ assertEquals(2, result.length);
+ assertEquals(fDomainInfo1, result[0]);
+ assertEquals(fDomainInfo2, result[1]);
+
+ session.setSessionPath("/home/user");
+ assertEquals("/home/user", session.getSessionPath());
+
+ session.setSessionState("active");
+ TraceSessionState state = session.getSessionState();
+ state = session.getSessionState();
+ assertEquals("active", state.getInName());
+ assertEquals("ACTIVE", state.name());
+ assertEquals("ACTIVE", state.toString());
+ assertEquals(1, state.ordinal());
+
+ session.setSessionState("inactive");
+ state = session.getSessionState();
+ assertEquals("inactive", state.getInName());
+ assertEquals("INACTIVE", state.name());
+ assertEquals("INACTIVE", state.toString());
+ assertEquals(0, state.ordinal());
+
+ session.setSessionState("test");
+ state = session.getSessionState();
+ assertEquals("inactive", state.getInName());
+ assertEquals("INACTIVE", state.name());
+ assertEquals("INACTIVE", state.toString());
+ assertEquals(0, state.ordinal());
+
+ session.setSessionState(TraceSessionState.ACTIVE);
+ state = session.getSessionState();
+ assertEquals("active", state.getInName());
+ assertEquals("ACTIVE", state.name());
+ assertEquals("ACTIVE", state.toString());
+ assertEquals(1, state.ordinal());
+
+ session.setSessionState(TraceSessionState.INACTIVE);
+ state = session.getSessionState();
+ assertEquals("inactive", state.getInName());
+ assertEquals("INACTIVE", state.name());
+ assertEquals("INACTIVE", state.toString());
+ assertEquals(0, state.ordinal());
+ }
+
+ public void testToString_1() {
+ ISessionInfo fixture = new SessionInfo("sessionName");
+
+ String result = fixture.toString();
+
+ // add additional test code here
+ assertEquals("[SessionInfo([TraceInfo(Name=sessionName)],State=INACTIVE,Domains=)]", result);
+ }
+
+ /**
+ * Run the String toString() method test.
+ *
+ */
+ public void testToString_2() {
+ String result = fSessionInfo1.toString();
+
+ // add additional test code here
+ assertEquals("[SessionInfo([TraceInfo(Name=session1)],State=ACTIVE,Domains=[DomainInfo([TraceInfo(Name=test1)],Channels=[ChannelInfo([TraceInfo(Name=channel1)],State=DISABLED,OverwriteMode=true,SubBuffersSize=13,NumberOfSubBuffers=12,SwitchTimer=10,ReadTimer=11,output=splice(),Events=[EventInfo([BaseEventInfo([TraceInfo(Name=event1)],type=TRACEPOINT,level=TRACE_DEBUG)],State=ENABLED)])],isKernel=false)])]", result);
+ }
+
+ // ------------------------------------------------------------------------
+ // equals
+ // ------------------------------------------------------------------------
+
+ public void testEqualsReflexivity() {
+ assertTrue("equals", fSessionInfo1.equals(fSessionInfo1));
+ assertTrue("equals", fSessionInfo2.equals(fSessionInfo2));
+
+ assertTrue("equals", !fSessionInfo1.equals(fSessionInfo2));
+ assertTrue("equals", !fSessionInfo2.equals(fSessionInfo1));
+ }
+
+ public void testEqualsSymmetry() {
+ SessionInfo event1 = new SessionInfo((SessionInfo)fSessionInfo1);
+ SessionInfo event2 = new SessionInfo((SessionInfo)fSessionInfo2);
+
+ assertTrue("equals", event1.equals(fSessionInfo1));
+ assertTrue("equals", fSessionInfo1.equals(event1));
+
+ assertTrue("equals", event2.equals(fSessionInfo2));
+ assertTrue("equals", fSessionInfo2.equals(event2));
+ }
+
+ public void testEqualsTransivity() {
+ SessionInfo channel1 = new SessionInfo((SessionInfo)fSessionInfo1);
+ SessionInfo channel2 = new SessionInfo((SessionInfo)fSessionInfo1);
+ SessionInfo channel3 = new SessionInfo((SessionInfo)fSessionInfo1);
+
+ assertTrue("equals", channel1.equals(channel2));
+ assertTrue("equals", channel2.equals(channel3));
+ assertTrue("equals", channel1.equals(channel3));
+ }
+
+ public void testEqualsNull() throws Exception {
+ assertTrue("equals", !fSessionInfo1.equals(null));
+ assertTrue("equals", !fSessionInfo2.equals(null));
+ }
+
+ // ------------------------------------------------------------------------
+ // hashCode
+ // ------------------------------------------------------------------------
+
+ public void testHashCode() {
+ SessionInfo channel1 = new SessionInfo((SessionInfo)fSessionInfo1);
+ SessionInfo channel2 = new SessionInfo((SessionInfo)fSessionInfo2);
+
+ assertTrue("hashCode", fSessionInfo1.hashCode() == channel1.hashCode());
+ assertTrue("hashCode", fSessionInfo2.hashCode() == channel2.hashCode());
+
+ assertTrue("hashCode", fSessionInfo1.hashCode() != channel2.hashCode());
+ assertTrue("hashCode", fSessionInfo2.hashCode() != channel1.hashCode());
+ }}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ITraceInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceInfo;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
+import junit.framework.TestCase;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo;
+
+/**
+ * The class <code>TraceInfoTest</code> contains test for the class <code>{@link TraceInfo}</code>.
+ */
+@SuppressWarnings("nls")
+public class TraceInfoTest extends TestCase {
+
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private ITraceInfo fTraceInfo1 = null;
+ private ITraceInfo fTraceInfo2 = null;
+
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception if the initialization fails for some reason
+ *
+ */
+ @Override
+ public void setUp() throws Exception {
+ fTraceInfo1 = new TraceInfo("event1");
+ fTraceInfo2 = new TraceInfo("event2");
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception if the clean-up fails for some reason
+ *
+ */
+ @Override
+ public void tearDown() throws Exception {
+ }
+
+ // ------------------------------------------------------------------------
+ // Tests
+ // ------------------------------------------------------------------------
+
+ /**
+ * Run the BaseEventInfo() constructor test.
+ *
+ */
+ public void testTraceInfo() {
+ TraceInfo fixture = new TraceInfo("event");
+ assertNotNull(fixture);
+
+ assertEquals("event", fixture.getName());
+ }
+
+ /**
+ * Test Copy Constructor
+ */
+ public void testTraceInfo2() {
+ try {
+ String name = null;
+ new TraceInfo(name);
+ fail("null name in custructor");
+ }
+ catch (IllegalArgumentException e) {
+ // Success
+ }
+ }
+
+ /**
+ * Test Copy Constructor
+ */
+ public void testTraceInfoCopy() {
+ TraceInfo info = new TraceInfo((TraceInfo)fTraceInfo1);
+
+ assertEquals(fTraceInfo1.getName(), info.getName());
+ }
+
+ /**
+ * Test Copy Constructor
+ */
+ public void testTraceCopy2() {
+ try {
+ TraceInfo info = null;
+ new TraceInfo(info);
+ fail("null copy");
+ }
+ catch (IllegalArgumentException e) {
+ // Success
+ }
+ }
+
+ /**
+ * Run the void setEventType(String) method test.
+ *
+ */
+ public void testSetName() {
+ TraceInfo fixture = new TraceInfo("event");
+ fixture.setName("newName");
+ assertEquals("newName", fixture.getName());
+ }
+
+ /**
+ * Run the String toString() method test.
+ *
+ */
+ public void testToString_1() {
+ String result = fTraceInfo1.toString();
+
+ // add additional test code here
+ assertEquals("[TraceInfo(Name=event1)]", result);
+ }
+
+ // ------------------------------------------------------------------------
+ // equals
+ // ------------------------------------------------------------------------
+
+ public void testEqualsReflexivity() {
+ assertTrue("equals", fTraceInfo1.equals(fTraceInfo1));
+ assertTrue("equals", fTraceInfo2.equals(fTraceInfo2));
+
+ assertTrue("equals", !fTraceInfo1.equals(fTraceInfo2));
+ assertTrue("equals", !fTraceInfo2.equals(fTraceInfo1));
+ }
+
+ public void testEqualsSymmetry() {
+ TraceInfo info1 = new TraceInfo((TraceInfo)fTraceInfo1);
+ TraceInfo info2 = new TraceInfo((TraceInfo)fTraceInfo2);
+
+ assertTrue("equals", info1.equals(fTraceInfo1));
+ assertTrue("equals", fTraceInfo1.equals(info1));
+
+ assertTrue("equals", info2.equals(fTraceInfo2));
+ assertTrue("equals", fTraceInfo2.equals(info2));
+ }
+
+ public void testEqualsTransivity() {
+ TraceInfo info1 = new TraceInfo((TraceInfo)fTraceInfo1);
+ TraceInfo info2 = new TraceInfo((TraceInfo)fTraceInfo1);
+ TraceInfo info3 = new TraceInfo((TraceInfo)fTraceInfo1);
+
+ assertTrue("equals", info1.equals(info2));
+ assertTrue("equals", info2.equals(info3));
+ assertTrue("equals", info1.equals(info3));
+ }
+
+ public void testEqualsNull() {
+ assertTrue("equals", !fTraceInfo1.equals(null));
+ assertTrue("equals", !fTraceInfo2.equals(null));
+ }
+
+ // ------------------------------------------------------------------------
+ // hashCode
+ // ------------------------------------------------------------------------
+
+ public void testHashCode() {
+ TraceInfo info1 = new TraceInfo((TraceInfo)fTraceInfo1);
+ TraceInfo info2 = new TraceInfo((TraceInfo)fTraceInfo2);
+
+ assertTrue("hashCode", fTraceInfo1.hashCode() == info1.hashCode());
+ assertTrue("hashCode", fTraceInfo2.hashCode() == info2.hashCode());
+
+ assertTrue("hashCode", fTraceInfo1.hashCode() != info2.hashCode());
+ assertTrue("hashCode", fTraceInfo2.hashCode() != info1.hashCode());
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IBaseEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IUstProviderInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.UstProviderInfo;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.model.impl;
+
+import java.util.LinkedList;
+import java.util.List;
+
+import junit.framework.TestCase;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.UstProviderInfo;
+
+/**
+ * The class <code>ChannelInfoTest</code> contains tests for the class <code>{@link UstProviderInfo}</code>.
+ *
+ */
+@SuppressWarnings("nls")
+public class UstProviderInfoTest extends TestCase {
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private IUstProviderInfo fUstProviderInfo1 = null;
+ private IUstProviderInfo fUstProviderInfo2 = null;
+
+ private IBaseEventInfo fEventInfo1 = null;
+ private IBaseEventInfo fEventInfo2 = null;
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception
+ * if the initialization fails for some reason
+ *
+ */
+ @Override
+ public void setUp() {
+ ModelImplFactory factory = new ModelImplFactory();
+ fUstProviderInfo1 = factory.getUstProviderInfo1();
+ fUstProviderInfo2 = factory.getUstProviderInfo2();
+ fEventInfo1 = factory.getBaseEventInfo1();
+ fEventInfo1 = factory.getBaseEventInfo2();
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception
+ * if the clean-up fails for some reason
+ *
+ */
+ @Override
+ public void tearDown() {
+ }
+
+ // ------------------------------------------------------------------------
+ // Tests
+ // ------------------------------------------------------------------------
+
+ // ------------------------------------------------------------------------
+ // Constructors
+ // ------------------------------------------------------------------------
+
+ /**
+ * Run the UstProviderInfo() constructor test.
+ *
+ */
+ public void testUstProviderInfo() {
+ IUstProviderInfo result = new UstProviderInfo("test");
+ assertNotNull(result);
+
+ assertEquals("test", result.getName());
+ assertEquals(0, result.getPid());
+ assertEquals(0, result.getEvents().length);
+ }
+
+ public void testUstProviderInfoCopy() {
+ IUstProviderInfo providerInf = new UstProviderInfo((UstProviderInfo)fUstProviderInfo1);
+
+ assertEquals(fUstProviderInfo1.getName(), providerInf.getName());
+ assertEquals(fUstProviderInfo1.getPid(), providerInf.getPid());
+ assertEquals(fUstProviderInfo1.getEvents().length, providerInf.getEvents().length);
+
+ IBaseEventInfo[] orignalEvents = fUstProviderInfo1.getEvents();
+ IBaseEventInfo[] resultEvents = providerInf.getEvents();
+ for (int i = 0; i < orignalEvents.length; i++) {
+ assertEquals(orignalEvents[i], resultEvents[i]);
+ }
+ }
+
+ public void testUstProviderCopy2() {
+ try {
+ UstProviderInfo providerInfo = null;
+ new UstProviderInfo(providerInfo);
+ fail("null copy");
+ }
+ catch (IllegalArgumentException e) {
+ // Success
+ }
+ }
+
+ /**
+ * Run the IEventInfo[] getEvents() method test.
+ *
+ */
+ public void testGetAndSetters() {
+ IUstProviderInfo fixture = new UstProviderInfo("test");
+ fixture.setPid(2468);
+
+ // add an event
+ IBaseEventInfo event = new BaseEventInfo("event");
+ fixture.addEvent(event);
+
+ // Verify the stored events
+ IBaseEventInfo[] result = fixture.getEvents();
+
+ assertNotNull(result);
+ assertEquals(1, result.length);
+ assertNotNull(result[0]);
+ assertTrue(event.equals(result[0]));
+
+ assertEquals(2468, fixture.getPid());
+ }
+
+ /**
+ * Run the void setEvents(List<IBaseEventInfo>) method test.
+ *
+ */
+ public void testSetEvents_1() {
+ UstProviderInfo fixture = new UstProviderInfo("test");
+ fixture.setPid(2468);
+ List<IBaseEventInfo> events = new LinkedList<IBaseEventInfo>();
+ events.add(fEventInfo1);
+ events.add(fEventInfo2);
+ fixture.setEvents(events);
+
+ IBaseEventInfo[] infos = fixture.getEvents();
+
+ assertEquals(events.size(), infos.length);
+
+ for (int i = 0; i < infos.length; i++) {
+ assertEquals(events.get(i), infos[i]);
+ }
+ }
+
+ public void testToString_1() {
+ UstProviderInfo fixture = new UstProviderInfo("test");
+ fixture.setPid(2468);
+ String result = fixture.toString();
+
+ assertEquals("[EventInfo([TraceInfo(Name=test)],PID=2468,Events=None)]", result);
+ }
+
+ /**
+ * Run the String toString() method test.
+ *
+ */
+ public void testToString_2() {
+ String result = fUstProviderInfo2.toString();
+ assertEquals("[EventInfo([TraceInfo(Name=myUST2)],PID=2345,Events=[BaseEventInfo([TraceInfo(Name=event1)],type=UNKNOWN,level=TRACE_DEBUG)][BaseEventInfo([TraceInfo(Name=event2)],type=TRACEPOINT,level=TRACE_DEBUG)])]", result);
+ }
+
+ // ------------------------------------------------------------------------
+ // equals
+ // ------------------------------------------------------------------------
+
+ public void testEqualsReflexivity() {
+ assertTrue("equals", fUstProviderInfo1.equals(fUstProviderInfo1));
+ assertTrue("equals", fUstProviderInfo2.equals(fUstProviderInfo2));
+
+ assertTrue("equals", !fUstProviderInfo1.equals(fUstProviderInfo2));
+ assertTrue("equals", !fUstProviderInfo2.equals(fUstProviderInfo1));
+ }
+
+ public void testEqualsSymmetry() {
+ UstProviderInfo event1 = new UstProviderInfo((UstProviderInfo)fUstProviderInfo1);
+ UstProviderInfo event2 = new UstProviderInfo((UstProviderInfo)fUstProviderInfo2);
+
+ assertTrue("equals", event1.equals(fUstProviderInfo1));
+ assertTrue("equals", fUstProviderInfo1.equals(event1));
+
+ assertTrue("equals", event2.equals(fUstProviderInfo2));
+ assertTrue("equals", fUstProviderInfo2.equals(event2));
+ }
+
+ public void testEqualsTransivity() {
+ UstProviderInfo UstProvider1 = new UstProviderInfo((UstProviderInfo)fUstProviderInfo1);
+ UstProviderInfo UstProvider2 = new UstProviderInfo((UstProviderInfo)fUstProviderInfo1);
+ UstProviderInfo UstProvider3 = new UstProviderInfo((UstProviderInfo)fUstProviderInfo1);
+
+ assertTrue("equals", UstProvider1.equals(UstProvider2));
+ assertTrue("equals", UstProvider2.equals(UstProvider3));
+ assertTrue("equals", UstProvider1.equals(UstProvider3));
+ }
+
+ public void testEqualsNull() throws Exception {
+ assertTrue("equals", !fUstProviderInfo1.equals(null));
+ assertTrue("equals", !fUstProviderInfo2.equals(null));
+ }
+
+ // ------------------------------------------------------------------------
+ // hashCode
+ // ------------------------------------------------------------------------
+
+ public void testHashCode() {
+ UstProviderInfo UstProvider1 = new UstProviderInfo((UstProviderInfo)fUstProviderInfo1);
+ UstProviderInfo UstProvider2 = new UstProviderInfo((UstProviderInfo)fUstProviderInfo2);
+
+ assertTrue("hashCode", fUstProviderInfo1.hashCode() == UstProvider1.hashCode());
+ assertTrue("hashCode", fUstProviderInfo2.hashCode() == UstProvider2.hashCode());
+
+ assertTrue("hashCode", fUstProviderInfo1.hashCode() != UstProvider2.hashCode());
+ assertTrue("hashCode", fUstProviderInfo2.hashCode() != UstProvider1.hashCode());
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IBaseEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IDomainInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IEventInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.ISessionInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.IUstProviderInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.LogLevelType;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEnablement;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceEventType;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceLogLevel;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.TraceSessionState;
- import org.eclipse.linuxtools.lttng.ui.views.control.model.impl.ChannelInfo;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.ILttngControlService;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.LTTngControlService;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.ui.tests.control.service;
+
+import java.io.File;
+import java.net.URL;
+import java.util.ArrayList;
+import java.util.List;
+
+import junit.framework.TestCase;
+
+import org.eclipse.core.commands.ExecutionException;
+import org.eclipse.core.runtime.FileLocator;
+import org.eclipse.core.runtime.NullProgressMonitor;
+import org.eclipse.core.runtime.Path;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.ChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.LTTngControlService;
+import org.eclipse.linuxtools.lttng.stubs.service.CommandShellFactory;
+import org.eclipse.linuxtools.lttng.stubs.service.shells.LTTngToolsFileShell;
+import org.eclipse.linuxtools.lttng.ui.tests.LTTngUITestPlugin;
+/**
+ * The class <code>LTTngControlServiceTest</code> contains test for the class <code>{@link LTTngControlService}</code>.
+ */
+@SuppressWarnings("nls")
+public class LTTngControlServiceTest extends TestCase {
+
+ private static final String DIRECTORY = "testfiles";
+ private static final String TEST_STREAM = "LTTngServiceTest.cfg";
+
+ private static final String SCEN_LTTNG_NOT_INSTALLED = "LttngNotInstalled";
+ private static final String SCEN_NO_SESSION_AVAILABLE = "NoSessionAvailable";
+ private static final String SCEN_GET_SESSION_NAMES1 = "GetSessionNames1";
+ private static final String SCEN_GET_SESSION_NAME_NOT_EXIST = "GetSessionNameNotExist";
+ private static final String SCEN_GET_SESSION_GARBAGE_OUT = "GetSessionGarbageOut";
+ private static final String SCEN_GET_SESSION1 = "GetSession1";
+ private static final String SCEN_GET_KERNEL_PROVIDER1 = "GetKernelProvider1";
+ private static final String SCEN_GET_UST_PROVIDER1 = "GetUstProvider1";
+ private static final String SCEN_GET_UST_PROVIDER2 = "GetUstProvider2";
+ private static final String SCEN_CREATE_SESSION1 = "CreateSession1";
+ private static final String SCEN_CREATE_SESSION_VARIANTS = "CreateSessionVariants";
+ private static final String SCEN_DESTROY_SESSION1 = "DestroySession1";
+ private static final String SCEN_CHANNEL_HANDLING = "ChannelHandling";
+ private static final String SCEN_EVENT_HANDLING = "EventHandling";
+
+ // ------------------------------------------------------------------------
+ // Test data
+ // ------------------------------------------------------------------------
+ private CommandShellFactory fShellFactory;
+ private String fTestfile;
+ private LTTngToolsFileShell fShell;
+ private ILttngControlService fService;
+
+
+ // ------------------------------------------------------------------------
+ // Static methods
+ // ------------------------------------------------------------------------
+
+ // ------------------------------------------------------------------------
+ // Housekeeping
+ // ------------------------------------------------------------------------
+ /**
+ * Perform pre-test initialization.
+ *
+ * @throws Exception if the initialization fails for some reason
+ *
+ */
+ @Override
+ public void setUp() throws Exception {
+ super.setUp();
+ fShellFactory = CommandShellFactory.getInstance();
+
+ URL location = FileLocator.find(LTTngUITestPlugin.getDefault().getBundle(), new Path(DIRECTORY + File.separator + TEST_STREAM), null);
+ File testfile = new File(FileLocator.toFileURL(location).toURI());
+ fTestfile = testfile.getAbsolutePath();
+
+ fShell = fShellFactory.getFileShell();
+ fShell.loadScenarioFile(fTestfile);
+ fService = new LTTngControlService(fShell);
+ }
+
+ /**
+ * Perform post-test clean-up.
+ *
+ * @throws Exception if the clean-up fails for some reason
+ *
+ */
+ @Override
+ public void tearDown() throws Exception {
+ }
+
+ // ------------------------------------------------------------------------
+ // Test Cases
+ // ------------------------------------------------------------------------
+
+ public void testGetSessionNames() {
+ try {
+ fShell.setScenario(SCEN_LTTNG_NOT_INSTALLED);
+ fService.getSessionNames(new NullProgressMonitor());
+ fail("No exeption thrown");
+ } catch (ExecutionException e) {
+ // success
+ }
+ }
+
+ public void testGetSessionNames1() {
+ try {
+ fShell.setScenario(SCEN_NO_SESSION_AVAILABLE);
+ String[] result = fService.getSessionNames(new NullProgressMonitor());
+
+ assertNotNull(result);
+ assertEquals(0, result.length);
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testGetSessionNames2() {
+ try {
+ fShell.setScenario(SCEN_GET_SESSION_NAMES1);
+ String[] result = fService.getSessionNames(new NullProgressMonitor());
+
+ assertNotNull(result);
+ assertEquals(2, result.length);
+ assertEquals("mysession1", result[0]);
+ assertEquals("mysession", result[1]);
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testGetSessionNotExist() {
+ try {
+ fShell.setScenario(SCEN_GET_SESSION_NAME_NOT_EXIST);
+ fService.getSessionNames(new NullProgressMonitor());
+ fail("No exeption thrown");
+
+ } catch (ExecutionException e) {
+ // success
+ }
+ }
+
+ public void testGetSessionNameGarbage() {
+ try {
+ fShell.setScenario(SCEN_GET_SESSION_GARBAGE_OUT);
+ String[] result = fService.getSessionNames(new NullProgressMonitor());
+
+ assertNotNull(result);
+ assertEquals(0, result.length);
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testGetSession1() {
+ try {
+ fShell.setScenario(SCEN_GET_SESSION1);
+ ISessionInfo session = fService.getSession("mysession", new NullProgressMonitor());
+
+ // Verify Session
+ assertNotNull(session);
+ assertEquals("mysession", session.getName());
+ assertEquals("/home/user/lttng-traces/mysession-20120129-084256", session.getSessionPath());
+ assertEquals(TraceSessionState.ACTIVE, session.getSessionState());
+
+ IDomainInfo[] domains = session.getDomains();
+ assertNotNull(domains);
+ assertEquals(2, domains.length);
+
+ // Verify Kernel domain
+ assertEquals("Kernel", domains[0].getName());
+ IChannelInfo[] channels = domains[0].getChannels();
+ assertNotNull(channels);
+ assertEquals(2, channels.length);
+
+ // Verify Kernel's channel0
+ assertEquals("channel0", channels[0].getName());
+ assertEquals(4, channels[0].getNumberOfSubBuffers());
+ assertEquals("splice()", channels[0].getOutputType());
+ assertEquals(false, channels[0].isOverwriteMode());
+ assertEquals(200, channels[0].getReadTimer());
+ assertEquals(TraceEnablement.ENABLED, channels[0].getState());
+ assertEquals(262144, channels[0].getSubBufferSize());
+ assertEquals(0, channels[0].getSwitchTimer());
+
+ // Verify event info
+ IEventInfo[] channel0Events = channels[0].getEvents();
+ assertNotNull(channel0Events);
+ assertEquals(2, channel0Events.length);
+ assertEquals("block_rq_remap", channel0Events[0].getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, channel0Events[0].getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, channel0Events[0].getEventType());
+ assertEquals(TraceEnablement.ENABLED, channel0Events[0].getState());
+
+ assertEquals("block_bio_remap", channel0Events[1].getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, channel0Events[1].getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, channel0Events[1].getEventType());
+ assertEquals(TraceEnablement.DISABLED, channel0Events[1].getState());
+
+ // Verify Kernel's channel1
+ assertEquals("channel1", channels[1].getName());
+ assertEquals(4, channels[1].getNumberOfSubBuffers());
+ assertEquals("splice()", channels[1].getOutputType());
+ assertEquals(true, channels[1].isOverwriteMode());
+ assertEquals(400, channels[1].getReadTimer());
+ assertEquals(TraceEnablement.DISABLED, channels[1].getState());
+ assertEquals(524288, channels[1].getSubBufferSize());
+ assertEquals(100, channels[1].getSwitchTimer());
+
+ // Verify event info
+ IEventInfo[] channel1Events = channels[1].getEvents();
+ assertEquals(0, channel1Events.length);
+
+ // Verify domain UST global
+ assertEquals("UST global", domains[1].getName());
+
+ IChannelInfo[] ustChannels = domains[1].getChannels();
+
+ // Verify UST global's mychannel1
+ assertEquals("mychannel1", ustChannels[0].getName());
+ assertEquals(8, ustChannels[0].getNumberOfSubBuffers());
+ assertEquals("mmap()", ustChannels[0].getOutputType());
+ assertEquals(true, ustChannels[0].isOverwriteMode());
+ assertEquals(100, ustChannels[0].getReadTimer());
+ assertEquals(TraceEnablement.DISABLED, ustChannels[0].getState());
+ assertEquals(8192, ustChannels[0].getSubBufferSize());
+ assertEquals(200, ustChannels[0].getSwitchTimer());
+
+ // Verify event info
+ IEventInfo[] ustEvents = ustChannels[0].getEvents();
+ assertEquals(0, ustEvents.length);
+
+ // Verify UST global's channel0
+ assertEquals("channel0", ustChannels[1].getName());
+ assertEquals(4, ustChannels[1].getNumberOfSubBuffers());
+ assertEquals("mmap()", ustChannels[1].getOutputType());
+ assertEquals(false, ustChannels[1].isOverwriteMode());
+ assertEquals(200, ustChannels[1].getReadTimer());
+ assertEquals(TraceEnablement.ENABLED, ustChannels[1].getState());
+ assertEquals(4096, ustChannels[1].getSubBufferSize());
+ assertEquals(0, ustChannels[1].getSwitchTimer());
+
+ // Verify event info
+ ustEvents = ustChannels[1].getEvents();
+ assertEquals(2, ustEvents.length);
+
+ assertEquals("ust_tests_hello:tptest_sighandler", ustEvents[0].getName());
+ assertEquals(TraceLogLevel.TRACE_DEBUG_LINE, ustEvents[0].getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, ustEvents[0].getEventType());
+ assertEquals(TraceEnablement.DISABLED, ustEvents[0].getState());
+
+ assertEquals("*", ustEvents[1].getName());
+ assertEquals(TraceLogLevel.LEVEL_UNKNOWN, ustEvents[1].getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, ustEvents[1].getEventType());
+ assertEquals(TraceEnablement.ENABLED, ustEvents[1].getState());
+
+ // next session (no detailed information available)
+ session = fService.getSession("mysession1", new NullProgressMonitor());
+ assertNotNull(session);
+ assertEquals("mysession1", session.getName());
+ assertEquals("/home/user/lttng-traces/mysession1-20120203-133225", session.getSessionPath());
+ assertEquals(TraceSessionState.INACTIVE, session.getSessionState());
+
+ domains = session.getDomains();
+ assertNotNull(domains);
+ assertEquals(0, domains.length);
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testGetKernelProvider() {
+ try {
+ fShell.setScenario(SCEN_GET_KERNEL_PROVIDER1);
+ List<IBaseEventInfo> events = fService.getKernelProvider(new NullProgressMonitor());
+
+ // Verify event info
+ assertNotNull(events);
+ assertEquals(3, events.size());
+
+ IBaseEventInfo baseEventInfo = (IBaseEventInfo) events.get(0);
+ assertNotNull(baseEventInfo);
+ assertEquals("sched_kthread_stop", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ baseEventInfo = (IBaseEventInfo) events.get(1);
+ assertEquals("sched_kthread_stop_ret", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ baseEventInfo = (IBaseEventInfo) events.get(2);
+ assertEquals("sched_wakeup_new", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_EMERG, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testGetUstProvider() {
+ try {
+ fShell.setScenario(SCEN_GET_UST_PROVIDER1);
+ List<IUstProviderInfo> providers = fService.getUstProvider();
+
+ // Check all providers
+ assertNotNull(providers);
+ assertEquals(2, providers.size());
+
+ //Verify first provider
+ assertEquals("/home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello", providers.get(0).getName());
+ assertEquals(9379, providers.get(0).getPid());
+
+ // Verify event info
+ IBaseEventInfo[] events = providers.get(0).getEvents();
+ assertNotNull(events);
+ assertEquals(2, events.length);
+
+ IBaseEventInfo baseEventInfo = (IBaseEventInfo) events[0];
+ assertNotNull(baseEventInfo);
+ assertEquals("ust_tests_hello:tptest_sighandler", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_DEBUG_MODULE, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ baseEventInfo = (IBaseEventInfo) events[1];
+ assertEquals("ust_tests_hello:tptest", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_INFO, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ //Verify second provider
+ assertEquals("/home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello", providers.get(1).getName());
+ assertEquals(4852, providers.get(1).getPid());
+
+ // Verify event info
+ events = providers.get(1).getEvents();
+ assertNotNull(events);
+ assertEquals(2, events.length);
+
+ baseEventInfo = (IBaseEventInfo) events[0];
+ assertNotNull(baseEventInfo);
+ assertEquals("ust_tests_hello:tptest_sighandler", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_WARNING, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ baseEventInfo = (IBaseEventInfo) events[1];
+ assertEquals("ust_tests_hello:tptest", baseEventInfo.getName());
+ assertEquals(TraceLogLevel.TRACE_DEBUG_FUNCTION, baseEventInfo.getLogLevel());
+ assertEquals(TraceEventType.TRACEPOINT, baseEventInfo.getEventType());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testUstProvider2() {
+ try {
+ fShell.setScenario(SCEN_GET_UST_PROVIDER2);
+ List<IUstProviderInfo> providers = fService.getUstProvider();
+
+ assertNotNull(providers);
+ assertEquals(0, providers.size());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testCreateSession() {
+ try {
+ fShell.setScenario(SCEN_CREATE_SESSION1);
+
+ ISessionInfo info = fService.createSession("mysession2", null, new NullProgressMonitor());
+ assertNotNull(info);
+ assertEquals("mysession2", info.getName());
+ assertNotNull(info.getSessionPath());
+ assertTrue(info.getSessionPath().contains("mysession2"));
+ assertEquals(TraceSessionState.INACTIVE, info.getSessionState());
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testCreateSessionVariants() {
+
+ fShell.setScenario(SCEN_CREATE_SESSION_VARIANTS);
+
+ try {
+ fService.createSession("alreadyExist", null, new NullProgressMonitor());
+ fail("No exeption thrown");
+ } catch (ExecutionException e) {
+ // success
+ }
+
+ try {
+ fService.createSession("wrongName", null, new NullProgressMonitor());
+ fail("No exeption thrown");
+ } catch (ExecutionException e) {
+ // success
+ }
+
+ try {
+ fService.createSession("withPath", "/home/user/hallo", new NullProgressMonitor());
+ fail("No exeption thrown");
+ } catch (ExecutionException e) {
+ // success
+ }
+
+ try {
+ ISessionInfo info = fService.createSession("session with spaces", null, new NullProgressMonitor());
+ assertNotNull(info);
+ assertEquals("session with spaces", info.getName());
+ assertNotNull(info.getSessionPath());
+ assertTrue(info.getSessionPath().contains("session with spaces"));
+ assertEquals(TraceSessionState.INACTIVE, info.getSessionState());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+
+ try {
+ ISessionInfo info = fService.createSession("pathWithSpaces", "/home/user/hallo user/here", new NullProgressMonitor());
+ assertNotNull(info);
+ assertEquals("pathWithSpaces", info.getName());
+ assertNotNull(info.getSessionPath());
+ assertTrue(info.getSessionPath().contains("/home/user/hallo user/here"));
+ assertEquals(TraceSessionState.INACTIVE, info.getSessionState());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testDestroySession() {
+ try {
+ fShell.setScenario(SCEN_DESTROY_SESSION1);
+ fService.destroySession("mysession2", new NullProgressMonitor());
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testCreateChannel() {
+ try {
+
+ String sessionName = "mysession2";
+ List<String> list = new ArrayList<String>();
+ String kernelChannel0 = "mychannel0";
+ String kernelChannel1 = "mychannel1";
+ list.add(kernelChannel0);
+ list.add(kernelChannel1);
+
+ fShell.setScenario(SCEN_CHANNEL_HANDLING);
+
+ // Create/enable/configure 2 kernel channels
+ ChannelInfo chanInfo = new ChannelInfo("");
+ chanInfo.setOverwriteMode(true);
+ chanInfo.setSubBufferSize(16384);
+ chanInfo.setReadTimer(100);
+ chanInfo.setSwitchTimer(200);
+ chanInfo.setNumberOfSubBuffers(2);
+ fService.enableChannels(sessionName, list, true, chanInfo, new NullProgressMonitor());
+
+ // Create/enable/configure 1 UST channel
+ list.clear();
+ list.add("ustChannel");
+
+ chanInfo = new ChannelInfo("");
+ chanInfo.setOverwriteMode(true);
+ chanInfo.setSubBufferSize(32768);
+ chanInfo.setReadTimer(200);
+ chanInfo.setSwitchTimer(100);
+ chanInfo.setNumberOfSubBuffers(1);
+ fService.enableChannels(sessionName, list, false, chanInfo, new NullProgressMonitor());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testDisableChannel() {
+ try {
+
+ String sessionName = "mysession2";
+ List<String> list = new ArrayList<String>();
+ String kernelChannel0 = "mychannel0";
+ String kernelChannel1 = "mychannel1";
+ list.add(kernelChannel0);
+ list.add(kernelChannel1);
+
+ fShell.setScenario(SCEN_CHANNEL_HANDLING);
+ fService.disableChannels(sessionName, list, true, new NullProgressMonitor());
+
+ list.clear();
+ list.add("ustChannel");
+ fService.disableChannels(sessionName, list, false, new NullProgressMonitor());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testEnableChannel() {
+ try {
+
+ String sessionName = "mysession2";
+ List<String> list = new ArrayList<String>();
+ String kernelChannel0 = "mychannel0";
+ String kernelChannel1 = "mychannel1";
+ list.add(kernelChannel0);
+ list.add(kernelChannel1);
+
+ fShell.setScenario(SCEN_CHANNEL_HANDLING);
+ fService.enableChannels(sessionName, list, true, null, new NullProgressMonitor());
+
+ // Create/enable/configure 1 UST channel
+ list.clear();
+ list.add("ustChannel");
+
+ fService.enableChannels(sessionName, list, false, null, new NullProgressMonitor());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+// public void tesEnableChannelNoTracer() {
+// try {
+// ILttngControlService service = new LTTngControlService(fShellFactory.getShellForChannelNoTracer());
+// service.getSessionNames(new NullProgressMonitor());
+// fail("No exeption thrown");
+//
+// } catch (ExecutionException e) {
+// // success
+// }
+// }
+
+ public void testEnableEvents() {
+ try {
+ // 1) session name, channel = null, 3 event names, kernel
+ String sessionName = "mysession2";
+ List<String> list = new ArrayList<String>();
+ String eventName0 = "block_rq_remap";
+ String eventName1 = "block_bio_remap";
+ String eventName2 = "softirq_entry";
+ list.add(eventName0);
+ list.add(eventName1);
+ list.add(eventName2);
+ fShell.setScenario(SCEN_EVENT_HANDLING);
+ fService.enableEvents(sessionName, null, list, true, new NullProgressMonitor());
+
+ // 2) session name, channel=mychannel, event name= null, kernel
+ String channelName = "mychannel";
+ fService.enableEvents(sessionName, channelName, null, true, new NullProgressMonitor());
+
+ // 3) session name, channel=mychannel, 1 event name, ust
+ String ustEventName = "ust_tests_hello:tptest_sighandler";
+ list.clear();
+ list.add(ustEventName);
+ fService.enableEvents(sessionName, channelName, list, false, new NullProgressMonitor());
+
+ // 4) session name, channel = mychannel, no event name, ust
+ list.clear();
+ fService.enableEvents(sessionName, channelName, list, false, new NullProgressMonitor());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testEnableSyscalls() {
+ try {
+ // 1) session name, channel = null, 3 event names, kernel
+ String sessionName = "mysession2";
+ String channelName = "mychannel";
+
+ fShell.setScenario(SCEN_EVENT_HANDLING);
+
+ // 1) session name, channel = null
+ fService.enableSyscalls(sessionName, null, new NullProgressMonitor());
+
+ // 2) session name, channel = mychannel
+ fService.enableSyscalls(sessionName, channelName, new NullProgressMonitor());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testDynamicProbe() {
+ try {
+ // 1) session name, channel = null, 3 event names, kernel
+ String sessionName = "mysession2";
+ String channelName = "mychannel";
+ String eventName0 = "myevent0";
+ String eventName1 = "myevent1";
+ String functionProbe = "0xc0101340";
+ String dynProbe = "init_post";
+
+ fShell.setScenario(SCEN_EVENT_HANDLING);
+
+ // 1) session name, channel = null, event name, function probe, probe
+ fService.enableProbe(sessionName, null, eventName0, true, functionProbe, new NullProgressMonitor());
+
+ // 2) session name, channel = mychannel
+ fService.enableProbe(sessionName, channelName, eventName1, false, dynProbe, new NullProgressMonitor());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+ public void testEnableLogLevel() {
+ try {
+ // 1) session name, channel = null, 3 event names, kernel
+ String sessionName = "mysession2";
+ String channelName = "mychannel";
+ String eventName4 = "myevent4";
+ String eventName5 = "myevent5";
+
+ fShell.setScenario(SCEN_EVENT_HANDLING);
+
+ // 1) session name, channel = null, event name, loglevel-only, TRACE_DEBUG
+ fService.enableLogLevel(sessionName, null, eventName4, LogLevelType.LOGLEVEL_ONLY, TraceLogLevel.TRACE_DEBUG, new NullProgressMonitor());
+
+ // 2) session name, channel = mychannel, null, loglevel, TRACE_DEBUG_FUNCTION
+ fService.enableLogLevel(sessionName, channelName, eventName5, LogLevelType.LOGLEVEL, TraceLogLevel.TRACE_DEBUG_FUNCTION, new NullProgressMonitor());
+
+ } catch (ExecutionException e) {
+ fail(e.toString());
+ }
+ }
+
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.remote.IRemoteSystemProxy;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.ICommandShell;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.stubs.service;
+
+import org.eclipse.core.commands.ExecutionException;
+import org.eclipse.core.runtime.Status;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.remote.IRemoteSystemProxy;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandShell;
+import org.eclipse.linuxtools.lttng.stubs.service.shells.LTTngToolsFileShell;
+import org.eclipse.rse.core.model.IRSECallback;
+import org.eclipse.rse.core.subsystems.ICommunicationsListener;
+import org.eclipse.rse.core.subsystems.ISubSystem;
+import org.eclipse.rse.services.shells.IShellService;
+import org.eclipse.rse.services.terminals.ITerminalService;
+import org.eclipse.rse.subsystems.files.core.servicesubsystem.IFileServiceSubSystem;
+
+public class TestRemoteSystemProxy implements IRemoteSystemProxy {
+
+ private LTTngToolsFileShell fShell = null;
+ private String fTestFile = null;
+ private String fScenario = null;
+
+ @Override
+ public IShellService getShellService() {
+ return null;
+ }
+
+ @Override
+ public ITerminalService getTerminalService() {
+ return null;
+ }
+
+ @Override
+ public ISubSystem getShellServiceSubSystem() {
+ return null;
+ }
+
+ @Override
+ public ISubSystem getTerminalServiceSubSystem() {
+ return null;
+ }
+ @Override
+ public IFileServiceSubSystem getFileServiceSubSystem() {
+ return null;
+ }
+
+ @Override
+ public void connect(IRSECallback callback) throws ExecutionException {
+ if (callback != null) {
+ callback.done(Status.OK_STATUS, null);
+ }
+ }
+
+ @Override
+ public void disconnect() throws ExecutionException {
+ fShell = null;
+ }
+
+ @Override
+ public ICommandShell createCommandShell() throws ExecutionException {
+ if (fShell == null) {
+ fShell = CommandShellFactory.getInstance().getFileShell();
+ if ((fTestFile != null) && (fScenario != null)) {
+ try {
+ fShell.loadScenarioFile(fTestFile);
+ } catch (Exception e) {
+ throw new ExecutionException(e.toString());
+ }
+ fShell.setScenario(fScenario);
+ }
+ }
+ return fShell;
+ }
+
+ @Override
+ public void addCommunicationListener(ICommunicationsListener listener) {
+ }
+
+ @Override
+ public void removeCommunicationListener(ICommunicationsListener listener) {
+ }
+
+ public void setTestFile(String testFile) {
+ fTestFile = testFile;
+ }
+
+ public void setScenario(String scenario) {
+ fScenario = scenario;
+ if (fShell != null) {
+ fShell.setScenario(fScenario);
+ }
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.service.CommandResult;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.ICommandResult;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.stubs.service.shells;
+
+import java.io.BufferedReader;
+import java.io.DataInputStream;
+import java.io.FileInputStream;
+import java.io.InputStreamReader;
+import java.util.ArrayList;
+import java.util.Collection;
+import java.util.HashMap;
+import java.util.Iterator;
+import java.util.List;
+import java.util.Map;
+import java.util.regex.Matcher;
+import java.util.regex.Pattern;
+
+import org.eclipse.core.commands.ExecutionException;
+import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.CommandResult;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandResult;
+
+public class LTTngToolsFileShell extends TestCommandShell {
+
+ // ------------------------------------------------------------------------
+ // CONSTANTS
+ // ------------------------------------------------------------------------
+ private final static String SCENARIO_KEY = "<SCENARIO>"; //$NON-NLS-1$
+ private final static String SCENARIO_END_KEY = "</SCENARIO>"; //$NON-NLS-1$
+ private final static String INPUT_KEY = "<COMMAND_INPUT>"; //$NON-NLS-1$
+ private final static String INPUT_END_KEY = "</COMMAND_INPUT>"; //$NON-NLS-1$
+ private final static String RESULT_KEY = "<COMMAND_RESULT>"; //$NON-NLS-1$
+ @SuppressWarnings("unused")
+ private final static String RESULT_END_KEY = "</COMMAND_RESULT>"; //$NON-NLS-1$
+ private final static String OUTPUT_KEY = "<COMMAND_OUTPUT>"; //$NON-NLS-1$
+ private final static String OUTPUT_END_KEY = "</COMMAND_OUTPUT>"; //$NON-NLS-1$
+ private final static String COMMENT_KEY = "#.*"; //$NON-NLS-1$
+
+ private final static Pattern LTTNG_LIST_SESSION_PATTERN = Pattern.compile("lttng\\s+list\\s+(.+)"); //$NON-NLS-1$
+ private final static String LTTNG_LIST_PROVIDER_PATTERN = "lttng\\s+list\\s+(-u|-k)"; //$NON-NLS-1$
+
+ // ------------------------------------------------------------------------
+ // Attributes
+ // ------------------------------------------------------------------------
+ private String fScenariofile;
+ private String fScenario;
+
+ private Map<String, Map<String, ICommandResult>> fScenarioMap = new HashMap<String, Map<String, ICommandResult>>();
+ private Map<String, Integer> fSessionNameMap = new HashMap<String, Integer>();
+
+ /**
+ * Parse a scenario file with the format:
+ * <SCENARIO>
+ * ScenarioName
+ *
+ * <COMMAND_INPUT>
+ * Command
+ * </COMAND_INPUT>
+ *
+ * <COMMAND_RESULT>
+ * CommandResult
+ * </COMMAND_RESULT>
+ *
+ * <COMMAND_OUTPUT>
+ * CommandOutput
+ * </COMMAND_OUTPUT>
+ *
+ * </SCENARIO>
+ *
+ * Where: ScenarioName - is the scenario name
+ * Command - the command line string
+ * CommandResult - the result integer of the command (0 for success, 1 for failure)
+ * ComandOutput - the command output string (multi-line possible)
+ *
+ * Note: 1) There can be many scenarios per file
+ * 2) There can be many (Command-CommandResult-CommandOutput) triples per scenario
+ * 3) Lines starting with # will be ignored (comments)
+ *
+ * @param scenariofile - path to scenario file
+ * @throws Exception
+ */
+ public void loadScenarioFile(String scenariofile) throws Exception {
+ fScenariofile = scenariofile;
+
+ // clean up map
+ Collection<Map<String, ICommandResult>> values = fScenarioMap.values();
+ for (Iterator<Map<String, ICommandResult>> iterator = values.iterator(); iterator.hasNext();) {
+ Map<String, ICommandResult> map = (Map<String, ICommandResult>) iterator.next();
+ map.clear();
+ }
+ fScenarioMap.clear();
+
+ // load from file
+
+ // Open the file
+ FileInputStream fstream = new FileInputStream(fScenariofile);
+
+ // Get the object of DataInputStream
+ DataInputStream in = new DataInputStream(fstream);
+ BufferedReader br = new BufferedReader(new InputStreamReader(in));
+ String strLine;
+
+ // Read File Line by Line
+
+ // Temporary map for generating instance numbers for lttng list <session> commands.
+ // The numbers are per scenario.
+ Map<String, Integer> tmpSessionNameMap = new HashMap<String, Integer>();
+ while ((strLine = br.readLine()) != null) {
+
+ // Ignore comments
+ if(isComment(strLine)) {
+ continue;
+ }
+
+ if (SCENARIO_KEY.equals(strLine)) {
+ // scenario start
+
+ // Ignore comments
+ strLine = br.readLine();
+ while (isComment(strLine)) {
+ strLine = br.readLine();
+ }
+
+ String scenario = strLine;
+ Map<String, ICommandResult> commandMap = new HashMap<String, ICommandResult>();
+ fScenarioMap.put(scenario, commandMap);
+ List<String> output = null;
+ String input = null;
+ boolean inOutput = false;
+ int result = 0;
+ tmpSessionNameMap.clear();
+ while ((strLine = br.readLine()) != null) {
+ // Ignore comments
+ if(isComment(strLine)) {
+ continue;
+ }
+
+ if (SCENARIO_END_KEY.equals(strLine)) {
+ // Scenario is finished
+ break;
+ }
+ if (INPUT_KEY.equals(strLine)) {
+ strLine = br.readLine();
+ // Ignore comments
+ while (isComment(strLine)) {
+ strLine = br.readLine();
+ }
+ // Read command
+ input = strLine;
+
+ // Handle instances of 'lttng list <session"-comamand
+ Matcher matcher = LTTNG_LIST_SESSION_PATTERN.matcher(strLine);
+ if (matcher.matches() && !input.matches(LTTNG_LIST_PROVIDER_PATTERN)) {
+ String sessionName = matcher.group(1).trim();
+ Integer i = tmpSessionNameMap.get(sessionName);
+ if (i != null) {
+ i++;
+ } else {
+ i = 0;
+ }
+ tmpSessionNameMap.put(sessionName, i);
+ input += String.valueOf(i);
+ }
+ } else if (INPUT_END_KEY.equals(strLine)) {
+ // Initialize output array
+ output = new ArrayList<String>();
+ } else if (RESULT_KEY.equals(strLine)) {
+ strLine = br.readLine();
+ // Ignore comments
+ while (isComment(strLine)) {
+ strLine = br.readLine();
+ }
+ // Save result value
+ result = Integer.parseInt(strLine);
+ } else if (OUTPUT_END_KEY.equals(strLine)) {
+ // Save output/result in command map
+ commandMap.put(input, new CommandResult(result, output.toArray(new String[output.size()])));
+ inOutput = false;
+ } else if (OUTPUT_KEY.equals(strLine)) {
+ // first line of output
+ inOutput = true;
+ strLine = br.readLine();
+
+ // Ignore comments
+ while (isComment(strLine)) {
+ strLine = br.readLine();
+ }
+ output.add(strLine);
+ } else if (inOutput) {
+ // subsequent lines of output
+ output.add(strLine);
+ }
+// else {
+// if (RESULT_END_KEY.equals(strLine)) {
+ // nothing to do
+// }
+ }
+ }
+ }
+ //Close the input stream
+ in.close();
+ }
+
+ // Set the scenario to consider in executeCommand()
+ public synchronized void setScenario(String scenario) {
+ fScenario = scenario;
+ fSessionNameMap.clear();
+ if (!fScenarioMap.containsKey(fScenario)) {
+ throw new IllegalArgumentException();
+ }
+ }
+
+ /*
+ * (non-Javadoc)
+ * @see org.eclipse.linuxtools.lttng.stubs.service.shells.TestCommandShell#executeCommand(java.lang.String, org.eclipse.core.runtime.IProgressMonitor, boolean)
+ */
+ @SuppressWarnings("nls")
+ @Override
+ public ICommandResult executeCommand(String command, IProgressMonitor monitor, boolean checkReturnValue) throws ExecutionException {
+ Map<String, ICommandResult> commands = fScenarioMap.get(fScenario);
+
+ Matcher matcher = LTTNG_LIST_SESSION_PATTERN.matcher(command);
+ if (matcher.matches() && !command.matches(LTTNG_LIST_PROVIDER_PATTERN)) {
+ String sessionName = matcher.group(1).trim();
+ Integer i = fSessionNameMap.get(sessionName);
+ if (i != null) {
+ i++;
+ } else {
+ i = 0;
+ }
+ fSessionNameMap.put(sessionName, i);
+ command += String.valueOf(i);
+ }
+
+ if (commands.containsKey(command)) {
+ return commands.get(command);
+ }
+
+ String[] output = new String[1];
+ output[0] = String.valueOf("Command not found");
+ return new CommandResult(1, output);
+ }
+
+ // ------------------------------------------------------------------------
+ // Helper methods
+ // ------------------------------------------------------------------------
+ private boolean isComment(String line) {
+ return line.matches(COMMENT_KEY);
+ }
+}
--- /dev/null
- import org.eclipse.linuxtools.lttng.ui.views.control.service.CommandResult;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.ICommandResult;
- import org.eclipse.linuxtools.lttng.ui.views.control.service.ICommandShell;
+/**********************************************************************
+ * Copyright (c) 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Bernd Hufmann - Initial API and implementation
+ **********************************************************************/
+package org.eclipse.linuxtools.lttng.stubs.service.shells;
+
+import org.eclipse.core.commands.ExecutionException;
+import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.CommandResult;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandResult;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandShell;
+
+public class TestCommandShell implements ICommandShell {
+
+ protected boolean fIsConnected = false;
+
+ @Override
+ public void connect() throws ExecutionException {
+ fIsConnected = true;
+ }
+
+ @Override
+ public void disconnect() {
+ fIsConnected = false;
+ }
+
+ @Override
+ public ICommandResult executeCommand(String command, IProgressMonitor monitor) throws ExecutionException {
+ return executeCommand(command, monitor, true);
+ }
+
+ @Override
+ public ICommandResult executeCommand(String command, IProgressMonitor monitor, boolean checkReturnValue) throws ExecutionException {
+ if (fIsConnected) {
+
+ }
+ return new CommandResult(0, new String[0]);
+ }
+}
Bundle-RequiredExecutionEnvironment: JavaSE-1.6
Bundle-ActivationPolicy: lazy
Bundle-Localization: plugin
- Export-Package: org.eclipse.linuxtools.lttng.ui;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.model.trange;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.tracecontrol;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.tracecontrol.actions;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.tracecontrol.connectorservice;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.tracecontrol.dialogs;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.tracecontrol.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.tracecontrol.model.config;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.tracecontrol.subsystems;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.tracecontrol.utility;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.tracecontrol.wizards;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.common;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.control;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.control.dialogs,
- org.eclipse.linuxtools.lttng.ui.views.control.handlers,
- org.eclipse.linuxtools.lttng.ui.views.control.model,
- org.eclipse.linuxtools.lttng.ui.views.control.model.impl,
- org.eclipse.linuxtools.lttng.ui.views.control.property,
- org.eclipse.linuxtools.lttng.ui.views.control.remote,
- org.eclipse.linuxtools.lttng.ui.views.control.service,
- org.eclipse.linuxtools.lttng.ui.views.controlflow;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.controlflow.evProcessor;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.controlflow.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.distribution.model,
- org.eclipse.linuxtools.lttng.ui.views.events;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.latency;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.latency.dialogs;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.latency.listeners;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.latency.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.resources;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.resources.evProcessor;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.resources.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.statistics;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.statistics.evProcessor;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.statistics.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
- org.eclipse.linuxtools.lttng.ui.views.timeframe;x-friends:="org.eclipse.linuxtools.lttng.ui.tests"
+ Export-Package: org.eclipse.linuxtools.internal.lttng.ui;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.model.trange;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.tracecontrol;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.actions;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.connectorservice;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.dialogs;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.model.config;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.subsystems;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.utility;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.wizards;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.common;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.control;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
++ org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
++ org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
++ org.eclipse.linuxtools.internal.lttng.ui.views.control.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
++ org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
++ org.eclipse.linuxtools.internal.lttng.ui.views.control.property;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
++ org.eclipse.linuxtools.internal.lttng.ui.views.control.remote;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
++ org.eclipse.linuxtools.internal.lttng.ui.views.control.service;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.controlflow;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.controlflow.evProcessor;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.controlflow.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.distribution.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.events;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.latency;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.latency.dialogs;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.latency.listeners;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.latency.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.resources;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.resources.evProcessor;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.resources.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.statistics;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.statistics.evProcessor;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.statistics.model;x-friends:="org.eclipse.linuxtools.lttng.ui.tests",
+ org.eclipse.linuxtools.internal.lttng.ui.views.timeframe;x-friends:="org.eclipse.linuxtools.lttng.ui.tests"
++
<view
allowMultiple="false"
category="org.eclipse.linuxtools.lttng.ui.views.category"
- class="org.eclipse.linuxtools.lttng.ui.views.control.ControlView"
+ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView"
icon="icons/eview16/control_view.gif"
-- id="org.eclipse.linuxtools.lttng.ui.views.control"
++ id="org.eclipse.linuxtools.internal.lttng.ui.views.control"
name="%control.view.name"
restorable="true">
</view>
visible="true">
</actionSet>
</extension>
- id="org.eclipse.linuxtools.lttng.ui.commands.control.category"
+ <extension
+ point="org.eclipse.ui.commands">
+ <category
+ description="%commands.control.category.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ name="%commands.control.category">
+ </category>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.newConnection"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.new.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.newConnection"
+ name="%commands.control.new">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.connect"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.connect.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.connect"
+ name="%commands.control.connect">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.disconnect"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.disconnect.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disconnect"
+ name="%commands.control.disconnect">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.refresh"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.refresh.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.refresh"
+ name="%commands.control.refresh">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.delete"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.delete.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.delete"
+ name="%commands.control.delete">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.createSession"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.create.session.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.createSession"
+ name="%commands.control.create.session">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.destroySession"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.destroy.session.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.destroySession"
+ name="%commands.control.destroy.session">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.createChannelOnSession"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.create.channel.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.createChannelOnSession"
+ name="%commands.control.create.channel">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.createChannelOnDomain"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.create.channel.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.createChannelOnDomain"
+ name="%commands.control.create.channel">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.enableChannel"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.enable.channel.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enableChannel"
+ name="%commands.control.enable.channel">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.disableChannel"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.disable.channel.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disableChannel"
+ name="%commands.control.disable.channel">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.start"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.start.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.start"
+ name="%commands.control.start">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.stop"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.stop.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.stop"
+ name="%commands.control.stop">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.assign.event"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.enable.assign.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.assign.event"
+ name="%commands.control.enable.event">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.enable.event"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.enable.event.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.event"
+ name="%commands.control.enable.event">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.disable.event"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.disable.event.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disable.event"
+ name="%commands.control.disable.event">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.enable.eventOnChannel"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.enable.event.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.eventOnChannel"
+ name="%commands.control.enable.event">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.enable.eventOnDomain"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.enable.eventOnDomain.description"
- categoryId="org.eclipse.linuxtools.lttng.ui.commands.control.category"
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.eventOnDomain"
+ name="%commands.control.enable.eventOnDomain">
+ </command>
+ <command
- id="org.eclipse.linuxtools.lttng.ui.commands.control.enable.eventOnSession"
++ categoryId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.category"
+ description="%commands.control.enable.eventOnDomain.description"
- locationURI="toolbar:org.eclipse.linuxtools.lttng.ui.views.control">
++ id="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.eventOnSession"
+ name="%commands.control.enable.eventOnDomain">
+ </command>
+
+ </extension>
+ <extension
+ point="org.eclipse.ui.menus">
+ <menuContribution
+ allPopups="false"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.newConnection"
++ locationURI="toolbar:org.eclipse.linuxtools.internal.lttng.ui.views.control">
+ <command
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.connect"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.newConnection"
+ icon="icons/elcl16/target_add.gif"
+ label="%commands.control.new"
+ style="push">
+ </command>
+ <command
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.disconnect"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.connect"
+ icon="icons/elcl16/connect.gif"
+ label="%commands.control.connect"
+ style="push">
+ </command>
+ <command
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.refresh"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disconnect"
+ icon="icons/elcl16/disconnect.gif"
+ label="%commands.control.disconnect"
+ style="push">
+ </command>
+ <command
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.delete"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.refresh"
+ icon="icons/elcl16/refresh.gif"
+ label="%commands.control.refresh"
+ style="push">
+ </command>
+ <command
- name="org.eclipse.linuxtools.lttng.ui.views.control.toolbar.separator1"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.delete"
+ icon="icons/elcl16/target_delete.gif"
+ label="%commands.control.delete"
+ style="push">
+ </command>
+ <separator
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.start"
++ name="org.eclipse.linuxtools.internal.lttng.ui.views.control.toolbar.separator1"
+ visible="true">
+ </separator>
+ <command
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.stop"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.start"
+ icon="icons/elcl16/start_trace.gif"
+ label="%commands.control.start"
+ style="push">
+ </command>
+ <command
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.destroySession"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.stop"
+ icon="icons/elcl16/pause_trace.gif"
+ label="%commands.control.stop"
+ style="push">
+ </command>
+ <command
- locationURI="popup:org.eclipse.linuxtools.lttng.ui.views.control">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.destroySession"
+ icon="icons/elcl16/delete_trace.gif"
+ label="%commands.control.destroy.session"
+ style="push">
+ </command>
+
+ </menuContribution>
+ <menuContribution
+ allPopups="false"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.connect"
++ locationURI="popup:org.eclipse.linuxtools.internal.lttng.ui.views.control">
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TargetNodeComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.connect"
+ icon="icons/elcl16/connect.gif"
+ label="%commands.control.connect"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.disconnect"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TargetNodeComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disconnect"
+ icon="icons/elcl16/disconnect.gif"
+ label="%commands.control.disconnect"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.refresh"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceControlComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.refresh"
+ icon="icons/elcl16/refresh.gif"
+ label="%commands.control.refresh"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.delete"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TargetNodeComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.delete"
+ icon="icons/elcl16/target_delete.gif"
+ label="%commands.control.delete"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.createSession"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionGroup">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.createSession"
+ icon="icons/elcl16/add_button.gif"
+ label="%commands.control.create.session"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.start"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionGroup">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.start"
+ icon="icons/elcl16/start_trace.gif"
+ label="%commands.control.start"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.stop"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.stop"
+ icon="icons/elcl16/pause_trace.gif"
+ label="%commands.control.stop"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.destroySession"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.destroySession"
+ icon="icons/elcl16/delete_trace.gif"
+ label="%commands.control.destroy.session"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- name="org.eclipse.linuxtools.lttng.ui.views.control.popup.separator1"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+ <separator
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.createChannelOnSession"
++ name="org.eclipse.linuxtools.internal.lttng.ui.views.control.popup.separator1"
+ visible="true">
+ </separator>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.createChannelOnSession"
+ icon="icons/elcl16/add_button.gif"
+ label="%commands.control.create.channel"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <and>
+ <iterate
+ operator="or">
+ <instanceof
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceDomainComponent">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ <not>
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enable.eventOnSession"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent">
+ </instanceof>
+ </iterate>
+ </not>
+ <count
+ value="1">
+ </count>
+ </and>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.eventOnSession"
+ icon="icons/elcl16/edit.gif"
+ label="%commands.control.enable.eventOnDomain"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <and>
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.createChannelOnDomain"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ <count
+ value="1">
+ </count>
+ </and>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceDomainComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.createChannelOnDomain"
+ icon="icons/elcl16/add_button.gif"
+ label="%commands.control.create.channel"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <and>
+ <iterate
+ operator="or">
+ <instanceof
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent">
+ </instanceof>
+ </iterate>
+ <not>
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enable.eventOnDomain"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ </not>
+ <count
+ value="1">
+ </count>
+ </and>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceDomainComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.eventOnDomain"
+ icon="icons/elcl16/edit.gif"
+ label="%commands.control.enable.eventOnDomain"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <and>
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enableChannel"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent">
+ </instanceof>
+ </iterate>
+ <count
+ value="1">
+ </count>
+ </and>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceChannelComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enableChannel"
+ icon="icons/elcl16/edit.gif"
+ label="%commands.control.enable.channel"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.disableChannel"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceChannelComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disableChannel"
+ icon="icons/elcl16/edit.gif"
+ label="%commands.control.disable.channel"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.assign.event"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.assign.event"
+ icon="icons/elcl16/edit.gif"
+ label="%commands.control.enable.event"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enable.event"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceEventComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.event"
+ icon="icons/elcl16/edit.gif"
+ label="%commands.control.enable.event"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.disable.event"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceEventComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disable.event"
+ icon="icons/elcl16/edit.gif"
+ label="%commands.control.disable.event"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <iterate
+ operator="or">
+ <instanceof
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enable.eventOnChannel"
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </visibleWhen>
+ </command>
+
+ <command
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceChannelComponent">
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.eventOnChannel"
+ icon="icons/elcl16/edit.gif"
+ label="%commands.control.enable.event"
+ style="push">
+ <visibleWhen
+ checkEnabled="false">
+ <with
+ variable="activeMenuSelection">
+ <and>
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.NewConnectionHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.newConnection">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent">
+ </instanceof>
+ </iterate>
+ <count
+ value="1">
+ </count>
+ </and>
+ </with>
+ </visibleWhen>
+ </command>
+
+
+
+ </menuContribution>
+
+ </extension>
+ <extension
+ point="org.eclipse.ui.handlers">
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.ControlView">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.NewConnectionHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.newConnection">
+ <activeWhen>
+ <with
+ variable="activePart">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.ConnectHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.connect">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView">
+ </instanceof>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TargetNodeComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.ConnectHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.connect">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.DisconnectHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.disconnect">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TargetNodeComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.DisconnectHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disconnect">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.RefreshHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.refresh">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceControlComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.RefreshHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.refresh">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.DeleteHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.delete">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TargetNodeComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.DeleteHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.delete">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.CreateSessionHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.createSession">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionGroup">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.CreateSessionHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.createSession">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.DestroySessionHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.destroySession">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionGroup">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.DestroySessionHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.destroySession">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.CreateChannelOnSessionHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.createChannelOnSession">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.CreateChannelOnSessionHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.createChannelOnSession">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.CreateChannelOnDomainHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.createChannelOnDomain">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceDomainComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.CreateChannelOnDomainHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.createChannelOnDomain">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.EnableChannelHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enableChannel">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceChannelComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.EnableChannelHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enableChannel">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.DisableChannelHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.disableChannel">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceChannelComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.DisableChannelHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disableChannel">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.StartHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.start">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.StartHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.start">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.StopHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.stop">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.StopHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.stop">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.AssignEventHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.assign.event">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.BaseEventComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.AssignEventHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.assign.event">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.EnableEventHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enable.event">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceEventComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.EnableEventHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.event">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.DisableEventHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.disable.event">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceEventComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.DisableEventHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.disable.event">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.EnableEventOnChannelHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enable.eventOnChannel">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceChannelComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.EnableEventOnChannelHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.eventOnChannel">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.EnableEventOnDomainHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enable.eventOnDomain">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceDomainComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.EnableEventOnDomainHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.eventOnDomain">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
- class="org.eclipse.linuxtools.lttng.ui.views.control.handlers.EnableEventOnSessionHandler"
- commandId="org.eclipse.linuxtools.lttng.ui.commands.control.enable.eventOnSession">
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ <handler
- value="org.eclipse.linuxtools.lttng.ui.views.control.model.impl.TraceSessionComponent">
++ class="org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.EnableEventOnSessionHandler"
++ commandId="org.eclipse.linuxtools.internal.lttng.ui.commands.control.enable.eventOnSession">
+ <activeWhen>
+ <with
+ variable="selection">
+ <iterate
+ operator="or">
+ <instanceof
++ value="org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent">
+ </instanceof>
+ </iterate>
+ </with>
+ </activeWhen>
+ </handler>
+ </extension>
<!-- ======================================= -->
<!-- SubSystem Configuration -->
description="%lttng.rse.subsystem.type.description"
icon="icons/obj16/systemlttng.gif"
iconLive="icons/obj16/systemlttng-live.gif"
- id="org.eclipse.linuxtools.lttng.ui.tracecontrol.systemType"
+ id="org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.systemType"
label="%lttng.rse.subsystem.type.name"
- name="org.eclipse.linuxtools.lttng.ui.tracecontrol.systemType"
- subsystemConfigurationIds="org.eclipse.linuxtools.lttng.ui.tracecontrol.subsystems.TraceSubSystemConfiguration;org.eclipse.tm.tcf.rse.Processes;org.eclipse.tm.tcf.rse.Shells;org.eclipse.tm.tcf.rse.Files;org.eclipse.tm.tcf.rse.Terminals">
+ name="org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.systemType"
+ subsystemConfigurationIds="org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.subsystems.TraceSubSystemConfiguration;org.eclipse.tm.tcf.rse.Processes;org.eclipse.tm.tcf.rse.Shells;org.eclipse.tm.tcf.rse.Files;org.eclipse.tm.tcf.rse.Terminals">
</systemType>
- id="org.eclipse.linuxtools.lttng.ui.control.systemType"
+ <systemType
+ description="%trace.control.rse.system.type.description"
+ icon="icons/obj16/systemlttng2.gif"
+ iconLive="icons/obj16/systemlttng2-live.gif"
- name="org.eclipse.linuxtools.lttng.ui.control.systemType"
++ id="org.eclipse.linuxtools.internal.lttng.ui.control.systemType"
+ label="%trace.control.rse.system.type.name"
++ name="org.eclipse.linuxtools.internal.lttng.ui.control.systemType"
+ subsystemConfigurationIds="ssh.shells;ssh.files;ssh.terminals;processes.shell.linux">
+ </systemType>
</extension>
<!-- ======================================= -->
--- /dev/null
+ /*******************************************************************************
+ * Copyright (c) 2009, 2010 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Francois Chouinard - Initial API and implementation
+ * Bernd Hufmann - Updated for LTTng trace control
+ *
+ *******************************************************************************/
+
+ package org.eclipse.linuxtools.internal.lttng.ui;
+
++import java.net.URL;
+ import java.util.concurrent.ExecutionException;
+ import java.util.concurrent.TimeoutException;
+
+ import org.eclipse.core.runtime.IAdapterManager;
+ import org.eclipse.core.runtime.Platform;
++import org.eclipse.jface.resource.ImageDescriptor;
+ import org.eclipse.linuxtools.internal.lttng.core.tracecontrol.model.ProviderResource;
+ import org.eclipse.linuxtools.internal.lttng.core.tracecontrol.model.TargetResource;
+ import org.eclipse.linuxtools.internal.lttng.core.tracecontrol.model.TraceResource;
+ import org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.Messages;
+ import org.eclipse.linuxtools.internal.lttng.ui.tracecontrol.model.TraceAdapterFactory;
+ import org.eclipse.rse.services.clientserver.messages.SimpleSystemMessage;
+ import org.eclipse.rse.services.clientserver.messages.SystemMessage;
+ import org.eclipse.rse.ui.SystemBasePlugin;
++import org.eclipse.swt.graphics.Image;
+ import org.osgi.framework.BundleContext;
+
+ /**
+ * The activator class controls the plug-in life cycle
+ */
+ public class Activator extends SystemBasePlugin {
+
+ // The plug-in ID
+ public static final String PLUGIN_ID = "org.eclipse.linuxtools.lttng.ui"; //$NON-NLS-1$
+
+ // Icon names
+ public static final String ICON_ID_PROVIDER = "ICON_ID_PROVIDER"; //$NON-NLS-1$
+ public static final String ICON_ID_TARGET = "ICON_ID_TARGET"; //$NON-NLS-1$
+ public static final String ICON_ID_TRACE = "ICON_ID_TRACE"; //$NON-NLS-1$
+ public static final String ICON_ID_NEW_TRACE = "ICON_ID_NEW_TRACE"; //$NON-NLS-1$
+ public static final String ICON_ID_CONFIG_MARKERS = "ICON_ID_CONFIG_MARKERS"; //$NON-NLS-1$
+ public static final String ICON_ID_CONFIG_TRACE = "ICON_ID_CONFIG_TRACE"; //$NON-NLS-1$
+ public static final String ICON_ID_CHECKED = "ICON_ID_CHECKED"; //$NON-NLS-1$
+ public static final String ICON_ID_UNCHECKED = "ICON_ID_UNCHECKED"; //$NON-NLS-1$
+ public static final String ICON_ID_IMPORT_TRACE = "ICON_ID_IMPORT_TRACE"; //$NON-NLS-1$
+ public static final String ICON_ID_EDIT = "ICON_ID_EDIT"; //$NON-NLS-1$
+
+ // The shared instance
+ private static Activator plugin;
+
+ /**
+ * The constructor
+ */
+ public Activator() {
+ }
+
+ /*
+ * (non-Javadoc)
+ * @see org.eclipse.ui.plugin.AbstractUIPlugin#start(org.osgi.framework.BundleContext)
+ */
+ @Override
+ public void start(BundleContext context) throws Exception {
+ super.start(context);
+ TraceDebug.init();
+
+ // Trace control initialization
+ IAdapterManager manager = Platform.getAdapterManager();
+ TraceAdapterFactory factory = new TraceAdapterFactory();
+ manager.registerAdapters(factory, ProviderResource.class);
+ manager.registerAdapters(factory, TargetResource.class);
+ manager.registerAdapters(factory, TraceResource.class);
+
+ // Assign shared instance
+ plugin = this;
+ }
+
+ /*
+ * (non-Javadoc)
+ * @see org.eclipse.ui.plugin.AbstractUIPlugin#stop(org.osgi.framework.BundleContext)
+ */
+ @Override
+ public void stop(BundleContext context) throws Exception {
+ TraceDebug.stop();
+ plugin = null;
+ super.stop(context);
+ }
+
+ /**
+ * Returns the shared instance
+ *
+ * @return the shared instance
+ */
+ public static Activator getDefault() {
+ return plugin;
+ }
+
+ /**
+ * Create a System Message for given throwable
+ *
+ * @param x - The throwable the message is for
+ * @return
+ */
+ public SystemMessage getMessage(Throwable x) {
+ String msg = x.getMessage();
+ if (msg == null) {
+ msg = ""; //$NON-NLS-1$
+ }
+ if ((x instanceof ExecutionException) && (((ExecutionException)x).getCause() != null)) {
+ msg += " (" + ((ExecutionException)x).getCause().getMessage() + ")"; //$NON-NLS-1$ //$NON-NLS-2$
+ }
+ if (x instanceof TimeoutException) {
+ msg += " (" + Messages.Ltt_TimeoutMsg + ")"; //$NON-NLS-1$ //$NON-NLS-2$
+ }
+ return new SimpleSystemMessage(PLUGIN_ID, SystemMessage.ERROR, msg, x);
+ }
+
+ /*
+ * (non-Javadoc)
+ * @see org.eclipse.rse.ui.SystemBasePlugin#initializeImageRegistry()
+ */
+ @Override
+ protected void initializeImageRegistry() {
+ String path = getIconPath();
+ putImageInRegistry(ICON_ID_PROVIDER, path + "obj16/providers.gif"); //$NON-NLS-1$
+ putImageInRegistry(ICON_ID_TARGET, path + "obj16/targets.gif"); //$NON-NLS-1$
+ putImageInRegistry(ICON_ID_TRACE, path + "obj16/trace.gif"); //$NON-NLS-1$
+ putImageInRegistry(ICON_ID_NEW_TRACE, path + "elcl16/new_trace.gif"); //$NON-NLS-1$
+ putImageInRegistry(ICON_ID_CONFIG_MARKERS, path + "elcl16/configure_markers.gif"); //$NON-NLS-1$
+ putImageInRegistry(ICON_ID_CONFIG_TRACE, path + "elcl16/configure_trace.gif"); //$NON-NLS-1$
+ putImageInRegistry(ICON_ID_CHECKED, path + "elcl16/checked.gif"); //$NON-NLS-1$
+ putImageInRegistry(ICON_ID_UNCHECKED, path + "elcl16/unchecked.gif"); //$NON-NLS-1$
+ putImageInRegistry(ICON_ID_IMPORT_TRACE, path + "elcl16/import_trace.gif"); //$NON-NLS-1$
+ putImageInRegistry(ICON_ID_EDIT, path + "elcl16/edit.gif"); //$NON-NLS-1$
+ }
++
++ /**
++ * Loads the image in the plug-ins image registry (if necessary) and returns the image
++ * @param url - URL relative to the Bundle
++ * @return the image
++ */
++ public Image loadIcon(String url) {
++ String key = plugin.getBundle().getSymbolicName() + "/" + url; //$NON-NLS-1$
++ Image icon = plugin.getImageRegistry().get(key);
++ if (icon == null) {
++ URL imageURL = plugin.getBundle().getResource(url);
++ ImageDescriptor descriptor = ImageDescriptor.createFromURL(imageURL);
++ icon = descriptor.createImage();
++ plugin.getImageRegistry().put(key, icon);
++ }
++ return icon;
++ }
+ }
--- /dev/null
+ /*******************************************************************************
+ * Copyright (c) 2009 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Francois Chouinard - Initial API and implementation
+ *******************************************************************************/
+
+ package org.eclipse.linuxtools.internal.lttng.ui.views;
+
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
+ import org.eclipse.linuxtools.internal.lttng.ui.views.controlflow.ControlFlowView;
+ import org.eclipse.linuxtools.internal.lttng.ui.views.resources.ResourcesView;
+ import org.eclipse.linuxtools.internal.lttng.ui.views.statistics.StatisticsView;
+ import org.eclipse.linuxtools.tmf.ui.views.events.TmfEventsView;
+ import org.eclipse.linuxtools.tmf.ui.views.histogram.HistogramView;
+ import org.eclipse.ui.IFolderLayout;
+ import org.eclipse.ui.IPageLayout;
+ import org.eclipse.ui.IPerspectiveFactory;
+
+ /**
+ * <b><u>PerspectiveFactory</u></b>
+ * <p>
+ * The default LTTng perspective.
+ */
+ public class PerspectiveFactory implements IPerspectiveFactory {
+
+ // Perspective ID
+ public static final String ID = "org.eclipse.linuxtools.lttng.ui.perspective"; //$NON-NLS-1$
+
+ // LTTng views
+ private static final String EVENTS_VIEW_ID = TmfEventsView.ID;
+ private static final String CONTROL_FLOW_VIEW_ID = ControlFlowView.ID;
+ private static final String RESOURCES_VIEW_ID = ResourcesView.ID;
+ private static final String STATISTICS_VIEW_ID = StatisticsView.ID;
+ private static final String HISTOGRAM_VIEW_ID = HistogramView.ID;
++ private static final String CONTROL_VIEW_ID = ControlView.ID;
+
+ // Standard Eclipse views
+ private static final String PROJECT_VIEW_ID = IPageLayout.ID_PROJECT_EXPLORER;
+ private static final String PROPERTIES_VIEW_ID = IPageLayout.ID_PROP_SHEET;
+ private static final String BOOKMARKS_VIEW_ID = IPageLayout.ID_BOOKMARKS;
+
+ /*
+ * (non-Javadoc)
+ *
+ * @see org.eclipse.ui.IPerspectiveFactory#createInitialLayout(org.eclipse.ui.IPageLayout)
+ */
+ @Override
+ public void createInitialLayout(IPageLayout layout) {
+
+ layout.setEditorAreaVisible(false);
+
+ addFastViews(layout);
+ addViewShortcuts(layout);
+ addPerspectiveShortcuts(layout);
+
+ // Create the top left folder
+ IFolderLayout topLeftFolder = layout.createFolder(
+ "topLeftFolder", IPageLayout.LEFT, 0.15f, IPageLayout.ID_EDITOR_AREA); //$NON-NLS-1$
+ topLeftFolder.addView(PROJECT_VIEW_ID);
++ topLeftFolder.addView(CONTROL_VIEW_ID);
+
+ // Create the top right folder
+ IFolderLayout topRightFolder = layout.createFolder(
+ "topRightFolder", IPageLayout.TOP, 0.40f, IPageLayout.ID_EDITOR_AREA); //$NON-NLS-1$
+ topRightFolder.addView(CONTROL_FLOW_VIEW_ID);
+ topRightFolder.addView(RESOURCES_VIEW_ID);
+ topRightFolder.addView(STATISTICS_VIEW_ID);
+
+ // Create the middle right folder
+ IFolderLayout middleRightFolder = layout.createFolder(
+ "middleRightFolder", IPageLayout.BOTTOM, 0.40f, IPageLayout.ID_EDITOR_AREA); //$NON-NLS-1$
+ middleRightFolder.addView(EVENTS_VIEW_ID);
+
+ // Create the bottom right folder
+ IFolderLayout bottomRightFolder = layout.createFolder(
+ "bottomRightFolder", IPageLayout.BOTTOM, 0.50f, "middleRightFolder"); //$NON-NLS-1$ //$NON-NLS-2$
+ bottomRightFolder.addView(HISTOGRAM_VIEW_ID);
+ bottomRightFolder.addView(PROPERTIES_VIEW_ID);
+ bottomRightFolder.addView(BOOKMARKS_VIEW_ID);
+ }
+
+ /**
+ * Add fast views to the perspective
+ *
+ * @param layout
+ */
+ private void addFastViews(IPageLayout layout) {
+ // TODO Auto-generated method stub
+ }
+
+ /**
+ * Add view shortcuts to the perspective
+ *
+ * @param layout
+ */
+ private void addViewShortcuts(IPageLayout layout) {
+ // TODO Auto-generated method stub
+ }
+
+ /**
+ * Add perspective shortcuts to the perspective
+ *
+ * @param layout
+ */
+ private void addPerspectiveShortcuts(IPageLayout layout) {
+ // TODO Auto-generated method stub
+ }
+
+ }
--- /dev/null
- * Copyright (c) 2009 Ericsson
+ /*******************************************************************************
- * TODO: Implement me. Please.
++ * Copyright (c) 2009, 2012 Ericsson
+ *
+ * All rights reserved. This program and the accompanying materials are
+ * made available under the terms of the Eclipse Public License v1.0 which
+ * accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * Francois Chouinard - Initial API and implementation
++ * Bernd Hufmann - Filled with content
+ *******************************************************************************/
+
+ package org.eclipse.linuxtools.internal.lttng.ui.views.control;
+
++import org.eclipse.jface.action.MenuManager;
++import org.eclipse.jface.viewers.ColumnViewerToolTipSupport;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.jface.viewers.TreeViewer;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponentChangedListener;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlRoot;
++import org.eclipse.swt.SWT;
+ import org.eclipse.swt.widgets.Composite;
++import org.eclipse.swt.widgets.Menu;
+ import org.eclipse.ui.part.ViewPart;
+
+ /**
+ * <b><u>ControlView</u></b>
+ * <p>
-@Deprecated
-public class ControlView extends ViewPart {
++ * View implementation for Trace Control.
++ * </p>
+ */
- public static final String ID = "org.eclipse.linuxtools.lttng.ui.views.control"; //$NON-NLS-1$
++public class ControlView extends ViewPart implements ITraceControlComponentChangedListener {
+
- *
- */
- public ControlView() {
- // TODO Auto-generated constructor stub
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * View ID.
++ */
++ public static final String ID = "org.eclipse.linuxtools.internal.lttng.ui.views.control"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++
++ /**
++ * The tree viewer.
++ */
++ private TreeViewer fTreeViewer = null;
++
++ /**
++ * The trace control root node. This provides access to the whole model.
++ */
++ private ITraceControlComponent fRoot = null;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
+
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
+ /**
- // TODO Auto-generated method stub
++ * @return returns the trace control tree node (model).
++ */
++ public ITraceControlComponent getTraceControlRoot() {
++ return fRoot;
+ }
+
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
+ /*
+ * (non-Javadoc)
+ *
+ * @see org.eclipse.ui.part.WorkbenchPart#createPartControl(org.eclipse.swt.widgets.Composite)
+ */
+ @Override
+ public void createPartControl(Composite parent) {
- // TODO Auto-generated method stub
++ // Create tree viewer
++ fTreeViewer = new TreeViewer(parent, SWT.MULTI | SWT.H_SCROLL | SWT.V_SCROLL);
++ ColumnViewerToolTipSupport.enableFor(fTreeViewer);
+
++ fTreeViewer.setContentProvider(new TraceControlContentProvider());
++ fTreeViewer.setLabelProvider(new TraceControlLabelProvider());
++
++ // Create model root
++ fRoot = new TraceControlRoot();
++ fRoot.addComponentListener(this);
++ fTreeViewer.setInput(fRoot);
++
++ // Create context menu for the tree viewer
++ createContextMenu();
++
++ getSite().setSelectionProvider(fTreeViewer);
+ }
+
+ /*
+ * (non-Javadoc)
+ *
+ * @see org.eclipse.ui.part.WorkbenchPart#setFocus()
+ */
+ @Override
+ public void setFocus() {
++ fTreeViewer.getControl().setFocus();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponentChangedListener#componentAdded(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void componentAdded(ITraceControlComponent parent, ITraceControlComponent component) {
++ componentChanged(component);
++ }
+
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponentChangedListener#componentRemoved(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void componentRemoved(ITraceControlComponent parent, ITraceControlComponent component) {
++ componentChanged(component);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponentChangedListener#componentChanged(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void componentChanged(ITraceControlComponent component) {
++ if (fTreeViewer.getTree().isDisposed()) {
++ return;
++ }
++
++ fTreeViewer.getTree().getDisplay().asyncExec(new Runnable() {
++ @Override
++ public void run() {
++ if (fTreeViewer.getTree().isDisposed()) {
++ return;
++ }
++ fTreeViewer.refresh();
++ // Change selection needed
++ final ISelection sel = fTreeViewer.getSelection();
++ fTreeViewer.setSelection(null);
++ fTreeViewer.setSelection(sel);
++ }
++ });
++ }
++
++ /**
++ * Sets the selected component in the tree
++ * @param component - component to select
++ */
++ public void setSelection(ITraceControlComponent component) {
++ StructuredSelection selection = new StructuredSelection(component);
++ fTreeViewer.setSelection(selection);
+ }
+
++ /**
++ * Sets the selected components in the tree
++ * @param component - array of components to select
++ */
++ public void setSelection(ITraceControlComponent[] components) {
++ StructuredSelection selection = new StructuredSelection(components);
++ fTreeViewer.setSelection(selection);
++ }
++
++// public ITraceControlComponent getSelection() {
++// ISelection selection = fTreeViewer.getSelection();
++//
++// }
++
++ // ------------------------------------------------------------------------
++ // Helper methods
++ // ------------------------------------------------------------------------
++ private void createContextMenu() {
++ // First we create a menu Manager
++ final MenuManager menuManager = new MenuManager();
++ final Menu menu = menuManager.createContextMenu(fTreeViewer.getTree());
++ // Set the MenuManager
++ fTreeViewer.getTree().setMenu(menu);
++ getSite().registerContextMenu(menuManager, fTreeViewer);
++ }
+ }
--- /dev/null
--- /dev/null
++/*******************************************************************************
++ * Copyright (c) 2011 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ *
++ *******************************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control;
++
++import org.eclipse.osgi.util.NLS;
++
++/**
++ * <b><u>Messages</u></b>
++ * <p>
++ * Messages file for the trace control package.
++ * </p>
++ */
++final public class Messages extends NLS {
++ private static final String BUNDLE_NAME = "org.eclipse.linuxtools.internal.lttng.ui.views.control.messages"; //$NON-NLS-1$
++
++ // Failures
++ public static String TraceControl_ConnectionFailure;
++ public static String TraceControl_DisconnectionFailure;
++ public static String TraceControl_ExecutionCancelled;
++ public static String TraceControl_ExecutionFailure;
++ public static String TraceControl_ExecutionTimeout;
++ public static String TraceControl_ShellNotConnected;
++
++ public static String TraceControl_CommandShellError;
++ public static String TraceControl_CommandError;
++ public static String TraceControl_UnexpectedCommnadOutputFormat;
++ public static String TraceControl_UnexpectedNameError;
++ public static String TraceControl_UnexpectedPathError;
++
++ // Commands
++ public static String TraceControl_RetrieveNodeConfigurationJob;
++ public static String TraceControl_ListSessionFailure;
++ public static String TraceControl_EclipseCommandFailure;
++ public static String TraceControl_NewNodeCreationFailure;
++ public static String TraceControl_CreateSessionJob;
++
++ public static String TraceControl_DestroySessionJob;
++ public static String TraceControl_DestroyConfirmationTitle;
++ public static String TraceControl_DestroyConfirmationMessage;
++
++ public static String TraceControl_StartSessionJob;
++ public static String TraceControl_StopSessionJob;
++
++ public static String TraceControl_ChangeChannelStateJob;
++ public static String TraceControl_ChangeEventStateJob;
++
++ public static String TraceControl_EnableEventsJob;
++ public static String TraceControl_EnableEventsFailure;
++ public static String TraceControl_DisableEventsJob;
++
++ // Dialogs
++ public static String TraceControl_NewDialogTitle;
++ public static String TraceControl_NewNodeExistingConnectionGroupName;
++ public static String TraceControl_NewNodeEditButtonName;
++ public static String TraceControl_NewNodeComboToolTip;
++ public static String TraceControl_NewNodeConnectionNameLabel;
++ public static String TraceControl_NewNodeConnectionNameTooltip;
++ public static String TraceControl_NewNodeHostNameLabel;
++ public static String TraceControl_NewNodeHostNameTooltip;
++ public static String TraceControl_AlreadyExistsError;
++
++ public static String TraceControl_CreateSessionDialogTitle;
++ public static String TraceControl_CreateSessionNameLabel;
++ public static String TraceControl_CreateSessionNameTooltip;
++ public static String TraceControl_CreateSessionPathLabel;
++ public static String TraceControl_CreateSessionPathTooltip;
++ public static String TraceControl_InvalidSessionNameError;
++ public static String TraceControl_SessionAlreadyExistsError;
++ public static String TraceControl_SessionPathAlreadyExistsError;
++ public static String TraceControl_InvalidSessionPathError;
++ public static String TraceControl_FileSubSystemError;
++
++ public static String TraceControl_EnableChannelDialogTitle;
++ public static String TraceControl_EnableChannelNameLabel;
++ public static String TraceControl_EnableChannelNameTooltip;
++ public static String TraceControl_EnableChannelSubBufferSizeTooltip;
++ public static String TraceControl_EnableChannelNbSubBuffersTooltip;
++ public static String TraceControl_EnableChannelSwitchTimerTooltip;
++ public static String TraceControl_EnableChannelReadTimerTooltip;
++ public static String TraceControl_EnableChannelOutputTypeTooltip;
++ public static String TraceControl_EnableChannelOverwriteModeTooltip;
++
++ public static String TraceControl_InvalidChannelNameError;
++ public static String TraceControl_ChannelAlreadyExistsError;
++
++ public static String TraceControl_EnableEventsDialogTitle;
++ public static String TraceControl_EnableEventsSessionGroupName;
++ public static String TraceControl_EnableEventsChannelGroupName;
++ public static String TraceControl_EnableEventsSessionsTooltip;
++ public static String TraceControl_EnableEventsChannelsTooltip;
++ public static String TraceControl_EnableEventsNoSessionError;
++ public static String TraceControl_EnableEventsNoChannelError;
++
++ public static String TraceControl_EnableGroupSelectionName;
++ public static String TraceControl_EnableEventsTracepointGroupName;
++ public static String TraceControl_EnableEventsTracepointTreeTooltip;
++ public static String TraceControl_EnableEventsTracepointTreeAllLabel;
++ public static String TraceControl_EnableEventsSyscallName;
++ public static String TraceControl_EnableEventsSyscallTooltip;
++ public static String TraceControl_EnableEventsProbeGroupName;
++ public static String TraceControl_EnableEventsEventNameLabel;
++ public static String TraceControl_EnableEventsProbeEventNameTooltip;
++ public static String TraceControl_EnableEventsProbeNameLabel;
++ public static String TraceControl_EnableEventsProbeNameTooltip;
++ public static String TraceControl_EnableEventsFucntionGroupName;
++ public static String TraceControl_EnableEventsFunctionEventNameTooltip;
++ public static String TraceControl_EnableEventsFunctionNameLabel;
++
++ public static String TraceControl_EnableEventsWildcardGroupName;
++ public static String TraceControl_EnableEventsWildcardLabel;
++ public static String TraceControl_EnableEventsWildcardTooltip;
++ public static String TraceControl_EnableEventsLogLevelGroupName;
++ public static String TraceControl_EnableEventsLogLevelTypeName;
++ public static String TraceControl_EnableEventsLogLevelTypeTooltip;
++ public static String TraceControl_EnableEventsLogLevelOnlyTypeName;
++ public static String TraceControl_EnableEventsLogLevelOnlyTypeTooltip;
++ public static String TraceControl_EnableEventsLogLevelTooltip;
++ public static String TraceControl_EnableEventsLoglevelEventNameTooltip;
++
++ public static String TraceControl_InvalidProbeNameError;
++ public static String TraceControl_InvalidWildcardError;
++ public static String TraceControl_InvalidLogLevelEventNameError;
++
++
++ // Tree structure strings
++ public static String TraceControl_KernelDomainDisplayName;
++ public static String TraceControl_UstDisplayName;
++ public static String TraceControl_UstGlobalDomainDisplayName;
++ public static String TraceControl_AllSessionsDisplayName;
++ public static String TraceControl_SessionDisplayName;
++ public static String TraceControl_DomainDisplayName;
++ public static String TraceControl_ChannelDisplayName;
++ public static String TraceControl_EventDisplayName;
++ public static String TraceControl_ProviderDisplayName;
++ public static String TraceControl_KernelProviderDisplayName;
++
++ // Property names
++ public static String TraceControl_SessionNamePropertyName;
++ public static String TraceControl_EventNamePropertyName;
++ public static String TraceControl_EventTypePropertyName;
++ public static String TraceControl_LogLevelPropertyName;
++ public static String TraceControl_StatePropertyName;
++ public static String TraceControl_DomainNamePropertyName;
++ public static String TraceControl_ChannelNamePropertyName;
++ public static String TraceControl_OverwriteModePropertyName;
++ public static String TraceControl_SubBufferSizePropertyName;
++ public static String TraceControl_NbSubBuffersPropertyName;
++ public static String TraceControl_SwitchTimerPropertyName;
++ public static String TraceControl_ReadTimerPropertyName;
++ public static String TraceControl_OutputTypePropertyName;
++ public static String TraceControl_HostNamePropertyName;
++ public static String TraceControl_HostAddressPropertyName;
++ public static String TraceControl_SessionPathPropertyName;
++ public static String TraceControl_ProviderNamePropertyName;
++ public static String TraceControl_ProcessIdPropertyName;
++ public static String TraceControl_ProbeAddressPropertyName;
++ public static String TraceControl_ProbeOffsetPropertyName;
++ public static String TraceControl_ProbeSymbolPropertyName;
++
++ static {
++ // initialize resource bundle
++ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
++ }
++
++ private Messages() {
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control;
++
++import org.eclipse.jface.viewers.ITreeContentProvider;
++import org.eclipse.jface.viewers.Viewer;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++
++/**
++ * <b><u>TraceControlContentProvider</u></b>
++ * <p>
++ * Tree content provider implementation for trace control view.
++ * </p>
++ */
++public class TraceControlContentProvider implements ITreeContentProvider {
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.viewers.IContentProvider#dispose()
++ */
++ @Override
++ public void dispose() {
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.viewers.IContentProvider#inputChanged(org.eclipse.jface.viewers.Viewer, java.lang.Object, java.lang.Object)
++ */
++ @Override
++ public void inputChanged(Viewer viewer, Object oldInput, Object newInput) {
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.viewers.ITreeContentProvider#getElements(java.lang.Object)
++ */
++ @Override
++ public Object[] getElements(Object inputElement) {
++ return getChildren(inputElement);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.viewers.ITreeContentProvider#getChildren(java.lang.Object)
++ */
++ @Override
++ public Object[] getChildren(Object parentElement) {
++
++ if (parentElement instanceof ITraceControlComponent) {
++ return ((ITraceControlComponent)parentElement).getChildren();
++ }
++ return new Object[0];
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.viewers.ITreeContentProvider#getParent(java.lang.Object)
++ */
++ @Override
++ public Object getParent(Object element) {
++ if (element instanceof ITraceControlComponent) {
++ return ((ITraceControlComponent)element).getParent();
++ }
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.viewers.ITreeContentProvider#hasChildren(java.lang.Object)
++ */
++ @Override
++ public boolean hasChildren(Object element) {
++ if (element instanceof ITraceControlComponent) {
++ return ((ITraceControlComponent)element).hasChildren();
++ }
++ return false;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control;
++
++import org.eclipse.jface.viewers.ColumnLabelProvider;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.swt.graphics.Image;
++
++/**
++ * <b><u>TraceControlLabelProvider</u></b>
++ * <p>
++ * Label provider for trace control tree viewer.
++ * </p>
++ */
++public class TraceControlLabelProvider extends ColumnLabelProvider {
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /* (non-Javadoc)
++ * @see org.eclipse.jface.viewers.ILabelProvider#getImage(java.lang.Object)
++ */
++ @Override
++ public Image getImage(Object element) {
++ if ((element != null) && (element instanceof ITraceControlComponent)) {
++ return ((ITraceControlComponent) element).getImage();
++ }
++ return null;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.jface.viewers.ILabelProvider#getText(java.lang.Object)
++ */
++ @Override
++ public String getText(Object element) {
++ if ((element != null) && (element instanceof ITraceControlComponent)) {
++ return ((ITraceControlComponent) element).getName();
++ }
++ return "";//$NON-NLS-1$
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.viewers.CellLabelProvider#getToolTipText(java.lang.Object)
++ */
++ @Override
++ public String getToolTipText(Object element) {
++ if ((element != null) && (element instanceof ITraceControlComponent)) {
++ return ((ITraceControlComponent) element).getToolTip();
++ }
++ return null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++
++import org.eclipse.jface.dialogs.MessageDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.swt.widgets.Shell;
++
++/**
++ * <b><u>ConfirmDialog</u></b>
++ * <p>
++ * Confirmation dialog implementation.
++ * </p>
++ */
++
++public class ConfirmDialog implements IConfirmDialog {
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IConfirmDialog#openConfirm(org.eclipse.swt.widgets.Shell, java.lang.String, java.lang.String)
++ */
++ @Override
++ public boolean openConfirm(Shell parent, String title, String message) {
++ return MessageDialog.openConfirm(parent,
++ Messages.TraceControl_DestroyConfirmationTitle,
++ Messages.TraceControl_DestroyConfirmationMessage);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import org.eclipse.jface.dialogs.Dialog;
++import org.eclipse.jface.dialogs.IDialogConstants;
++import org.eclipse.jface.dialogs.MessageDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.ChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.swt.SWT;
++import org.eclipse.swt.events.VerifyEvent;
++import org.eclipse.swt.events.VerifyListener;
++import org.eclipse.swt.graphics.Point;
++import org.eclipse.swt.layout.GridData;
++import org.eclipse.swt.layout.GridLayout;
++import org.eclipse.swt.widgets.Button;
++import org.eclipse.swt.widgets.Composite;
++import org.eclipse.swt.widgets.Control;
++import org.eclipse.swt.widgets.Group;
++import org.eclipse.swt.widgets.Label;
++import org.eclipse.swt.widgets.Shell;
++import org.eclipse.swt.widgets.Text;
++
++/**
++ * <b><u>CreateChannelDialog</u></b>
++ * <p>
++ * Dialog box for collecting channel creation information.
++ * </p>
++ */
++public class CreateChannelDialog extends Dialog implements ICreateChannelOnSessionDialog {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The icon file for this dialog box.
++ */
++ public static final String ENABLE_CHANNEL_ICON_FILE = "icons/elcl16/edit.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The dialog composite.
++ */
++ private Composite fDialogComposite = null;
++ /**
++ * The text widget for the channel name
++ */
++ private Text fChannelNameText = null;
++ /**
++ * The overwrite mode of the channel.
++ */
++ private Button fOverwriteModeButton;
++ /**
++ * The sub-buffer size of the channel.
++ */
++ private Text fSubBufferSizeText;
++ /**
++ * The number of sub-buffers of the channel.
++ */
++ private Text fNumberOfSubBuffersText;
++ /**
++ * The switch timer interval of the channel.
++ */
++ private Text fSwitchTimerText;
++ /**
++ * The read timer interval of the channel.
++ */
++ private Text fReadTimerText;
++ /**
++ * Group composite for domain selection.
++ */
++ private Group fDomainGroup = null;
++ /**
++ * Radio button for selecting kernel domain.
++ */
++ private Button fKernelButton;
++ /**
++ * Radio button for selecting UST domain.
++ */
++ private Button fUstButton;
++ /**
++ * The parent domain component where the channel node should be added.
++ * Null in case of creation on session level.
++ */
++ private TraceDomainComponent fDomain;
++ /**
++ * Common verify listener for numeric text input.
++ */
++ private VerifyListener fVerifyListener;
++ /**
++ * Output channel information.
++ */
++ private IChannelInfo fChannelInfo;
++ /**
++ * Output domain information. True in case of Kernel domain. False for UST.
++ */
++ private boolean fIsKernel;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++
++ /**
++ * Constructor
++ * @param shell - a shell for the display of the dialog
++ */
++ public CreateChannelDialog(Shell shell) {
++ super(shell);
++ fIsKernel = true;
++
++ // Common verify listener
++ fVerifyListener = new VerifyListener() {
++ @Override
++ public void verifyText(VerifyEvent e) {
++ // only numbers are allowed.
++ e.doit = e.text.matches("[0-9]*"); //$NON-NLS-1$
++ }
++ };
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateChannelDialog#getChannelInfo()
++ */
++ @Override
++ public IChannelInfo getChannelInfo() {
++ return fChannelInfo;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateChannelDialog#setDomainComponent(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent)
++ */
++ @Override
++ public void setDomainComponent(TraceDomainComponent domain) {
++ fDomain = domain;
++ if (fDomain != null) {
++ fIsKernel = fDomain.isKernel();
++ } else {
++ fIsKernel = true;
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateChannelOnSessionDialog#isKernel()
++ */
++ @Override
++ public boolean isKernel() {
++ return fIsKernel;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.window.Window#configureShell(org.eclipse.swt.widgets.Shell)
++ */
++ @Override
++ protected void configureShell(Shell newShell) {
++ super.configureShell(newShell);
++ newShell.setText(Messages.TraceControl_EnableChannelDialogTitle);
++ newShell.setImage(Activator.getDefault().loadIcon(ENABLE_CHANNEL_ICON_FILE));
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createDialogArea(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected Control createDialogArea(Composite parent) {
++
++ // Main dialog panel
++ fDialogComposite = new Composite(parent, SWT.NONE);
++ GridLayout layout = new GridLayout(2, true);
++ fDialogComposite.setLayout(layout);
++
++ Label channelNameLabel = new Label(fDialogComposite, SWT.RIGHT);
++ channelNameLabel.setText(Messages.TraceControl_EnableChannelNameLabel);
++ fChannelNameText = new Text(fDialogComposite, SWT.NONE);
++ fChannelNameText.setToolTipText(Messages.TraceControl_EnableChannelNameTooltip);
++
++ Label subBufferSizeLabel = new Label(fDialogComposite, SWT.RIGHT);
++ subBufferSizeLabel.setText(Messages.TraceControl_SubBufferSizePropertyName);
++ fSubBufferSizeText = new Text(fDialogComposite, SWT.NONE);
++ fSubBufferSizeText.setToolTipText(Messages.TraceControl_EnableChannelSubBufferSizeTooltip);
++ fSubBufferSizeText.addVerifyListener(fVerifyListener);
++
++ Label numSubBufferLabel = new Label(fDialogComposite, SWT.RIGHT);
++ numSubBufferLabel.setText(Messages.TraceControl_NbSubBuffersPropertyName);
++ fNumberOfSubBuffersText = new Text(fDialogComposite, SWT.NONE);
++ fNumberOfSubBuffersText.setToolTipText(Messages.TraceControl_EnableChannelNbSubBuffersTooltip);
++ fNumberOfSubBuffersText.addVerifyListener(fVerifyListener);
++
++ Label switchTimerLabel = new Label(fDialogComposite, SWT.RIGHT);
++ switchTimerLabel.setText(Messages.TraceControl_SwitchTimerPropertyName);
++ fSwitchTimerText = new Text(fDialogComposite, SWT.NONE);
++ fSwitchTimerText.setToolTipText(Messages.TraceControl_EnableChannelSwitchTimerTooltip);
++ fSwitchTimerText.addVerifyListener(fVerifyListener);
++
++ Label readTimerLabel = new Label(fDialogComposite, SWT.RIGHT);
++ readTimerLabel.setText(Messages.TraceControl_ReadTimerPropertyName);
++ fReadTimerText = new Text(fDialogComposite, SWT.NONE);
++ fReadTimerText.setToolTipText(Messages.TraceControl_EnableChannelReadTimerTooltip);
++ fReadTimerText.addVerifyListener(fVerifyListener);
++
++ fOverwriteModeButton = new Button(fDialogComposite, SWT.CHECK);
++ fOverwriteModeButton.setText(Messages.TraceControl_OverwriteModePropertyName);
++ fOverwriteModeButton.setToolTipText(Messages.TraceControl_EnableChannelOverwriteModeTooltip);
++ new Label(fDialogComposite, SWT.RIGHT);
++
++ fDomainGroup = new Group(fDialogComposite, SWT.SHADOW_NONE);
++ fDomainGroup.setText(Messages.TraceControl_DomainDisplayName);
++ layout = new GridLayout(2, true);
++ fDomainGroup.setLayout(layout);
++
++ fKernelButton = new Button(fDomainGroup, SWT.RADIO);
++ fKernelButton.setText(Messages.TraceControl_KernelDomainDisplayName);
++ fKernelButton.setSelection(fIsKernel);
++ fUstButton = new Button(fDomainGroup, SWT.RADIO);
++ fUstButton.setText(Messages.TraceControl_UstDisplayName);
++ fUstButton.setSelection(!fIsKernel);
++
++ if (fDomain != null) {
++ fKernelButton.setEnabled(false);
++ fUstButton.setEnabled(false);
++ }
++
++ // layout widgets
++ GridData data = new GridData(GridData.FILL, GridData.CENTER, false, false, 2, 1);
++ fDomainGroup.setLayoutData(data);
++
++ data = new GridData(SWT.BEGINNING, SWT.BEGINNING, true, true);
++ fKernelButton.setLayoutData(data);
++ data = new GridData(SWT.BEGINNING, SWT.BEGINNING, true, true);
++ fUstButton.setLayoutData(data);
++
++ data = new GridData(GridData.HORIZONTAL_ALIGN_FILL);
++ fSubBufferSizeText.setText("666.666.666.666"); //$NON-NLS-1$
++ Point minSize = fSubBufferSizeText.computeSize(SWT.DEFAULT, SWT.DEFAULT, true);
++ data.widthHint = minSize.x + 5;
++
++ fChannelNameText.setLayoutData(data);
++ fSubBufferSizeText.setLayoutData(data);
++ fNumberOfSubBuffersText.setLayoutData(data);
++ fSwitchTimerText.setLayoutData(data);
++ fReadTimerText.setLayoutData(data);
++
++ fSubBufferSizeText.setText(""); //$NON-NLS-1$
++
++ setDefaults();
++
++ return fDialogComposite;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createButtonsForButtonBar(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected void createButtonsForButtonBar(Composite parent) {
++ createButton(parent, IDialogConstants.DETAILS_ID, "Default", true); //$NON-NLS-1$
++ createButton(parent, IDialogConstants.OK_ID, "&Ok", true); //$NON-NLS-1$
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#okPressed()
++ */
++ @Override
++ protected void okPressed() {
++ // Set channel information
++ fChannelInfo = new ChannelInfo(fChannelNameText.getText());
++ fChannelInfo.setSubBufferSize(Long.parseLong(fSubBufferSizeText.getText()));
++ fChannelInfo.setNumberOfSubBuffers(Integer.parseInt(fNumberOfSubBuffersText.getText()));
++ fChannelInfo.setSwitchTimer(Long.parseLong(fSwitchTimerText.getText()));
++ fChannelInfo.setReadTimer(Long.parseLong(fReadTimerText.getText()));
++ fChannelInfo.setOverwriteMode(fOverwriteModeButton.getSelection());
++
++ if (fKernelButton.getSelection() == true) {
++ fIsKernel = true;
++ } else {
++ fIsKernel = false;
++ }
++
++ // Check for invalid names
++ if (!fChannelInfo.getName().matches("^[a-zA-Z0-9\\-\\_]{1,}$")) { //$NON-NLS-1$
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_EnableChannelDialogTitle,
++ Messages.TraceControl_InvalidChannelNameError + " (" + fChannelInfo.getName() + ") \n"); //$NON-NLS-1$ //$NON-NLS-2$
++ return;
++ }
++
++ // Check for duplicate names
++ if (fDomain != null && fDomain.containsChild(fChannelInfo.getName())) {
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_EnableChannelDialogTitle,
++ Messages.TraceControl_ChannelAlreadyExistsError + " (" + fChannelInfo.getName() + ") \n"); //$NON-NLS-1$ //$NON-NLS-2$
++ return;
++ }
++
++ // validation successful -> call super.okPressed()
++ super.okPressed();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#buttonPressed(int)
++ */
++ @Override
++ protected void buttonPressed(int buttonId) {
++ if (buttonId == IDialogConstants.DETAILS_ID) {
++ setDefaults();
++ return;
++ }
++ super.buttonPressed(buttonId);
++ }
++
++ // ------------------------------------------------------------------------
++ // Helper methods
++ // ------------------------------------------------------------------------
++ /**
++ * Sets default value depending on Kernel or UST
++ */
++ private void setDefaults() {
++ fSwitchTimerText.setText(String.valueOf(IChannelInfo.DEFAULT_SWITCH_TIMER));
++ fReadTimerText.setText(String.valueOf(IChannelInfo.DEFAULT_READ_TIMER));
++ fOverwriteModeButton.setSelection(IChannelInfo.DEFAULT_OVERWRITE_MODE);
++ if (fKernelButton.getSelection()) {
++ fSubBufferSizeText.setText(String.valueOf(IChannelInfo.DEFAULT_SUB_BUFFER_SIZE_KERNEL));
++ fNumberOfSubBuffersText.setText(String.valueOf(IChannelInfo.DEFAULT_NUMBER_OF_SUB_BUFFERS_KERNEL));
++ } else {
++ fSubBufferSizeText.setText(String.valueOf(IChannelInfo.DEFAULT_SUB_BUFFER_SIZE_UST));
++ fNumberOfSubBuffersText.setText(String.valueOf(IChannelInfo.DEFAULT_NUMBER_OF_SUB_BUFFERS_UST));
++ }
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import org.eclipse.core.runtime.NullProgressMonitor;
++import org.eclipse.jface.dialogs.Dialog;
++import org.eclipse.jface.dialogs.IDialogConstants;
++import org.eclipse.jface.dialogs.MessageDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionGroup;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.remote.IRemoteSystemProxy;
++import org.eclipse.rse.services.clientserver.messages.SystemMessageException;
++import org.eclipse.rse.subsystems.files.core.servicesubsystem.IFileServiceSubSystem;
++import org.eclipse.rse.subsystems.files.core.subsystems.IRemoteFile;
++import org.eclipse.swt.SWT;
++import org.eclipse.swt.graphics.Point;
++import org.eclipse.swt.layout.GridData;
++import org.eclipse.swt.layout.GridLayout;
++import org.eclipse.swt.widgets.Composite;
++import org.eclipse.swt.widgets.Control;
++import org.eclipse.swt.widgets.Label;
++import org.eclipse.swt.widgets.Shell;
++import org.eclipse.swt.widgets.Text;
++
++/**
++ * <b><u>CreateSessionDialog</u></b>
++ * <p>
++ * Dialog box for collecting session creation information.
++ * </p>
++ */
++public class CreateSessionDialog extends Dialog implements ICreateSessionDialog {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The icon file for this dialog box.
++ */
++ public static final String CREATE_SESSION_ICON_FILE = "icons/elcl16/add_button.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The dialog composite.
++ */
++ private Composite fDialogComposite = null;
++ /**
++ * The text widget for the session name
++ */
++ private Text fSessionNameText = null;
++ /**
++ * The text widget for the session path
++ */
++ private Text fSessionPathText = null;
++ /**
++ * The parent where the new node should be added.
++ */
++ private TraceSessionGroup fParent;
++ /**
++ * The session name string.
++ */
++ private String fSessionName = null;
++ /**
++ * The session path string.
++ */
++ private String fSessionPath = null;
++ /**
++ * Flag whether default location (path) shall be used or not
++ */
++ private boolean fIsDefaultPath = true;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param shell - a shell for the display of the dialog
++ */
++ public CreateSessionDialog(Shell shell) {
++ super(shell);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateSessionDialog#getSessionName()
++ */
++ @Override
++ public String getSessionName() {
++ return fSessionName;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateSessionDialog#getSessionPath()
++ */
++ @Override
++ public String getSessionPath() {
++ return fSessionPath;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateSessionDialog#isDefaultSessionPath()
++ */
++ @Override
++ public boolean isDefaultSessionPath() {
++ return fIsDefaultPath;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateSessionDialog#setTraceSessionGroup(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionGroup)
++ */
++ @Override
++ public void setTraceSessionGroup(TraceSessionGroup group) {
++ fParent = group;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.window.Window#configureShell(org.eclipse.swt.widgets.Shell)
++ */
++ @Override
++ protected void configureShell(Shell newShell) {
++ super.configureShell(newShell);
++ newShell.setText(Messages.TraceControl_CreateSessionDialogTitle);
++ newShell.setImage(Activator.getDefault().loadIcon(CREATE_SESSION_ICON_FILE));
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createDialogArea(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected Control createDialogArea(Composite parent) {
++
++ // Main dialog panel
++ fDialogComposite = new Composite(parent, SWT.NONE);
++ GridLayout layout = new GridLayout(2, true);
++ fDialogComposite.setLayout(layout);
++
++ Label sessionNameLabel = new Label(fDialogComposite, SWT.RIGHT);
++ sessionNameLabel.setText(Messages.TraceControl_CreateSessionNameLabel);
++ fSessionNameText = new Text(fDialogComposite, SWT.NONE);
++ fSessionNameText.setToolTipText(Messages.TraceControl_CreateSessionNameTooltip);
++
++ Label sessionPath = new Label(fDialogComposite, SWT.RIGHT);
++ sessionPath.setText(Messages.TraceControl_CreateSessionPathLabel);
++ fSessionPathText = new Text(fDialogComposite, SWT.NONE);
++ fSessionPathText.setToolTipText(Messages.TraceControl_CreateSessionPathTooltip);
++
++ // layout widgets
++ GridData data = new GridData(GridData.HORIZONTAL_ALIGN_FILL);
++ fSessionPathText.setText("666.666.666.666"); //$NON-NLS-1$
++ Point minSize = fSessionPathText.computeSize(SWT.DEFAULT, SWT.DEFAULT, true);
++ data.widthHint = minSize.x + 5;
++
++ fSessionNameText.setLayoutData(data);
++ fSessionPathText.setLayoutData(data);
++
++ fSessionPathText.setText(""); //$NON-NLS-1$
++
++ return fDialogComposite;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createButtonsForButtonBar(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected void createButtonsForButtonBar(Composite parent) {
++ createButton(parent, IDialogConstants.OK_ID, "&Ok", true); //$NON-NLS-1$
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#okPressed()
++ */
++ @Override
++ protected void okPressed() {
++ // Validate input data
++ fSessionName = fSessionNameText.getText();
++ fSessionPath = fSessionPathText.getText();
++
++ if (!"".equals(fSessionPath)) { //$NON-NLS-1$
++ // validate sessionPath
++
++ TargetNodeComponent node = (TargetNodeComponent)fParent.getParent();
++ IRemoteSystemProxy proxy = node.getRemoteSystemProxy();
++ IFileServiceSubSystem fsss = proxy.getFileServiceSubSystem();
++ if (fsss != null) {
++ try {
++ IRemoteFile remoteFolder = fsss.getRemoteFileObject(fSessionPath, new NullProgressMonitor());
++ if (remoteFolder.exists()) {
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_CreateSessionDialogTitle,
++ Messages.TraceControl_SessionPathAlreadyExistsError + " (" + fSessionPath + ") \n"); //$NON-NLS-1$ //$NON-NLS-2$
++ return;
++ }
++ } catch (SystemMessageException e) {
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_CreateSessionDialogTitle,
++ Messages.TraceControl_FileSubSystemError + "\n" + e); //$NON-NLS-1$
++ return;
++ }
++ }
++ fIsDefaultPath = false;
++ }
++
++ // If no session name is specified use default name auto
++ if ("".equals(fSessionName)) { //$NON-NLS-1$
++ fSessionName = "auto"; //$NON-NLS-1$
++ }
++
++ // Check for invalid names
++ if (!fSessionName.matches("^[a-zA-Z0-9\\-\\_]{1,}$")) { //$NON-NLS-1$
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_CreateSessionDialogTitle,
++ Messages.TraceControl_InvalidSessionNameError + " (" + fSessionName + ") \n"); //$NON-NLS-1$ //$NON-NLS-2$
++ return;
++ }
++
++ // Check if node with name already exists in parent
++ if(fParent.containsChild(fSessionName)) {
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_CreateSessionDialogTitle,
++ Messages.TraceControl_SessionAlreadyExistsError + " (" + fSessionName + ")"); //$NON-NLS-1$ //$NON-NLS-2$
++ return;
++ }
++
++ // validation successful -> call super.okPressed()
++ super.okPressed();
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import java.util.List;
++
++import org.eclipse.jface.dialogs.Dialog;
++import org.eclipse.jface.dialogs.IDialogConstants;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProviderGroup;
++import org.eclipse.swt.SWT;
++import org.eclipse.swt.events.SelectionAdapter;
++import org.eclipse.swt.events.SelectionEvent;
++import org.eclipse.swt.graphics.Point;
++import org.eclipse.swt.layout.GridData;
++import org.eclipse.swt.layout.GridLayout;
++import org.eclipse.swt.widgets.Button;
++import org.eclipse.swt.widgets.Composite;
++import org.eclipse.swt.widgets.Control;
++import org.eclipse.swt.widgets.Group;
++import org.eclipse.swt.widgets.Shell;
++
++/**
++ * <b><u>EnableEventsDialog</u></b>
++ * <p>
++ * Dialog box for collecting information events to be enabled.
++ * </p>
++ */
++public class EnableEventsDialog extends Dialog implements IEnableEventsDialog {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++
++ /**
++ * The icon file for this dialog box.
++ */
++ public static final String ENABLE_EVENT_ICON_FILE = "icons/elcl16/edit.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The dialog composite.
++ */
++ private Composite fDialogComposite;
++ /**
++ * The composite with widgets for collecting information about kernel events.
++ */
++ private EnableKernelEventComposite fKernelComposite;
++ /**
++ * The composite with widgets for collecting information about UST events.
++ */
++ private EnableUstEventsComposite fUstComposite;
++ /**
++ * Radio button for selecting kernel domain.
++ */
++ private Button fKernelButton;
++ /**
++ * Radio button for selecting UST domain.
++ */
++ private Button fUstButton;
++ /**
++ * The referenced trace provider group containing the kernel provider and UST
++ * provider component which contains a list of available tracepoints.
++ */
++ private TraceProviderGroup fProviderGroup;
++ /**
++ * The parent domain component where the channel node should be added.
++ * Null in case the domain is not known (i.e. on session level).
++ */
++ private TraceDomainComponent fDomain;
++ /**
++ * Output domain information. True in case of Kernel domain. False for UST.
++ */
++ private boolean fIsKernel;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param shell - a shell for the display of the dialog
++ * @param providerGroup - the trace provider group
++ */
++ public EnableEventsDialog(Shell shell) {
++ super(shell);
++ setShellStyle(SWT.RESIZE);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isTracpoints()
++ */
++ @Override
++ public boolean isTracepoints() {
++ if (fIsKernel) {
++ return fKernelComposite.isTracepoints();
++ }
++ return fUstComposite.isTracepoints();
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isAllTracePoints()
++ */
++ @Override
++ public boolean isAllTracePoints() {
++ if (fIsKernel) {
++ return fKernelComposite.isAllTracePoints();
++ }
++ return fUstComposite.isAllTracePoints();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isSysCalls()
++ */
++ @Override
++ public boolean isSysCalls() {
++ if (fIsKernel) {
++ return fKernelComposite.isSysCalls();
++ }
++ return false;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isAllSysCalls()
++ */
++ @Override
++ public boolean isAllSysCalls() {
++ if (fIsKernel) {
++ return fKernelComposite.isSysCalls();
++ }
++ return false;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getEventNames()
++ */
++ @Override
++ public List<String> getEventNames() {
++ if (fIsKernel) {
++ return fKernelComposite.getEventNames();
++ }
++ return fUstComposite.getEventNames();
++ }
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isDynamicProbe()
++ */
++ @Override
++ public boolean isDynamicProbe() {
++ if (fIsKernel) {
++ return fKernelComposite.isDynamicProbe();
++ }
++ return false;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getProbeName()
++ */
++ @Override
++ public String getProbeName() {
++ if (fIsKernel) {
++ return fKernelComposite.getProbeName();
++ }
++ return null;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getProbeEventName()
++ */
++ @Override
++ public String getProbeEventName() {
++ if (fIsKernel) {
++ return fKernelComposite.getProbeEventName();
++ }
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isDynamicFunctionProbe()
++ */
++ @Override
++ public boolean isDynamicFunctionProbe() {
++ if (fIsKernel) {
++ return fKernelComposite.isDynamicFunctionProbe();
++ }
++ return false;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getFunctionEventName()
++ */
++ @Override
++ public String getFunctionEventName() {
++ if (fIsKernel) {
++ return fKernelComposite.getFunctionEventName();
++ }
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getFunction()
++ */
++ @Override
++ public String getFunction() {
++ if (fIsKernel) {
++ return fKernelComposite.getFunction();
++ }
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#isWildcard()
++ */
++ @Override
++ public boolean isWildcard() {
++ if (!fIsKernel) {
++ return fUstComposite.isWildcard();
++ }
++ return false;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#getWildcard()
++ */
++ @Override
++ public String getWildcard() {
++ if (!fIsKernel) {
++ return fUstComposite.getWildcard();
++ }
++ return null;
++
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#isLogLevel()
++ */
++ @Override
++ public boolean isLogLevel() {
++ if (!fIsKernel) {
++ return fUstComposite.isLogLevel();
++ }
++ return false;
++
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#getLogLevelType()
++ */
++ @Override
++ public LogLevelType getLogLevelType() {
++ if (!fIsKernel) {
++ return fUstComposite.getLogLevelType();
++ }
++ return null;
++
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#getLogLevel()
++ */
++ @Override
++ public TraceLogLevel getLogLevel() {
++ if (!fIsKernel) {
++ return fUstComposite.getLogLevel();
++ }
++ return null;
++
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#getLogLevelEventName()
++ */
++ @Override
++ public String getLogLevelEventName() {
++ if (!fIsKernel) {
++ return fUstComposite.getLogLevelEventName();
++ }
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableEventsDialog#isKernel()
++ */
++ @Override
++ public boolean isKernel() {
++ return fIsKernel;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableEventsDialog#setTraceProviderGroup(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProviderGroup)
++ */
++ @Override
++ public void setTraceProviderGroup(TraceProviderGroup providerGroup) {
++ fProviderGroup = providerGroup;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableEventsDialog#setTraceDomainComponent(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent)
++ */
++ @Override
++ public void setTraceDomainComponent(TraceDomainComponent domain) {
++ fDomain = domain;
++ if (fDomain != null) {
++ fIsKernel = fDomain.isKernel();
++ } else {
++ fIsKernel = true;
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.window.Window#configureShell(org.eclipse.swt.widgets.Shell)
++ */
++ @Override
++ protected void configureShell(Shell newShell) {
++ super.configureShell(newShell);
++ newShell.setText(Messages.TraceControl_EnableEventsDialogTitle);
++ newShell.setImage(Activator.getDefault().loadIcon(ENABLE_EVENT_ICON_FILE));
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createDialogArea(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected Control createDialogArea(Composite parent) {
++
++ // Main dialog panel
++ fDialogComposite = new Composite(parent, SWT.NONE);
++ GridLayout layout = new GridLayout(1, true);
++ fDialogComposite.setLayout(layout);
++ fDialogComposite.setLayoutData(new GridData(GridData.FILL_BOTH));
++
++ // ------------------------------------------------------------------------
++ // Domain Group
++ // ------------------------------------------------------------------------
++ Group domainGroup = new Group(fDialogComposite, SWT.SHADOW_NONE);
++ domainGroup.setText(Messages.TraceControl_DomainDisplayName);
++ layout = new GridLayout(2, true);
++ domainGroup.setLayout(layout);
++
++ fKernelButton = new Button(domainGroup, SWT.RADIO);
++ fKernelButton.setText(Messages.TraceControl_KernelDomainDisplayName);
++ fKernelButton.setSelection(fIsKernel);
++ fUstButton = new Button(domainGroup, SWT.RADIO);
++ fUstButton.setText(Messages.TraceControl_UstDisplayName);
++ fUstButton.setSelection(!fIsKernel);
++
++ if (fDomain != null) {
++ fKernelButton.setEnabled(false);
++ fUstButton.setEnabled(false);
++ }
++
++ // layout widgets
++ GridData data = new GridData(GridData.FILL_HORIZONTAL);
++ domainGroup.setLayoutData(data);
++
++ data = new GridData(SWT.BEGINNING, SWT.BEGINNING, true, true);
++ fKernelButton.setLayoutData(data);
++ data = new GridData(SWT.BEGINNING, SWT.BEGINNING, true, true);
++ fUstButton.setLayoutData(data);
++
++ // ------------------------------------------------------------------------
++ // Kernel or UST event data group
++ // ------------------------------------------------------------------------
++ fUstComposite = null;
++ fKernelComposite = null;
++ if (fIsKernel) {
++ createKernelComposite();
++ fUstComposite = null;
++ } else {
++ createUstComposite();
++ }
++
++ fKernelButton.addSelectionListener(new SelectionAdapter() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ if (fKernelButton.getSelection()) {
++ disposeUstComposite();
++ createKernelComposite();
++ fDialogComposite.layout();
++ }
++ }
++ });
++
++ fUstButton.addSelectionListener(new SelectionAdapter() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ if (fUstButton.getSelection()) {
++ disposeKernelComposite();
++ createUstComposite();
++ fDialogComposite.layout();
++ }
++ }
++ });
++
++ fDialogComposite.layout();
++
++ getShell().setMinimumSize(new Point(500, 650));
++
++ return fDialogComposite;
++ }
++
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createButtonsForButtonBar(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected void createButtonsForButtonBar(Composite parent) {
++ createButton(parent, IDialogConstants.OK_ID, "&Ok", true); //$NON-NLS-1$
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#okPressed()
++ */
++ @Override
++ protected void okPressed() {
++ if (fKernelButton.getSelection() == true) {
++ fIsKernel = true;
++ } else {
++ fIsKernel = false;
++ }
++
++ // Validate kernel composite in case of kernel domain
++ if (fKernelComposite != null && !fKernelComposite.isValid()) {
++ return;
++ }
++
++ // Validate UST composite in case of UST domain
++ if (fUstComposite != null && !fUstComposite.isValid()) {
++ return;
++ }
++
++ // validation successful -> call super.okPressed()
++ super.okPressed();
++ }
++
++ // ------------------------------------------------------------------------
++ // Helper methods
++ // ------------------------------------------------------------------------
++ /**
++ * Creates the kernel composite (if not existing)
++ */
++ private void createKernelComposite() {
++ if (fKernelComposite == null) {
++ fKernelComposite = new EnableKernelEventComposite(fDialogComposite, SWT.NONE, fProviderGroup);
++ GridLayout layout = new GridLayout(1, true);
++ fKernelComposite.setLayout(layout);
++ fKernelComposite.setLayoutData(new GridData(GridData.FILL_BOTH));
++
++ fKernelComposite.createContent();
++ }
++ }
++
++ /**
++ * Disposes the kernel composite (if existing)
++ */
++ private void disposeKernelComposite() {
++ if (fKernelComposite != null) {
++ fKernelComposite.dispose();
++ fKernelComposite = null;
++ }
++ }
++
++ /**
++ * Creates the UST composite (if not existing)
++ */
++ private void createUstComposite() {
++ if (fUstComposite == null) {
++ fUstComposite = new EnableUstEventsComposite(fDialogComposite, SWT.NONE, fProviderGroup);
++ GridLayout layout = new GridLayout(1, true);
++ fUstComposite.setLayout(layout);
++ fUstComposite.setLayoutData(new GridData(GridData.FILL_BOTH));
++
++ fUstComposite.createContent();
++ }
++ }
++
++ /**
++ * Disposes the UST composite (if existing)
++ */
++ private void disposeUstComposite() {
++ if (fUstComposite != null) {
++ fUstComposite.dispose();
++ fUstComposite = null;
++ }
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import java.util.ArrayList;
++import java.util.List;
++
++import org.eclipse.jface.dialogs.MessageDialog;
++import org.eclipse.jface.viewers.CheckStateChangedEvent;
++import org.eclipse.jface.viewers.CheckboxTreeViewer;
++import org.eclipse.jface.viewers.ICheckStateListener;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.TraceControlContentProvider;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.TraceControlLabelProvider;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.KernelProviderComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProviderGroup;
++import org.eclipse.swt.SWT;
++import org.eclipse.swt.events.SelectionAdapter;
++import org.eclipse.swt.events.SelectionEvent;
++import org.eclipse.swt.graphics.Image;
++import org.eclipse.swt.layout.GridData;
++import org.eclipse.swt.layout.GridLayout;
++import org.eclipse.swt.widgets.Button;
++import org.eclipse.swt.widgets.Composite;
++import org.eclipse.swt.widgets.Group;
++import org.eclipse.swt.widgets.Label;
++import org.eclipse.swt.widgets.Text;
++
++/**
++ * <b><u>EnableKernelEventsComposite</u></b>
++ * <p>
++ * A composite for collecting information about kernel events to be enabled.
++ * </p>
++ */
++public class EnableKernelEventComposite extends Composite implements IEnableKernelEvents {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ private enum KernelGroupEnum { TRACEPOINTS, SYSCALLS, PROBE, FUNCTION };
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++
++ /**
++ * A button to enable/disable the tracepoints group
++ */
++ private Button fTracepointsActivateButton;
++ /**
++ * A tree viewer for displaying and selection of available tracepoints.
++ */
++ private CheckboxTreeViewer fTracepointsViewer;
++ /**
++ * A button to enable/disable the syscalls group
++ */
++ private Button fSysCallsActivateButton;
++ /**
++ * A button to enable or disable the dynamic probe group.
++ */
++ private Button fProbeActivateButton;
++ /**
++ * The text field for the event name for the dynamic probe.
++ */
++ private Text fProbeEventNameText;
++ /**
++ * The text field for the dynamic probe.
++ */
++ private Text fProbeText;
++ /**
++ * A button to enable or disable the dynamic function probe group.
++ */
++ private Button fFunctionActivateButton;
++ /**
++ * The text field for the event name for the dynamic probe.
++ */
++ private Text fFunctionEventNameText;
++ /**
++ * The text field for the dynamic function entry/return probe.
++ */
++ private Text fFunctionText;
++ /**
++ * The referenced trace provider group containing the kernel provider
++ * component which contains a list of available tracepoints.
++ */
++ private TraceProviderGroup fProviderGroup;
++ /**
++ * The flag indicating that tracepoints are selected.
++ */
++ private boolean fIsTracepoints;
++ /**
++ * The flag indicating that all tracepoints are selected.
++ */
++ private boolean fIsAllTracepoints;
++ /**
++ * The flag indicating that syscalls are selected.
++ */
++ private boolean fIsSysCalls;
++ /**
++ * The list of tracepoints to be enabled.
++ */
++ private List<String> fSelectedEvents;
++ /**
++ * The flag indicating that dynamic probe is selected.
++ */
++ private boolean fIsDynamicProbe;
++ /**
++ * The event name of the dynamic probe.
++ */
++ private String fProbeEventName;
++ /**
++ * The dynamic probe.
++ */
++ private String fProbeString;
++ /**
++ * The flag indicating that the dynamic function probe is selected.
++ */
++ private boolean fIsDynamicFunctionProbe;
++ /**
++ * The event name of the dynamic function entry/return probe.
++ */
++ private String fFunctionEventName;
++ /**
++ * The dynamic function entry/return probe.
++ */
++ private String fFunctionString;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++
++ public EnableKernelEventComposite(Composite parent, int style, TraceProviderGroup providerGroup) {
++ super(parent, style);
++ fProviderGroup = providerGroup;
++ }
++
++ // ------------------------------------------------------------------------
++ // Acessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isTracpoints()
++ */
++ @Override
++ public boolean isTracepoints() {
++ return fIsTracepoints;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isAllTracePoints()
++ */
++ @Override
++ public boolean isAllTracePoints() {
++ return fIsAllTracepoints;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isSysCalls()
++ */
++ @Override
++ public boolean isSysCalls() {
++ return fIsSysCalls;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isAllSysCalls()
++ */
++ @Override
++ public boolean isAllSysCalls() {
++ return fIsSysCalls;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getEventNames()
++ */
++ @Override
++ public List<String> getEventNames() {
++ return new ArrayList<String>(fSelectedEvents);
++ }
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isDynamicProbe()
++ */
++ @Override
++ public boolean isDynamicProbe() {
++ return fIsDynamicProbe;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getProbeName()
++ */
++ @Override
++ public String getProbeName() {
++ return fProbeString;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getProbeEventName()
++ */
++ @Override
++ public String getProbeEventName() {
++ return fProbeEventName;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#isDynamicFunctionProbe()
++ */
++ @Override
++ public boolean isDynamicFunctionProbe() {
++ return fIsDynamicFunctionProbe;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getFunctionEventName()
++ */
++ @Override
++ public String getFunctionEventName() {
++ return fFunctionEventName;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableKernelEvents#getFunction()
++ */
++ @Override
++ public String getFunction() {
++ return fFunctionString;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Creates the composite content
++ */
++ public void createContent() {
++
++ // Tracepoints Group
++ createTracepointsGroup();
++
++ // Syscalls Group
++ createSysCallsGroup();
++
++ // Dynamic Probe Group
++ createDynamicProbeGroup();
++
++ // Dynamic Function Probe Group
++ createDynamicFunctionPropeGroup();
++
++ // Set default enablements
++ setKernelEnablements(KernelGroupEnum.TRACEPOINTS);
++ }
++
++ /**
++ * Validates the kernel composite input data.
++ * @return true if configured data is valid and can be retrieved.
++ */
++ public boolean isValid() {
++ fIsTracepoints = fTracepointsActivateButton.getSelection();
++ fIsSysCalls = fSysCallsActivateButton.getSelection();
++ fIsDynamicProbe = fProbeActivateButton.getSelection();
++ fIsDynamicFunctionProbe = fFunctionActivateButton.getSelection();
++
++ List<ITraceControlComponent> comps = fProviderGroup.getChildren(KernelProviderComponent.class);
++ fIsAllTracepoints = fTracepointsViewer.getChecked(comps.get(0));
++
++ Object[] checkedElements = fTracepointsViewer.getCheckedElements();
++ fSelectedEvents = new ArrayList<String>();
++ for (int i = 0; i < checkedElements.length; i++) {
++ ITraceControlComponent component = (ITraceControlComponent)checkedElements[i];
++ if (component instanceof BaseEventComponent) {
++ fSelectedEvents.add(component.getName());
++ }
++ }
++
++ // initialize probe string
++ fProbeEventName = null;
++ fProbeString = null;
++ String temp = fProbeEventNameText.getText();
++ if (!temp.matches("^[\\s]{0,}$") && !temp.matches("^[a-zA-Z0-9\\-\\_]{1,}$")) { //$NON-NLS-1$ //$NON-NLS-2$
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_EnableEventsDialogTitle,
++ Messages.TraceControl_InvalidProbeNameError + " (" + temp + ") \n"); //$NON-NLS-1$ //$NON-NLS-2$
++
++ return false;
++ }
++
++ if(!fProbeText.getText().matches("\\s*")) { //$NON-NLS-1$
++ fProbeEventName = temp;
++ // fProbeString will be validated by lttng-tools
++ fProbeString = fProbeText.getText();
++ }
++
++ // initialize function string
++ fFunctionEventName = null;
++ fFunctionString = null;
++
++ temp = fFunctionEventNameText.getText();
++ if (!temp.matches("^[\\s]{0,}$") && !temp.matches("^[a-zA-Z0-9\\-\\_]{1,}$")) { //$NON-NLS-1$ //$NON-NLS-2$
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_EnableEventsDialogTitle,
++ Messages.TraceControl_InvalidProbeNameError + " (" + temp + ") \n"); //$NON-NLS-1$ //$NON-NLS-2$
++
++ return false;
++ }
++
++ if(!fFunctionText.getText().matches("\\s*")) { //$NON-NLS-1$
++ fFunctionEventName = temp;
++ // fFunctionString will be validated by lttng-tools
++ fFunctionString = fFunctionText.getText();
++ }
++
++ return true;
++ }
++
++ /**
++ * Creates tracepoints group.
++ */
++ private void createTracepointsGroup() {
++
++ GridLayout layout;
++ GridData data;
++ Group tpMainGroup = new Group(this, SWT.SHADOW_NONE);
++ tpMainGroup.setText(Messages.TraceControl_EnableEventsTracepointGroupName);
++ layout = new GridLayout(2, false);
++ tpMainGroup.setLayout(layout);
++ data = new GridData(GridData.FILL_BOTH);
++ tpMainGroup.setLayoutData(data);
++
++ Composite buttonComposite = new Composite(tpMainGroup, SWT.NONE);
++ layout = new GridLayout(1, true);
++ buttonComposite.setLayout(layout);
++ data = new GridData(SWT.BEGINNING, SWT.CENTER, false, true);
++ buttonComposite.setLayoutData(data);
++
++ fTracepointsActivateButton = new Button(buttonComposite, SWT.RADIO);
++ fTracepointsActivateButton.setText(Messages.TraceControl_EnableGroupSelectionName);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fTracepointsActivateButton.setLayoutData(data);
++ fTracepointsActivateButton.addSelectionListener(new SelectionAdapter() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ setKernelEnablements(KernelGroupEnum.TRACEPOINTS);
++ }
++ });
++
++ Group tracepointsGroup = new Group(tpMainGroup, SWT.SHADOW_NONE);
++ layout = new GridLayout(1, true);
++ tracepointsGroup.setLayout(layout);
++ data = new GridData(GridData.FILL_BOTH);
++ tracepointsGroup.setLayoutData(data);
++
++ fTracepointsViewer = new CheckboxTreeViewer(tracepointsGroup, SWT.MULTI | SWT.H_SCROLL | SWT.V_SCROLL);
++ fTracepointsViewer.getTree().setToolTipText(Messages.TraceControl_EnableEventsTracepointTreeTooltip);
++
++ fTracepointsViewer.setContentProvider(new KernelContentProvider());
++ fTracepointsViewer.setLabelProvider(new KernelLabelProvider());
++ fTracepointsViewer.addCheckStateListener(new KernelCheckListener());
++ fTracepointsViewer.setInput(fProviderGroup);
++
++ fTracepointsViewer.getTree().setLayoutData(new GridData(GridData.FILL_BOTH));
++ }
++
++ /**
++ * Creates syscalls group.
++ */
++ private void createSysCallsGroup() {
++ GridLayout layout;
++ GridData data;
++ Group sysCallsMainGroup = new Group(this, SWT.SHADOW_NONE);
++ sysCallsMainGroup.setText(Messages.TraceControl_EnableEventsSyscallName);
++ sysCallsMainGroup.setToolTipText(Messages.TraceControl_EnableEventsSyscallTooltip);
++ layout = new GridLayout(2, false);
++ sysCallsMainGroup.setLayout(layout);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ sysCallsMainGroup.setLayoutData(data);
++
++ Composite buttonComposite = new Composite(sysCallsMainGroup, SWT.NONE);
++ layout = new GridLayout(1, false);
++ buttonComposite.setLayout(layout);
++ data = new GridData(SWT.BEGINNING, SWT.CENTER, false, true);
++ buttonComposite.setLayoutData(data);
++
++ fSysCallsActivateButton = new Button(buttonComposite, SWT.RADIO);
++ fSysCallsActivateButton.setText(Messages.TraceControl_EnableGroupSelectionName);
++ fSysCallsActivateButton.setToolTipText(Messages.TraceControl_EnableEventsSyscallTooltip);
++ fSysCallsActivateButton.setSelection(false);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fSysCallsActivateButton.setLayoutData(data);
++ fSysCallsActivateButton.addSelectionListener(new SelectionAdapter() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ setKernelEnablements(KernelGroupEnum.SYSCALLS);
++ }
++ });
++ }
++
++ /**
++ * Creates dynamic probe group.
++ */
++ private void createDynamicProbeGroup() {
++ GridLayout layout;
++ GridData data;
++ Group probeMainGroup = new Group(this, SWT.SHADOW_NONE);
++ probeMainGroup.setText(Messages.TraceControl_EnableEventsProbeGroupName);
++ layout = new GridLayout(2, false);
++ probeMainGroup.setLayout(layout);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ probeMainGroup.setLayoutData(data);
++
++ Composite buttonComposite = new Composite(probeMainGroup, SWT.NONE);
++ layout = new GridLayout(1, false);
++ buttonComposite.setLayout(layout);
++ data = new GridData(SWT.BEGINNING, SWT.CENTER, false, true);
++ buttonComposite.setLayoutData(data);
++
++ fProbeActivateButton = new Button(buttonComposite, SWT.RADIO);
++ fProbeActivateButton.setText(Messages.TraceControl_EnableGroupSelectionName);
++ fProbeActivateButton.setSelection(false);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fProbeActivateButton.setLayoutData(data);
++ fProbeActivateButton.addSelectionListener(new SelectionAdapter() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ setKernelEnablements(KernelGroupEnum.PROBE);
++ }
++ });
++
++ Group probeGroup = new Group(probeMainGroup, SWT.SHADOW_NONE);
++ layout = new GridLayout(4, true);
++ probeGroup.setLayout(layout);
++ probeGroup.setLayoutData(new GridData(GridData.FILL_HORIZONTAL));
++
++ Label probeNameLabel = new Label(probeGroup, SWT.LEFT);
++ probeNameLabel.setText(Messages.TraceControl_EnableEventsEventNameLabel);
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 1;
++ probeNameLabel.setLayoutData(data);
++
++ fProbeEventNameText = new Text(probeGroup, SWT.LEFT);
++ fProbeEventNameText.setToolTipText(Messages.TraceControl_EnableEventsProbeEventNameTooltip);
++
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 3;
++ fProbeEventNameText.setLayoutData(data);
++
++ Label probeLabel = new Label(probeGroup, SWT.LEFT);
++ probeLabel.setText(Messages.TraceControl_EnableEventsProbeNameLabel);
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 1;
++ probeLabel.setLayoutData(data);
++
++ fProbeText = new Text(probeGroup, SWT.LEFT);
++ fProbeText.setToolTipText(Messages.TraceControl_EnableEventsProbeNameTooltip);
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 3;
++ fProbeText.setLayoutData(data);
++ }
++
++ /**
++ * Creates dynamic function entry/return probe group.
++ */
++ private void createDynamicFunctionPropeGroup() {
++ GridLayout layout;
++ GridData data;
++ Group functionMainGroup = new Group(this, SWT.SHADOW_NONE);
++ functionMainGroup.setText(Messages.TraceControl_EnableEventsFucntionGroupName);
++ layout = new GridLayout(2, false);
++ functionMainGroup.setLayout(layout);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ functionMainGroup.setLayoutData(data);
++
++ Composite buttonComposite = new Composite(functionMainGroup, SWT.NONE);
++ layout = new GridLayout(1, false);
++ buttonComposite.setLayout(layout);
++ data = new GridData(SWT.BEGINNING, SWT.CENTER, false, true);
++ buttonComposite.setLayoutData(data);
++
++ fFunctionActivateButton = new Button(buttonComposite, SWT.RADIO);
++ fFunctionActivateButton.setText(Messages.TraceControl_EnableGroupSelectionName);
++ fFunctionActivateButton.setSelection(false);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fFunctionActivateButton.setLayoutData(data);
++ fFunctionActivateButton.addSelectionListener(new SelectionAdapter() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ setKernelEnablements(KernelGroupEnum.FUNCTION);
++ }
++ });
++
++ Group functionGroup = new Group(functionMainGroup, SWT.SHADOW_NONE);
++ layout = new GridLayout(4, true);
++ functionGroup.setLayout(layout);
++ functionGroup.setLayoutData(new GridData(GridData.FILL_HORIZONTAL));
++
++ Label functionNameLabel = new Label(functionGroup, SWT.LEFT);
++ functionNameLabel.setText(Messages.TraceControl_EnableEventsEventNameLabel);
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 1;
++ functionNameLabel.setLayoutData(data);
++
++ fFunctionEventNameText = new Text(functionGroup, SWT.LEFT);
++ fFunctionEventNameText.setToolTipText(Messages.TraceControl_EnableEventsFunctionEventNameTooltip);
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 3;
++ fFunctionEventNameText.setLayoutData(data);
++
++ Label functionLabel = new Label(functionGroup, SWT.LEFT);
++ functionLabel.setText(Messages.TraceControl_EnableEventsFunctionNameLabel);
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 1;
++ functionLabel.setLayoutData(data);
++
++ fFunctionText = new Text(functionGroup, SWT.LEFT);
++ fFunctionText.setToolTipText(Messages.TraceControl_EnableEventsProbeNameTooltip);
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 3;
++ fFunctionText.setLayoutData(data);
++ }
++
++ /**
++ * Enable/selects widgets depending on the group specified.
++ * @param group - group to enable.
++ */
++ private void setKernelEnablements(KernelGroupEnum group) {
++ fTracepointsActivateButton.setSelection(group == KernelGroupEnum.TRACEPOINTS);
++ fTracepointsViewer.getTree().setEnabled(group == KernelGroupEnum.TRACEPOINTS);
++
++ fSysCallsActivateButton.setSelection(group == KernelGroupEnum.SYSCALLS);
++
++ fProbeActivateButton.setSelection(group == KernelGroupEnum.PROBE);
++ fProbeEventNameText.setEnabled(group == KernelGroupEnum.PROBE);
++ fProbeText.setEnabled(group == KernelGroupEnum.PROBE);
++
++ fFunctionActivateButton.setSelection(group == KernelGroupEnum.FUNCTION);
++ fFunctionEventNameText.setEnabled(group == KernelGroupEnum.FUNCTION);
++ fFunctionText.setEnabled(group == KernelGroupEnum.FUNCTION);
++ }
++
++ // ------------------------------------------------------------------------
++ // Local classes
++ // ------------------------------------------------------------------------
++ /**
++ * Content provider for the tracepoints tree.
++ */
++ final public class KernelContentProvider extends TraceControlContentProvider {
++ @Override
++ public Object[] getChildren(Object parentElement) {
++ if (parentElement instanceof TraceProviderGroup) {
++ List<ITraceControlComponent> children = ((ITraceControlComponent)parentElement).getChildren(KernelProviderComponent.class);
++ return (ITraceControlComponent[]) children.toArray(new ITraceControlComponent[children.size()]);
++ }
++ if (parentElement instanceof ITraceControlComponent) {
++ return ((ITraceControlComponent)parentElement).getChildren();
++ }
++ return new Object[0];
++ }
++ }
++
++ /**
++ * Content label for the tracepoints tree.
++ */
++ final public class KernelLabelProvider extends TraceControlLabelProvider {
++ @Override
++ public Image getImage(Object element) {
++ return null;
++ }
++ @Override
++ public String getText(Object element) {
++ if ((element != null) && (element instanceof KernelProviderComponent)) {
++ return Messages.TraceControl_EnableEventsTracepointTreeAllLabel;
++ }
++ return super.getText(element);
++ }
++ }
++
++ /**
++ * Check state listener for the tracepoints tree.
++ */
++ final public class KernelCheckListener implements ICheckStateListener {
++ @Override
++ public void checkStateChanged(CheckStateChangedEvent event) {
++ if (event.getChecked()) {
++ if (event.getElement() instanceof KernelProviderComponent) {
++ fTracepointsViewer.setSubtreeChecked(event.getElement(), true);
++ }
++ } else {
++ if (event.getElement() instanceof KernelProviderComponent) {
++ fTracepointsViewer.setSubtreeChecked(event.getElement(), false);
++ } else {
++ ITraceControlComponent component = (ITraceControlComponent) event.getElement();
++ fTracepointsViewer.setChecked(component.getParent(), false);
++ }
++ }
++ }
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import java.util.ArrayList;
++import java.util.HashSet;
++import java.util.List;
++import java.util.Set;
++
++import org.eclipse.jface.dialogs.MessageDialog;
++import org.eclipse.jface.viewers.CheckStateChangedEvent;
++import org.eclipse.jface.viewers.CheckboxTreeViewer;
++import org.eclipse.jface.viewers.ICheckStateListener;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.TraceControlContentProvider;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.TraceControlLabelProvider;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProviderGroup;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.UstProviderComponent;
++import org.eclipse.swt.SWT;
++import org.eclipse.swt.custom.CCombo;
++import org.eclipse.swt.events.SelectionAdapter;
++import org.eclipse.swt.events.SelectionEvent;
++import org.eclipse.swt.graphics.Image;
++import org.eclipse.swt.layout.GridData;
++import org.eclipse.swt.layout.GridLayout;
++import org.eclipse.swt.widgets.Button;
++import org.eclipse.swt.widgets.Composite;
++import org.eclipse.swt.widgets.Group;
++import org.eclipse.swt.widgets.Label;
++import org.eclipse.swt.widgets.Text;
++
++/**
++ * <b><u>EnableUstEventsComposite</u></b>
++ * <p>
++ * A composite for collecting information about UST events to be enabled.
++ * </p>
++ */
++public class EnableUstEventsComposite extends Composite implements IEnableUstEvents {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++
++ private enum GroupEnum { TRACEPOINTS, WILDCARD, LOGLEVEL };
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++
++ /**
++ * A button to enable/disable the tracepoints group
++ */
++ private Button fTracepointsActivateButton;
++ /**
++ * A tree viewer for diplaying and selection of available tracepoints.
++ */
++ private CheckboxTreeViewer fTracepointsViewer;
++ /**
++ * A button to enable/disable the wildcard group
++ */
++ private Button fWildcardActivateButton;
++ /**
++ * A Text field for the event's wildcard.
++ */
++ private Text fWildcardText;
++ /**
++ * A button to enable/disable the log level group
++ */
++ private Button fLogLevelActivateButton;
++ /**
++ * A Text field for the event name for the log level enablement.
++ */
++ private Text fLogLevelEventNameText;
++ /**
++ * A Combo box for selecting the log level.
++ */
++ private CCombo fLogLevelCombo;
++ /**
++ * A button for selecting the log level (range 0 to level).
++ */
++ private Button fLogLevelButton;
++ /**
++ * A button for selecting the specified log level only.
++ */
++ private Button fLogLevelOnlyButton;
++ /**
++ * The referenced trace provider group containing the UST providers
++ * component which contains a list of available tracepoints.
++ */
++ private TraceProviderGroup fProviderGroup;
++ /**
++ * The flag indicating that tracepoints are selected.
++ */
++ private boolean fIsTracepoints;
++ /**
++ * The flag indicating that all tracepoints (across providers) are selected.
++ */
++ private boolean fIsAllTracepoints;
++ /**
++ * The list of tracepoints to be enabled.
++ */
++ private List<String> fSelectedEvents;
++ /**
++ * The flag indicating that all wildcard are selected..
++ */
++ private boolean fIsWildcard;
++ /**
++ * The wildcard if wildcard is selected.
++ */
++ private String fWildcard;
++ /**
++ *The flag indicating that all log level are selected.
++ */
++ private boolean fIsLogLevel;
++ /**
++ * The event name for the log level enablement.
++ */
++ private String fLogLevelEventName;
++ /**
++ * The type of the log level (loglevel or loglevel-only)
++ */
++ private LogLevelType fLogLevelType;
++ /**
++ * The actual selected log level.
++ */
++ private TraceLogLevel fLogLevel;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param parent - a parent composite
++ * @Param style - a compsite style
++ * @param providerGroup - the trace provider group
++ */
++ public EnableUstEventsComposite(Composite parent, int style, TraceProviderGroup providerGroup) {
++ super(parent, style);
++ fProviderGroup = providerGroup;
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#isTracepoints()
++ */
++ @Override
++ public boolean isTracepoints() {
++ return fIsTracepoints;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#isAllTracePoints()
++ */
++ @Override
++ public boolean isAllTracePoints() {
++ return fIsAllTracepoints;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#getEventNames()
++ */
++ @Override
++ public List<String> getEventNames() {
++ return new ArrayList<String>(fSelectedEvents);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#isWildcard()
++ */
++ @Override
++ public boolean isWildcard() {
++ return fIsWildcard;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#getWildcard()
++ */
++ @Override
++ public String getWildcard() {
++ return "\"" + fWildcard + "\""; //$NON-NLS-1$//$NON-NLS-2$
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#isLogLevel()
++ */
++ @Override
++ public boolean isLogLevel() {
++ return fIsLogLevel;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#getLogLevelType()
++ */
++ @Override
++ public LogLevelType getLogLevelType() {
++ return fLogLevelType;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#getLogLevel()
++ */
++ @Override
++ public TraceLogLevel getLogLevel() {
++ return fLogLevel;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableUstEvents#getLogLevelEventName()
++ */
++ @Override
++ public String getLogLevelEventName() {
++ return fLogLevelEventName;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ public void createContent() {
++
++ // Tracepoints Group
++ createTracepointsGroup();
++
++ // Wildcard Group
++ createWildCardGroup();
++
++ // Log Level Group
++ createLogLevelGroup();
++
++ // Set default enablements
++ setEnablements(GroupEnum.TRACEPOINTS);
++ }
++
++ /**
++ * Validates the kernel composite input data.
++ * @return true if configured data is valid and can be retrieved.
++ */
++ public boolean isValid() {
++
++ fIsTracepoints = fTracepointsActivateButton.getSelection();
++ fIsWildcard = fWildcardActivateButton.getSelection();
++ fIsLogLevel = fLogLevelActivateButton.getSelection();
++
++ fIsAllTracepoints = fTracepointsViewer.getChecked(fProviderGroup);
++
++ Set<String> set = new HashSet<String>();
++ Object[] checkedElements = fTracepointsViewer.getCheckedElements();
++ fSelectedEvents = new ArrayList<String>();
++ for (int i = 0; i < checkedElements.length; i++) {
++ ITraceControlComponent component = (ITraceControlComponent)checkedElements[i];
++ if (!set.contains(component.getName()) && (component instanceof BaseEventComponent)) {
++ set.add(component.getName());
++ fSelectedEvents.add(component.getName());
++ }
++ }
++
++ if (fLogLevelButton.getSelection()) {
++ fLogLevelType = LogLevelType.LOGLEVEL;
++ } else if (fLogLevelOnlyButton.getSelection()) {
++ fLogLevelType = LogLevelType.LOGLEVEL_ONLY;
++ } else {
++ fLogLevelType = LogLevelType.LOGLEVEL_NONE;
++ }
++
++ // initialize log level event name string
++ fLogLevelEventName = null;
++ String temp = fLogLevelEventNameText.getText();
++ if (!temp.matches("^[\\s]{0,}$") && !temp.matches("^[a-zA-Z0-9\\-\\_]{1,}$")) { //$NON-NLS-1$ //$NON-NLS-2$
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_EnableEventsDialogTitle,
++ Messages.TraceControl_InvalidLogLevelEventNameError + " (" + temp + ") \n"); //$NON-NLS-1$ //$NON-NLS-2$
++
++ return false;
++ }
++
++ if(!temp.matches("\\s*")) { //$NON-NLS-1$
++ fLogLevelEventName = temp;
++ }
++
++ // initialize log level event name string
++ fWildcard = null;
++ temp = fWildcardText.getText();
++ if (!temp.matches("^[\\s]{0,}$") && !temp.matches("^[a-zA-Z0-9\\-\\_\\*]{1,}$")) { //$NON-NLS-1$ //$NON-NLS-2$
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_EnableEventsDialogTitle,
++ Messages.TraceControl_InvalidWildcardError + " (" + temp + ") \n"); //$NON-NLS-1$ //$NON-NLS-2$
++
++ return false;
++ }
++
++ if(!temp.matches("\\s*")) { //$NON-NLS-1$
++ fWildcard = temp;
++ }
++
++ // validation successful -> call super.okPressed()
++ return true;
++ }
++
++ // ------------------------------------------------------------------------
++ // Helper methods
++ // ------------------------------------------------------------------------
++
++ /**
++ * Creates tracepoints group.
++ */
++ private void createTracepointsGroup() {
++ Group tpMainGroup = new Group(this, SWT.SHADOW_NONE);
++ tpMainGroup.setText(Messages.TraceControl_EnableEventsTracepointGroupName);
++ GridLayout layout = new GridLayout(2, false);
++ tpMainGroup.setLayout(layout);
++ GridData data = new GridData(GridData.FILL_BOTH);
++ tpMainGroup.setLayoutData(data);
++
++ Composite buttonComposite = new Composite(tpMainGroup, SWT.NONE);
++ layout = new GridLayout(1, true);
++ buttonComposite.setLayout(layout);
++ data = new GridData(SWT.BEGINNING, SWT.CENTER, false, true);
++ buttonComposite.setLayoutData(data);
++
++ fTracepointsActivateButton = new Button(buttonComposite, SWT.RADIO);
++ fTracepointsActivateButton.setText(Messages.TraceControl_EnableGroupSelectionName);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fTracepointsActivateButton.setLayoutData(data);
++ fTracepointsActivateButton.addSelectionListener(new SelectionAdapter() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ setEnablements(GroupEnum.TRACEPOINTS);
++ }
++ });
++
++ Group tpGroup = new Group(tpMainGroup, SWT.SHADOW_NONE);
++ layout = new GridLayout(1, true);
++ tpGroup.setLayout(layout);
++ data = new GridData(GridData.FILL_BOTH);
++ tpGroup.setLayoutData(data);
++
++ fTracepointsViewer = new CheckboxTreeViewer(tpGroup, SWT.MULTI | SWT.H_SCROLL | SWT.V_SCROLL);
++ fTracepointsViewer.getTree().setToolTipText(Messages.TraceControl_EnableEventsTracepointTreeTooltip);
++ fTracepointsViewer.setContentProvider(new UstContentProvider());
++
++ fTracepointsViewer.setLabelProvider(new UstLabelProvider());
++ fTracepointsViewer.addCheckStateListener(new UstCheckStateListener());
++
++ fTracepointsViewer.setInput(fProviderGroup.getParent());
++ fTracepointsViewer.getTree().setLayoutData(new GridData(GridData.FILL_BOTH));
++ }
++
++ /**
++ * Creates wildcard group.
++ */
++ private void createWildCardGroup() {
++ Group wildcardMainGroup = new Group(this, SWT.SHADOW_NONE);
++ wildcardMainGroup.setText(Messages.TraceControl_EnableEventsWildcardGroupName);
++ GridLayout layout = new GridLayout(2, false);
++ wildcardMainGroup.setLayout(layout);
++ GridData data = new GridData(GridData.FILL_HORIZONTAL);
++ wildcardMainGroup.setLayoutData(data);
++
++ Composite buttonComposite = new Composite(wildcardMainGroup, SWT.NONE);
++ layout = new GridLayout(1, false);
++ buttonComposite.setLayout(layout);
++ data = new GridData(SWT.BEGINNING, SWT.CENTER, false, true);
++ buttonComposite.setLayoutData(data);
++
++ fWildcardActivateButton = new Button(buttonComposite, SWT.RADIO);
++ fWildcardActivateButton.setText(Messages.TraceControl_EnableGroupSelectionName);
++ fWildcardActivateButton.setSelection(false);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fWildcardActivateButton.setLayoutData(data);
++ fWildcardActivateButton.addSelectionListener(new SelectionAdapter() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ setEnablements(GroupEnum.WILDCARD);
++ }
++ });
++
++ Group wildcardGroup = new Group(wildcardMainGroup, SWT.SHADOW_NONE);
++ layout = new GridLayout(3, true);
++ wildcardGroup.setLayout(layout);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ wildcardGroup.setLayoutData(data);
++
++ Label wildcardLabel = new Label(wildcardGroup, SWT.LEFT);
++ wildcardLabel.setText(Messages.TraceControl_EnableEventsWildcardLabel);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ data.horizontalSpan = 1;
++ wildcardLabel.setLayoutData(data);
++
++ fWildcardText = new Text(wildcardGroup, SWT.LEFT);
++ fWildcardText.setToolTipText(Messages.TraceControl_EnableEventsWildcardTooltip);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ data.horizontalSpan = 2;
++ fWildcardText.setLayoutData(data);
++ }
++
++ /**
++ * Creates log level group.
++ */
++ private void createLogLevelGroup() {
++ Group logLevelMainGroup = new Group(this, SWT.SHADOW_NONE);
++ logLevelMainGroup.setText(Messages.TraceControl_EnableEventsLogLevelGroupName);
++ GridLayout layout = new GridLayout(2, false);
++ logLevelMainGroup.setLayout(layout);
++ GridData data = new GridData(GridData.FILL_HORIZONTAL);
++ logLevelMainGroup.setLayoutData(data);
++
++ Composite buttonComposite = new Composite(logLevelMainGroup, SWT.NONE);
++ layout = new GridLayout(1, false);
++ buttonComposite.setLayout(layout);
++ data = new GridData(SWT.BEGINNING, SWT.CENTER, false, true);
++ buttonComposite.setLayoutData(data);
++
++ fLogLevelActivateButton = new Button(buttonComposite, SWT.RADIO);
++ fLogLevelActivateButton.setText(Messages.TraceControl_EnableGroupSelectionName);
++ fLogLevelActivateButton.setSelection(false);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fLogLevelActivateButton.setLayoutData(data);
++ fLogLevelActivateButton.addSelectionListener(new SelectionAdapter() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ setEnablements(GroupEnum.LOGLEVEL);
++ }
++ });
++
++ Group logLevelGroup = new Group(logLevelMainGroup, SWT.SHADOW_NONE);
++ layout = new GridLayout(3, true);
++ logLevelGroup.setLayout(layout);
++ logLevelGroup.setLayoutData(new GridData(GridData.FILL_HORIZONTAL));
++
++ Label logLevelEventNameLabel = new Label(logLevelGroup, SWT.LEFT);
++ logLevelEventNameLabel.setText(Messages.TraceControl_EnableEventsEventNameLabel);
++
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 1;
++ logLevelEventNameLabel.setLayoutData(data);
++
++ fLogLevelEventNameText = new Text(logLevelGroup, SWT.LEFT);
++ fLogLevelEventNameText.setToolTipText(Messages.TraceControl_EnableEventsLoglevelEventNameTooltip);
++ data = new GridData(GridData.FILL_BOTH);
++ data.horizontalSpan = 2;
++ fLogLevelEventNameText.setLayoutData(data);
++
++ TraceLogLevel[] levels = TraceLogLevel.values();
++
++ String[] levelNames = new String[levels.length - 1];
++ int k = 0;
++ for (int i = 0; i < levels.length; i++) {
++ if (levels[i] != TraceLogLevel.LEVEL_UNKNOWN) {
++ levelNames[k++] = levels[i].getInName();
++ }
++ }
++
++ fLogLevelCombo = new CCombo(logLevelGroup, SWT.READ_ONLY);
++ fLogLevelCombo.setItems(levelNames);
++ fLogLevelCombo.setToolTipText(Messages.TraceControl_EnableEventsLogLevelTooltip);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ data.horizontalSpan = 4;
++ fLogLevelCombo.setLayoutData(data);
++
++ fLogLevelButton = new Button(logLevelGroup, SWT.RADIO);
++ fLogLevelButton.setText(Messages.TraceControl_EnableEventsLogLevelTypeName);
++ fLogLevelButton.setToolTipText(Messages.TraceControl_EnableEventsLogLevelTypeTooltip);
++ data = new GridData(GridData.FILL_BOTH);
++ fLogLevelButton.setLayoutData(data);
++
++ fLogLevelOnlyButton = new Button(logLevelGroup, SWT.RADIO);
++ fLogLevelOnlyButton.setText(Messages.TraceControl_EnableEventsLogLevelOnlyTypeName);
++ fLogLevelOnlyButton.setToolTipText(Messages.TraceControl_EnableEventsLogLevelOnlyTypeTooltip);
++ data = new GridData(GridData.FILL_BOTH);
++ fLogLevelButton.setLayoutData(data);
++ }
++
++ /**
++ * Enable/selects widgets depending on the group specified.
++ * @param group - group to enable.
++ */
++ private void setEnablements(GroupEnum group) {
++
++ // Enable/disable trace point items
++ fTracepointsActivateButton.setSelection(group == GroupEnum.TRACEPOINTS);
++ fTracepointsViewer.getTree().setEnabled(group == GroupEnum.TRACEPOINTS);
++
++ // Enable/disable wildcard items
++ fWildcardActivateButton.setSelection(group == GroupEnum.WILDCARD);
++ fWildcardText.setEnabled(group == GroupEnum.WILDCARD);
++
++ // Enable/disable log level items
++ fLogLevelActivateButton.setSelection(group == GroupEnum.LOGLEVEL);
++ fLogLevelEventNameText.setEnabled(group == GroupEnum.LOGLEVEL);
++ fLogLevelCombo.setEnabled(group == GroupEnum.LOGLEVEL);
++ fLogLevelButton.setEnabled(group == GroupEnum.LOGLEVEL);
++ fLogLevelOnlyButton.setEnabled(group == GroupEnum.LOGLEVEL);
++ }
++
++ // ------------------------------------------------------------------------
++ // Local classes
++ // ------------------------------------------------------------------------
++ /**
++ * Content provider for the tracepoints tree.
++ */
++ final public class UstContentProvider extends TraceControlContentProvider {
++ @Override
++ public Object[] getChildren(Object parentElement) {
++ if (parentElement instanceof TargetNodeComponent) {
++ List<ITraceControlComponent> children = ((ITraceControlComponent)parentElement).getChildren(TraceProviderGroup.class);
++ return (ITraceControlComponent[]) children.toArray(new ITraceControlComponent[children.size()]);
++ }
++ if (parentElement instanceof TraceProviderGroup) {
++ List<ITraceControlComponent> children = ((ITraceControlComponent)parentElement).getChildren(UstProviderComponent.class);
++ return (ITraceControlComponent[]) children.toArray(new ITraceControlComponent[children.size()]);
++ }
++ if (parentElement instanceof ITraceControlComponent) {
++ return ((ITraceControlComponent)parentElement).getChildren();
++ }
++ return new Object[0];
++ }
++ }
++
++ /**
++ * Content label for the tracepoints tree.
++ */
++ final public class UstLabelProvider extends TraceControlLabelProvider {
++ @Override
++ public Image getImage(Object element) {
++ return null;
++ }
++ @Override
++ public String getText(Object element) {
++ if ((element != null) && (element instanceof TraceProviderGroup)) {
++ return Messages.TraceControl_EnableEventsTracepointTreeAllLabel;
++ }
++
++ if ((element != null) && (element instanceof UstProviderComponent)) {
++ return Messages.TraceControl_EnableEventsTracepointTreeAllLabel + " - " + ((UstProviderComponent)element).getName(); //$NON-NLS-1$
++ }
++ return super.getText(element);
++ }
++ }
++
++ /**
++ * Check state listener for the tracepoints tree.
++ */
++ final public class UstCheckStateListener implements ICheckStateListener {
++ @Override
++ public void checkStateChanged(CheckStateChangedEvent event) {
++ if (event.getChecked()) {
++ if (event.getElement() instanceof TraceProviderGroup) {
++ fTracepointsViewer.setSubtreeChecked(event.getElement(), true);
++ }
++ if (event.getElement() instanceof UstProviderComponent) {
++ fTracepointsViewer.setSubtreeChecked(event.getElement(), true);
++ }
++ } else {
++ if (event.getElement() instanceof TraceProviderGroup) {
++ fTracepointsViewer.setSubtreeChecked(event.getElement(), true);
++ }
++ if (event.getElement() instanceof UstProviderComponent) {
++ ITraceControlComponent component = (ITraceControlComponent) event.getElement();
++ fTracepointsViewer.setSubtreeChecked(event.getElement(), false);
++ fTracepointsViewer.setChecked(component.getParent(), false);
++ } else {
++ ITraceControlComponent component = (ITraceControlComponent) event.getElement();
++ fTracepointsViewer.setChecked(component.getParent(), false);
++ fTracepointsViewer.setChecked(component.getParent().getParent(), false);
++ }
++ }
++ }
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import java.util.Arrays;
++
++import org.eclipse.jface.dialogs.Dialog;
++import org.eclipse.jface.dialogs.IDialogConstants;
++import org.eclipse.jface.dialogs.MessageDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.swt.SWT;
++import org.eclipse.swt.custom.CCombo;
++import org.eclipse.swt.events.SelectionEvent;
++import org.eclipse.swt.events.SelectionListener;
++import org.eclipse.swt.layout.GridData;
++import org.eclipse.swt.layout.GridLayout;
++import org.eclipse.swt.widgets.Composite;
++import org.eclipse.swt.widgets.Control;
++import org.eclipse.swt.widgets.Group;
++import org.eclipse.swt.widgets.Shell;
++
++/**
++ * <b><u>EnableEventsDialog</u></b>
++ * <p>
++ * Dialog box for collecting information about the events to enable.
++ * </p>
++ */
++public class GetEventInfoDialog extends Dialog implements IGetEventInfoDialog {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The icon file for this dialog box.
++ */
++ public static final String TARGET_NEW_CONNECTION_ICON_FILE = "icons/elcl16/edit.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The dialog composite.
++ */
++ private Composite fDialogComposite = null;
++ /**
++ * The Group for the session combo box.
++ */
++ private Group fSessionsGroup = null;
++ /**
++ * The Group for the channel combo box.
++ */
++ private Group fChannelsGroup = null;
++ /**
++ * The session combo box.
++ */
++ private CCombo fSessionsCombo = null;
++ /**
++ * The channel combo box.
++ */
++ private CCombo fChannelsCombo = null;
++ /**
++ * The list of available sessions.
++ */
++ private TraceSessionComponent[] fSessions;
++ /**
++ * True for kernel, false for UST.
++ */
++ private boolean fIsKernel;
++ /**
++ * Index in session array (selected session).
++ */
++ private int fSessionIndex = 0;
++ /**
++ * The Channel where the events should be enabled.
++ */
++ private TraceChannelComponent fChannel;
++ /**
++ * List of available channels of the selected session.
++ */
++ private TraceChannelComponent[] fChannels;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor of dialog box.
++ * @param shell - the shell for the dialog box
++ */
++ public GetEventInfoDialog(Shell shell) {
++ super(shell);
++ setShellStyle(SWT.RESIZE);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableEventsDialog#getSession()
++ */
++ @Override
++ public TraceSessionComponent getSession() {
++ return fSessions[fSessionIndex];
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableEventsDialog#getChannel()
++ */
++ @Override
++ public TraceChannelComponent getChannel() {
++ return fChannel;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IGetEventInfoDialog#setIsKernel(boolean)
++ */
++ @Override
++ public void setIsKernel(boolean isKernel) {
++ fIsKernel = isKernel;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IGetEventInfoDialog#setSessions(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent[])
++ */
++ @Override
++ public void setSessions(TraceSessionComponent[] sessions) {
++ fSessions = Arrays.copyOf(sessions, sessions.length);
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.window.Window#configureShell(org.eclipse.swt.widgets.Shell)
++ */
++ @Override
++ protected void configureShell(Shell newShell) {
++ super.configureShell(newShell);
++ newShell.setText(Messages.TraceControl_EnableEventsDialogTitle);
++ newShell.setImage(Activator.getDefault().loadIcon(TARGET_NEW_CONNECTION_ICON_FILE));
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createDialogArea(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected Control createDialogArea(Composite parent) {
++
++ // Main dialog panel
++ fDialogComposite = new Composite(parent, SWT.NONE);
++ GridLayout layout = new GridLayout(1, true);
++ fDialogComposite.setLayout(layout);
++ fDialogComposite.setLayoutData(new GridData(GridData.FILL_BOTH));
++
++ fSessionsGroup = new Group(fDialogComposite, SWT.SHADOW_NONE);
++ fSessionsGroup.setText(Messages.TraceControl_EnableEventsSessionGroupName);
++ layout = new GridLayout(1, true);
++ fSessionsGroup.setLayout(layout);
++ GridData data = new GridData(GridData.FILL_HORIZONTAL);
++ fSessionsGroup.setLayoutData(data);
++
++ fSessionsCombo = new CCombo(fSessionsGroup, SWT.READ_ONLY);
++ fSessionsCombo.setToolTipText(Messages.TraceControl_EnableEventsSessionsTooltip);
++ fSessionsCombo.setLayoutData(new GridData(GridData.FILL_HORIZONTAL));
++
++ String items[] = new String[fSessions.length];
++ for (int i = 0; i < items.length; i++) {
++ items[i] = String.valueOf(fSessions[i].getName());
++ }
++
++ fSessionsCombo.setItems(items);
++ fSessionsCombo.setEnabled(fSessions.length > 0);
++
++ fChannelsGroup = new Group(fDialogComposite, SWT.SHADOW_NONE);
++ fChannelsGroup.setText(Messages.TraceControl_EnableEventsChannelGroupName);
++ layout = new GridLayout(1, true);
++ fChannelsGroup.setLayout(layout);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fChannelsGroup.setLayoutData(data);
++
++ fChannelsCombo = new CCombo(fChannelsGroup, SWT.READ_ONLY);
++ fChannelsCombo.setToolTipText(Messages.TraceControl_EnableEventsChannelsTooltip);
++ fChannelsCombo.setLayoutData(new GridData(GridData.FILL_HORIZONTAL));
++ fChannelsCombo.setEnabled(false);
++
++ fSessionsCombo.addSelectionListener(new SelectionListener() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ fSessionIndex = fSessionsCombo.getSelectionIndex();
++
++ if (fSessionIndex >= 0) {
++ TraceDomainComponent domain = null;
++ TraceDomainComponent[] domains = fSessions[fSessionIndex].getDomains();
++ for (int i = 0; i < domains.length; i++) {
++
++ if (domains[i].isKernel() == fIsKernel) {
++ domain = domains[i];
++ break;
++ }
++ }
++
++ if (domain != null) {
++ fChannels = domain.getChannels();
++ String items[] = new String[fChannels.length];
++ for (int i = 0; i < items.length; i++) {
++ items[i] = String.valueOf(fChannels[i].getName());
++ }
++ fChannelsCombo.setItems(items);
++ fChannelsCombo.setEnabled(fChannels.length > 0);
++ } else {
++ fChannelsCombo.setItems(new String[0]);
++ fChannelsCombo.setEnabled(false);
++ fChannels = null;
++ }
++ fChannelsCombo.getParent().getParent().layout();
++ }
++ }
++
++ @Override
++ public void widgetDefaultSelected(SelectionEvent e) {
++ }
++ });
++ return fDialogComposite;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createButtonsForButtonBar(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected void createButtonsForButtonBar(Composite parent) {
++ createButton(parent, IDialogConstants.OK_ID, "&Ok", true); //$NON-NLS-1$
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#okPressed()
++ */
++ @Override
++ protected void okPressed() {
++
++ if (fSessionsCombo.getSelectionIndex() < 0) {
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_EnableEventsDialogTitle,
++ Messages.TraceControl_EnableEventsNoSessionError);
++ return;
++ }
++
++ fSessionIndex = fSessionsCombo.getSelectionIndex();
++
++ if ((fChannels != null) && (fChannels.length > 0) && (fChannelsCombo.getSelectionIndex() < 0)) {
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_EnableEventsDialogTitle,
++ Messages.TraceControl_EnableEventsNoChannelError);
++ return;
++ }
++
++ if ((fChannels != null) && (fChannels.length > 0)) {
++ fChannel = fChannels[fChannelsCombo.getSelectionIndex()];
++ }
++
++ super.okPressed();
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import org.eclipse.swt.widgets.Shell;
++
++/**
++ * <b><u>IConfirmDialog</u></b>
++ * <p>
++ * Interface for a confirmation dialog.
++ * </p>
++ */
++public interface IConfirmDialog {
++
++ public boolean openConfirm(Shell parent, String title, String message);
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++
++/**
++ * <b><u>ICreateChannelDialog</u></b>
++ * <p>
++ * Interface for the create channel dialog when domain is known.
++ * </p>
++ */
++public interface ICreateChannelDialog {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return the configuration info for the new channel.
++ */
++ public IChannelInfo getChannelInfo();
++
++ /**
++ * Sets the domain component
++ * @param domain - the trace domain component
++ */
++ public void setDomainComponent(TraceDomainComponent domain);
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * @return the open return value
++ */
++ int open();
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++
++/**
++ * <b><u>ICreateChannelOnSessionDialog</u></b>
++ * <p>
++ * Interface for the create channel dialog when domain is known, i.e. dialog
++ * was opened on session level.
++ * </p>
++ */
++public interface ICreateChannelOnSessionDialog extends ICreateChannelDialog {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return true for Kernel domain. False for UST.
++ */
++ public boolean isKernel();
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionGroup;
++
++/**
++ * <b><u>ICreateSessionDialog</u></b>
++ * <p>
++ * Interface for create session dialog.
++ * </p>
++ */
++public interface ICreateSessionDialog {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return the session name.
++ */
++ public String getSessionName();
++
++ /**
++ * @return the session path (null for default path)
++ */
++ public String getSessionPath();
++
++ /**
++ * @return true for default location else false
++ */
++ public boolean isDefaultSessionPath();
++
++ /**
++ * Set trace session group.
++ * @param group - the session group
++ */
++ public void setTraceSessionGroup(TraceSessionGroup group);
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * @return the open return value
++ */
++ int open();
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProviderGroup;
++
++/**
++ * <b><u>IEnableKernelEvents</u></b>
++ * <p>
++ * Interface for providing information about Kernel or UST events to be enabled.
++ * </p>
++ */
++public interface IEnableEventsDialog extends IEnableKernelEvents, IEnableUstEvents {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return the session the events shall be enabled.
++ */
++ public boolean isKernel();
++
++ /**
++ * Sets the trace provider group.
++ * @param providerGroup - a trace provider group
++ */
++ public void setTraceProviderGroup(TraceProviderGroup providerGroup);
++
++ /**
++ * Sets the trace domain component.
++ * @param domain - a domain of the events (null if not known)
++ */
++ public void setTraceDomainComponent(TraceDomainComponent domain);
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * @return returns the open return value
++ */
++ int open();
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import java.util.List;
++
++/**
++ * <b><u>IEnableKernelEvents</u></b>
++ * <p>
++ * Interface for providing information about kernel events to be enabled.
++ * </p>
++ */
++public interface IEnableKernelEvents {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /**
++ * @return a flag whether the tracepoints shall be configured.
++ */
++ public boolean isTracepoints();
++
++ /**
++ * @return a flag indicating whether all tracepoints shall be enabled or not.
++ */
++ public boolean isAllTracePoints();
++
++ /**
++ * @return a flag whether the syscalls shall be configured.
++ */
++ public boolean isSysCalls();
++
++ /**
++ * @return a flag indicating whether syscalls shall be enabled or not.
++ */
++ public boolean isAllSysCalls();
++
++ /**
++ * @return a list of event names to be enabled.
++ */
++ public List<String> getEventNames();
++
++ /**
++ * @return a flag whether the dynamic probe shall be configured.
++ */
++ public boolean isDynamicProbe();
++
++ /**
++ * @return event name of the dynamic probe (or null if no dynamic probe).
++ */
++ public String getProbeEventName();
++
++ /**
++ * @return the dynamic probe (or null if no dynamic probe).
++ */
++ public String getProbeName();
++
++ /**
++ * @return a flag whether the dynamic function entry/return probe shall be configured.
++ */
++ public boolean isDynamicFunctionProbe();
++
++ /**
++ * @return event name of the dynamic function entry/exit probe (or null if no dynamic probe).
++ */
++ public String getFunctionEventName();
++
++ /**
++ * @return the dynamic function entry/exit probe (or null if no dynamic probe).
++ */
++ public String getFunction();
++
++// /**
++// * @return a flag whether events using wildcards should be enabled
++// */
++// public boolean isWildcard();
++//
++// /**
++// * @return a wildcard
++// */
++// public String getWildcard();
++//
++// /**
++// * @return a flag whether events using log levels should be enabled
++// */
++// public boolean isLogLevel();
++//
++// /**
++// * @return a log level type (loglevel or loglevel-only)
++// */
++// public LogLevelType getLogLevelType();
++//
++// /**
++// * @return a log level
++// */
++// public TraceLogLevel getLogLevel();
++//
++// /**
++// * @return a event name for the log level enable action
++// */
++// public String getLogLevelEventName();
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import java.util.List;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++
++/**
++ * <b><u>IEnableKernelEvents</u></b>
++ * <p>
++ * Interface for providing information about UST events to be enabled.
++ * </p>
++ */
++public interface IEnableUstEvents {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /**
++ * @return a flag whether the tracepoints shall be configured.
++ */
++ public boolean isTracepoints();
++
++ /**
++ * @return a flag indicating whether all tracepoints shall be enabled or not.
++ */
++ public boolean isAllTracePoints();
++
++ /**
++ * @return a list of event names to be enabled.
++ */
++ public List<String> getEventNames();
++
++ /**
++ * @return a flag whether events using wildcards should be enabled
++ */
++ public boolean isWildcard();
++
++ /**
++ * @return a wildcard
++ */
++ public String getWildcard();
++
++ /**
++ * @return a flag whether events using log levels should be enabled
++ */
++ public boolean isLogLevel();
++
++ /**
++ * @return a log level type (loglevel or loglevel-only)
++ */
++ public LogLevelType getLogLevelType();
++
++ /**
++ * @return a log level
++ */
++ public TraceLogLevel getLogLevel();
++
++ /**
++ * @return a event name for the log level enable action
++ */
++ public String getLogLevelEventName();
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++
++/**
++ * <b><u>IEnableEventsDialog</u></b>
++ * <p>
++ * Interface for a dialog box for collecting information about the events to enable.
++ * </p>
++ */
++public interface IGetEventInfoDialog {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return the session the events shall be enabled.
++ */
++ public TraceSessionComponent getSession();
++
++ /**
++ * @return the channel the events shall be enabled. Null for default channel.
++ */
++ public TraceChannelComponent getChannel();
++
++ /**
++ * Sets flag about domain.
++ * @param isKernel - true for kernel, false for UST
++ */
++ public void setIsKernel(boolean isKernel);
++
++ /**
++ * Sets available session.
++ * @param sessions - a array of available sessions.
++ */
++ public void setSessions(TraceSessionComponent[] sessions);
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * @return returns the open return value
++ */
++ int open();
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.rse.core.model.IHost;
++
++/**
++ * <b><u>INewConnectionDialog</u></b>
++ * <p>
++ * Interface for connection information dialog.
++ * </p>
++ */
++public interface INewConnectionDialog {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return the connection name (alias).
++ */
++ public String getConnectionName();
++
++ /**
++ * @return the host name (IP address or DNS name)
++ */
++ public String getHostName();
++
++ /**
++ * Sets the trace control root
++ * @param parent - the trace control parent
++ */
++ public void setTraceControlParent(ITraceControlComponent parent);
++
++ /**
++ * Sets the available hosts to select.
++ * @param hosts - the available hosts
++ */
++ public void setHosts(IHost[] hosts);
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * @return returns the open return value
++ */
++ int open();
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import java.util.Arrays;
++
++import org.eclipse.jface.dialogs.Dialog;
++import org.eclipse.jface.dialogs.IDialogConstants;
++import org.eclipse.jface.dialogs.MessageDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.rse.core.model.IHost;
++import org.eclipse.swt.SWT;
++import org.eclipse.swt.custom.CCombo;
++import org.eclipse.swt.events.SelectionEvent;
++import org.eclipse.swt.events.SelectionListener;
++import org.eclipse.swt.graphics.Point;
++import org.eclipse.swt.layout.GridData;
++import org.eclipse.swt.layout.GridLayout;
++import org.eclipse.swt.widgets.Button;
++import org.eclipse.swt.widgets.Composite;
++import org.eclipse.swt.widgets.Control;
++import org.eclipse.swt.widgets.Group;
++import org.eclipse.swt.widgets.Label;
++import org.eclipse.swt.widgets.Shell;
++import org.eclipse.swt.widgets.Text;
++
++/**
++ * <b><u>NewConnectionDialog</u></b>
++ * <p>
++ * Dialog box for connection information.
++ * </p>
++ */
++public class NewConnectionDialog extends Dialog implements INewConnectionDialog {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The icon file for this dialog box.
++ */
++ public static final String TARGET_NEW_CONNECTION_ICON_FILE = "icons/elcl16/target_add.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The dialog composite.
++ */
++ private Composite fDialogComposite = null;
++ /**
++ * The Group for the host combo box.
++ */
++ private Group fComboGroup = null;
++ /**
++ * The Group for the text input.
++ */
++ private Group fTextGroup = null;
++ /**
++ * The host combo box.
++ */
++ private CCombo fExistingHostsCombo = null;
++ /**
++ * The check box button for enabling/disabling the text input.
++ */
++ private Button fButton = null;
++ /**
++ * The text widget for the node name (alias)
++ */
++ private Text fConnectionNameText = null;
++ /**
++ * The text widget for the node address (IP or DNS name)
++ */
++ private Text fHostNameText = null;
++ /**
++ * The parent where the new node should be added.
++ */
++ private ITraceControlComponent fParent;
++ /**
++ * The node name (alias) string.
++ */
++ private String fConnectionName = null;
++ /**
++ * The node address (IP or DNS name) string.
++ */
++ private String fHostName = null;
++
++ /**
++ * Input list of existing RSE hosts available for selection.
++ */
++ private IHost[] fExistingHosts = new IHost[0];
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ public NewConnectionDialog(Shell shell) {
++ super(shell);
++ setShellStyle(SWT.RESIZE);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.INewConnectionDialog#getConnectionName()
++ */
++ @Override
++ public String getConnectionName() {
++ return fConnectionName;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.INewConnectionDialog#getHostName()
++ */
++ @Override
++ public String getHostName() {
++ return fHostName;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.INewConnectionDialog#setTraceControlParent(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void setTraceControlParent(ITraceControlComponent parent) {
++ fParent = parent;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.INewConnectionDialog#setHosts(org.eclipse.rse.core.model.IHost[])
++ */
++ @Override
++ public void setHosts(IHost[] hosts) {
++ if (hosts != null) {
++ fExistingHosts = Arrays.copyOf(hosts, hosts.length);
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.window.Window#configureShell(org.eclipse.swt.widgets.Shell)
++ */
++ @Override
++ protected void configureShell(Shell newShell) {
++ super.configureShell(newShell);
++ newShell.setText(Messages.TraceControl_NewDialogTitle);
++ newShell.setImage(Activator.getDefault().loadIcon(TARGET_NEW_CONNECTION_ICON_FILE));
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createDialogArea(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected Control createDialogArea(Composite parent) {
++
++ // Main dialog panel
++ fDialogComposite = new Composite(parent, SWT.NONE);
++ GridLayout layout = new GridLayout(1, true);
++ fDialogComposite.setLayout(layout);
++ fDialogComposite.setLayoutData(new GridData(GridData.FILL_BOTH));
++
++ // Existing connections group
++ fComboGroup = new Group(fDialogComposite, SWT.SHADOW_NONE);
++ fComboGroup.setText(Messages.TraceControl_NewNodeExistingConnectionGroupName);
++ layout = new GridLayout(2, true);
++ fComboGroup.setLayout(layout);
++ GridData data = new GridData(GridData.FILL_HORIZONTAL);
++ fComboGroup.setLayoutData(data);
++
++ fExistingHostsCombo = new CCombo(fComboGroup, SWT.READ_ONLY);
++ fExistingHostsCombo.setToolTipText(Messages.TraceControl_NewNodeComboToolTip);
++ fExistingHostsCombo.setLayoutData(new GridData(GridData.FILL, GridData.CENTER, true, false, 2, 1));
++
++ String items[] = new String[fExistingHosts.length];
++ for (int i = 0; i < items.length; i++) {
++ items[i] = String.valueOf(fExistingHosts[i].getAliasName() + " - " + fExistingHosts[i].getHostName()); //$NON-NLS-1$
++ }
++
++ fExistingHostsCombo.setItems(items);
++ fExistingHostsCombo.setEnabled(fExistingHosts.length > 0);
++
++ // Node information grop
++ fTextGroup = new Group(fDialogComposite, SWT.SHADOW_NONE);
++ layout = new GridLayout(3, true);
++ fTextGroup.setLayout(layout);
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fTextGroup.setLayoutData(data);
++
++ fButton = new Button(fTextGroup, SWT.CHECK);
++ fButton.setLayoutData(new GridData(GridData.FILL, GridData.CENTER, true, false, 3, 1));
++ fButton.setText(Messages.TraceControl_NewNodeEditButtonName);
++ fButton.setEnabled(fExistingHosts.length > 0);
++
++ Label connectionNameLabel = new Label(fTextGroup, SWT.RIGHT);
++ connectionNameLabel.setText(Messages.TraceControl_NewNodeConnectionNameLabel);
++ fConnectionNameText = new Text(fTextGroup, SWT.NONE);
++ fConnectionNameText.setToolTipText(Messages.TraceControl_NewNodeConnectionNameTooltip);
++ fConnectionNameText.setEnabled(fExistingHosts.length == 0);
++
++ Label hostNameLabel = new Label(fTextGroup, SWT.RIGHT);
++ hostNameLabel.setText(Messages.TraceControl_NewNodeHostNameLabel);
++ fHostNameText = new Text(fTextGroup, SWT.NONE);
++ fHostNameText.setToolTipText(Messages.TraceControl_NewNodeHostNameTooltip);
++ fHostNameText.setEnabled(fExistingHosts.length == 0);
++
++ fButton.addSelectionListener(new SelectionListener() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ if (fButton.getSelection()) {
++ fExistingHostsCombo.deselectAll();
++ fExistingHostsCombo.setEnabled(false);
++ fConnectionNameText.setEnabled(true);
++ fHostNameText.setEnabled(true);
++ } else {
++ fExistingHostsCombo.setEnabled(true);
++ fConnectionNameText.setEnabled(false);
++ fHostNameText.setEnabled(false);
++ }
++ }
++
++ @Override
++ public void widgetDefaultSelected(SelectionEvent e) {
++ }
++ });
++
++ fExistingHostsCombo.addSelectionListener(new SelectionListener() {
++ @Override
++ public void widgetSelected(SelectionEvent e) {
++ int index = fExistingHostsCombo.getSelectionIndex();
++ fConnectionNameText.setText(fExistingHosts[index].getAliasName());
++ fHostNameText.setText(fExistingHosts[index].getHostName());
++ }
++
++ @Override
++ public void widgetDefaultSelected(SelectionEvent e) {
++ }
++ });
++
++ // layout widgets
++ data = new GridData(GridData.FILL_HORIZONTAL);
++ fHostNameText.setText("666.666.666.666"); //$NON-NLS-1$
++ Point minSize = fHostNameText.computeSize(SWT.DEFAULT, SWT.DEFAULT, true);
++ data.widthHint = minSize.x + 5;
++ data.horizontalSpan = 2;
++
++ fConnectionNameText.setLayoutData(data);
++ fHostNameText.setLayoutData(data);
++
++ fHostNameText.setText(""); //$NON-NLS-1$
++
++ return fDialogComposite;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#createButtonsForButtonBar(org.eclipse.swt.widgets.Composite)
++ */
++ @Override
++ protected void createButtonsForButtonBar(Composite parent) {
++ createButton(parent, IDialogConstants.OK_ID, "&Ok", true); //$NON-NLS-1$
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.jface.dialogs.Dialog#okPressed()
++ */
++ @Override
++ protected void okPressed() {
++ // Validate input data
++ fConnectionName = fConnectionNameText.getText();
++ fHostName = fHostNameText.getText();
++
++ if (!"".equals(fHostName)) { //$NON-NLS-1$
++ // If no node name is specified use the node address as name
++ if ("".equals(fConnectionName)) { //$NON-NLS-1$
++ fConnectionName = fHostName;
++ }
++ // Check if node with name already exists in parent
++ if(fParent.containsChild(fConnectionName)) {
++ MessageDialog.openError(getShell(),
++ Messages.TraceControl_NewDialogTitle,
++ Messages.TraceControl_AlreadyExistsError + " (" + fConnectionName + ")"); //$NON-NLS-1$//$NON-NLS-2$
++ return;
++ }
++ }
++ else {
++ return;
++ }
++ // validation successful -> call super.okPressed()
++ super.okPressed();
++ }
++}
--- /dev/null
--- /dev/null
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs;
++
++import org.eclipse.ui.PlatformUI;
++
++
++public class TraceControlDialogFactory {
++
++ // ------------------------------------------------------------------------
++ // Members
++ // ------------------------------------------------------------------------
++
++ /**
++ * The factory instance.
++ */
++ private static TraceControlDialogFactory fInstance;
++
++ /**
++ * The new connection dialog reference.
++ */
++ private INewConnectionDialog fNewConnectionDialog;
++
++ /**
++ * The create channel dialog (on domain level)
++ */
++ private ICreateChannelDialog fCreateChannelDialog;
++
++ /**
++ * The create channel dialog (on session level)
++ */
++ private ICreateChannelOnSessionDialog fCreateChannelOnSessionDialog;
++
++ /**
++ * The create session dialog.
++ */
++ private ICreateSessionDialog fCreateSessionDialog;
++
++ /**
++ * The enable events dialog.
++ */
++ private IEnableEventsDialog fEnableEventsDialog;
++
++ /**
++ * The get event info dialog.
++ */
++ private IGetEventInfoDialog fGetEventInfoDialog;
++
++ /**
++ * The confirmation dialog implementation
++ */
++ private IConfirmDialog fConfirmDialog;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++
++ /**
++ * Constructor for R4EUIDialogFactory.
++ */
++ private TraceControlDialogFactory() {
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /**
++ * @return TraceControlDialogFactory instance
++ */
++ public static TraceControlDialogFactory getInstance() {
++ if (null == fInstance) {
++ fInstance = new TraceControlDialogFactory();
++ }
++ return fInstance;
++ }
++
++ /**
++ * @return new connection dialog
++ */
++ public INewConnectionDialog getNewConnectionDialog() {
++ if (null == fNewConnectionDialog) {
++ fNewConnectionDialog = new NewConnectionDialog(PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell());
++ }
++ return fNewConnectionDialog;
++ }
++
++ /**
++ * Sets a new connection dialog implementation.
++ * @param newConnectionDialog - new connection dialog implementation
++ */
++ public void setNewConnectionDialog(INewConnectionDialog newConnectionDialog) {
++ fNewConnectionDialog = newConnectionDialog;
++ }
++
++ /**
++ * @return create channel dialog (on domain level)
++ */
++ public ICreateChannelDialog getCreateChannelDialog() {
++ if (null == fCreateChannelDialog) {
++ fCreateChannelDialog = new CreateChannelDialog(PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell());
++ }
++ return fCreateChannelDialog;
++ }
++
++ /**
++ * Sets a create channel dialog implementation (on domain level).
++ * @param createChannelDialog - a create channel dialog implementation
++ */
++ public void setCreateChannelDialog(ICreateChannelDialog createChannelDialog) {
++ fCreateChannelDialog = createChannelDialog;
++ }
++
++ /**
++ * @return create channel dialog (on session level)
++ */
++ public ICreateChannelOnSessionDialog getCreateChannelOnSessionDialog() {
++ if (null == fCreateChannelOnSessionDialog) {
++ fCreateChannelOnSessionDialog = new CreateChannelDialog(PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell());
++ }
++ return fCreateChannelOnSessionDialog;
++ }
++
++ /**
++ * Sets a create channel dialog implementation (on domain level).
++ * @param createChannelDialog - a create channel dialog implementation
++ */
++ public void setCreateChannelOnSessionDialog(ICreateChannelOnSessionDialog createChannelDialog) {
++ fCreateChannelOnSessionDialog = createChannelDialog;
++ }
++
++ /**
++ * @return create session dialog implementation
++ */
++ public ICreateSessionDialog getCreateSessionDialog() {
++ if (null == fCreateSessionDialog) {
++ fCreateSessionDialog = new CreateSessionDialog(PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell());
++ }
++ return fCreateSessionDialog;
++ }
++
++ /**
++ * Sets a create session dialog implementation.
++ * @param createSessionDialog - a create session implementation.
++ */
++ public void setCreateSessionDialog(ICreateSessionDialog createSessionDialog) {
++ fCreateSessionDialog = createSessionDialog;
++ }
++
++ /**
++ * @return enable events dialog implementation.
++ */
++ public IEnableEventsDialog getEnableEventsDialog() {
++ if (null == fEnableEventsDialog) {
++ fEnableEventsDialog = new EnableEventsDialog(PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell());
++ }
++ return fEnableEventsDialog;
++ }
++
++ /**
++ * Sets a enable events dialog implementation.
++ * @param enableEventsDialog - a enable events dialog implementation.
++ */
++ public void setEnableEventsDialog(IEnableEventsDialog enableEventsDialog) {
++ fEnableEventsDialog = enableEventsDialog;
++ }
++
++ /**
++ * @return get events info dialog implementation.
++ */
++ public IGetEventInfoDialog getGetEventInfoDialog() {
++ if (null == fGetEventInfoDialog) {
++ fGetEventInfoDialog = new GetEventInfoDialog(PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell());
++ }
++ return fGetEventInfoDialog;
++ }
++
++ /**
++ * Sets a get events info dialog implementation.
++ * @param getEventInfoDialog - a get events info dialog implementation
++ */
++ public void setGetEventInfoDialog(IGetEventInfoDialog getEventInfoDialog) {
++ fGetEventInfoDialog = getEventInfoDialog;
++ }
++
++ /**
++ * @return the confirmation dialog implementation
++ */
++ public IConfirmDialog getConfirmDialog() {
++ if (null == fConfirmDialog) {
++ fConfirmDialog = new ConfirmDialog();
++ }
++ return fConfirmDialog;
++ }
++
++ /**
++ * Sets the confirmation dialog implementation
++ * @param confirmDialog
++ */
++ public void setConfirmDialog(IConfirmDialog confirmDialog) {
++ fConfirmDialog = confirmDialog;
++ }
++}
++
++
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.jface.window.Window;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IGetEventInfoDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.TraceControlDialogFactory;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.KernelProviderComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.UstProviderComponent;
++import org.eclipse.ui.IWorkbenchPage;
++
++/**
++ * <b><u>EnableEventHandler</u></b>
++ * <p>
++ * Command handler implementation to assign events to a session and channel and enable/configure them.
++ * This is done on the trace provider level.
++ * </p>
++ */
++public class AssignEventHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The list of event components the command is to be executed on.
++ */
++ private List<BaseEventComponent> fEvents = new ArrayList<BaseEventComponent>();
++
++ /**
++ * The list of available sessions.
++ */
++ private TraceSessionComponent[] fSessions;
++
++ /**
++ * Flag for indicating Kernel or UST.
++ */
++ Boolean fIsKernel = null;
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++
++ // Open dialog box to retrieve the session and channel where the events should be enabled in.
++ final IGetEventInfoDialog dialog = TraceControlDialogFactory.getInstance().getGetEventInfoDialog();
++ dialog.setIsKernel(fIsKernel);
++ dialog.setSessions(fSessions);
++
++ if (dialog.open() != Window.OK) {
++ return null;
++ }
++
++ Job job = new Job(Messages.TraceControl_EnableEventsJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++
++ String errorString = null;
++ try {
++ List<String> eventNames = new ArrayList<String>();
++ // Create list of event names
++ for (Iterator<BaseEventComponent> iterator = fEvents.iterator(); iterator.hasNext();) {
++ BaseEventComponent event = (BaseEventComponent) iterator.next();
++ eventNames.add(event.getName());
++ }
++
++ TraceChannelComponent channel = dialog.getChannel();
++ if (channel == null) {
++ // enable events on default channel (which will be created by lttng-tools)
++ dialog.getSession().enableEvents(eventNames, fIsKernel, monitor);
++ } else {
++ channel.enableEvents(eventNames, monitor);
++ }
++
++ } catch (ExecutionException e) {
++ errorString = e.toString() + "\n"; //$NON-NLS-1$
++ }
++
++ // get session configuration in all cases
++ try {
++ dialog.getSession().getConfigurationFromNode(monitor);
++ } catch (ExecutionException e) {
++ if (errorString == null) {
++ errorString = new String();
++ }
++ errorString += Messages.TraceControl_ListSessionFailure + ": " + e.toString(); //$NON-NLS-1$
++ }
++
++ if (errorString != null) {
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, errorString);
++ }
++ return Status.OK_STATUS;
++ }
++ };
++ job.setUser(true);
++ job.schedule();
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ fEvents.clear();
++ fSessions = null;
++ fIsKernel = null;
++
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ // Check if one or more session are selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++
++ StructuredSelection structered = ((StructuredSelection) selection);
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++ if (element instanceof BaseEventComponent) {
++ BaseEventComponent event = (BaseEventComponent) element;
++ ITraceControlComponent provider = event.getParent();
++
++ // check for kernel or UST provider
++ boolean temp = false;
++ if (provider instanceof KernelProviderComponent) {
++ temp = true;
++ } else if (provider instanceof UstProviderComponent) {
++ temp = false;
++ } else {
++ return false;
++ }
++ if (fIsKernel == null) {
++ fIsKernel = Boolean.valueOf(temp);
++ } else {
++ // don't mix events from Kernel and UST provider
++ if (fIsKernel.booleanValue() != temp) {
++ return false;
++ }
++ }
++
++ // Add BaseEventComponents
++ fEvents.add(event);
++
++ if (fSessions == null) {
++ TargetNodeComponent root = (TargetNodeComponent)event.getParent().getParent().getParent();
++ fSessions = root.getSessions();
++ }
++ }
++ }
++ }
++ return ((fEvents.size() > 0) && (fSessions != null) && (fSessions.length > 0));
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import org.eclipse.core.commands.AbstractHandler;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.ui.IWorkbenchPage;
++import org.eclipse.ui.IWorkbenchPart;
++import org.eclipse.ui.IWorkbenchWindow;
++import org.eclipse.ui.PlatformUI;
++
++/**
++ * <b><u>BaseControlViewHandler</u></b>
++ * <p>
++ * Abstract Command handler implementation for all control view handlers.
++ * </p>
++ */
++abstract public class BaseControlViewHandler extends AbstractHandler {
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * @return returns the workbench page for the Control View
++ */
++ protected IWorkbenchPage getWorkbenchPage() {
++ // Check if we are closing down
++ IWorkbenchWindow window = PlatformUI.getWorkbench().getActiveWorkbenchWindow();
++ if (window == null) {
++ return null;
++ }
++
++ // Check if we are in the Project View
++ IWorkbenchPage page = window.getActivePage();
++ if (page == null) {
++ return null;
++ }
++
++ IWorkbenchPart part = page.getActivePart();
++ if (!(part instanceof ControlView)) {
++ return null;
++ }
++ return page;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.jface.window.Window;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IEnableEventsDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.TraceControlDialogFactory;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProviderGroup;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.IWorkbenchWindow;
++import org.eclipse.ui.PlatformUI;
++
++/**
++ * <b><u>EnableEventOnSessionHandler</u></b>
++ * <p>
++ * Base command handler implementation to enable events.
++ * </p>
++ */
++abstract public class BaseEnableEventHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The session component the command is to be executed on.
++ */
++ protected TraceSessionComponent fSession = null;
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Enables a list of events for given parameters.
++ * @param eventNames - list of event names
++ * @param isKernel - true if kernel domain else false
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ abstract public void enableEvents(List<String> eventNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException;
++ /**
++ * Enables all syscall events.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ abstract public void enableSyscalls(IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Enables a dynamic probe.
++ * @param eventName - a event name
++ * @param isFunction - true for dynamic function entry/return probe else false
++ * @param probe - a dynamic probe information
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ abstract public void enableProbe(String eventName, boolean isFunction, String probe, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Enables events using log level
++ * @param eventName - a event name
++ * @param logLevelType - a log level type
++ * @param level - a log level
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ abstract public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * @return returns the relevant domain (null if domain is not known)
++ */
++ abstract TraceDomainComponent getDomain();
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++
++ final IWorkbenchWindow window = PlatformUI.getWorkbench().getActiveWorkbenchWindow();
++
++ if (window == null) {
++ return false;
++ }
++
++ TargetNodeComponent node = fSession.getTargetNode();
++ List<ITraceControlComponent> providers = node.getChildren(TraceProviderGroup.class);
++
++ final IEnableEventsDialog dialog = TraceControlDialogFactory.getInstance().getEnableEventsDialog();
++ dialog.setTraceProviderGroup((TraceProviderGroup)providers.get(0));
++ dialog.setTraceDomainComponent(getDomain());
++
++ if (dialog.open() != Window.OK) {
++ return null;
++ }
++
++ Job job = new Job(Messages.TraceControl_ChangeEventStateJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++ String errorString = null;
++
++ try {
++ // Enable tracepoint events
++ if (dialog.isTracepoints()) {
++ if (dialog.isAllTracePoints()) {
++ enableEvents(null, dialog.isKernel(), monitor);
++ } else {
++ List<String> eventNames = dialog.getEventNames();
++ if (eventNames.size() > 0) {
++ enableEvents(eventNames, dialog.isKernel(), monitor);
++ }
++ }
++ }
++
++ // Enable syscall events
++ if (dialog.isAllSysCalls()) {
++ if (dialog.isAllSysCalls()) {
++ enableSyscalls(monitor);
++ }
++ }
++
++ // Enable dynamic probe
++ if (dialog.isDynamicProbe()) {
++ if ((dialog.getProbeEventName() != null && dialog.getProbeName() != null)) {
++ enableProbe(dialog.getProbeEventName(), false, dialog.getProbeName(), monitor);
++ }
++ }
++
++ // Enable dynamic function probe
++ if (dialog.isDynamicFunctionProbe()) {
++ if ((dialog.getFunctionEventName() != null) && (dialog.getFunction() != null)) {
++ enableProbe(dialog.getFunctionEventName(), true, dialog.getFunction(), monitor);
++ }
++ }
++
++ // Enable event using a wildcard
++ if (dialog.isWildcard()) {
++ List<String> eventNames = dialog.getEventNames();
++ eventNames.add(dialog.getWildcard());
++
++ if (eventNames.size() > 0) {
++ enableEvents(eventNames, dialog.isKernel(), monitor);
++ }
++ }
++
++ // Enable events using log level
++ if (dialog.isLogLevel()) {
++ enableLogLevel(dialog.getLogLevelEventName(), dialog.getLogLevelType(), dialog.getLogLevel(), monitor);
++ }
++
++ } catch (ExecutionException e) {
++ if (errorString == null) {
++ errorString = new String();
++ }
++ errorString += e.toString() + "\n"; //$NON-NLS-1$
++ }
++
++ // get session configuration in all cases
++ try {
++ fSession.getConfigurationFromNode(monitor);
++ } catch (ExecutionException e) {
++ if (errorString == null) {
++ errorString = new String();
++ }
++ errorString += Messages.TraceControl_ListSessionFailure + ": " + e.toString(); //$NON-NLS-1$
++ }
++
++ if (errorString != null) {
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, errorString);
++ }
++ return Status.OK_STATUS;
++ }
++ };
++ job.setUser(true);
++ job.schedule();
++
++ return null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.ui.IWorkbenchPage;
++
++/**
++ * <b><u>BaseNodeHandler</u></b>
++ * <p>
++ * Command handler implementation to delete a target host.
++ * </p>
++ */
++abstract public class BaseNodeHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The target node component the command is to be executed on.
++ */
++ protected TargetNodeComponent fTargetNode = null;
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ fTargetNode = null;
++
++ // Check if the node component is selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ Object element = ((StructuredSelection) selection).getFirstElement();
++ fTargetNode = (element instanceof TargetNodeComponent) ? (TargetNodeComponent) element : null;
++ }
++ return fTargetNode != null;
++ }
++
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.IWorkbenchPage;
++import org.eclipse.ui.IWorkbenchWindow;
++import org.eclipse.ui.PlatformUI;
++
++/**
++ * <b><u>ChangeChannelStateHandler</u></b>
++ * <p>
++ * Abstract command handler implementation to enable or disabling a trace channel.
++ * </p>
++ */
++abstract public class ChangeChannelStateHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * Kernel domain component reference.
++ */
++ protected TraceDomainComponent fKernelDomain = null;
++ /**
++ * UST domain component reference.
++ */
++ protected TraceDomainComponent fUstDomain = null;
++ /**
++ * The list of kernel channel components the command is to be executed on.
++ */
++ protected List<TraceChannelComponent> fKernelChannels = new ArrayList<TraceChannelComponent>();
++ /**
++ * The list of UST channel components the command is to be executed on.
++ */
++ protected List<TraceChannelComponent> fUstChannels = new ArrayList<TraceChannelComponent>();
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return the new state to set
++ */
++ abstract protected TraceEnablement getNewState();
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Changes the state of the given channels.
++ * @param domain - the domain of the channels.
++ * @param channelNames - a list of channel names
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ abstract protected void changeState(TraceDomainComponent domain, List<String> channelNames, IProgressMonitor monitor) throws ExecutionException;
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++
++ IWorkbenchWindow window = PlatformUI.getWorkbench().getActiveWorkbenchWindow();
++
++ if (window == null) {
++ return false;
++ }
++
++ Job job = new Job(Messages.TraceControl_ChangeChannelStateJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++ String errorString = null;
++
++ TraceSessionComponent session = null;
++
++ try {
++ if (fKernelDomain != null) {
++ session = (TraceSessionComponent)fKernelDomain.getParent();
++ List<String> channelNames = new ArrayList<String>();
++ for (Iterator<TraceChannelComponent> iterator = fKernelChannels.iterator(); iterator.hasNext();) {
++ // Enable all selected channels which are disabled
++ TraceChannelComponent channel = (TraceChannelComponent) iterator.next();
++ channelNames.add(channel.getName());
++ }
++
++ changeState(fKernelDomain, channelNames, monitor);
++
++ for (Iterator<TraceChannelComponent> iterator = fKernelChannels.iterator(); iterator.hasNext();) {
++ // Enable all selected channels which are disabled
++ TraceChannelComponent channel = (TraceChannelComponent) iterator.next();
++ channel.setState(getNewState());
++ }
++ }
++
++ if (fUstDomain != null) {
++ if (session == null) {
++ session = (TraceSessionComponent)fUstDomain.getParent();
++ }
++
++ List<String> channelNames = new ArrayList<String>();
++ for (Iterator<TraceChannelComponent> iterator = fUstChannels.iterator(); iterator.hasNext();) {
++ // Enable all selected channels which are disabled
++ TraceChannelComponent channel = (TraceChannelComponent) iterator.next();
++ channelNames.add(channel.getName());
++ }
++
++ changeState(fUstDomain, channelNames, monitor);
++
++ for (Iterator<TraceChannelComponent> iterator = fUstChannels.iterator(); iterator.hasNext();) {
++ // Enable all selected channels which are disabled
++ TraceChannelComponent channel = (TraceChannelComponent) iterator.next();
++ channel.setState(getNewState());
++ }
++ }
++ } catch (ExecutionException e) {
++ errorString = e.toString() + "\n"; //$NON-NLS-1$
++ }
++
++ // In all cases notify listeners
++ session.fireComponentChanged(session);
++
++ if (errorString != null) {
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, errorString);
++ }
++
++ return Status.OK_STATUS;
++ }
++ };
++ job.setUser(true);
++ job.schedule();
++
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ reset();
++
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ // Check if one or more session are selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ StructuredSelection structered = ((StructuredSelection) selection);
++ String sessionName = null;
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++
++ if (element instanceof TraceChannelComponent) {
++
++ // Add only TraceChannelComponents that are disabled
++ TraceChannelComponent channel = (TraceChannelComponent) element;
++ if (sessionName == null) {
++ sessionName = String.valueOf(channel.getSessionName());
++ }
++
++ // Enable command only for channels of same session
++ if (!sessionName.equals(channel.getSessionName())) {
++ reset();
++ break;
++ }
++
++ if ((channel.getState() != getNewState())) {
++ if (channel.isKernel()) {
++ fKernelChannels.add(channel);
++ if (fKernelDomain == null) {
++ fKernelDomain = (TraceDomainComponent) channel.getParent();
++ }
++ } else {
++ fUstChannels.add(channel);
++ if (fUstDomain == null) {
++ fUstDomain = (TraceDomainComponent) channel.getParent();
++ }
++ }
++ }
++ }
++ }
++ }
++ return fKernelChannels.size() + fUstChannels.size() > 0;
++ }
++
++ /**
++ * Reset members
++ */
++ private void reset() {
++ fKernelDomain = null;
++ fUstDomain = null;
++ fKernelChannels.clear();
++ fUstChannels.clear();
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.IWorkbenchPage;
++import org.eclipse.ui.IWorkbenchWindow;
++import org.eclipse.ui.PlatformUI;
++
++/**
++ * <b><u>EnableChannelHandler</u></b>
++ * <p>
++ * Base Command handler implementation to enable or disabling a trace channel.
++ * </p>
++ */
++abstract public class ChangeEventStateHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * Channel component reference.
++ */
++ protected TraceChannelComponent fChannel = null;
++ /**
++ * The list of kernel channel components the command is to be executed on.
++ */
++ protected List<TraceEventComponent> fEvents = new ArrayList<TraceEventComponent>();
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return the new state to set
++ */
++ abstract protected TraceEnablement getNewState();
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Change the state
++ * @param channel - channel of events to be enabled
++ * @param eventNames - list event names
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ abstract protected void changeState(TraceChannelComponent channel, List<String> eventNames, IProgressMonitor monitor) throws ExecutionException;
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++
++ IWorkbenchWindow window = PlatformUI.getWorkbench().getActiveWorkbenchWindow();
++
++ if (window == null) {
++ return false;
++ }
++
++ Job job = new Job(Messages.TraceControl_ChangeChannelStateJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++ String errorString = null;
++
++ TraceSessionComponent session = null;
++
++ try {
++ boolean isAll = false;
++ if (fChannel != null) {
++ session = fChannel.getSession();
++ List<String> eventNames = new ArrayList<String>();
++ for (Iterator<TraceEventComponent> iterator = fEvents.iterator(); iterator.hasNext();) {
++ // Enable/disable all selected channels which are disabled
++ TraceEventComponent event = (TraceEventComponent) iterator.next();
++
++ // Workaround for wildcard handling in lttng-tools
++ if ("*".equals(event.getName())) { //$NON-NLS-1$
++ isAll = true;
++ } else {
++ eventNames.add(event.getName());
++ }
++ }
++ if (isAll) {
++ changeState(fChannel, null, monitor);
++ }
++
++ if (eventNames.size() > 0) {
++ changeState(fChannel, eventNames, monitor);
++ }
++
++ for (Iterator<TraceEventComponent> iterator = fEvents.iterator(); iterator.hasNext();) {
++ // Enable all selected channels which are disabled
++ TraceEventComponent ev = (TraceEventComponent) iterator.next();
++ ev.setState(getNewState());
++ }
++ }
++ } catch (ExecutionException e) {
++ errorString = e.toString() + "\n"; //$NON-NLS-1$
++ }
++
++ // In all cases notify listeners
++ session.fireComponentChanged(session);
++
++ if (errorString != null) {
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, errorString);
++ }
++
++ return Status.OK_STATUS;
++ }
++ };
++ job.setUser(true);
++ job.schedule();
++
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ reset();
++
++ // Check if one or more session are selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ StructuredSelection structered = ((StructuredSelection) selection);
++ String sessionName = null;
++ String channelName = null;
++
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++
++ if (element instanceof TraceEventComponent) {
++
++ TraceEventComponent event = (TraceEventComponent) element;
++ if (sessionName == null) {
++ sessionName = String.valueOf(event.getSessionName());
++ }
++
++ if (fChannel == null) {
++ fChannel = (TraceChannelComponent)event.getParent();
++ }
++
++ if (channelName == null) {
++ channelName = event.getChannelName();
++ }
++
++ // Enable command only for events of same session, same channel and domain
++ if ((!sessionName.equals(event.getSessionName())) ||
++ (!channelName.equals(event.getChannelName())) ||
++ (fChannel.isKernel() != event.isKernel())) {
++ reset();
++ break;
++ }
++
++ if ((event.getState() != getNewState())) {
++ fEvents.add(event);
++ }
++ }
++ }
++ }
++ return fEvents.size() > 0;
++ }
++
++ /**
++ * Reset members
++ */
++ private void reset() {
++ fChannel = null;
++ fEvents.clear();
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.IWorkbenchPage;
++import org.eclipse.ui.IWorkbenchWindow;
++import org.eclipse.ui.PlatformUI;
++
++/**
++ * <b><u>ChangeSessionStateHandler</u></b>
++ * <p>
++ * Abstract command handler implementation to start or stop one or more trace sessions.
++ * </p>
++ */
++abstract public class ChangeSessionStateHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The list of session components the command is to be executed on.
++ */
++ protected List<TraceSessionComponent> fSessions = new ArrayList<TraceSessionComponent>();
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /**
++ * @return new required state.
++ */
++ abstract TraceSessionState getNewState();
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /**
++ * Performs the state change on given session.
++ * @param session - a session which state is to be changed
++ * @param monitor - a progress monitor
++ */
++ abstract public void changeState(TraceSessionComponent session, IProgressMonitor monitor) throws ExecutionException;
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++
++ IWorkbenchWindow window = PlatformUI.getWorkbench().getActiveWorkbenchWindow();
++
++ if (window == null) {
++ return false;
++ }
++
++ Job job = new Job(Messages.TraceControl_StartSessionJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++ try {
++ for (Iterator<TraceSessionComponent> iterator = fSessions.iterator(); iterator.hasNext();) {
++
++ // Start all selected sessions
++ TraceSessionComponent session = (TraceSessionComponent) iterator.next();
++ changeState(session, monitor);
++
++ // Set Session state
++ session.setSessionState(getNewState());
++ session.fireComponentChanged(session);
++ }
++ } catch (ExecutionException e) {
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, e.toString());
++ }
++ return Status.OK_STATUS;
++ }
++ };
++ job.setUser(true);
++ job.schedule();
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ fSessions.clear();
++
++ // Check if one or more session are selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ StructuredSelection structered = ((StructuredSelection) selection);
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++ if (element instanceof TraceSessionComponent) {
++ // Add only TraceSessionComponents that are inactive and not destroyed
++ TraceSessionComponent session = (TraceSessionComponent) element;
++ if ((session.getSessionState() != getNewState()) && (!session.isDestroyed())) {
++ fSessions.add((TraceSessionComponent)element);
++ }
++ }
++ }
++ }
++ return fSessions.size() > 0;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++
++/**
++ * <b><u>ConnectHandler</u></b>
++ * <p>
++ * Command handler implementation to connect to a target host.
++ * </p>
++ */
++public class ConnectHandler extends BaseNodeHandler {
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseNodeHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++ fTargetNode.connect();
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseNodeHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ return (super.isEnabled() && (fTargetNode.getTargetNodeState() == TargetNodeState.DISCONNECTED));
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.jface.window.Window;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateChannelDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.TraceControlDialogFactory;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.IWorkbenchPage;
++
++/**
++ * <b><u>CreateChannelOnDomainHandler</u></b>
++ * <p>
++ * Command handler implementation to create a trace channel for known domain.
++ * </p>
++ */
++public class CreateChannelOnDomainHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The the domain component the command is to be executed on.
++ */
++ private TraceDomainComponent fDomain;
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++
++ // Get channel information from user
++ final ICreateChannelDialog dialog = TraceControlDialogFactory.getInstance().getCreateChannelDialog();
++ dialog.setDomainComponent(fDomain);
++
++ if (dialog.open() != Window.OK) {
++ return null;
++ }
++
++ Job job = new Job(Messages.TraceControl_ChangeChannelStateJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++ String errorString = null;
++
++ List<String> channelNames = new ArrayList<String>();
++ channelNames.add(dialog.getChannelInfo().getName());
++
++ try {
++ fDomain.enableChannels(channelNames, dialog.getChannelInfo(), monitor);
++ } catch (ExecutionException e) {
++ if (errorString == null) {
++ errorString = new String();
++ }
++ errorString += e.toString() + "\n"; //$NON-NLS-1$
++ }
++
++ // get session configuration in all cases
++ try {
++ fDomain.getConfigurationFromNode(monitor);
++ } catch (ExecutionException e) {
++ if (errorString == null) {
++ errorString = new String();
++ }
++ errorString += Messages.TraceControl_ListSessionFailure + ": " + e.toString(); //$NON-NLS-1$
++ }
++
++ if (errorString != null) {
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, errorString);
++ }
++ return Status.OK_STATUS;
++ }
++ };
++
++ job.setUser(true);
++ job.schedule();
++
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++ fDomain = null;
++
++ // Check if one domain is selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ StructuredSelection structered = ((StructuredSelection) selection);
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++ if (element instanceof TraceDomainComponent) {
++ TraceDomainComponent domain = (TraceDomainComponent) element;
++ TraceSessionComponent session = (TraceSessionComponent) domain.getParent();
++ // Add only TraceDomainComponent whose TraceSessionComponent parent is inactive and not destroyed
++ if ((session.getSessionState() == TraceSessionState.INACTIVE) && (!session.isDestroyed())) {
++ fDomain = domain;
++ }
++ }
++ }
++ }
++ return fDomain != null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.jface.window.Window;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateChannelOnSessionDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.TraceControlDialogFactory;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.IWorkbenchPage;
++
++/**
++ * <b><u>CreateChannelOnSessionHandler</u></b>
++ * <p>
++ * Command handler implementation to create a trace channel for unknown domain
++ * (on session level).
++ * </p>
++ */
++public class CreateChannelOnSessionHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The session component the command is to be executed on.
++ */
++ private TraceSessionComponent fSession = null;
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++
++ final ICreateChannelOnSessionDialog dialog = TraceControlDialogFactory.getInstance().getCreateChannelOnSessionDialog();
++
++ if (dialog.open() != Window.OK) {
++ return null;
++ }
++
++ Job job = new Job(Messages.TraceControl_ChangeChannelStateJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++ String errorString = null;
++
++ List<String> channelNames = new ArrayList<String>();
++ TraceDomainComponent newDomain = new TraceDomainComponent("dummy", fSession); //$NON-NLS-1$
++ channelNames.add(dialog.getChannelInfo().getName());
++ newDomain.setIsKernel(dialog.isKernel());
++
++ try {
++ newDomain.enableChannels(channelNames, dialog.getChannelInfo(), monitor);
++ } catch (ExecutionException e) {
++ if (errorString == null) {
++ errorString = new String();
++ }
++ errorString += e.toString() + "\n"; //$NON-NLS-1$
++ }
++
++ // get session configuration in all cases
++ try {
++ fSession.getConfigurationFromNode(monitor);
++ } catch (ExecutionException e) {
++ if (errorString == null) {
++ errorString = new String();
++ }
++ errorString += Messages.TraceControl_ListSessionFailure + ": " + e.toString(); //$NON-NLS-1$
++ }
++
++ if (errorString != null) {
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, errorString);
++ }
++ return Status.OK_STATUS;
++ }
++ };
++ job.setUser(true);
++ job.schedule();
++
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ fSession = null;
++
++ // Check if one session is selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ StructuredSelection structered = ((StructuredSelection) selection);
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++ if (element instanceof TraceSessionComponent) {
++ // Add only TraceSessionComponents that are inactive and not destroyed
++ TraceSessionComponent session = (TraceSessionComponent) element;
++ if ((session.getSessionState() == TraceSessionState.INACTIVE) && (!session.isDestroyed())) {
++ fSession = session;
++ }
++ }
++ }
++ }
++ return fSession != null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.jface.window.Window;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.ICreateSessionDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.TraceControlDialogFactory;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionGroup;
++import org.eclipse.ui.IWorkbenchPage;
++
++/**
++ * <b><u>CreateSessionHandler</u></b>
++ * <p>
++ * Command handler implementation to create a trace session.
++ * </p>
++ */
++public class CreateSessionHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The trace session group the command is to be executed on.
++ */
++ private TraceSessionGroup fSessionGroup = null;
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++
++ // Open dialog box for the node name and address
++ ICreateSessionDialog dialog = TraceControlDialogFactory.getInstance().getCreateSessionDialog();
++ dialog.setTraceSessionGroup(fSessionGroup);
++
++ if (dialog.open() != Window.OK) {
++ return null;
++ }
++
++ final String sessionName = dialog.getSessionName();
++ final String sessionPath = dialog.isDefaultSessionPath() ? null : dialog.getSessionPath();
++
++ Job job = new Job(Messages.TraceControl_CreateSessionJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++ try {
++ fSessionGroup.createSession(sessionName, sessionPath, monitor);
++ } catch (ExecutionException e) {
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, e.toString());
++ }
++ return Status.OK_STATUS;
++ }
++ };
++ job.setUser(true);
++ job.schedule();
++
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ fSessionGroup = null;
++
++ // Check if the session group project is selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ Object element = ((StructuredSelection) selection).getFirstElement();
++ fSessionGroup = (element instanceof TraceSessionGroup) ? (TraceSessionGroup) element : null;
++ }
++ return fSessionGroup != null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++
++/**
++ * <b><u>DeleteHandler</u></b>
++ * <p>
++ * Command handler implementation to delete a target host.
++ * </p>
++ */
++public class DeleteHandler extends BaseNodeHandler {
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseNodeHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++ ITraceControlComponent root = fTargetNode.getParent();
++ fTargetNode.removeAllChildren();
++ root.removeChild(fTargetNode);
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseNodeHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ return (super.isEnabled() && (fTargetNode.getTargetNodeState() == TargetNodeState.DISCONNECTED));
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.IConfirmDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.TraceControlDialogFactory;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionGroup;
++import org.eclipse.ui.IWorkbenchPage;
++import org.eclipse.ui.IWorkbenchWindow;
++import org.eclipse.ui.PlatformUI;
++
++/**
++ * <b><u>DestroySessionHandler</u></b>
++ * <p>
++ * Command handler implementation to destroy one or more trace sessions.
++ * </p>
++ */
++public class DestroySessionHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The list of session components the command is to be executed on.
++ */
++ private List<TraceSessionComponent> fSessions = new ArrayList<TraceSessionComponent>();
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++
++ IWorkbenchWindow window = PlatformUI.getWorkbench().getActiveWorkbenchWindow();
++
++ if (window == null) {
++ return false;
++ }
++ // Get user confirmation
++ IConfirmDialog dialog = TraceControlDialogFactory.getInstance().getConfirmDialog();
++ if (!dialog.openConfirm(window.getShell(),
++ Messages.TraceControl_DestroyConfirmationTitle,
++ Messages.TraceControl_DestroyConfirmationMessage)) {
++
++ return null;
++ }
++
++ Job job = new Job(Messages.TraceControl_DestroySessionJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++ try {
++ // Make a copy of the list of sessions to avoid ConcurrentModificationException when iterating
++ // over fSessions, since fSessions is modified in another thread triggered by the tree viewer refresh
++ // after removing a session.
++ TraceSessionComponent[] sessions = (TraceSessionComponent[])fSessions.toArray(new TraceSessionComponent[fSessions.size()]);
++
++ for (int i = 0; i < sessions.length; i++) {
++ // Destroy all selected sessions
++ TraceSessionComponent session = sessions[i];
++ TraceSessionGroup sessionGroup = (TraceSessionGroup)session.getParent();
++ sessionGroup.destroySession(session, monitor);
++ }
++ } catch (ExecutionException e) {
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, e.toString());
++ }
++ return Status.OK_STATUS;
++ }
++ };
++ job.setUser(true);
++ job.schedule();
++
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++ fSessions.clear();
++
++ // Check if one or more session are selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ StructuredSelection structered = ((StructuredSelection) selection);
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++ if (element instanceof TraceSessionComponent) {
++ // Add only TraceSessionComponents that are inactive and not destroyed
++ TraceSessionComponent session = (TraceSessionComponent) element;
++ if ((session.getSessionState() == TraceSessionState.INACTIVE) && (!session.isDestroyed())) {
++ fSessions.add((TraceSessionComponent)element);
++ }
++ }
++ }
++ }
++ return fSessions.size() > 0;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++
++/**
++ * <b><u>DisableChannelHandler</u></b>
++ * <p>
++ * Command handler implementation to disable one or more trace channels per session and domain.
++ * </p>
++ */
++public class DisableChannelHandler extends ChangeChannelStateHandler {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseChangeChannelStateHandler#getNewState()
++ */
++ @Override
++ protected TraceEnablement getNewState() {
++ return TraceEnablement.DISABLED;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseChangeChannelStateHandler#changeState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent, java.util.List, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ protected void changeState(TraceDomainComponent domain, List<String> channelNames, IProgressMonitor monitor) throws ExecutionException {
++ domain.disableChannels(channelNames, monitor);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++
++/**
++ * <b><u>DisableEventHandler</u></b>
++ * <p>
++ * Command handler implementation to disable one or more events session, domain and channel.
++ * </p>
++ */
++public class DisableEventHandler extends ChangeEventStateHandler {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.ChangeEventStateHandler#getNewState()
++ */
++ @Override
++ protected TraceEnablement getNewState() {
++ return TraceEnablement.DISABLED;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.ChangeEventStateHandler#changeState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent, java.util.List, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ protected void changeState(TraceChannelComponent channel, List<String> eventNames, IProgressMonitor monitor) throws ExecutionException{
++ channel.disableEvent(eventNames, monitor);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++
++/**
++ * <b><u>DisconnectHandler</u></b>
++ * <p>
++ * Command handler implementation to disconnect from a target host.
++ * </p>
++ */
++public class DisconnectHandler extends BaseNodeHandler {
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseNodeHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++ fTargetNode.disconnect();
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseNodeHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ return super.isEnabled() && (fTargetNode.getTargetNodeState() == TargetNodeState.CONNECTED);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++
++/**
++ * <b><u>EnableChannelHandler</u></b>
++ * <p>
++ * Command handler implementation to enable one or more trace channels per session and domain.
++ * </p>
++ */
++public class EnableChannelHandler extends ChangeChannelStateHandler {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseChangeChannelStateHandler#getNewState()
++ */
++ @Override
++ protected TraceEnablement getNewState() {
++ return TraceEnablement.ENABLED;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseChangeChannelStateHandler#changeState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent, java.util.List, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ protected void changeState(TraceDomainComponent domain, List<String> channelNames, IProgressMonitor monitor) throws ExecutionException {
++ domain.enableChannels(channelNames, null, monitor);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++
++/**
++ * <b><u>EnableEventHandler</u></b>
++ * <p>
++ * Command handler implementation to enable one or more events session, domain and channel.
++ * </p>
++ */
++public class EnableEventHandler extends ChangeEventStateHandler {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.ChangeEventStateHandler#getNewState()
++ */
++ @Override
++ protected TraceEnablement getNewState() {
++ return TraceEnablement.ENABLED;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.ChangeEventStateHandler#changeState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent, java.util.List, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ protected void changeState(TraceChannelComponent channel, List<String> eventNames, IProgressMonitor monitor) throws ExecutionException{
++ channel.enableEvents(eventNames, monitor);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.IWorkbenchPage;
++
++/**
++ * <b><u>EnableEventOnChannelHandler</u></b>
++ * <p>
++ * Command handler implementation to enable events for a known channel.
++ * </p>
++ */
++public class EnableEventOnChannelHandler extends BaseEnableEventHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The channel component the command is to be executed on.
++ */
++ private TraceChannelComponent fChannel = null;
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableEvents(java.util.List, boolean, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableEvents(List<String> eventNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException {
++ fChannel.enableEvents(eventNames, monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableSyscalls(org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableSyscalls(IProgressMonitor monitor) throws ExecutionException {
++ fChannel.enableSyscalls(monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableProbe(java.lang.String, boolean, java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableProbe(String eventName, boolean isFunction, String probe, IProgressMonitor monitor) throws ExecutionException {
++ fChannel.enableProbe(eventName, isFunction, probe, monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableLogLevel(java.lang.String, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level, IProgressMonitor monitor) throws ExecutionException {
++ fChannel.enableLogLevel(eventName, logLevelType, level, monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#getDomain()
++ */
++ @Override
++ public TraceDomainComponent getDomain() {
++ return (TraceDomainComponent) fChannel.getParent();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ fChannel = null;
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ StructuredSelection structered = ((StructuredSelection) selection);
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++ if (element instanceof TraceChannelComponent) {
++ // Add only if corresponding TraceSessionComponents is inactive and not destroyed
++ TraceChannelComponent channel = (TraceChannelComponent) element;
++ TraceSessionComponent session = channel.getSession();
++ if(session.getSessionState() == TraceSessionState.INACTIVE && !session.isDestroyed()) {
++ fChannel = channel;
++ fSession = session;
++ }
++ }
++ }
++ }
++ return fChannel != null;
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.IWorkbenchPage;
++
++/**
++ * <b><u>EnableEventOnDomainHandler</u></b>
++ * <p>
++ * Command handler implementation to enable events for a known domain and default channel 'channel0'
++ * (which will be created if doesn't exist).
++ * </p>
++ */
++public class EnableEventOnDomainHandler extends BaseEnableEventHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The domain component the command is to be executed on.
++ */
++ private TraceDomainComponent fDomain = null;
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableEvents(java.util.List, boolean, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableEvents(List<String> eventNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException {
++ fDomain.enableEvents(eventNames, monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableSyscalls(org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableSyscalls(IProgressMonitor monitor) throws ExecutionException {
++ fDomain.enableSyscalls(monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableProbe(java.lang.String, boolean, java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableProbe(String eventName, boolean isFunction, String probe, IProgressMonitor monitor) throws ExecutionException {
++ fDomain.enableProbe(eventName, isFunction, probe, monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableLogLevel(java.lang.String, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level, IProgressMonitor monitor) throws ExecutionException {
++ fDomain.enableLogLevel(eventName, logLevelType, level, monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#getDomain()
++ */
++ @Override
++ public TraceDomainComponent getDomain() {
++ return fDomain;
++ }
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ fDomain = null;
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ StructuredSelection structered = ((StructuredSelection) selection);
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++ if (element instanceof TraceDomainComponent) {
++ // Add only if corresponding TraceSessionComponents is inactive and not destroyed
++ TraceDomainComponent domain = (TraceDomainComponent) element;
++ TraceSessionComponent session = domain.getSession();
++ if(session.getSessionState() == TraceSessionState.INACTIVE && !session.isDestroyed()) {
++ fDomain = domain;
++ fSession = session;
++ }
++ }
++ }
++ }
++ return fDomain != null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.IWorkbenchPage;
++
++/**
++ * <b><u>EnableEventOnSessionHandler</u></b>
++ * <p>
++ * Command handler implementation to enable events for a known session and default channel 'channel0'
++ * (which will be created if doesn't exist).
++ * </p>
++ */
++public class EnableEventOnSessionHandler extends BaseEnableEventHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++
++ //-------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableEvents(java.util.List, boolean, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableEvents(List<String> eventNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException {
++ fSession.enableEvents(eventNames, isKernel, monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableSyscalls(org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableSyscalls(IProgressMonitor monitor) throws ExecutionException {
++ fSession.enableSyscalls(monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableProbe(java.lang.String, boolean, java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableProbe(String eventName, boolean isFunction, String probe, IProgressMonitor monitor) throws ExecutionException {
++ fSession.enableProbe(eventName, isFunction, probe, monitor);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#enableLogLevel(java.lang.String, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level, IProgressMonitor monitor) throws ExecutionException {
++ fSession.enableLogLevel(eventName, logLevelType, level, monitor);
++ }
++
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.BaseEnableEventHandler#getDomain()
++ */
++ @Override
++ public TraceDomainComponent getDomain() {
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ fSession = null;
++
++ // Check if one session is selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++ StructuredSelection structered = ((StructuredSelection) selection);
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++ if (element instanceof TraceSessionComponent) {
++ // Add only if corresponding TraceSessionComponents is inactive and not destroyed
++ TraceSessionComponent session = (TraceSessionComponent) element;
++ if(session.getSessionState() == TraceSessionState.INACTIVE && !session.isDestroyed()) {
++ fSession = session;
++ }
++ }
++ }
++ }
++ return fSession != null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.jface.dialogs.MessageDialog;
++import org.eclipse.jface.window.Window;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.INewConnectionDialog;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.dialogs.TraceControlDialogFactory;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.rse.core.IRSESystemType;
++import org.eclipse.rse.core.RSECorePlugin;
++import org.eclipse.rse.core.model.IHost;
++import org.eclipse.rse.core.model.ISystemRegistry;
++import org.eclipse.ui.IWorkbenchPage;
++import org.eclipse.ui.IWorkbenchPart;
++import org.eclipse.ui.IWorkbenchWindow;
++import org.eclipse.ui.PlatformUI;
++
++/**
++ * <b><u>NewConnectionHandler</u></b>
++ * <p>
++ * Command handler for creation new connection for trace control.
++ * </p>
++ */
++public class NewConnectionHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The trace control system type defined for LTTng version 2.0 and later.
++ */
++ public final static String TRACE_CONTROL_SYSTEM_TYPE = "org.eclipse.linuxtools.internal.lttng.ui.control.systemType"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The parent trace control component the new node will be added to.
++ */
++ private ITraceControlComponent fRoot = null;
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++ assert (fRoot != null);
++
++ IWorkbenchWindow window = PlatformUI.getWorkbench().getActiveWorkbenchWindow();
++ if (window == null) {
++ return false;
++ }
++
++ ISystemRegistry registry = RSECorePlugin.getTheSystemRegistry();
++
++ // get system type definition for LTTng 2.x connection
++ IRSESystemType sysType = RSECorePlugin.getTheCoreRegistry().getSystemTypeById(TRACE_CONTROL_SYSTEM_TYPE);
++
++ // get all hosts for this system type
++ IHost[] hosts = registry.getHostsBySystemType(sysType);
++
++ // Open dialog box for the node name and address
++ final INewConnectionDialog dialog = TraceControlDialogFactory.getInstance().getNewConnectionDialog();
++ dialog.setTraceControlParent(fRoot);
++ dialog.setHosts(hosts);
++
++ if (dialog.open() != Window.OK) {
++ return null;
++ }
++
++ String hostName = dialog.getConnectionName();
++ String hostAddress = dialog.getHostName();
++
++ // get the singleton RSE registry
++ IHost host = null;
++
++ for (int i = 0; i < hosts.length; i++) {
++ if (hosts[i].getAliasName().equals(hostName)) {
++ host = hosts[i];
++ break;
++ }
++ }
++
++ if (host == null) {
++ // if there's no host then we will create it
++ try {
++ // create the host object as an SSH Only connection
++ host = registry.createHost(
++ sysType, //System Type Name
++ hostName, //Connection name
++ hostAddress, //IP Address
++ "Connection to Host"); //description //$NON-NLS-1$
++ }
++ catch (Exception e) {
++ MessageDialog.openError(window.getShell(),
++ Messages.TraceControl_EclipseCommandFailure,
++ Messages.TraceControl_NewNodeCreationFailure + " (" + hostName + ", " + hostAddress + ")" + ":\n" + e.toString()); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$
++ return null;
++ }
++ }
++
++ if (host != null) {
++ // successful creation of host
++ TargetNodeComponent node = null;
++ if (!fRoot.containsChild(hostName)) {
++ node = new TargetNodeComponent(hostName, fRoot, host);
++ fRoot.addChild(node);
++ }
++ else {
++ node = (TargetNodeComponent)fRoot.getChild(hostName);
++ }
++
++ node.connect();
++ }
++ return null;
++ }
++
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ fRoot = null;
++
++ // no need to verify part because it has been already done in getWorkbenchPage()
++ IWorkbenchPart part = page.getActivePart();
++ fRoot = ((ControlView) part).getTraceControlRoot();
++
++ return (fRoot != null);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import java.util.Iterator;
++
++import org.eclipse.core.commands.ExecutionEvent;
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.jface.viewers.ISelection;
++import org.eclipse.jface.viewers.StructuredSelection;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.ControlView;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent;
++import org.eclipse.ui.IWorkbenchPage;
++
++/**
++ * <b><u>RefreshHandler</u></b>
++ * <p>
++ * Command handler implementation to refresh node configuration.
++ * </p>
++ */
++public class RefreshHandler extends BaseControlViewHandler {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The node component reference.
++ */
++ private TargetNodeComponent fNode;
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#execute(org.eclipse.core.commands.ExecutionEvent)
++ */
++ @Override
++ public Object execute(ExecutionEvent event) throws ExecutionException {
++ fNode.refresh();
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.commands.AbstractHandler#isEnabled()
++ */
++ @Override
++ public boolean isEnabled() {
++ fNode = null;
++
++ // Get workbench page for the Control View
++ IWorkbenchPage page = getWorkbenchPage();
++ if (page == null) {
++ return false;
++ }
++
++ // Check if one or more session are selected
++ ISelection selection = page.getSelection(ControlView.ID);
++ if (selection instanceof StructuredSelection) {
++
++ StructuredSelection structered = ((StructuredSelection) selection);
++ for (Iterator<?> iterator = structered.iterator(); iterator.hasNext();) {
++ Object element = (Object) iterator.next();
++ if (element instanceof TraceControlComponent) {
++ TraceControlComponent component = (TraceControlComponent) element;
++ boolean isConnected = component.getTargetNodeState() == TargetNodeState.CONNECTED;
++ if (isConnected) {
++ while ((component != null) && component.getClass() != TargetNodeComponent.class) {
++ component = (TraceControlComponent) component.getParent();
++ }
++ if (component != null) {
++ fNode = (TargetNodeComponent) component;
++ }
++ }
++ }
++ }
++ }
++ return fNode != null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++
++/**
++ * <b><u>StartHandler</u></b>
++ * <p>
++ * Command handler implementation to start one or more trace sessions.
++ * </p>
++ */
++public class StartHandler extends ChangeSessionStateHandler {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.ChangeSessionStateHandler#getNewState()
++ */
++ @Override
++ public TraceSessionState getNewState() {
++ return TraceSessionState.ACTIVE;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.ChangeSessionStateHandler#changeState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void changeState(TraceSessionComponent session, IProgressMonitor monitor) throws ExecutionException {
++ session.startSession(monitor);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++
++/**
++ * <b><u>StopHandler</u></b>
++ * <p>
++ * Command handler implementation to stop one or more trace sessions.
++ * </p>
++ */
++public class StopHandler extends ChangeSessionStateHandler {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.ChangeSessionStateHandler#getNewState()
++ */
++ @Override
++ public TraceSessionState getNewState() {
++ return TraceSessionState.INACTIVE;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.handlers.ChangeSessionStateHandler#changeState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void changeState(TraceSessionComponent session, IProgressMonitor monitor) throws ExecutionException {
++ session.stopSession(monitor);
++ }
++}
--- /dev/null
--- /dev/null
++TraceControl_ConnectionFailure=Connecting to host failed
++TraceControl_DisconnectionFailure=Disconnection to host failed
++TraceControl_ExecutionCancelled=Command Execution cancelled
++TraceControl_ExecutionFailure=Command Execution failed
++TraceControl_ExecutionTimeout=Command Execution timed-out
++TraceControl_ShellNotConnected=Command shell not connected
++TraceControl_CommandShellError=Could not create HostShellProcessAdapter
++TraceControl_CommandError=Command failed! Command:
++TraceControl_UnexpectedCommnadOutputFormat=Unexpected command output
++TraceControl_UnexpectedNameError=Unexpected session name returned
++TraceControl_UnexpectedPathError=Unexpected session path returned
++
++# Commands
++TraceControl_ListSessionFailure=List sessions failed
++TraceControl_RetrieveNodeConfigurationJob=Retrieving Target Node Configuration...
++TraceControl_EclipseCommandFailure=Command failed
++TraceControl_NewNodeCreationFailure=Creation of new connection failed
++TraceControl_CreateSessionJob=Creating Session...
++
++TraceControl_DestroySessionJob=Destroying Session...
++TraceControl_DestroyConfirmationTitle=Destroy Confirmation
++TraceControl_DestroyConfirmationMessage=Do you want to delete all selected sessions?
++
++TraceControl_StartSessionJob=Starting Session...
++TraceControl_StopSessionJob=Stopping Session...
++
++TraceControl_ChangeChannelStateJob=Changing State of Channels...
++TraceControl_ChangeEventStateJob=Changing State of Events...
++
++TraceControl_EnableEventsJob=Enabling Events...
++TraceControl_EnableEventsFailure=Enable Events failed
++TraceControl_DisableEventsJob=Disabling Events...
++
++# Dialogs
++TraceControl_NewDialogTitle=New Connection
++TraceControl_NewNodeExistingConnectionGroupName=Existing Connections
++TraceControl_NewNodeEditButtonName=Edit connection information
++TraceControl_NewNodeComboToolTip=List of existing connections (connection name - host name)
++TraceControl_NewNodeConnectionNameLabel=Connection Name
++TraceControl_NewNodeConnectionNameTooltip=Alias to be displayed for node to connect to.
++TraceControl_NewNodeHostNameLabel=Host Name
++TraceControl_NewNodeHostNameTooltip=IP Address or DNS name of node to connect to.
++TraceControl_AlreadyExistsError=Node name already exists in Control View
++
++TraceControl_CreateSessionDialogTitle=Create Session
++TraceControl_CreateSessionNameLabel=Session Name
++TraceControl_CreateSessionNameTooltip=The name of the session to be created.
++TraceControl_CreateSessionPathLabel=Session Path
++TraceControl_CreateSessionPathTooltip=The session path (keep empty for default location)
++TraceControl_InvalidSessionNameError=The session name is invalid
++TraceControl_SessionAlreadyExistsError=The session name already exists
++TraceControl_SessionPathAlreadyExistsError=Session path already exists
++TraceControl_InvalidSessionPathError=The session path is invalid
++TraceControl_FileSubSystemError=File subsystem error in session creation dialog.
++
++TraceControl_EnableChannelDialogTitle=Enable Channel
++TraceControl_EnableChannelNameLabel=Channel Name
++TraceControl_EnableChannelNameTooltip=The name of the channel to be enabled.
++TraceControl_EnableChannelSubBufferSizeTooltip=The sub-buffers size of the channel.
++TraceControl_EnableChannelNbSubBuffersTooltip=The number of sub-buffers of the channel.
++TraceControl_EnableChannelSwitchTimerTooltip=The switch timer interval in usec.
++TraceControl_EnableChannelReadTimerTooltip=The switch timer interval in usec.
++TraceControl_EnableChannelOutputTypeTooltip=The output type of the channel.
++TraceControl_EnableChannelOverwriteModeTooltip=Select for overwrite mode (Flight recorder mode).
++
++TraceControl_InvalidChannelNameError=The channel name is invalid or empty
++TraceControl_ChannelAlreadyExistsError=Channel already exists
++
++TraceControl_EnableEventsDialogTitle=Enable Events
++TraceControl_EnableEventsSessionGroupName=Session List
++TraceControl_EnableEventsChannelGroupName=Channel List
++TraceControl_EnableEventsSessionsTooltip=List of available sessions.
++TraceControl_EnableEventsChannelsTooltip=List of available channels of selected session.\nIf no channel is available default channel will be created.
++TraceControl_EnableEventsNoSessionError=No session from session list is selected.
++TraceControl_EnableEventsNoChannelError=No channel from channel list is selected.
++
++TraceControl_EnableGroupSelectionName=Select
++TraceControl_EnableEventsTracepointGroupName=Tracepoint Events
++TraceControl_EnableEventsTracepointTreeTooltip=List of available kernel tracepoint events
++TraceControl_EnableEventsTracepointTreeAllLabel=All
++TraceControl_EnableEventsSyscallName=All Syscalls
++TraceControl_EnableEventsSyscallTooltip=Enable all Syscalls
++TraceControl_EnableEventsProbeGroupName=Dynamic Probe
++TraceControl_EnableEventsEventNameLabel=Event Name
++TraceControl_EnableEventsProbeEventNameTooltip=The name of the event for enabling a dynamic probe
++TraceControl_EnableEventsProbeNameLabel=Probe
++TraceControl_EnableEventsProbeNameTooltip=[addr | symbol | symbol+offset]\nAddr and offset can be octal (0NNN...),\ndecimal (NNN...) or hexadecimal (0xNNN...)
++TraceControl_EnableEventsFucntionGroupName=Dynamic Function Entry/Return Probe
++TraceControl_EnableEventsFunctionEventNameTooltip=The name of the event for enabling a dynamic function entry/return probe
++TraceControl_EnableEventsFunctionNameLabel=Function
++
++TraceControl_EnableEventsWildcardGroupName=Wildcard
++TraceControl_EnableEventsWildcardLabel=Wildcard
++TraceControl_EnableEventsWildcardTooltip=The wild card string of event names
++TraceControl_EnableEventsLogLevelGroupName=Log Level
++TraceControl_EnableEventsLogLevelTypeName=loglevel
++TraceControl_EnableEventsLogLevelTypeTooltip=The tracepoint log level range from 0 to loglevel
++TraceControl_EnableEventsLogLevelOnlyTypeName=loglevel-only
++TraceControl_EnableEventsLogLevelOnlyTypeTooltip=The tracepoint log level (only this loglevel)
++TraceControl_EnableEventsLogLevelTooltip=The available log levels
++TraceControl_EnableEventsLoglevelEventNameTooltip=Event name for enabling log levels
++
++TraceControl_InvalidProbeNameError=The probe name is invalid
++TraceControl_InvalidWildcardError=The wild card name is invalid
++TraceControl_InvalidLogLevelEventNameError=The event name for log level is invalid
++
++# Tree structure strings
++TraceControl_KernelDomainDisplayName=Kernel
++TraceControl_UstGlobalDomainDisplayName=UST global
++TraceControl_UstDisplayName=UST
++TraceControl_AllSessionsDisplayName=Sessions
++TraceControl_SessionDisplayName=Session
++TraceControl_DomainDisplayName=Domain
++TraceControl_ChannelDisplayName=Channel
++TraceControl_EventDisplayName=Event
++TraceControl_ProviderDisplayName=Provider
++TraceControl_KernelProviderDisplayName=Kernel
++
++# Property names
++TraceControl_SessionNamePropertyName=Session Name
++TraceControl_EventNamePropertyName=Event Name
++TraceControl_EventTypePropertyName=Event Type
++TraceControl_LogLevelPropertyName=Log Level
++TraceControl_StatePropertyName=State
++TraceControl_DomainNamePropertyName=Domain Name
++TraceControl_ChannelNamePropertyName=Channel Name
++TraceControl_OverwriteModePropertyName=Overwrite Mode
++TraceControl_SubBufferSizePropertyName=Sub Buffer Size
++TraceControl_NbSubBuffersPropertyName=Number of Sub Buffers
++TraceControl_SwitchTimerPropertyName=Switch Timer Interval
++TraceControl_ReadTimerPropertyName=Read Timer Interval
++TraceControl_OutputTypePropertyName=Output Type
++TraceControl_HostNamePropertyName=Connection Name
++TraceControl_HostAddressPropertyName=Host Name
++TraceControl_SessionPathPropertyName=Session Path
++TraceControl_ProviderNamePropertyName=Provider Name
++TraceControl_ProcessIdPropertyName=Process ID
++TraceControl_ProbeAddressPropertyName=Address
++TraceControl_ProbeOffsetPropertyName=Offset
++TraceControl_ProbeSymbolPropertyName=Symbol
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>IBaseEventInfo</u></b>
++ * <p>
++ * Interface for retrieval of basic trace event information.
++ * </p>
++ */
++public interface IBaseEventInfo extends ITraceInfo {
++
++ /**
++ * @return the trace event type
++ */
++ public TraceEventType getEventType();
++
++ /**
++ * Sets the trace event type to the given type
++ * @param type - type to set
++ */
++ public void setEventType(TraceEventType type);
++
++ /**
++ * Sets the trace event type to the type specified by the given name.
++ * @param typeName - event type name
++ */
++ public void setEventType(String typeName);
++
++ /**
++ * @return the trace event log level
++ */
++ public TraceLogLevel getLogLevel();
++
++ /**
++ * Sets the trace event log level to the given level
++ * @param level - event log level to set
++ */
++ public void setLogLevel(TraceLogLevel level);
++
++ /**
++ * Sets the trace event log level to the level specified by the given name.
++ * @param levelName - event log level name
++ */
++ public void setLogLevel(String levelName);
++
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++import java.util.List;
++
++/**
++ * <b><u>IChannelInfo</u></b>
++ * <p>
++ * Interface for retrieval of trace channel information.
++ * </p>
++ */
++public interface IChannelInfo extends ITraceInfo {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Default value for overwrite mode.
++ */
++ public final static boolean DEFAULT_OVERWRITE_MODE = false;
++ /**
++ * Default value for sub-buffer size for a UST channel.
++ */
++ public final static long DEFAULT_SUB_BUFFER_SIZE_UST = 4096L;
++ /**
++ * Default value for sub-buffer size for a Kernel channel.
++ */
++ public final static long DEFAULT_SUB_BUFFER_SIZE_KERNEL = 262144L;
++ /**
++ * Default value for number of sub-buffer a UST channel.
++ */
++ public final static int DEFAULT_NUMBER_OF_SUB_BUFFERS_UST = 8;
++ /**
++ * Default value for number of sub-buffer a Kernel channel.
++ */
++ public final static int DEFAULT_NUMBER_OF_SUB_BUFFERS_KERNEL = 4;
++ /**
++ * Default value for number of the switch timer interval.
++ */
++ public final static long DEFAULT_SWITCH_TIMER = 0;
++ /**
++ * Default value for number of the read timer interval.
++ */
++ public final static long DEFAULT_READ_TIMER = 200;
++
++ /**
++ * @return the overwrite mode value.
++ */
++ public boolean isOverwriteMode();
++ /**
++ * Sets the overwrite mode value to the given mode.
++ * @param mode - mode to set.
++ */
++ public void setOverwriteMode(boolean mode);
++
++ /**
++ * @return the sub-buffer size.
++ */
++ public long getSubBufferSize();
++ /**
++ * Sets the sub-buffer size to the given value.
++ * @param bufferSize - size to set to set.
++ */
++ public void setSubBufferSize(long bufferSize);
++
++ /**
++ * @return the number of sub-buffers.
++ */
++ public int getNumberOfSubBuffers();
++ /**
++ * Sets the number of sub-buffers to the given value.
++ * @param numberOfSubBuffers - value to set.
++ */
++ public void setNumberOfSubBuffers(int numberOfSubBuffers);
++
++ /**
++ * @return the switch timer interval.
++ */
++ public long getSwitchTimer();
++ /**
++ * Sets the switch timer interval to the given value.
++ * @param timer - timer value to set.
++ */
++ public void setSwitchTimer(long timer);
++
++ /**
++ * @return the read timer interval.
++ */
++ public long getReadTimer();
++ /**
++ * Sets the read timer interval to the given value.
++ * @param timer - timer value to set..
++ */
++ public void setReadTimer(long timer);
++
++ /**
++ * @return the output type.
++ */
++ public String getOutputType();
++ /**
++ * Sets the output type to the given value.
++ * @param type - type to set.
++ */
++ public void setOutputType(String type);
++
++ /**
++ * @return the channel state (enabled or disabled).
++ */
++ public TraceEnablement getState();
++ /**
++ * Sets the channel state (enablement) to the given value.
++ * @param state - state to set.
++ */
++ public void setState(TraceEnablement state);
++ /**
++ * Sets the channel state (enablement) to the value specified by the given name.
++ * @param stateName - state to set.
++ */
++ public void setState(String stateName);
++
++ /**
++ * @return all event information as array.
++ */
++ public IEventInfo[] getEvents();
++ /**
++ * Sets the event information specified by given list.
++ * @param events - all event information to set.
++ */
++ public void setEvents(List<IEventInfo> events);
++ /**
++ * Adds a single event information.
++ * @param event - event information to add.
++ */
++ public void addEvent(IEventInfo event);
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++import java.util.List;
++
++/**
++ * <b><u>IDomainInfo</u></b>
++ * <p>
++ * Interface for retrieval of trace domain information.
++ * </p>
++ */
++
++public interface IDomainInfo extends ITraceInfo {
++
++ /**
++ * @return information about all channels
++ */
++ public IChannelInfo[] getChannels();
++
++ /**
++ * Sets the channel information specified by given list.
++ * @param channels - all channel information to set.
++ */
++ public void setChannels(List<IChannelInfo> channels);
++
++ /**
++ * Adds a single channel information.
++ * @param channel - channel information to add.
++ */
++ public void addChannel(IChannelInfo channel);
++
++ /**
++ * @return true if domain is kernel, false for UST
++ */
++ public boolean isKernel();
++
++ /**
++ * Sets whether domain is Kernel domain or UST
++ * @param isKernel true for kernel, false for UST
++ */
++ public void setIsKernel(boolean isKernel);
++
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>IEventInfo</u></b>
++ * <p>
++ * Interface for retrieval of trace event information.
++ * </p>
++ */
++public interface IEventInfo extends IBaseEventInfo {
++
++ /**
++ * @return the event state (enabled or disabled).
++ */
++ public TraceEnablement getState();
++
++ /**
++ * Sets the event state (enablement) to the given value.
++ * @param state - state to set.
++ */
++ public void setState(TraceEnablement state);
++
++ /**
++ * Sets the event state (enablement) to the value specified by the given name.
++ * @param stateName - state to set.
++ */
++ public void setState(String stateName);
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>IProbeEventInfo</u></b>
++ * <p>
++ * Interface for retrieval of probe event information.
++ * </p>
++ */
++public interface IProbeEventInfo extends IEventInfo {
++
++ /**
++ * @return the address of the probe. (null if not used)
++ */
++ public String getAddress();
++
++ /**
++ * Sets the address of the probe.
++ * @param address - a address (null if not used)
++ */
++ public void setAddress(String address);
++
++ /**
++ * @return the offset applied to the symbol (null if not used).
++ */
++ public String getOffset();
++
++ /**
++ * Sets the offset applied to the symbol.
++ * @param offset - a offset ((null if not used)
++ */
++ public void setOffset(String offset);
++
++ /**
++ * @return the symbol name. ((null if not used))
++ */
++ public String getSymbol();
++
++ /**
++ * Sets the symbol name.
++ * @param symbol - a symbol name ((null if not used))
++ */
++ public void setSymbol(String symbol);
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++import java.util.List;
++
++/**
++ * <b><u>ISessionInfo</u></b>
++ * <p>
++ * Interface for retrieval of trace session information.
++ * </p>
++ */
++public interface ISessionInfo extends ITraceInfo {
++
++ /**
++ * @return the session state state (active or inactive).
++ */
++ public TraceSessionState getSessionState();
++ /**
++ * Sets the session state to the given value.
++ * @param state - state to set.
++ */
++ public void setSessionState(TraceSessionState state);
++
++ /**
++ * Sets the event state to the value specified by the given name.
++ * @param stateName - state to set.
++ */
++ public void setSessionState(String stateName);
++
++ /**
++ * @return path string where session is located.
++ */
++ public String getSessionPath();
++
++ /**
++ * Sets the path string (where session is located) to the given value.
++ * @param path - session path to set.
++ */
++ public void setSessionPath(String path);
++
++ /**
++ * @return all domain information as array.
++ */
++ public IDomainInfo[] getDomains();
++
++ /**
++ * Sets all domain information specified by given list.
++ * @param domains - all domain information to set.
++ */
++ public void setDomains(List<IDomainInfo> domains);
++
++ /**
++ * Adds a single domain information.
++ * @param domain - domain information to add.
++ */
++ public void addDomain(IDomainInfo domainInfo);
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++import java.util.List;
++
++import org.eclipse.core.runtime.IAdaptable;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService;
++import org.eclipse.swt.graphics.Image;
++
++/**
++ * <b><u>ITraceControlComponent</u></b>
++ * <p>
++ * Interface for trace control components that can be displayed in the
++ * trace control tree viewer.
++ * </p>
++ */
++public interface ITraceControlComponent extends IAdaptable {
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /**
++ * @return the name of the component
++ */
++ public String getName();
++ /**
++ * Sets the name of the component to the given value.
++ * @param name - name to set
++ */
++ public void setName(String name);
++
++ /**
++ * @return the image representing the component.
++ */
++ public Image getImage();
++ /**
++ * Sets the image path of the component.
++ * @param path - path to the image location
++ */
++ public void setImage(String path);
++ /**
++ * Sets the image the component.
++ * @param image - image to the image location
++ */
++ public void setImage(Image image);
++
++ /**
++ * @return tool tip with information about the component.
++ */
++ public String getToolTip();
++ /**
++ * Sets the tool tip with information about the component.
++ * @param toolTip - the tool tip to set.
++ */
++ public void setToolTip(String toolTip);
++
++ /**
++ * @return the node's connection state
++ */
++ public TargetNodeState getTargetNodeState();
++ /**
++ * Sets the node's connection state.
++ * @param state - the state to set
++ */
++ public void setTargetNodeState(TargetNodeState state);
++
++ /**
++ * @return returns the parent component.
++ */
++ public ITraceControlComponent getParent();
++ /**
++ * Sets the parent component.
++ * @param parent - the parent to set.
++ */
++ public void setParent(ITraceControlComponent parent);
++
++ /**
++ * @return the children components
++ */
++ public ITraceControlComponent[] getChildren();
++ /**
++ * Sets the children components.
++ * @param children - the children to set.
++ */
++ public void setChildren(List<ITraceControlComponent> children);
++ /**
++ * Returns the child component with given name.
++ * @param name - name of child to find.
++ * @return child component or null.
++ */
++ public ITraceControlComponent getChild(String name);
++ /**
++ * Gets children for given class type.
++ * @param clazz - a class type to get
++ * @return list of trace control components matching given class type.
++ */
++ public List<ITraceControlComponent> getChildren(Class<? extends ITraceControlComponent> clazz);
++
++ /**
++ * @return the LTTng control service implementation.
++ */
++ public ILttngControlService getControlService();
++
++ /**
++ * Sets the LTTng control service implementation.
++ * @param service - the service to set.
++ */
++ public void setControlService(ILttngControlService service);
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Dispose any resource.
++ */
++ public void dispose();
++
++ /**
++ * Adds a child component.
++ * @param component - child to add.
++ */
++ public void addChild(ITraceControlComponent component);
++
++ /**
++ * Removes the given child component.
++ * @param component - the child to remove.
++ */
++ public void removeChild(ITraceControlComponent component);
++
++ /**
++ * Removes all children.
++ */
++ public void removeAllChildren();
++
++ /**
++ * Checks if child with given name exists.
++ * @param name - child name to search for.
++ * @return - true if exists else false.
++ */
++ public boolean containsChild(String name);
++
++ /**
++ * Checks for children.
++ * @return true if one or more children exist else false
++ */
++ public boolean hasChildren();
++
++ /**
++ * Adds a component listener for notification of component changes.
++ * @param listener - listener interface implementation to add.
++ */
++ public void addComponentListener(ITraceControlComponentChangedListener listener);
++
++ /**
++ * Removes a component listener for notification of component changes.
++ * @param listener - listener interface implementation to remove.
++ */
++ public void removeComponentListener(ITraceControlComponentChangedListener listener);
++
++ /**
++ * Notifies listeners about the addition of a child.
++ * @param parent - the parent where the child was added.
++ * @param component - the child that was added.
++ */
++ public void fireComponentAdded(ITraceControlComponent parent, ITraceControlComponent component);
++
++ /**
++ * Notifies listeners about the removal of a child.
++ * @param parent - the parent where the child was removed.
++ * @param component - the child that was removed.
++ */
++ public void fireComponentRemoved(ITraceControlComponent parent, ITraceControlComponent component);
++
++ /**
++ * Notifies listeners about the change of a component.
++ * @param component - the component that was changed.
++ */
++ public void fireComponentChanged(ITraceControlComponent component);
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>ITraceControlComponentChangedListener</u></b>
++ * <p>
++ * Listener interface a class can implement to be notified about changes
++ * of components
++ * </p>
++ */
++public interface ITraceControlComponentChangedListener {
++ /**
++ * Interface for notifications about the addition of a component.
++ * @param parent - the parent where the child was added.
++ * @param component - the child that was added.
++ */
++ public void componentAdded(ITraceControlComponent parent, ITraceControlComponent component);
++
++ /**
++ * Interface for notifications about the removal of a child.
++ * @param parent - the parent where the child was removed.
++ * @param component - the child that was removed.
++ */
++ public void componentRemoved(ITraceControlComponent parent, ITraceControlComponent component);
++ /**
++ * NInterface for notifications about the change of a component.
++ * @param component - the component that was changed.
++ */
++ public void componentChanged(ITraceControlComponent component);
++}
++
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>ITraceInfo</u></b>
++ * <p>
++ * Interface for retrieve trace comon information.
++ * </p>
++ */
++
++public interface ITraceInfo {
++ /**
++ * @return the name of the information element.
++ */
++ public String getName();
++
++ /**
++ * Sets the name of the information element.
++ * @param name
++ */
++ public void setName(String name);
++
++ /**
++ * @return a formated (readable) String with content.
++ */
++ public String formatString();
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++import java.util.List;
++
++/**
++ * <b><u>IUstProviderInfo</u></b>
++ * <p>
++ * Interface for retrieval of UST provider information.
++ * </p>
++ */
++public interface IUstProviderInfo extends ITraceInfo {
++
++ /**
++ * @return the process ID of the UST provider.
++ */
++ public int getPid();
++
++ /**
++ * Sets the process ID of the UST provider to the given value.
++ * @param pid - process ID to set
++ */
++ public void setPid(int pid);
++
++ /**
++ * @return all event information as array.
++ */
++ public IBaseEventInfo[] getEvents();
++
++ /**
++ * Sets the event information specified by given list.
++ * @param events - all event information to set.
++ */
++ public void setEvents(List<IBaseEventInfo> events);
++
++ /**
++ * Adds a single event information.
++ * @param event - event information to add.
++ */
++ public void addEvent(IBaseEventInfo event);
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ *********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>LogLevelType</u></b>
++ * <p>
++ * Type of log Level enumeration.
++ * </p>
++ */
++public enum LogLevelType {
++
++ // ------------------------------------------------------------------------
++ // Enum definition
++ // ------------------------------------------------------------------------
++ LOGLEVEL, // range of log levels [0,logLevel]
++ LOGLEVEL_ONLY, // single log level
++ LOGLEVEL_NONE; // no log level
++};
++
++
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>TargetNodeState</u></b>
++ * <p>
++ * Enumeration for the node connection state.
++ * </p>
++ */
++public enum TargetNodeState {
++ DISCONNECTED,
++ DISCONNECTING,
++ CONNECTED,
++ CONNECTING;
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>TraceEnablement</u></b>
++ * <p>
++ * Enumeration for enabled/disabled states.
++ * </p>
++ */
++public enum TraceEnablement {
++
++ // ------------------------------------------------------------------------
++ // Enum definition
++ // ------------------------------------------------------------------------
++ DISABLED("disabled"), //$NON-NLS-1$
++ ENABLED("enabled"); //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * Name of enum
++ */
++ private final String fInName;
++
++ // ------------------------------------------------------------------------
++ // Constuctors
++ // ------------------------------------------------------------------------
++
++ /**
++ * Private constructor
++ * @param name the name of state
++ */
++ private TraceEnablement(String name) {
++ fInName = name;
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return state name
++ */
++ public String getInName() {
++ return fInName;
++ }
++};
++
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>TraceEventType</u></b>
++ * <p>
++ * Trace event type enumeration.
++ * </p>
++ */
++public enum TraceEventType {
++ TRACEPOINT("tracepoint"), //$NON-NLS-1$
++ SYSCALL("syscall"), //$NON-NLS-1$
++ PROBE("probe"), //$NON-NLS-1$
++ UNKNOWN("unknown"); //$NON-NLS-1$
++
++ private final String fInName;
++
++ private TraceEventType(String name) {
++ fInName = name;
++ }
++
++ public String getInName() {
++ return fInName;
++ }
++};
++
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ *********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>TraceLogLevels</u></b>
++ * <p>
++ * Log Level enumeration.
++ * </p>
++ */
++@SuppressWarnings("nls")
++public enum TraceLogLevel {
++
++ // ------------------------------------------------------------------------
++ // Enum definition
++ // ------------------------------------------------------------------------
++ TRACE_EMERG("TRACE_EMERG"), // 0
++ TRACE_ALERT("TRACE_ALERT"), // 1
++ TRACE_CRIT("TRACE_CRIT"), // 2
++ TRACE_ERR("TRACE_ERR"), // 3
++ TRACE_WARNING("TRACE_WARNING"), // 4
++ TRACE_NOTICE("TRACE_NOTICE"), // 5
++ TRACE_INFO("TRACE_INFO"), // 6
++ TRACE_DEBUG_SYSTEM("TRACE_DEBUG_SYSTEM"), // 7
++ TRACE_DEBUG_PROGRAM("TRACE_DEBUG_PROGRAM"), // 8
++ TRACE_DEBUG_PROCESS("TRACE_DEBUG_PROCESS"), // 9
++ TRACE_DEBUG_MODULE("TRACE_DEBUG_MODULE"), // 10
++ TRACE_DEBUG_UNIT("TRACE_DEBUG_UNIT"), // 11
++ TRACE_DEBUG_FUNCTION("TRACE_DEBUG_FUNCTION"), //12
++ TRACE_DEBUG_LINE("TRACE_DEBUG_LINE"), //13
++ TRACE_DEBUG("TRACE_DEBUG"), // 14
++ LEVEL_UNKNOWN("LEVEL_UNKNOWN"); // 15
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * Name of enum.
++ */
++ private final String fInName;
++
++ // ------------------------------------------------------------------------
++ // Constuctors
++ // ------------------------------------------------------------------------
++
++ /**
++ * Private constructor
++ * @param name the name of state
++ */
++ private TraceLogLevel(String name) {
++ fInName = name;
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return state name
++ */
++ public String getInName() {
++ return fInName;
++ }
++};
++
++
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ *********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model;
++
++/**
++ * <b><u>TraceSessionState</u></b>
++ * <p>
++ * Session state enumeration.
++ * </p>
++ */
++public enum TraceSessionState {
++
++ // ------------------------------------------------------------------------
++ // Enum definition
++ // ------------------------------------------------------------------------
++ INACTIVE("inactive"), //$NON-NLS-1$
++ ACTIVE("active"); //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * Name of enum.
++ */
++ private final String fInName;
++
++ // ------------------------------------------------------------------------
++ // Constuctors
++ // ------------------------------------------------------------------------
++
++ /**
++ * Private constructor
++ * @param name the name of state
++ */
++ private TraceSessionState(String name) {
++ fInName = name;
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * @return state name
++ */
++ public String getInName() {
++ return fInName;
++ }
++};
++
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BaseEventPropertySource;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++/**
++ * <b><u>BaseEventComponent</u></b>
++ * <p>
++ * Implementation of the base trace event component.
++ * </p>
++ */
++public class BaseEventComponent extends TraceControlComponent {
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component.
++ */
++ public static final String TRACE_EVENT_ICON_FILE_ENABLED = "icons/obj16/event_enabled.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The Event information implementation.
++ */
++ private IBaseEventInfo fEventInfo;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public BaseEventComponent(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ setImage(TRACE_EVENT_ICON_FILE_ENABLED);
++ fEventInfo = new EventInfo(name);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * Sets the event information.
++ * @param eventInfo - the event info to set.
++ */
++ public void setEventInfo(IBaseEventInfo eventInfo) {
++ fEventInfo = eventInfo;
++ }
++
++ /**
++ * @return the event type.
++ */
++ public TraceEventType getEventType() {
++ return fEventInfo.getEventType();
++ }
++
++ /**
++ * Sets the event type to the given value.
++ * @param type - type to set.
++ */
++ public void setEventType(TraceEventType type) {
++ fEventInfo.setEventType(type);
++ }
++
++ /**
++ * Sets the event type to the value specified by the give name.
++ * @param typeName - the type name.
++ */
++ public void setEventType(String typeName) {
++ fEventInfo.setEventType(typeName);
++ }
++
++ /**
++ * @return the trace event log level
++ */
++ public TraceLogLevel getLogLevel() {
++ return fEventInfo.getLogLevel();
++ }
++
++ /**
++ * Sets the trace event log level to the given level
++ * @param level - event log level to set
++ */
++ public void setLogLevel(TraceLogLevel level) {
++ fEventInfo.setLogLevel(level);
++ }
++
++ /**
++ * Sets the trace event log level to the level specified by the given name.
++ * @param levelName - event log level name
++ */
++ public void setLogLevel(String levelName) {
++ fEventInfo.setLogLevel(levelName);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ if (adapter == IPropertySource.class) {
++ return new BaseEventPropertySource(this);
++ }
++ return null;
++ }
++
++ /**
++ * @return target node component.
++ */
++ public TargetNodeComponent getTargetNode() {
++ return (TargetNodeComponent) getParent().getParent();
++ }
++
++ /**
++ * @return if provider kernel or UST
++ */
++ public boolean isKernel() {
++ return getParent() instanceof KernelProviderComponent;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++
++/**
++* <b><u>BaseEventInfo</u></b>
++* <p>
++* Implementation of the basic trace event interface (IEventInfo) to store event
++* related data.
++* </p>
++*/
++public class BaseEventInfo extends TraceInfo implements IBaseEventInfo {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The trace event type.
++ */
++ private TraceEventType fEventType = TraceEventType.UNKNOWN;
++ /**
++ * The trace log level.
++ */
++ private TraceLogLevel fLogLevel = TraceLogLevel.TRACE_DEBUG;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - name of base event
++ */
++ public BaseEventInfo(String name) {
++ super(name);
++ }
++
++ /**
++ * Copy constructor
++ * @param other - the instance to copy
++ */
++ public BaseEventInfo(BaseEventInfo other) {
++ super(other);
++ fEventType = other.fEventType;
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo#getEventType()
++ */
++ @Override
++ public TraceEventType getEventType() {
++ return fEventType;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo#setEventType(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType)
++ */
++ @Override
++ public void setEventType(TraceEventType type) {
++ fEventType = type;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo#setEventType(java.lang.String)
++ */
++ @Override
++ public void setEventType(String typeName) {
++ if(TraceEventType.TRACEPOINT.getInName().equals(typeName)) {
++ fEventType = TraceEventType.TRACEPOINT;
++ } else if(TraceEventType.SYSCALL.getInName().equals(typeName)) {
++ fEventType = TraceEventType.SYSCALL;
++ } else if (TraceEventType.PROBE.getInName().equals(typeName)) {
++ fEventType = TraceEventType.PROBE;
++ } else {
++ fEventType = TraceEventType.UNKNOWN;
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo#getLogLevel()
++ */
++ @Override
++ public TraceLogLevel getLogLevel() {
++ return fLogLevel;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo#setLogLevel(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel)
++ */
++ @Override
++ public void setLogLevel(TraceLogLevel level) {
++ fLogLevel = level;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo#setLogLevel(java.lang.String)
++ */
++ @Override
++ public void setLogLevel(String levelName) {
++ if(TraceLogLevel.TRACE_EMERG.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_EMERG;
++ } else if(TraceLogLevel.TRACE_ALERT.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_ALERT;
++ } else if(TraceLogLevel.TRACE_CRIT.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_CRIT;
++ } else if(TraceLogLevel.TRACE_ERR.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_ERR;
++ } else if(TraceLogLevel.TRACE_WARNING.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_WARNING;
++ } else if(TraceLogLevel.TRACE_NOTICE.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_NOTICE;
++ } else if(TraceLogLevel.TRACE_INFO.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_INFO;
++ } else if(TraceLogLevel.TRACE_DEBUG_SYSTEM.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_DEBUG_SYSTEM;
++ } else if(TraceLogLevel.TRACE_DEBUG_PROGRAM.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_DEBUG_PROGRAM;
++ } else if(TraceLogLevel.TRACE_DEBUG_PROCESS.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_DEBUG_PROCESS;
++ } else if(TraceLogLevel.TRACE_DEBUG_MODULE.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_DEBUG_MODULE;
++ } else if(TraceLogLevel.TRACE_DEBUG_UNIT.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_DEBUG_UNIT;
++ } else if(TraceLogLevel.TRACE_DEBUG_FUNCTION.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_DEBUG_FUNCTION;
++ } else if(TraceLogLevel.TRACE_DEBUG_LINE.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_DEBUG_LINE;
++ } else if(TraceLogLevel.TRACE_DEBUG.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.TRACE_DEBUG;
++ } else if(TraceLogLevel.LEVEL_UNKNOWN.getInName().equals(levelName)) {
++ fLogLevel = TraceLogLevel.LEVEL_UNKNOWN;
++ } else {
++ fLogLevel = TraceLogLevel.TRACE_DEBUG;
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#formatString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String formatString() {
++ StringBuffer output = new StringBuffer();
++ // ust_tests_hello:tptest_sighandler (loglevel: TRACE_DEBUG_MODULE (10)) (type: tracepoint)");
++ output.append("\n ");
++ output.append(getName());
++ if (fLogLevel != TraceLogLevel.LEVEL_UNKNOWN) {
++ output.append(" (loglevel: ");
++ output.append(fLogLevel.getInName());
++ output.append(" (");
++ output.append(fLogLevel.ordinal());
++ output.append("))");
++ }
++ output.append(" (type: ");
++ output.append(fEventType.getInName());
++ output.append(")");
++ return output.toString();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#hashCode()
++ */
++ @Override
++ public int hashCode() {
++ final int prime = 31;
++ int result = super.hashCode();
++ result = prime * result + ((fEventType == null) ? 0 : (fEventType.ordinal() + 1));
++ result = prime * result + ((fLogLevel == null) ? 0 : (fLogLevel.ordinal() + 1));
++ return result;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#equals(java.lang.Object)
++ */
++ @Override
++ public boolean equals(Object obj) {
++ if (this == obj) {
++ return true;
++ }
++ if (!super.equals(obj)) {
++ return false;
++ }
++ if (getClass() != obj.getClass()) {
++ return false;
++ }
++ BaseEventInfo other = (BaseEventInfo) obj;
++ if (fEventType != other.fEventType) {
++ return false;
++ }
++ if (fLogLevel != other.fLogLevel) {
++ return false;
++ }
++ return true;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#toString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String toString() {
++ StringBuffer output = new StringBuffer();
++ output.append("[BaseEventInfo(");
++ output.append(super.toString());
++ output.append(",type=");
++ output.append(fEventType);
++ output.append(",level=");
++ output.append(fLogLevel);
++ output.append(")]");
++ return output.toString();
++ }
++
++
++
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++
++/**
++ * <b><u>ChannelInfo</u></b>
++ * <p>
++ * Implementation of the trace channel interface (IChannelInfo) to store channel
++ * related data.
++ * </p>
++ */
++public class ChannelInfo extends TraceInfo implements IChannelInfo {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The overwrite mode of the channel.
++ */
++ private boolean fOverwriteMode;
++ /**
++ * The sub-buffer size of the channel.
++ */
++ private long fSubBufferSize;
++ /**
++ * The number of sub-buffers of the channel.
++ */
++ private int fNumberOfSubBuffers;
++ /**
++ * The switch timer interval of the channel.
++ */
++ private long fSwitchTimer;
++ /**
++ * The read timer interval of the channel.
++ */
++ private long fReadTimer;
++ /**
++ * The Output type of the channel.
++ */
++ private String fOutputType = ""; //$NON-NLS-1$
++ /**
++ * The channel enable state.
++ */
++ private TraceEnablement fState = TraceEnablement.DISABLED;
++ /**
++ * The events information of the channel.
++ */
++ private List<IEventInfo> fEvents = new ArrayList<IEventInfo>();
++
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - name channel
++ */
++ public ChannelInfo(String name) {
++ super(name);
++ }
++
++ /**
++ * Copy constructor
++ * @param other - the instance to copy
++ */
++ public ChannelInfo(ChannelInfo other) {
++ super(other);
++ fOverwriteMode = other.fOverwriteMode;
++ fSubBufferSize = other.fSubBufferSize;
++ fNumberOfSubBuffers = other.fNumberOfSubBuffers;
++ fSwitchTimer = other.fSwitchTimer;
++ fReadTimer = other.fReadTimer;
++ fOutputType = (other.fOutputType == null ? null : String.valueOf(other.fOutputType));
++ fState = other.fState;
++ for (Iterator<IEventInfo> iterator = other.fEvents.iterator(); iterator.hasNext();) {
++ IEventInfo event = iterator.next();
++ if (event instanceof EventInfo) {
++ fEvents.add(new EventInfo((EventInfo)event));
++ } else {
++ fEvents.add(event);
++ }
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#getOverwriteMode()
++ */
++ @Override
++ public boolean isOverwriteMode() {
++ return fOverwriteMode;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#setOverwriteMode(boolean)
++ */
++ @Override
++ public void setOverwriteMode(boolean mode) {
++ fOverwriteMode = mode;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#getSubBufferSize()
++ */
++ @Override
++ public long getSubBufferSize() {
++ return fSubBufferSize;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#setSubBufferSize(long)
++ */
++ @Override
++ public void setSubBufferSize(long bufferSize) {
++ fSubBufferSize = bufferSize;
++
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#getNumberOfSubBuffers()
++ */
++ @Override
++ public int getNumberOfSubBuffers() {
++ return fNumberOfSubBuffers;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#setNumberOfSubBuffers(int)
++ */
++ @Override
++ public void setNumberOfSubBuffers(int numberOfSubBuffers) {
++ fNumberOfSubBuffers = numberOfSubBuffers;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#getSwitchTimer()
++ */
++ @Override
++ public long getSwitchTimer() {
++ return fSwitchTimer;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#setSwitchTimer(long)
++ */
++ @Override
++ public void setSwitchTimer(long timer) {
++ fSwitchTimer = timer;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#getReadTimer()
++ */
++ @Override
++ public long getReadTimer() {
++ return fReadTimer;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#setReadTimer(long)
++ */
++ @Override
++ public void setReadTimer(long timer) {
++ fReadTimer = timer;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#getOutputType()
++ */
++ @Override
++ public String getOutputType() {
++ return fOutputType;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#setOutputType(java.lang.String)
++ */
++ @Override
++ public void setOutputType(String type) {
++ fOutputType = type;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#getState()
++ */
++ @Override
++ public TraceEnablement getState() {
++ return fState;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#setState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement)
++ */
++ @Override
++ public void setState(TraceEnablement state) {
++ fState = state;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#setState(java.lang.String)
++ */
++ @Override
++ public void setState(String stateName) {
++ fState = TraceEnablement.ENABLED;
++ if (TraceEnablement.DISABLED.getInName().equals(stateName)) {
++ fState = TraceEnablement.DISABLED;
++ } else if (TraceEnablement.ENABLED.getInName().equals(stateName)) {
++ fState = TraceEnablement.ENABLED;
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#getEvents()
++ */
++ @Override
++ public IEventInfo[] getEvents() {
++ return fEvents.toArray(new IEventInfo[fEvents.size()]);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#setEvents(java.util.List)
++ */
++ @Override
++ public void setEvents(List<IEventInfo> events) {
++ for (Iterator<IEventInfo> iterator = events.iterator(); iterator.hasNext();) {
++ IEventInfo eventInfo = (IEventInfo) iterator.next();
++ fEvents.add(eventInfo);
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo#addEvent(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo)
++ */
++ @Override
++ public void addEvent(IEventInfo channel) {
++ fEvents.add(channel);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#formatString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String formatString() {
++ StringBuffer output = new StringBuffer();
++ //- channel0: [enabled]
++ output.append("\n- ");
++ output.append(getName());
++ output.append(": [");
++ output.append(getState().getInName());
++ output.append("]\n");
++ // Attributes:
++ output.append("\n Attributes:\n");
++ // overwrite mode: 0
++ output.append(" overwrite mode: ");
++ output.append(isOverwriteMode() ? "1" : "0");
++ // subbufers size: 262144
++ output.append("\n subbufers size: ");
++ output.append(getSubBufferSize());
++ // number of subbufers: 4
++ output.append("\n number of subbufers: ");
++ output.append(getNumberOfSubBuffers());
++ // switch timer interval: 0
++ output.append("\n switch timer interval: ");
++ output.append(getSwitchTimer());
++ // read timer interval: 200
++ output.append("\n read timer interval: ");
++ output.append(getReadTimer());
++ // output: splice()
++ output.append("\n output: ");
++ output.append(getOutputType());
++ output.append("\n\n");
++
++ output.append(" Events:");
++ if (fEvents.isEmpty()) {
++ output.append("\n None");
++ } else {
++ for (Iterator<IEventInfo> iterator = fEvents.iterator(); iterator.hasNext();) {
++ IEventInfo event = (IEventInfo) iterator.next();
++ output.append(event.formatString());
++ }
++ }
++ output.append("\n");
++
++ return output.toString();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#hashCode()
++ */
++ @Override
++ public int hashCode() {
++ final int prime = 31;
++ int result = super.hashCode();
++ result = prime * result + ((fEvents == null) ? 0 : fEvents.hashCode());
++ result = prime * result + fNumberOfSubBuffers;
++ result = prime * result + ((fOutputType == null) ? 0 : fOutputType.hashCode());
++ result = prime * result + (fOverwriteMode ? 1231 : 1237);
++ result = prime * result + (int) (fReadTimer ^ (fReadTimer >>> 32));
++ result = prime * result + ((fState == null) ? 0 : (fState.ordinal() + 1));
++ result = prime * result + (int) (fSubBufferSize ^ (fSubBufferSize >>> 32));
++ result = prime * result + (int) (fSwitchTimer ^ (fSwitchTimer >>> 32));
++ return result;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#equals(java.lang.Object)
++ */
++ @Override
++ public boolean equals(Object obj) {
++ if (this == obj) {
++ return true;
++ }
++ if (!super.equals(obj)) {
++ return false;
++ }
++ if (getClass() != obj.getClass()) {
++ return false;
++ }
++ ChannelInfo other = (ChannelInfo) obj;
++ if (fEvents == null) {
++ if (other.fEvents != null) {
++ return false;
++ }
++ } else if (!fEvents.equals(other.fEvents)) {
++ return false;
++ }
++ if (fNumberOfSubBuffers != other.fNumberOfSubBuffers) {
++ return false;
++ }
++ if (fOutputType == null) {
++ if (other.fOutputType != null) {
++ return false;
++ }
++ } else if (!fOutputType.equals(other.fOutputType)) {
++ return false;
++ }
++ if (fOverwriteMode != other.fOverwriteMode) {
++ return false;
++ }
++ if (fReadTimer != other.fReadTimer) {
++ return false;
++ }
++ if (fState != other.fState) {
++ return false;
++ }
++ if (fSubBufferSize != other.fSubBufferSize) {
++ return false;
++ }
++ if (fSwitchTimer != other.fSwitchTimer) {
++ return false;
++ }
++ return true;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#toString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String toString() {
++ StringBuffer output = new StringBuffer();
++ output.append("[ChannelInfo(");
++ output.append(super.toString());
++ output.append(",State=");
++ output.append(fState);
++ output.append(",OverwriteMode=");
++ output.append(fOverwriteMode);
++ output.append(",SubBuffersSize=");
++ output.append(fSubBufferSize);
++ output.append(",NumberOfSubBuffers=");
++ output.append(fNumberOfSubBuffers);
++ output.append(",SwitchTimer=");
++ output.append(fSwitchTimer);
++ output.append(",ReadTimer=");
++ output.append(fReadTimer);
++ output.append(",output=");
++ output.append(fOutputType);
++ output.append(",Events=");
++ if (fEvents.isEmpty()) {
++ output.append("None");
++ } else {
++ for (Iterator<IEventInfo> iterator = fEvents.iterator(); iterator.hasNext();) {
++ IEventInfo event = (IEventInfo) iterator.next();
++ output.append(event.toString());
++ }
++ }
++ output.append(")]");
++ return output.toString();
++ }
++
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo;
++
++/**
++ * <b><u>DomainInfo</u></b>
++ * <p>
++ * Implementation of the trace domain interface (IDomainInfo) to store domain
++ * related data.
++ * </p>
++ */
++public class DomainInfo extends TraceInfo implements IDomainInfo {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The channels information of the domain.
++ */
++ private List<IChannelInfo> fChannels = new ArrayList<IChannelInfo>();
++ private boolean fIsKernel = false;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - name of domain
++ */
++ public DomainInfo(String name) {
++ super(name);
++ }
++
++ /**
++ * Copy constructor
++ * @param other - the instance to copy
++ */
++ public DomainInfo(DomainInfo other) {
++ super(other);
++ for (int i = 0; i < other.fChannels.size(); i++) {
++ if (other.fChannels.get(i) instanceof ChannelInfo) {
++ fChannels.add(new ChannelInfo((ChannelInfo)other.fChannels.get(i)));
++ } else {
++ fChannels.add(other.fChannels.get(i));
++ }
++ }
++ fIsKernel = other.fIsKernel;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo#isKernel()
++ */
++ @Override
++ public boolean isKernel() {
++ return fIsKernel;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo#setIsKernel(boolean)
++ */
++ @Override
++ public void setIsKernel(boolean isKernel) {
++ fIsKernel = isKernel;
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo#getChannels()
++ */
++ @Override
++ public IChannelInfo[] getChannels() {
++ return fChannels.toArray(new IChannelInfo[fChannels.size()]);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo#setChannels(java.util.List)
++ */
++ @Override
++ public void setChannels(List<IChannelInfo> channels) {
++ for (Iterator<IChannelInfo> iterator = channels.iterator(); iterator.hasNext();) {
++ IChannelInfo channelInfo = (IChannelInfo) iterator.next();
++ fChannels.add(channelInfo);
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo#addChannel(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo)
++ */
++ @Override
++ public void addChannel(IChannelInfo channel) {
++ fChannels.add(channel);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#formatString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String formatString() {
++ StringBuffer output = new StringBuffer();
++ //=== Domain: Kernel ===
++ output.append("\n=== Domain: ");
++ output.append(getName());
++ output.append(" ===\n");
++ output.append("\n");
++ // Channels:
++ output.append("Channels:\n");
++ // -------------
++ output.append("-------------");
++ if (fChannels.isEmpty()) {
++ output.append("\nNone");
++ } else {
++ for (Iterator<IChannelInfo> iterator = fChannels.iterator(); iterator.hasNext();) {
++ IChannelInfo channel = (IChannelInfo) iterator.next();
++ output.append(channel.formatString());
++ }
++ }
++ output.append("\n");
++ return output.toString();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#hashCode()
++ */
++ @Override
++ public int hashCode() {
++ final int prime = 31;
++ int result = super.hashCode();
++ result = prime * result + ((fChannels == null) ? 0 : fChannels.hashCode());
++ result = prime * result + (fIsKernel ? 1231 : 1237);
++ return result;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#equals(java.lang.Object)
++ */
++ @Override
++ public boolean equals(Object obj) {
++ if (this == obj) {
++ return true;
++ }
++ if (!super.equals(obj)) {
++ return false;
++ }
++ if (getClass() != obj.getClass()) {
++ return false;
++ }
++ DomainInfo other = (DomainInfo) obj;
++ if (fChannels == null) {
++ if (other.fChannels != null) {
++ return false;
++ }
++ } else if (!fChannels.equals(other.fChannels)) {
++ return false;
++ }
++ if (fIsKernel != other.fIsKernel) {
++ return false;
++ }
++ return true;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#toString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String toString() {
++ StringBuffer output = new StringBuffer();
++ output.append("[DomainInfo(");
++ output.append(super.toString());
++ output.append(",Channels=");
++ if (fChannels.isEmpty()) {
++ output.append("None");
++ } else {
++ for (Iterator<IChannelInfo> iterator = fChannels.iterator(); iterator.hasNext();) {
++ IChannelInfo channel = (IChannelInfo) iterator.next();
++ output.append(channel.toString());
++ }
++ }
++ output.append(",isKernel=");
++ output.append(String.valueOf(fIsKernel));
++ output.append(")]");
++ return output.toString();
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++
++/**
++* <b><u>EventInfo</u></b>
++* <p>
++* Implementation of the trace event interface (IEventInfo) to store event
++* related data.
++* </p>
++*/
++public class EventInfo extends BaseEventInfo implements IEventInfo {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The enable state of the event.
++ */
++ private TraceEnablement fState = TraceEnablement.DISABLED;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - name of event
++ */
++ public EventInfo(String name) {
++ super(name);
++ }
++
++ /**
++ * Copy constructor
++ * @param other - the instance to copy
++ */
++ public EventInfo(EventInfo other) {
++ super(other);
++ fState = other.fState;
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo#getState()
++ */
++ @Override
++ public TraceEnablement getState() {
++ return fState;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo#setState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement)
++ */
++ @Override
++ public void setState(TraceEnablement state) {
++ fState = state;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#formatString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String formatString() {
++ StringBuffer output = new StringBuffer();
++ // ust_tests_hello:tptest_sighandler (loglevel: TRACE_DEBUG_MODULE (10)) (type: tracepoint) [enabled]");
++ output.append(super.formatString());
++ output.append(" [");
++ output.append(fState.getInName());
++ output.append("]");
++ return output.toString();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo#setState(java.lang.String)
++ */
++ @Override
++ public void setState(String stateName) {
++ fState = TraceEnablement.DISABLED;
++ if (TraceEnablement.DISABLED.getInName().equals(stateName)) {
++ fState = TraceEnablement.DISABLED;
++ } else if (TraceEnablement.ENABLED.getInName().equals(stateName)) {
++ fState = TraceEnablement.ENABLED;
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo#hashCode()
++ */
++ @Override
++ public int hashCode() {
++ final int prime = 31;
++ int result = super.hashCode();
++ result = prime * result + ((fState == null) ? 0 : (fState.ordinal() + 1));
++ return result;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo#equals(java.lang.Object)
++ */
++ @Override
++ public boolean equals(Object obj) {
++ if (this == obj) {
++ return true;
++ }
++ if (!super.equals(obj)) {
++ return false;
++ }
++ if (getClass() != obj.getClass()) {
++ return false;
++ }
++ EventInfo other = (EventInfo) obj;
++ if (fState != other.fState) {
++ return false;
++ }
++ return true;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo#toString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String toString() {
++ StringBuffer output = new StringBuffer();
++ output.append("[EventInfo(");
++ output.append(super.toString());
++ output.append(",State=");
++ output.append(fState);
++ output.append(")]");
++ return output.toString();
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.KernelProviderPropertySource;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++/**
++ * <b><u>KernelProviderComponent</u></b>
++ * <p>
++ * TODO
++ * </p>
++ */
++public class KernelProviderComponent extends TraceControlComponent {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component.
++ */
++ public static final String KERNEL_PROVIDER_ICON_FILE = "icons/obj16/targets.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public KernelProviderComponent(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ setImage(KERNEL_PROVIDER_ICON_FILE);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * Sets the events information for this component.
++ * @param eventInfos - events information to set.
++ */
++ public void setEventInfo(List<IBaseEventInfo> eventInfos) {
++ for (Iterator<IBaseEventInfo> iterator = eventInfos.iterator(); iterator.hasNext();) {
++ IBaseEventInfo baseEventInfo = (IBaseEventInfo) iterator.next();
++ BaseEventComponent component = new BaseEventComponent(baseEventInfo.getName(), this);
++ component.setEventInfo(baseEventInfo);
++ addChild(component);
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ if (adapter == IPropertySource.class) {
++ return new KernelProviderPropertySource(this);
++ }
++ return null;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo;
++
++/**
++* <b><u>ProbleEventInfo</u></b>
++* <p>
++* Implementation of the trace event interface (IProbeEventInfo) to store probe event
++* related data.
++* </p>
++*/
++public class ProbeEventInfo extends EventInfo implements IProbeEventInfo {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The dynamic probe address (null if symbol is used).
++ */
++ private String fAddress;
++ /**
++ * The dynamic probe offset (if symbol is used).
++ */
++ private String fOffset;
++
++ /**
++ * The symbol name (null if address is used)
++ */
++ private String fSymbol;
++
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - name of event
++ */
++ public ProbeEventInfo(String name) {
++ super(name);
++ }
++
++ /**
++ * Copy constructor
++ * @param other - the instance to copy
++ */
++ public ProbeEventInfo(ProbeEventInfo other) {
++ super(other);
++ fAddress = other.fAddress;
++ fOffset = other.fOffset;
++ fSymbol = other.fSymbol;
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo#getAddress()
++ */
++ @Override
++ public String getAddress() {
++ return fAddress;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo#setAddress(java.lang.String)
++ */
++ @Override
++ public void setAddress(String address) {
++ fAddress = address;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo#getOffset()
++ */
++ @Override
++ public String getOffset() {
++ return fOffset;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo#setOffset(java.lang.String)
++ */
++ @Override
++ public void setOffset(String offset) {
++ fOffset = offset;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo#getSymbol()
++ */
++ @Override
++ public String getSymbol() {
++ return fSymbol;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo#setSymbol(java.lang.String)
++ */
++ @Override
++ public void setSymbol(String symbol) {
++ fSymbol = symbol;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operation
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#formatString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String formatString() {
++ StringBuffer output = new StringBuffer();
++ // name (type: probe) [enabled]");
++ // address:
++ output.append(super.formatString());
++ if (fAddress != null) {
++ output.append("\n addr: ");
++ output.append(fAddress);
++ } else {
++ output.append("\n offset: ");
++ output.append(fOffset);
++ output.append("\n");
++ output.append(" symbol: ");
++ output.append(fSymbol);
++ }
++ return output.toString();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo#hashCode()
++ */
++ @Override
++ public int hashCode() {
++ final int prime = 31;
++ int result = super.hashCode();
++ result = prime * result + ((fAddress == null) ? 0 : fAddress.hashCode());
++ result = prime * result + ((fOffset == null) ? 0 : fOffset.hashCode());
++ result = prime * result + ((fSymbol == null) ? 0 : fSymbol.hashCode());
++ return result;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo#equals(java.lang.Object)
++ */
++ @Override
++ public boolean equals(Object obj) {
++ if (this == obj) {
++ return true;
++ }
++ if (!super.equals(obj)) {
++ return false;
++ }
++ if (getClass() != obj.getClass()) {
++ return false;
++ }
++ ProbeEventInfo other = (ProbeEventInfo) obj;
++ if (fAddress == null) {
++ if (other.fAddress != null) {
++ return false;
++ }
++ } else if (!fAddress.equals(other.fAddress)) {
++ return false;
++ }
++ if (fOffset == null) {
++ if (other.fOffset != null) {
++ return false;
++ }
++ } else if (!fOffset.equals(other.fOffset)) {
++ return false;
++ }
++ if (fSymbol == null) {
++ if (other.fSymbol != null) {
++ return false;
++ }
++ } else if (!fSymbol.equals(other.fSymbol)) {
++ return false;
++ }
++ return true;
++ }
++
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.EventInfo#toString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String toString() {
++ StringBuffer output = new StringBuffer();
++ output.append("[ProbeEventInfo(");
++ output.append(super.toString());
++ if (fAddress != null) {
++ output.append(",fAddress=");
++ output.append(fAddress);
++ } else {
++ output.append(",fOffset=");
++ output.append(fOffset);
++ output.append(",fSymbol=");
++ output.append(fSymbol);
++ }
++ output.append(")]");
++ return output.toString();
++ }
++
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++
++/**
++ * <b><u>SessionInfo</u></b>
++ * <p>
++ * Implementation of the trace session interface (ISessionInfo) to store session
++ * related data.
++ * </p>
++ */
++public class SessionInfo extends TraceInfo implements ISessionInfo {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The trace session state.
++ */
++ private TraceSessionState fState = TraceSessionState.INACTIVE;
++ /**
++ * The trace session path for storing traces.
++ */
++ private String fSessionPath = ""; //$NON-NLS-1$
++ /**
++ * The domains information of this session.
++ */
++ private List<IDomainInfo> fDomains = new ArrayList<IDomainInfo>();
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - name of base event
++ */
++ public SessionInfo(String name) {
++ super(name);
++ }
++
++ /**
++ * Copy constructor
++ * @param other - the instance to copy
++ */
++ public SessionInfo(SessionInfo other) {
++ super(other);
++ fState = other.fState;
++ fSessionPath = other.fSessionPath;
++
++ for (Iterator<IDomainInfo> iterator = other.fDomains.iterator(); iterator.hasNext();) {
++ IDomainInfo domain = iterator.next();
++ if (domain instanceof DomainInfo) {
++ fDomains.add(new DomainInfo((DomainInfo)domain));
++ } else {
++ fDomains.add(domain);
++ }
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo#getSessionState()
++ */
++ @Override
++ public TraceSessionState getSessionState() {
++ return fState;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo#setSessionState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState)
++ */
++ @Override
++ public void setSessionState(TraceSessionState state) {
++ fState = state;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo#setSessionState(java.lang.String)
++ */
++ @Override
++ public void setSessionState(String stateName) {
++ if (TraceSessionState.INACTIVE.getInName().equals(stateName)) {
++ fState = TraceSessionState.INACTIVE;
++ } else if (TraceSessionState.ACTIVE.getInName().equals(stateName)) {
++ fState = TraceSessionState.ACTIVE;
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo#getSessionPath()
++ */
++ @Override
++ public String getSessionPath() {
++ return fSessionPath;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo#setSessionPath(java.lang.String)
++ */
++ @Override
++ public void setSessionPath(String path) {
++ fSessionPath = path;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo#getDomains()
++ */
++ @Override
++ public IDomainInfo[] getDomains() {
++ return fDomains.toArray(new IDomainInfo[fDomains.size()]);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo#setDomains(java.util.List)
++ */
++ @Override
++ public void setDomains(List<IDomainInfo> domains) {
++ for (Iterator<IDomainInfo> iterator = domains.iterator(); iterator.hasNext();) {
++ IDomainInfo domainInfo = (IDomainInfo) iterator.next();
++ fDomains.add(domainInfo);
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo#addDomain(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo)
++ */
++ @Override
++ public void addDomain(IDomainInfo domainInfo) {
++ fDomains.add(domainInfo);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#formatString()
++ */
++ @Override
++ @SuppressWarnings("nls")
++ public String formatString() {
++ StringBuffer output = new StringBuffer();
++ // Tracing session mysession: [active]
++ output.append("Tracing session ");
++ output.append(getName());
++ output.append(": [");
++ output.append(getSessionState().getInName());
++ output.append("]\n");
++
++ // Trace path: /home/user/lttng-traces/mysession-20120129-084256
++ output.append(" Trace path: ");
++ output.append(getSessionPath());
++ output.append("\n");
++
++ for (Iterator<IDomainInfo> iterator = fDomains.iterator(); iterator.hasNext();) {
++ IDomainInfo domain = (IDomainInfo) iterator.next();
++ output.append(domain.formatString());
++ }
++ return output.toString();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#hashCode()
++ */
++ @Override
++ public int hashCode() {
++ final int prime = 31;
++ int result = super.hashCode();
++ result = prime * result + ((fDomains == null) ? 0 : fDomains.hashCode());
++ result = prime * result + ((fSessionPath == null) ? 0 : fSessionPath.hashCode());
++ result = prime * result + ((fState == null) ? 0 : (fState.ordinal() + 1));
++ return result;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#equals(java.lang.Object)
++ */
++ @Override
++ public boolean equals(Object obj) {
++ if (this == obj) {
++ return true;
++ }
++ if (!super.equals(obj)) {
++ return false;
++ }
++ if (getClass() != obj.getClass()) {
++ return false;
++ }
++ SessionInfo other = (SessionInfo) obj;
++ if (fDomains == null) {
++ if (other.fDomains != null) {
++ return false;
++ }
++ } else if (!fDomains.equals(other.fDomains)) {
++ return false;
++ }
++ if (fSessionPath == null) {
++ if (other.fSessionPath != null) {
++ return false;
++ }
++ } else if (!fSessionPath.equals(other.fSessionPath)) {
++ return false;
++ }
++ if (fState != other.fState) {
++ return false;
++ }
++ return true;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#toString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String toString() {
++ StringBuffer output = new StringBuffer();
++ output.append("[SessionInfo(");
++ output.append(super.toString());
++ output.append(",State=");
++ output.append(fState);
++ output.append(",Domains=");
++ for (Iterator<IDomainInfo> iterator = fDomains.iterator(); iterator.hasNext();) {
++ IDomainInfo domain = (IDomainInfo) iterator.next();
++ output.append(domain.toString());
++ }
++ output.append(")]");
++ return output.toString();
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.IStatus;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.core.runtime.jobs.Job;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TargetNodePropertySource;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.remote.IRemoteSystemProxy;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.remote.RemoteSystemProxy;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandShell;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.LTTngControlService;
++import org.eclipse.rse.core.model.IHost;
++import org.eclipse.rse.core.model.IRSECallback;
++import org.eclipse.rse.core.subsystems.CommunicationsEvent;
++import org.eclipse.rse.core.subsystems.ICommunicationsListener;
++import org.eclipse.swt.graphics.Image;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++/**
++ * <b><u>TargetNodeComponent</u></b>
++ * <p>
++ * Implementation of the trace node component.
++ * </p>
++ */
++public class TargetNodeComponent extends TraceControlComponent implements ICommunicationsListener {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component (state connected).
++ */
++ public static final String TARGET_NODE_CONNECTED_ICON_FILE = "icons/obj16/target_connected.gif"; //$NON-NLS-1$
++ /**
++ * Path to icon file for this component (state disconnected).
++ */
++ public static final String TARGET_NODE_DISCONNECTED_ICON_FILE = "icons/obj16/target_disconnected.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The node connection state.
++ */
++ private TargetNodeState fState = TargetNodeState.DISCONNECTED;
++ /**
++ * The image to be displayed in state disconnected.
++ */
++ private Image fDisconnectedImage = null;
++ /**
++ * The connection implementation.
++ */
++ private IHost fHost = null;
++ /**
++ * The remote proxy implementation.
++ */
++ private IRemoteSystemProxy fRemoteProxy = null;
++ /**
++ * The control service for LTTng specific commands.
++ */
++ private ILttngControlService fService = null;
++ /**
++ * The command shell for issuing commands.
++ */
++ private ICommandShell fShell = null;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component
++ * @param parent - the parent of the component
++ * @param host - the host connection implementation
++ * @param proxy - the remote proxy implementation
++ */
++ public TargetNodeComponent(String name, ITraceControlComponent parent, IHost host, IRemoteSystemProxy proxy) {
++ super(name, parent);
++ setImage(TARGET_NODE_CONNECTED_ICON_FILE);
++ fDisconnectedImage = Activator.getDefault().loadIcon(TARGET_NODE_DISCONNECTED_ICON_FILE);
++ fHost = host;
++ fRemoteProxy = proxy;
++ setToolTip(fHost.getHostName());
++ }
++
++ /**
++ * Constructor (using default proxy)
++ * @param name - the name of the component
++ * @param parent - the parent of the component
++ * @param host - the host connection implementation
++ */
++ public TargetNodeComponent(String name, ITraceControlComponent parent, IHost host) {
++ this(name, parent, host, new RemoteSystemProxy(host));
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getImage()
++ */
++ @Override
++ public Image getImage() {
++ if (fState == TargetNodeState.CONNECTED) {
++ return super.getImage();
++ }
++ return fDisconnectedImage;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getTargetNodeState()
++ */
++ @Override
++ public TargetNodeState getTargetNodeState() {
++ return fState;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#setTargetNodeState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent.TargetNodeState)
++ */
++ @Override
++ public void setTargetNodeState(TargetNodeState state) {
++ fState = state;
++ fireComponentChanged(TargetNodeComponent.this);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getControlService()
++ */
++ @Override
++ public ILttngControlService getControlService() {
++ return fService;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#setControlService(org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService)
++ */
++ @Override
++ public void setControlService(ILttngControlService service) {
++ fService = (ILttngControlService)service;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ if (adapter == IPropertySource.class) {
++ return new TargetNodePropertySource(this);
++ }
++ return null;
++ }
++
++ /**
++ * @return remote host name
++ */
++ public String getHostName() {
++ return fHost.getHostName();
++ }
++
++ /**
++ * @return remote system proxy implementation
++ */
++ public IRemoteSystemProxy getRemoteSystemProxy() {
++ return fRemoteProxy;
++ }
++
++ /**
++ * @return all available sessions.
++ */
++ public TraceSessionComponent[] getSessions() {
++ List<ITraceControlComponent> compenents = getChildren(TraceSessionGroup.class);
++ if (compenents.size() > 0) {
++ TraceSessionGroup group = (TraceSessionGroup)compenents.get(0);
++ List<ITraceControlComponent> sessions = group.getChildren(TraceSessionComponent.class);
++ return (TraceSessionComponent[])sessions.toArray(new TraceSessionComponent[sessions.size()]);
++ }
++ return new TraceSessionComponent[0];
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /*
++ * @see org.eclipse.rse.core.subsystems.ICommunicationsListener#communicationsStateChange(org.eclipse.rse.core.subsystems.CommunicationsEvent)
++ */
++ @Override
++ public void communicationsStateChange(CommunicationsEvent e) {
++ if (e.getState() == CommunicationsEvent.AFTER_DISCONNECT ||
++ e.getState() == CommunicationsEvent.CONNECTION_ERROR) {
++ handleDisconnected();
++ } if ((e.getState() == CommunicationsEvent.AFTER_CONNECT) && (fState != TargetNodeState.CONNECTING)) {
++ handleConnected();
++ }
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.rse.core.subsystems.ICommunicationsListener#isPassiveCommunicationsListener()
++ */
++ @Override
++ public boolean isPassiveCommunicationsListener() {
++ return true;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceControlComponent#dispose()
++ */
++ @Override
++ public void dispose() {
++ fRemoteProxy.removeCommunicationListener(this);
++ }
++
++ /**
++ * Method to connect this node component to the remote target node.
++ */
++ public void connect() {
++ if (fState == TargetNodeState.DISCONNECTED) {
++ try {
++ setTargetNodeState(TargetNodeState.CONNECTING);
++ fRemoteProxy.connect(new IRSECallback() {
++ @Override
++ public void done(IStatus status, Object result) {
++ // Note: result might be null!
++ if(status.isOK()) {
++ handleConnected();
++ } else {
++ handleDisconnected();
++ }
++ }
++ });
++ } catch (Exception e) {
++ setTargetNodeState(TargetNodeState.DISCONNECTED);
++ Activator.logError(Messages.TraceControl_ConnectionFailure + " (" + getName() + ").", e); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ }
++ }
++
++ /**
++ * Method to disconnect this node component to the remote target node.
++ */
++ public void disconnect() {
++ if (fState == TargetNodeState.CONNECTED) {
++ try {
++ setTargetNodeState(TargetNodeState.DISCONNECTING);
++ fRemoteProxy.disconnect();
++ } catch (Exception e) {
++ Activator.logError(Messages.TraceControl_DisconnectionFailure + getName(), e);
++ } finally {
++ handleDisconnected();
++ }
++ }
++ }
++
++ /**
++ * Retrieves the trace configuration from the target node and populates the information
++ * in the tree model. The execution is done in a own job.
++ *
++ * @throws ExecutionException
++ */
++ public void getConfigurationFromNode() {
++ Job job = new Job(Messages.TraceControl_RetrieveNodeConfigurationJob) {
++ @Override
++ protected IStatus run(IProgressMonitor monitor) {
++
++ try {
++ // Get provider information from node
++ TraceProviderGroup providerGroup = new TraceProviderGroup(Messages.TraceControl_ProviderDisplayName, TargetNodeComponent.this);
++ addChild(providerGroup);
++ providerGroup.getProviderFromNode(monitor);
++
++ // Get session information from node
++ TraceSessionGroup sessionGroup = new TraceSessionGroup(Messages.TraceControl_AllSessionsDisplayName, TargetNodeComponent.this);
++ addChild(sessionGroup);
++ sessionGroup.getSessionsFromNode(monitor);
++ } catch (ExecutionException e) {
++ removeAllChildren();
++ return new Status(Status.ERROR, Activator.PLUGIN_ID, e.toString());
++ }
++
++ return Status.OK_STATUS;
++ }
++ };
++ job.setUser(true);
++ job.schedule();
++ }
++
++ public void refresh() {
++ removeAllChildren();
++ getConfigurationFromNode();
++ }
++
++ // ------------------------------------------------------------------------
++ // Helper function
++ // ------------------------------------------------------------------------
++ /**
++ * @return returns the control service for LTTng specific commands.
++ * @throws ExecutionException
++ */
++ private ILttngControlService createControlService() throws ExecutionException {
++ if (fShell == null) {
++ fShell = fRemoteProxy.createCommandShell();
++ fRemoteProxy.addCommunicationListener(this);
++ }
++ fService = new LTTngControlService(fShell);
++ return fService;
++ }
++
++ /**
++ * Handles the connected event.
++ */
++ private void handleConnected() {
++ setTargetNodeState(TargetNodeState.CONNECTED);
++ try {
++ createControlService();
++ getConfigurationFromNode();
++ } catch (ExecutionException e) {
++ Activator.logError(Messages.TraceControl_ListSessionFailure, e);
++ }
++ }
++
++ /**
++ * Handles the disconnected event.
++ */
++ private void handleDisconnected() {
++ removeAllChildren();
++ setTargetNodeState(TargetNodeState.DISCONNECTED);
++ fShell = null;
++ fService = null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.NullProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceChannelPropertySource;
++import org.eclipse.swt.graphics.Image;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++
++/**
++ * <b><u>TraceChannelComponent</u></b>
++ * <p>
++ * Implementation of the trace channel component.
++ * </p>
++ */
++public class TraceChannelComponent extends TraceControlComponent {
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component (state enabled).
++ */
++ public static final String TRACE_CHANNEL_ICON_FILE_ENABLED = "icons/obj16/channel.gif"; //$NON-NLS-1$
++ /**
++ * Path to icon file for this component (state disabled).
++ */
++ public static final String TRACE_CHANNEL_ICON_FILE_DISABLED = "icons/obj16/channel_disabled.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The channel information.
++ */
++ private IChannelInfo fChannelInfo = null;
++ /**
++ * The image to be displayed in disabled state.
++ */
++ private Image fDisabledImage = null;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public TraceChannelComponent(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ setImage(TRACE_CHANNEL_ICON_FILE_ENABLED);
++ setToolTip(Messages.TraceControl_ChannelDisplayName);
++ fChannelInfo = new ChannelInfo(name);
++ fDisabledImage = Activator.getDefault().loadIcon(TRACE_CHANNEL_ICON_FILE_DISABLED);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getImage()
++ */
++ @Override
++ public Image getImage() {
++ if (fChannelInfo.getState() == TraceEnablement.DISABLED) {
++ return fDisabledImage;
++ }
++ return super.getImage();
++ }
++
++ /**
++ * Sets the channel information.
++ * @param channelInfo
++ */
++ public void setChannelInfo(IChannelInfo channelInfo) {
++ fChannelInfo = channelInfo;
++ IEventInfo[] events = fChannelInfo.getEvents();
++ for (int i = 0; i < events.length; i++) {
++ TraceEventComponent event = null;
++ if (events[i].getClass() == ProbeEventInfo.class) {
++ event = new TraceProbeEventComponent(events[i].getName(), this);
++ } else {
++ event = new TraceEventComponent(events[i].getName(), this);
++ }
++
++ event.setEventInfo(events[i]);
++ addChild(event);
++ }
++ }
++
++ /**
++ * @return the overwrite mode value.
++ */
++ public boolean isOverwriteMode() {
++ return fChannelInfo.isOverwriteMode();
++ }
++ /**
++ * Sets the overwrite mode value to the given mode.
++ * @param mode - mode to set.
++ */
++ public void setOverwriteMode(boolean mode){
++ fChannelInfo.setOverwriteMode(mode);
++ }
++ /**
++ * @return the sub-buffer size.
++ */
++ public long getSubBufferSize() {
++ return fChannelInfo.getSubBufferSize();
++ }
++ /**
++ * Sets the sub-buffer size to the given value.
++ * @param bufferSize - size to set to set.
++ */
++ public void setSubBufferSize(long bufferSize) {
++ fChannelInfo.setSubBufferSize(bufferSize);
++ }
++ /**
++ * @return the number of sub-buffers.
++ */
++ public int getNumberOfSubBuffers() {
++ return fChannelInfo.getNumberOfSubBuffers();
++ }
++ /**
++ * Sets the number of sub-buffers to the given value.
++ * @param numberOfSubBuffers - value to set.
++ */
++ public void setNumberOfSubBuffers(int numberOfSubBuffers) {
++ fChannelInfo.setNumberOfSubBuffers(numberOfSubBuffers);
++ }
++ /**
++ * @return the switch timer interval.
++ */
++ public long getSwitchTimer() {
++ return fChannelInfo.getSwitchTimer();
++ }
++ /**
++ * Sets the switch timer interval to the given value.
++ * @param timer - timer value to set.
++ */
++ public void setSwitchTimer(long timer) {
++ fChannelInfo.setSwitchTimer(timer);
++ }
++ /**
++ * @return the read timer interval.
++ */
++ public long getReadTimer() {
++ return fChannelInfo.getReadTimer();
++ }
++ /**
++ * Sets the read timer interval to the given value.
++ * @param timer - timer value to set..
++ */
++ public void setReadTimer(long timer) {
++ fChannelInfo.setReadTimer(timer);
++ }
++ /**
++ * @return the output type.
++ */
++ public String getOutputType() {
++ return fChannelInfo.getOutputType();
++ }
++ /**
++ * Sets the output type to the given value.
++ * @param type - type to set.
++ */
++ public void setOutputType(String type) {
++ fChannelInfo.setOutputType(type);
++ }
++ /**
++ * @return the channel state (enabled or disabled).
++ */
++ public TraceEnablement getState() {
++ return fChannelInfo.getState();
++ }
++ /**
++ * Sets the channel state (enablement) to the given value.
++ * @param state - state to set.
++ */
++ public void setState(TraceEnablement state) {
++ fChannelInfo.setState(state);
++ }
++ /**
++ * Sets the channel state (enablement) to the value specified by the given name.
++ * @param stateName - state to set.
++ */
++ public void setState(String stateName) {
++ fChannelInfo.setState(stateName);
++ }
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ if (adapter == IPropertySource.class) {
++ return new TraceChannelPropertySource(this);
++ }
++ return null;
++ }
++
++ /**
++ * @return session name from parent
++ */
++ public String getSessionName() {
++ return ((TraceDomainComponent)getParent()).getSessionName();
++ }
++
++ /**
++ * @return session from parent
++ */
++ public TraceSessionComponent getSession() {
++ return ((TraceDomainComponent)getParent()).getSession();
++ }
++
++ /**
++ * @return if domain is kernel or UST
++ */
++ public boolean isKernel() {
++ return ((TraceDomainComponent)getParent()).isKernel();
++ }
++
++ /**
++ * @return the parent target node
++ */
++ public TargetNodeComponent getTargetNode() {
++ return ((TraceDomainComponent)getParent()).getTargetNode();
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Enables a list of events with no additional parameters.
++ * @param eventNames - a list of event names to enabled.
++ * @throws ExecutionException
++ */
++ public void enableEvents(List<String> eventNames) throws ExecutionException {
++ enableEvents(eventNames, new NullProgressMonitor());
++ }
++
++ /**
++ * Enables a list of events with no additional parameters.
++ * @param eventNames - a list of event names to enabled.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableEvents(List<String> eventNames, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableEvents(getSessionName(), getName(), eventNames, isKernel(), monitor);
++ }
++
++ /**
++ * Enables all syscalls (for kernel domain)
++ * @throws ExecutionException
++ */
++ public void enableSyscalls() throws ExecutionException {
++ enableSyscalls(new NullProgressMonitor());
++ }
++
++ /**
++ * Enables all syscalls (for kernel domain)
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableSyscalls(IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableSyscalls(getSessionName(), getName(), monitor);
++ }
++
++ /**
++ * Enables a dynamic probe (for kernel domain)
++ * @param eventName - event name for probe
++ * @param isFunction - true for dynamic function entry/return probe else false
++ * @param probe - the actual probe
++ * @throws ExecutionException
++ */
++ public void enableProbe(String eventName, boolean isFunction, String probe) throws ExecutionException {
++ enableProbe(eventName, isFunction, probe, new NullProgressMonitor());
++ }
++
++ /**
++ * Enables a dynamic probe (for kernel domain)
++ * @param eventName - event name for probe
++ * @param isFunction - true for dynamic function entry/return probe else false
++ * @param probe - the actual probe
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableProbe(String eventName, boolean isFunction, String probe, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableProbe(getSessionName(), getName(), eventName, isFunction, probe, monitor);
++ }
++
++ /**
++ * Enables events using log level.
++ * @param eventName - a event name
++ * @param logLevelType - a log level type
++ * @param level - a log level
++ * @throws ExecutionException
++ */
++ public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level) throws ExecutionException {
++ enableLogLevel(eventName, logLevelType, level, new NullProgressMonitor());
++ }
++
++ /**
++ * Enables events using log level.
++ * @param eventName - a event name
++ * @param logLevelType - a log level type
++ * @param level - a log level
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableLogLevel(getSessionName(), getName(), eventName, logLevelType, level, monitor);
++ }
++
++ /**
++ * Enables a list of events with no additional parameters.
++ * @param eventNames - a list of event names to enabled.
++ * @throws ExecutionException
++ */
++ public void disableEvent(List<String> eventNames) throws ExecutionException {
++ disableEvent(eventNames, new NullProgressMonitor());
++ }
++
++ /**
++ * Enables a list of events with no additional parameters.
++ * @param eventNames - a list of event names to enabled.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void disableEvent(List<String> eventNames, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().disableEvent(getParent().getParent().getName(), getName(), eventNames, isKernel(), monitor);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.runtime.ListenerList;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponentChangedListener;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TargetNodeState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService;
++import org.eclipse.swt.graphics.Image;
++
++/**
++ * <b><u>TraceControlComponent</u></b>
++ * <p>
++ * Base implementation for trace control component.
++ * </p>
++ */
++public class TraceControlComponent implements ITraceControlComponent {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The name of the component
++ */
++ private String fName = ""; //$NON-NLS-1$
++ /**
++ * The image to be displayed for the component.
++ */
++ private Image fImage = null;
++ /**
++ * The tool tip to be displayed for the component.
++ */
++ private String fToolTip = null;
++ /**
++ * The parent component.
++ */
++ private ITraceControlComponent fParent = null;
++ /**
++ * The list if children components.
++ */
++ private List<ITraceControlComponent> fChildren = new ArrayList<ITraceControlComponent>();
++ /**
++ * The list of listeners to be notified about changes.
++ */
++ private ListenerList fListeners = new ListenerList();
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ */
++ public TraceControlComponent(String name) {
++ this(name, null);
++ }
++
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent component.
++ */
++ public TraceControlComponent(String name, ITraceControlComponent parent) {
++ fName = name;
++ fParent = parent;
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#getName()
++ */
++ @Override
++ public String getName() {
++ return fName;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#setName(java.lang.String)
++ */
++ @Override
++ public void setName(String name) {
++ fName = name;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#getImage()
++ */
++ @Override
++ public Image getImage() {
++ return fImage;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#setImage(java.lang.String)
++ */
++ @Override
++ public void setImage(String path) {
++ fImage = Activator.getDefault().loadIcon(path);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#setImage(org.eclipse.swt.graphics.Image)
++ */
++ @Override
++ public void setImage(Image image) {
++ fImage = image;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#getToolTip()
++ */
++ @Override
++ public String getToolTip() {
++ return fToolTip;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#setToolTip(java.lang.String)
++ */
++ @Override
++ public void setToolTip(String toolTip) {
++ fToolTip = toolTip;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#getTargetNodeState()
++ */
++ @Override
++ public TargetNodeState getTargetNodeState() {
++ if (getParent() != null) {
++ return getParent().getTargetNodeState();
++ }
++ return TargetNodeState.DISCONNECTED;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#setTargetNodeState(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent.TargetNodeState)
++ */
++ @Override
++ public void setTargetNodeState(TargetNodeState state) {
++ if (getParent() != null) {
++ getParent().setTargetNodeState(state);
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#getParent()
++ */
++ @Override
++ public ITraceControlComponent getParent() {
++ return fParent;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#setParent(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void setParent(ITraceControlComponent parent) {
++ fParent = parent;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#getChildren()
++ */
++ @Override
++ public ITraceControlComponent[] getChildren() {
++ return (ITraceControlComponent [])fChildren.toArray(new ITraceControlComponent[fChildren.size()]);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#setChildren(java.util.List)
++ */
++ @Override
++ public void setChildren(List<ITraceControlComponent> children) {
++ for (Iterator<ITraceControlComponent> iterator = children.iterator(); iterator.hasNext();) {
++ ITraceControlComponent traceControlComponent = (ITraceControlComponent) iterator.next();
++ fChildren.add(traceControlComponent);
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#getChild(java.lang.String)
++ */
++ @Override
++ public ITraceControlComponent getChild(String name) {
++ ITraceControlComponent child = null;
++ for (int i = 0; i < fChildren.size(); i++) {
++ if (fChildren.get(i).getName().equals(name)) {
++ child = fChildren.get(i);
++ break;
++ }
++ }
++ return child;
++ }
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#getChildren(java.lang.Class)
++ */
++ @Override
++ public List<ITraceControlComponent> getChildren(Class<? extends ITraceControlComponent> clazz) {
++ List<ITraceControlComponent> list = new ArrayList<ITraceControlComponent>();
++
++ for (Iterator<ITraceControlComponent> iterator = fChildren.iterator(); iterator.hasNext();) {
++ ITraceControlComponent child = (ITraceControlComponent) iterator.next();
++ if (child.getClass() == clazz) {
++ list.add(child);
++ }
++ }
++ return list;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#getControlService()
++ */
++ @Override
++ public ILttngControlService getControlService() {
++ if (getParent() != null) {
++ return getParent().getControlService();
++ }
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#setControlService(org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService)
++ */
++ @Override
++ public void setControlService(ILttngControlService service) {
++ if (getParent() != null) {
++ getParent().setControlService(service);
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#dispose()
++ */
++ @Override
++ public void dispose() {
++ // default implementation
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#addChild(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void addChild(ITraceControlComponent component) {
++ if (component != null) {
++ fChildren.add(component);
++ }
++ fireComponentAdded(this, component);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#removeChild(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void removeChild(ITraceControlComponent component) {
++ if (component != null) {
++ fChildren.remove(component);
++ component.dispose();
++ }
++ fireComponentRemoved(this, component);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#removeAllChildren()
++ */
++ @Override
++ public void removeAllChildren() {
++ for (Iterator<ITraceControlComponent> iterator = fChildren.iterator(); iterator.hasNext();) {
++ ITraceControlComponent child = (ITraceControlComponent) iterator.next();
++ child.removeAllChildren();
++ }
++ fChildren.clear();
++// fireCompenentChanged(this);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#containsChild(java.lang.String)
++ */
++ @Override
++ public boolean containsChild(String name) {
++ boolean retValue = false;
++ for (int i = 0; i < fChildren.size(); i++) {
++ if (fChildren.get(i).getName().equals(name)) {
++ retValue = true;
++ break;
++ }
++ }
++ return retValue;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#hasChildren()
++ */
++ @Override
++ public boolean hasChildren() {
++ return !fChildren.isEmpty();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#addComponentListener(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponentChangedListener)
++ */
++ @Override
++ public void addComponentListener(ITraceControlComponentChangedListener listener) {
++ if (fParent != null)
++ fParent.addComponentListener(listener);
++ else {
++ fListeners.add(listener);
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#removeComponentListener(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponentChangedListener)
++ */
++ @Override
++ public void removeComponentListener(ITraceControlComponentChangedListener listener) {
++ if (fParent != null)
++ fParent.removeComponentListener(listener);
++ else {
++ fListeners.remove(listener);
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#fireCompenentAdded(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void fireComponentAdded(ITraceControlComponent parent, ITraceControlComponent component) {
++ if (component == null) {
++ return;
++ }
++
++ if (fParent != null) {
++ fParent.fireComponentAdded(parent, component);
++ } else {
++ Object[] listeners = fListeners.getListeners();
++ for (int i = 0; i < listeners.length; i++) {
++ ITraceControlComponentChangedListener listener = (ITraceControlComponentChangedListener) listeners[i];
++ listener.componentAdded(parent, component);
++ }
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#fireCompenentRemoved(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void fireComponentRemoved(ITraceControlComponent parent, ITraceControlComponent component) {
++ if (component == null) {
++ return;
++ }
++
++ if (fParent != null) {
++ fParent.fireComponentRemoved(parent, component);
++ } else {
++ Object[] listeners = fListeners.getListeners();
++ for (int i = 0; i < listeners.length; i++) {
++ ITraceControlComponentChangedListener listener = (ITraceControlComponentChangedListener) listeners[i];
++ listener.componentRemoved(parent, component);
++ }
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent#fireCompenentChanged(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent)
++ */
++ @Override
++ public void fireComponentChanged(ITraceControlComponent component) {
++ if (component == null) {
++ return;
++ }
++
++ if (fParent != null) {
++ fParent.fireComponentChanged(component);
++ } else {
++ Object[] listeners = fListeners.getListeners();
++ for (int i = 0; i < listeners.length; i++) {
++ ITraceControlComponentChangedListener listener = (ITraceControlComponentChangedListener) listeners[i];
++ listener.componentChanged(component);
++ }
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.core.runtime.IAdaptable#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ return null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++
++/**
++ * <b><u>TraceControlRoot</u></b>
++ * <p>
++ * Root element in trace control tree.
++ * </p>
++ */
++public class TraceControlRoot extends TraceControlComponent {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The name of the root component
++ */
++ public final static String TRACE_CONTROL_ROOT_NAME = "trace_control_root"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Default constructor
++ */
++ public TraceControlRoot() {
++ super(TRACE_CONTROL_ROOT_NAME);
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.NullProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceDomainPropertySource;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++/**
++ * <b><u>TraceDomainComponent</u></b>
++ * <p>
++ * Implementation of the trace domain component.
++ * </p>
++ */
++public class TraceDomainComponent extends TraceControlComponent {
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component.
++ */
++ public static final String TRACE_DOMAIN_ICON_FILE = "icons/obj16/domain.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The domain information.
++ */
++ private IDomainInfo fDomainInfo = null;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public TraceDomainComponent(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ setImage(TRACE_DOMAIN_ICON_FILE);
++ setToolTip(Messages.TraceControl_DomainDisplayName);
++ fDomainInfo = new DomainInfo(name);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * Sets the domain information.
++ * @param domainInfo - the domain information to set.
++ */
++ public void setDomainInfo(IDomainInfo domainInfo) {
++ fDomainInfo = domainInfo;
++ IChannelInfo[] channels = fDomainInfo.getChannels();
++ for (int i = 0; i < channels.length; i++) {
++ TraceChannelComponent channel = new TraceChannelComponent(channels[i].getName(), this);
++ channel.setChannelInfo(channels[i]);
++ addChild(channel);
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ if (adapter == IPropertySource.class) {
++ return new TraceDomainPropertySource(this);
++ }
++ return null;
++ }
++
++ /**
++ * @return session name from parent
++ */
++ public String getSessionName() {
++ return ((TraceSessionComponent)getParent()).getName();
++ }
++
++ /**
++ * @return session from parent
++ */
++ public TraceSessionComponent getSession() {
++ return (TraceSessionComponent)getParent();
++ }
++
++ /**
++ * @return true if domain is kernel, false for UST
++ */
++ public boolean isKernel() {
++ return fDomainInfo.isKernel();
++ }
++
++ /**
++ * Sets whether domain is Kernel domain or UST
++ * @param isKernel true for kernel, false for UST
++ */
++ public void setIsKernel(boolean isKernel) {
++ fDomainInfo.setIsKernel(isKernel);
++ }
++
++ /**
++ * @return returns all available channels for this domain.
++ */
++ public TraceChannelComponent[] getChannels() {
++ List<ITraceControlComponent> channels = getChildren(TraceChannelComponent.class);
++ return (TraceChannelComponent[])channels.toArray(new TraceChannelComponent[channels.size()]);
++ }
++
++ /**
++ * @return the parent target node
++ */
++ public TargetNodeComponent getTargetNode() {
++ return ((TraceSessionComponent)getParent()).getTargetNode();
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Retrieves the session configuration from the node.
++ * @throws ExecutionException
++ */
++ public void getConfigurationFromNode() throws ExecutionException {
++ getConfigurationFromNode(new NullProgressMonitor());
++ }
++ /**
++ * Retrieves the session configuration from the node.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void getConfigurationFromNode(IProgressMonitor monitor) throws ExecutionException {
++ TraceSessionComponent session = (TraceSessionComponent) getParent();
++ session.getConfigurationFromNode(monitor);
++ }
++ /**
++ * Enables channels with given names which are part of this domain. If a given channel
++ * doesn't exists it creates a new channel with the given parameters (or default values
++ * if given parameter is null).
++ * @param channelNames - a list of channel names to enable on this domain
++ * @param info - channel information to set for the channel (use null for default)
++ * @throws ExecutionException
++ */
++ public void enableChannels(List<String> channelNames, IChannelInfo info) throws ExecutionException {
++ enableChannels(channelNames, info, new NullProgressMonitor());
++ }
++ /**
++ * Enables channels with given names which are part of this domain. If a given channel
++ * doesn't exists it creates a new channel with the given parameters (or default values
++ * if given parameter is null).
++ * @param channelNames - a list of channel names to enable on this domain
++ * @param info - channel information to set for the channel (use null for default)
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableChannels(List<String> channelNames, IChannelInfo info, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableChannels(getParent().getName(), channelNames, isKernel(), info, monitor);
++ }
++ /**
++ * Disables channels with given names which are part of this domain.
++ * @param channelNames - a list of channel names to enable on this domain
++ * @throws ExecutionException
++ */
++ public void disableChannels(List<String> channelNames) throws ExecutionException {
++ disableChannels(channelNames, new NullProgressMonitor());
++ }
++ /**
++ * Disables channels with given names which are part of this domain.
++ * @param channelNames - a list of channel names to enable on this domain
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void disableChannels(List<String> channelNames, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().disableChannels(getParent().getName(), channelNames, isKernel(), monitor);
++ }
++
++ /**
++ * Enables a list of events with no additional parameters.
++ * @param eventNames - a list of event names to enabled.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableEvents(List<String> eventNames, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableEvents(getSessionName(), null, eventNames, isKernel(), monitor);
++ }
++
++ /**
++ * Enables all syscalls (for kernel domain)
++ * @throws ExecutionException
++ */
++ public void enableSyscalls() throws ExecutionException {
++ enableSyscalls(new NullProgressMonitor());
++ }
++
++ /**
++ * Enables all syscalls (for kernel domain)
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++
++ public void enableSyscalls(IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableSyscalls(getSessionName(), null, monitor);
++ }
++
++ /**
++ * Enables a dynamic probe (for kernel domain)
++ * @param eventName - event name for probe
++ * @param isFunction - true for dynamic function entry/return probe else false
++ * @param probe - the actual probe
++ * @throws ExecutionException
++ */
++ public void enableProbe(String eventName, boolean isFunction, String probe) throws ExecutionException {
++ enableProbe(eventName, isFunction, probe, new NullProgressMonitor());
++ }
++
++ /**
++ * Enables a dynamic probe (for kernel domain)
++ * @param eventName - event name for probe
++ * @param isFunction - true for dynamic function entry/return probe else false
++ * @param probe - the actual probe
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableProbe(String eventName, boolean isFunction, String probe, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableProbe(getSessionName(), null, eventName, isFunction, probe, monitor);
++ }
++
++ /**
++ * Enables events using log level.
++ * @param eventName - a event name
++ * @param logLevelType - a log level type
++ * @param level - a log level
++ * @throws ExecutionException
++ */
++ public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level) throws ExecutionException {
++ enableLogLevel(eventName, logLevelType, level, new NullProgressMonitor());
++ }
++
++ /**
++ * Enables events using log level.
++ * @param eventName - a event name
++ * @param logLevelType - a log level type
++ * @param level - a log level
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableLogLevel(getSessionName(), null, eventName, logLevelType, level, monitor);
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEnablement;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceEventPropertySource;
++import org.eclipse.swt.graphics.Image;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++
++/**
++ * <b><u>TraceEventComponent</u></b>
++ * <p>
++ * Implementation of the trace channel component.
++ * </p>
++ */
++public class TraceEventComponent extends TraceControlComponent {
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component (enabled state).
++ */
++ public static final String TRACE_EVENT_ICON_FILE_ENABLED = "icons/obj16/event_enabled.gif"; //$NON-NLS-1$
++ /**
++ * Path to icon file for this component (disabled state).
++ */
++ public static final String TRACE_EVENT_ICON_FILE_DISABLED = "icons/obj16/event_disabled.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The event information.
++ */
++ protected IEventInfo fEventInfo = null;
++ /**
++ * The image to be displayed when in disabled state.
++ */
++ private Image fDisabledImage = null;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public TraceEventComponent(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ setImage(TRACE_EVENT_ICON_FILE_ENABLED);
++ setToolTip(Messages.TraceControl_EventDisplayName);
++ fEventInfo = new EventInfo(name);
++ fDisabledImage = Activator.getDefault().loadIcon(TRACE_EVENT_ICON_FILE_DISABLED);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getImage()
++ */
++ @Override
++ public Image getImage() {
++ if (fEventInfo.getState() == TraceEnablement.DISABLED) {
++ return fDisabledImage;
++ }
++ return super.getImage();
++ }
++
++ /**
++ * Sets the event information.
++ * @param eventInfo - the event information to set.
++ */
++ public void setEventInfo(IEventInfo eventInfo) {
++ fEventInfo = eventInfo;
++ }
++
++ /**
++ * @return the trace event type
++ */
++ public TraceEventType getEventType() {
++ return fEventInfo.getEventType();
++ }
++
++ /**
++ * Sets the trace event type to the given type
++ * @param type - type to set
++ */
++ public void setEventType(TraceEventType type) {
++ fEventInfo.setEventType(type);
++ }
++
++ /**
++ * Sets the trace event type to the type specified by the given name.
++ * @param type - event type name
++ */
++ public void setEventType(String typeName) {
++ fEventInfo.setEventType(typeName);
++ }
++
++ /**
++ * @return the event state (enabled or disabled).
++ */
++ public TraceEnablement getState() {
++ return fEventInfo.getState();
++ }
++
++ /**
++ * Sets the event state (enablement) to the given value.
++ * @param state - state to set.
++ */
++ public void setState(TraceEnablement state) {
++ fEventInfo.setState(state);
++ }
++
++ /**
++ * Sets the event state (enablement) to the value specified by the given name.
++ * @param stateName - state to set.
++ */
++ public void setState(String stateName) {
++ fEventInfo.setState(stateName);
++ }
++
++ /**
++ * @return the trace event log level
++ */
++ public TraceLogLevel getLogLevel() {
++ return fEventInfo.getLogLevel();
++ }
++
++ /**
++ * Sets the trace event log level to the given level
++ * @param level - event log level to set
++ */
++ public void setLogLevel(TraceLogLevel level) {
++ fEventInfo.setLogLevel(level);
++ }
++
++ /**
++ * Sets the trace event log level to the level specified by the given name.
++ * @param levelName - event log level name
++ */
++ public void setLogLevel(String levelName) {
++ fEventInfo.setLogLevel(levelName);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ if (adapter == IPropertySource.class) {
++ return new TraceEventPropertySource(this);
++ }
++ return null;
++ }
++
++ /**
++ * @return session name from parent
++ */
++ public String getSessionName() {
++ return ((TraceChannelComponent)getParent()).getSessionName();
++ }
++
++ /**
++ * @return channel name from parent
++ */
++ public String getChannelName() {
++ return getParent().getName();
++ }
++
++ /**
++ * @return if domain is kernel or UST
++ */
++ public boolean isKernel() {
++ return ((TraceChannelComponent)getParent()).isKernel();
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo;
++
++/**
++ * <b><u>TraceInfo</u></b>
++ * <p>
++ * Implementation of the base trace information interface (ITraceInfo) to
++ * store common data.
++ * </p>
++ */
++public class TraceInfo implements ITraceInfo {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The name of the element.
++ */
++ private String fName = null;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - name of trace element
++ */
++ public TraceInfo(String name) {
++ if (name == null) {
++ throw new IllegalArgumentException();
++ }
++ fName = name;
++ }
++
++ /**
++ * Copy constructor
++ * @param other - the instance to copy
++ */
++ public TraceInfo(TraceInfo other) {
++ if (other == null) {
++ throw new IllegalArgumentException();
++ } else {
++ fName = String.valueOf(other.fName);
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#getName()
++ */
++ @Override
++ public String getName() {
++ return fName;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#setName(java.lang.String)
++ */
++ @Override
++ public void setName(String name) {
++ fName = name;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#formatString()
++ */
++ @Override
++ public String formatString() {
++ return toString();
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see java.lang.Object#hashCode()
++ */
++ @Override
++ public int hashCode() {
++ final int prime = 31;
++ int result = 1;
++ result = prime * result + ((fName == null) ? 0 : fName.hashCode());
++ return result;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see java.lang.Object#equals(java.lang.Object)
++ */
++ @Override
++ public boolean equals(Object obj) {
++ if (this == obj) {
++ return true;
++ }
++ if (obj == null) {
++ return false;
++ }
++ if (getClass() != obj.getClass()) {
++ return false;
++ }
++ TraceInfo other = (TraceInfo) obj;
++ if (fName == null) {
++ if (other.fName != null) {
++ return false;
++ }
++ } else if (!fName.equals(other.fName)) {
++ return false;
++ }
++ return true;
++ }
++ /*
++ * (non-Javadoc)
++ * @see java.lang.Object#toString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String toString() {
++ StringBuffer output = new StringBuffer();
++ output.append("[TraceInfo(");
++ output.append("Name=");
++ output.append(getName());
++ output.append(")]");
++ return output.toString();
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceProbeEventPropertySource;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++
++/**
++ * <b><u>TraceProbeEventComponent</u></b>
++ * <p>
++ * Implementation of the trace channel component.
++ * </p>
++ */
++public class TraceProbeEventComponent extends TraceEventComponent {
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public TraceProbeEventComponent(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ fEventInfo = new ProbeEventInfo(name);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /**
++ * Sets the event information.
++ * @param eventInfo - the event information to set.
++ */
++ @Override
++ public void setEventInfo(IEventInfo eventInfo) {
++ if (eventInfo instanceof ProbeEventInfo) {
++ fEventInfo = eventInfo;
++ return;
++ }
++ throw new IllegalArgumentException("Invalid type passed. Only class of type ProbeEventInfo allowed:\n" + eventInfo.getClass()); //$NON-NLS-1$
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ if (adapter == IPropertySource.class) {
++ return new TraceProbeEventPropertySource(this);
++ }
++ return null;
++ }
++ /**
++ * @return the address of the probe. (null if Symbol is used)
++ */
++ public String getAddress() {
++ return getEventInfo().getAddress();
++ }
++ /**
++ * Sets the address of the probe.
++ * @param address - a address
++ */
++ public void setAddress(String address) {
++ getEventInfo().setAddress(address);
++ }
++ /**
++ * @return the offset applied to the symbol.
++ */
++ public String getOffset() {
++ return getEventInfo().getOffset();
++ }
++ /**
++ * Sets the offset applied to the symbol. (valid if symbol is used)
++ * @param offset - a offset
++ */
++ public void setOffset(String offset) {
++ getEventInfo().setOffset(offset);
++ }
++ /**
++ * @return the symbol name. (null if address is used)
++ */
++ public String getSymbol() {
++ return getEventInfo().getSymbol();
++ }
++ /**
++ * Sets the symbol name.
++ * @param symbol - a symbol name (null if address is used)
++ */
++ public void setSymbol(String symbol) {
++ getEventInfo().setSymbol(symbol);
++ }
++
++ // ------------------------------------------------------------------------
++ // Helper methods
++ // ------------------------------------------------------------------------
++ private ProbeEventInfo getEventInfo() {
++ return (ProbeEventInfo) fEventInfo;
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.NullProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo;
++
++/**
++ * <b><u>TraceProviderGroup</u></b>
++ * <p>
++ * Implementation of the trace provider group.
++ * </p>
++ */
++public class TraceProviderGroup extends TraceControlComponent {
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component.
++ */
++ public static final String TRACE_PROVIDERS_ICON_FILE = "icons/obj16/providers.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public TraceProviderGroup(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ setImage(TRACE_PROVIDERS_ICON_FILE);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /**
++ * Gets the provider information from the target node.
++ * @throws ExecutionException
++ */
++ public void getProviderFromNode() throws ExecutionException {
++ getProviderFromNode(new NullProgressMonitor());
++ }
++
++ /**
++ * Gets the provider information from the target node.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void getProviderFromNode(IProgressMonitor monitor) throws ExecutionException {
++
++ List<IBaseEventInfo> eventInfos = getControlService().getKernelProvider(monitor);
++ KernelProviderComponent component = new KernelProviderComponent(Messages.TraceControl_KernelProviderDisplayName, this);
++ addChild(component);
++ component.setEventInfo(eventInfos);
++
++ List<IUstProviderInfo> allProviders = getControlService().getUstProvider(monitor);
++
++ for (Iterator<IUstProviderInfo> iterator = allProviders.iterator(); iterator.hasNext();) {
++ IUstProviderInfo ustProviderInfo = (IUstProviderInfo) iterator.next();
++ UstProviderComponent ustComponent = new UstProviderComponent(ustProviderInfo.getName(), this);
++ addChild(ustComponent);
++ ustComponent.setUstProvider(ustProviderInfo);
++ }
++ }
++}
++
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.NullProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.Activator;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceSessionState;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.TraceSessionPropertySource;
++import org.eclipse.swt.graphics.Image;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++/**
++ * <b><u>TraceSessionComponent</u></b>
++ * <p>
++ * Implementation of the trace session component.
++ * </p>
++ */
++public class TraceSessionComponent extends TraceControlComponent {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component (inactive state).
++ */
++ public static final String TRACE_SESSION_ICON_FILE_INACTIVE = "icons/obj16/session_inactive.gif"; //$NON-NLS-1$
++ /**
++ * Path to icon file for this component (active state).
++ */
++ public static final String TRACE_SESSION_ICON_FILE_ACTIVE = "icons/obj16/session_active.gif"; //$NON-NLS-1$
++ /**
++ * Path to icon file for this component (destroyed state).
++ */
++ public static final String TRACE_SESSION_ICON_FILE_DESTROYED = "icons/obj16/session_destroyed.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The session information.
++ */
++ private ISessionInfo fSessionInfo = null;
++ /**
++ * A flag to indicate if session has been destroyed.
++ */
++ private boolean fIsDestroyed = false;
++ /**
++ * The image to be displayed in state active.
++ */
++ private Image fActiveImage = null;
++ /**
++ * The image to be displayed in state destroyed
++ */
++ private Image fDestroyedImage = null;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public TraceSessionComponent(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ setImage(TRACE_SESSION_ICON_FILE_INACTIVE);
++ setToolTip(Messages.TraceControl_SessionDisplayName);
++ fSessionInfo = new SessionInfo(name);
++ fActiveImage = Activator.getDefault().loadIcon(TRACE_SESSION_ICON_FILE_ACTIVE);
++ fDestroyedImage = Activator.getDefault().loadIcon(TRACE_SESSION_ICON_FILE_DESTROYED);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getImage()
++ */
++ @Override
++ public Image getImage() {
++ if (fIsDestroyed) {
++ return fDestroyedImage;
++ }
++
++ if (fSessionInfo.getSessionState() == TraceSessionState.INACTIVE) {
++ return super.getImage();
++ }
++
++ return fActiveImage;
++ }
++
++ /**
++ * @return the whether the session is destroyed or not.
++ */
++ public boolean isDestroyed() {
++ return fIsDestroyed;
++ }
++
++ /**
++ * Sets the session destroyed state to the given value.
++ * @param destroyed - value to set.
++ */
++ public void setDestroyed(boolean destroyed) {
++ fIsDestroyed = destroyed;
++ }
++
++ /**
++ * @return the session state state (active or inactive).
++ */
++ public TraceSessionState getSessionState() {
++ return fSessionInfo.getSessionState();
++ }
++
++ /**
++ * Sets the session state to the given value.
++ * @param state - state to set.
++ */
++ public void setSessionState(TraceSessionState state) {
++ fSessionInfo.setSessionState(state);
++ }
++
++ /**
++ * Sets the event state to the value specified by the given name.
++ * @param stateName - state to set.
++ */
++ public void setSessionState(String stateName) {
++ fSessionInfo.setSessionState(stateName);
++ }
++
++ /**
++ * @return path string where session is located.
++ */
++ public String getSessionPath() {
++ return fSessionInfo.getSessionPath();
++ }
++
++ /**
++ * Sets the path string (where session is located) to the given value.
++ * @param path - session path to set.
++ */
++ public void setSessionPath(String sessionPath) {
++ fSessionInfo.setSessionPath(sessionPath);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ if (adapter == IPropertySource.class) {
++ return new TraceSessionPropertySource(this);
++ }
++ return null;
++ }
++
++ /**
++ * @return all available domains of this session.
++ */
++ public TraceDomainComponent[] getDomains() {
++ List<ITraceControlComponent> sessions = getChildren(TraceDomainComponent.class);
++ return (TraceDomainComponent[])sessions.toArray(new TraceDomainComponent[sessions.size()]);
++ }
++
++ /**
++ * @return the parent target node
++ */
++ public TargetNodeComponent getTargetNode() {
++ return ((TraceSessionGroup)getParent()).getTargetNode();
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Retrieves the session configuration from the node.
++ * @throws ExecutionException
++ */
++ public void getConfigurationFromNode() throws ExecutionException {
++ getConfigurationFromNode(new NullProgressMonitor());
++ }
++
++ /**
++ * Retrieves the session configuration from the node.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void getConfigurationFromNode(IProgressMonitor monitor) throws ExecutionException {
++ removeAllChildren();
++ fSessionInfo = getControlService().getSession(getName(), monitor);
++ IDomainInfo[] domains = fSessionInfo.getDomains();
++ for (int i = 0; i < domains.length; i++) {
++ TraceDomainComponent domainComponent = new TraceDomainComponent(domains[i].getName(), this);
++ addChild(domainComponent);
++ domainComponent.setDomainInfo(domains[i]);
++ }
++ }
++
++ /**
++ * Starts the session.
++ * throws ExecutionExecption
++ */
++ public void startSession() throws ExecutionException {
++ startSession(new NullProgressMonitor());
++ }
++
++ /**
++ * Starts the session.
++ * @param monitor - a progress monitor
++ * throws ExecutionExecption
++ */
++ public void startSession(IProgressMonitor monitor) throws ExecutionException {
++ getControlService().startSession(getName(), monitor);
++ }
++
++ /**
++ * Starts the session.
++ * throws ExecutionExecption
++ */
++ public void stopSession() throws ExecutionException {
++ startSession(new NullProgressMonitor());
++ }
++
++ /**
++ * Starts the session.
++ * @param monitor - a progress monitor
++ * throws ExecutionExecption
++ */
++ public void stopSession(IProgressMonitor monitor) throws ExecutionException {
++ getControlService().stopSession(getName(), monitor);
++ }
++
++ /**
++ * Enables a list of events with no additional parameters.
++ * @param eventNames - a list of event names to enabled.
++ * @param isKernel - a flag for indicating kernel or UST.
++ * @throws ExecutionException
++ */
++ public void enableEvent(List<String> eventNames, boolean isKernel) throws ExecutionException {
++ enableEvents(eventNames, isKernel, new NullProgressMonitor());
++ }
++
++ /**
++ * Enables a list of events with no additional parameters.
++ * @param eventNames - a list of event names to enabled.
++ * @param isKernel - a flag for indicating kernel or UST.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableEvents(List<String> eventNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableEvents(getName(), null, eventNames, isKernel, monitor);
++ }
++
++ /**
++ * Enables all syscalls (for kernel domain)
++ * @throws ExecutionException
++ */
++ public void enableSyscalls() throws ExecutionException {
++ enableSyscalls(new NullProgressMonitor());
++ }
++
++ /**
++ * Enables all syscalls (for kernel domain)
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableSyscalls(IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableSyscalls(getName(), null, monitor);
++ }
++
++ /**
++ * Enables a dynamic probe (for kernel domain)
++ * @param eventName - event name for probe
++ * @param isFunction - true for dynamic function entry/return probe else false
++ * @param probe - the actual probe
++ * @throws ExecutionException
++ */
++ public void enableProbe(String eventName, boolean isFunction, String probe) throws ExecutionException {
++ enableProbe(eventName, isFunction, probe, new NullProgressMonitor());
++ }
++
++ /**
++ * Enables a dynamic probe (for kernel domain)
++ * @param eventName - event name for probe
++ * @param isFunction - true for dynamic function entry/return probe else false
++ * @param probe - the actual probe
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableProbe(String eventName, boolean isFunction, String probe, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableProbe(getName(), null, eventName, isFunction, probe, monitor);
++ }
++
++ /**
++ * Enables events using log level.
++ * @param eventName - a event name
++ * @param logLevelType - a log level type
++ * @param level - a log level
++ * @throws ExecutionException
++ */
++ public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level) throws ExecutionException {
++ enableLogLevel(eventName, logLevelType, level, new NullProgressMonitor());
++ }
++
++ /**
++ * Enables events using log level.
++ * @param eventName - a event name
++ * @param logLevelType - a log level type
++ * @param level - a log level
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableLogLevel(String eventName, LogLevelType logLevelType, TraceLogLevel level, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().enableLogLevel(getName(), null, eventName, logLevelType, level, monitor);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.NullProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++
++/**
++ * <b><u>TraceSessionGroup</u></b>
++ * <p>
++ * Implementation of the trace session group.
++ * </p>
++ */
++public class TraceSessionGroup extends TraceControlComponent {
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component.
++ */
++ public static final String TRACE_SESSIONS_ICON_FILE = "icons/obj16/sessions.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public TraceSessionGroup(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ setImage(TRACE_SESSIONS_ICON_FILE);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /**
++ * @return the parent target node
++ */
++ public TargetNodeComponent getTargetNode() {
++ return (TargetNodeComponent)getParent();
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Retrieves the sessions information from the node.
++ * @throws ExecutionException
++ */
++ public void getSessionsFromNode() throws ExecutionException {
++ getSessionsFromNode(new NullProgressMonitor());
++ }
++
++ /**
++ * Retrieves the sessions information from the node.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void getSessionsFromNode(IProgressMonitor monitor) throws ExecutionException {
++ String[] sessionNames = getControlService().getSessionNames(monitor);
++ for (int i = 0; i < sessionNames.length; i++) {
++ TraceSessionComponent session = new TraceSessionComponent(sessionNames[i], this);
++ addChild(session);
++ session.getConfigurationFromNode(monitor);
++ }
++ }
++
++ /**
++ * Creates a session with given session name and location.
++ * @param sessionName - a session name to create
++ * @param sessionPath - a path for storing the traces (use null for default)
++ * @return the session information
++ * throws ExecutionExecption
++ */
++ public void createSession(String sessionName, String sessionPath) throws ExecutionException {
++ createSession(sessionName, sessionPath, new NullProgressMonitor());
++ }
++
++ /**
++ * Creates a session with given session name and location.
++ * @param sessionName - a session name to create
++ * @param sessionPath - a path for storing the traces (use null for default)
++ * @Param monitor - a progress monitor
++ * @return the session information
++ * throws ExecutionExecption
++ */
++ public void createSession(String sessionName, String sessionPath, IProgressMonitor monitor) throws ExecutionException {
++ ISessionInfo sessionInfo = getControlService().createSession(sessionName, sessionPath, monitor);
++ if (sessionInfo != null) {
++ TraceSessionComponent session = new TraceSessionComponent(sessionInfo.getName(), TraceSessionGroup.this);
++ addChild(session);
++ session.getConfigurationFromNode(monitor);
++ }
++ }
++
++ /**
++ * Destroys a session with given session name.
++ * @param session - a session component to destroy
++ * throws ExecutionExecption
++ */
++ public void destroySession(TraceSessionComponent session) throws ExecutionException {
++ destroySession(session, new NullProgressMonitor());
++ }
++
++ /**
++ * Destroys a session with given session name.
++ * @param session - a session component to destroy
++ * @param monitor - a progress monitor
++ * throws ExecutionExecption
++ */
++ public void destroySession(TraceSessionComponent session, IProgressMonitor monitor) throws ExecutionException {
++ getControlService().destroySession(session.getName(), monitor);
++ session.removeAllChildren();
++ removeChild(session);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceControlComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.property.UstProviderPropertySource;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++/**
++ * <b><u>UstProviderComponent</u></b>
++ * <p>
++ * Implementation of the UST provider component.
++ * </p>
++ */
++public class UstProviderComponent extends TraceControlComponent {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * Path to icon file for this component.
++ */
++ public static final String USTL_PROVIDER_ICON_FILE = "icons/obj16/targets.gif"; //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The UST provider information.
++ */
++ private IUstProviderInfo fProviderInfo = null;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - the name of the component.
++ * @param parent - the parent of this component.
++ */
++ public UstProviderComponent(String name, ITraceControlComponent parent) {
++ super(name, parent);
++ setImage(USTL_PROVIDER_ICON_FILE);
++ fProviderInfo = new UstProviderInfo(name);
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++ /**
++ * Sets the UST provider information to the given value.
++ * @param providerInfo - the provider information to set
++ */
++ public void setUstProvider(IUstProviderInfo providerInfo) {
++ fProviderInfo = providerInfo;
++ IBaseEventInfo[] events = providerInfo.getEvents();
++ for (int i = 0; i < events.length; i++) {
++ BaseEventComponent component = new BaseEventComponent(events[i].getName(), this);
++ component.setEventInfo(events[i]);
++ addChild(component);
++ }
++ setToolTip("PID=" + fProviderInfo.getPid()); //$NON-NLS-1$
++ }
++
++ /**
++ * @return the process ID of the UST provider.
++ */
++ public int getPid() {
++ return fProviderInfo.getPid();
++ }
++
++ /**
++ * Sets the process ID of the UST provider to the given value.
++ * @param pid - process ID to set
++ */
++ public void setPid(int pid) {
++ fProviderInfo.setPid(pid);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceControlComponent#getAdapter(java.lang.Class)
++ */
++ @SuppressWarnings("rawtypes")
++ @Override
++ public Object getAdapter(Class adapter) {
++ if (adapter == IPropertySource.class) {
++ return new UstProviderPropertySource(this);
++ }
++ return null;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++}
++
++
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo;
++
++/**
++ * <b><u>UstProviderInfo</u></b>
++ * <p>
++ * Implementation of the Ust Provider interface (IUstProviderInfo) to store UST
++ * provider related data.
++ * </p>
++ */
++public class UstProviderInfo extends TraceInfo implements IUstProviderInfo {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The process ID of the UST provider.
++ */
++ private int fPid = 0;
++ /**
++ * List of event information.
++ */
++ private List<IBaseEventInfo> fEvents = new ArrayList<IBaseEventInfo>();
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param name - name of UST provider
++ */
++ public UstProviderInfo(String name) {
++ super(name);
++ }
++
++ /**
++ * Copy constructor
++ * @param other - the instance to copy
++ */
++ public UstProviderInfo(UstProviderInfo other) {
++ super(other);
++ fPid = other.fPid;
++ for (Iterator<IBaseEventInfo> iterator = other.fEvents.iterator(); iterator.hasNext();) {
++ IBaseEventInfo event = iterator.next();
++ if (event instanceof BaseEventInfo) {
++ fEvents.add(new BaseEventInfo((BaseEventInfo)event));
++ } else {
++ fEvents.add(event);
++ }
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessors
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo#getPid()
++ */
++ @Override
++ public int getPid() {
++ return fPid;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo#setPid(int)
++ */
++ @Override
++ public void setPid(int pid) {
++ fPid = pid;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo#getEvents()
++ */
++ @Override
++ public IBaseEventInfo[] getEvents() {
++ return fEvents.toArray(new IBaseEventInfo[fEvents.size()]);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo#setEvents(java.util.List)
++ */
++ @Override
++ public void setEvents(List<IBaseEventInfo> events) {
++ for (Iterator<IBaseEventInfo> iterator = events.iterator(); iterator.hasNext();) {
++ IBaseEventInfo eventInfo = (IBaseEventInfo) iterator.next();
++ fEvents.add(eventInfo);
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo#addEvent(org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo)
++ */
++ @Override
++ public void addEvent(IBaseEventInfo event) {
++ fEvents.add(event);
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ITraceInfo#formatString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String formatString() {
++ StringBuffer output = new StringBuffer();
++ //PID: 9379 - Name: /home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello
++ output.append("\nPID: ");
++ output.append(fPid);
++ output.append(" - Name: ");
++ output.append(getName());
++ for (Iterator<IBaseEventInfo> iterator = fEvents.iterator(); iterator.hasNext();) {
++ IBaseEventInfo event = (IBaseEventInfo) iterator.next();
++ output.append(event.formatString());
++ }
++ output.append("\n");
++
++ return output.toString();
++ }
++
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#hashCode()
++ */
++ @Override
++ public int hashCode() {
++ final int prime = 31;
++ int result = super.hashCode();
++ result = prime * result + ((fEvents == null) ? 0 : fEvents.hashCode());
++ result = prime * result + fPid;
++ return result;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#equals(java.lang.Object)
++ */
++ @Override
++ public boolean equals(Object obj) {
++ if (this == obj) {
++ return true;
++ }
++ if (!super.equals(obj)) {
++ return false;
++ }
++ if (getClass() != obj.getClass()) {
++ return false;
++ }
++ UstProviderInfo other = (UstProviderInfo) obj;
++ if (fEvents == null) {
++ if (other.fEvents != null) {
++ return false;
++ }
++ } else if (!fEvents.equals(other.fEvents)) {
++ return false;
++ }
++ if (fPid != other.fPid) {
++ return false;
++ }
++ return true;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceInfo#toString()
++ */
++ @SuppressWarnings("nls")
++ @Override
++ public String toString() {
++ StringBuffer output = new StringBuffer();
++ output.append("[EventInfo(");
++ output.append(super.toString());
++ output.append(",PID=");
++ output.append(fPid);
++ output.append(",Events=");
++ if (fEvents.isEmpty()) {
++ output.append("None");
++ } else {
++ for (Iterator<IBaseEventInfo> iterator = fEvents.iterator(); iterator.hasNext();) {
++ IBaseEventInfo event = (IBaseEventInfo) iterator.next();
++ output.append(event.toString());
++ }
++ }
++ output.append(")]");
++ return output.toString();
++ }
++
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import java.util.ArrayList;
++import java.util.List;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventComponent;
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.TextPropertyDescriptor;
++
++/**
++ * <b><u>BaseEventPropertySource</u></b>
++ * <p>
++ * Property source implementation for the base event component.
++ * </p>
++ */
++public class BaseEventPropertySource extends BasePropertySource {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++
++ /**
++ * The base event 'name' property ID.
++ */
++ public static final String BASE_EVENT_NAME_PROPERTY_ID = "base.event.name"; //$NON-NLS-1$
++ /**
++ * The base event 'type' property ID.
++ */
++ public static final String BASE_EVENT_TYPE_PROPERTY_ID = "base.event.type"; //$NON-NLS-1$
++ /**
++ * The base event 'log level' property ID.
++ */
++ public static final String BASE_EVENT_LOGLEVEL_PROPERTY_ID = "base.event.loglevel"; //$NON-NLS-1$
++ /**
++ * The base event 'name' property name.
++ */
++ public static final String BASE_EVENT_NAME_PROPERTY_NAME = Messages.TraceControl_EventNamePropertyName;
++ /**
++ * The base event 'type' property name.
++ */
++ public static final String BASE_EVENT_TYPE_PROPERTY_NAME = Messages.TraceControl_EventTypePropertyName;
++ /**
++ * The base event 'log level' property name.
++ */
++ public static final String BASE_EVENT_LOGLEVEL_PROPERTY_NAME = Messages.TraceControl_LogLevelPropertyName;
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The base event component which this property source is for.
++ */
++ private final BaseEventComponent fBaseEvent;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param component - the base event component
++ */
++ public BaseEventPropertySource(BaseEventComponent component) {
++ fBaseEvent = component;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyDescriptors()
++ */
++ @Override
++ public IPropertyDescriptor[] getPropertyDescriptors() {
++ List<IPropertyDescriptor> list = new ArrayList<IPropertyDescriptor> ();
++ list.add(new TextPropertyDescriptor(BASE_EVENT_NAME_PROPERTY_ID, BASE_EVENT_NAME_PROPERTY_NAME));
++ list.add(new TextPropertyDescriptor(BASE_EVENT_TYPE_PROPERTY_ID, BASE_EVENT_TYPE_PROPERTY_NAME));
++ if (fBaseEvent.getLogLevel() != TraceLogLevel.LEVEL_UNKNOWN) {
++ list.add(new TextPropertyDescriptor(BASE_EVENT_LOGLEVEL_PROPERTY_ID, BASE_EVENT_LOGLEVEL_PROPERTY_NAME));
++ }
++ return (IPropertyDescriptor [])list.toArray(new IPropertyDescriptor[list.size()]);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ public Object getPropertyValue(Object id) {
++ if(BASE_EVENT_NAME_PROPERTY_ID.equals(id)) {
++ return fBaseEvent.getName();
++ }
++ if (BASE_EVENT_TYPE_PROPERTY_ID.equals(id)) {
++ return fBaseEvent.getEventType().name();
++ }
++ if (BASE_EVENT_LOGLEVEL_PROPERTY_ID.equals(id)) {
++ return fBaseEvent.getLogLevel().name();
++ }
++ return null;
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.IPropertySource;
++
++/**
++ * <b><u>BaseEventPropertySource</u></b>
++ * <p>
++ * Base property source implementation.
++ * </p>
++ */
++abstract public class BasePropertySource implements IPropertySource {
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.ui.views.properties.IPropertySource#getEditableValue()
++ */
++ @Override
++ public Object getEditableValue() {
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.ui.views.properties.IPropertySource#getPropertyDescriptors()
++ */
++ @Override
++ abstract public IPropertyDescriptor[] getPropertyDescriptors();
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.ui.views.properties.IPropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ abstract public Object getPropertyValue(Object id);
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.ui.views.properties.IPropertySource#isPropertySet(java.lang.Object)
++ */
++ @Override
++ public boolean isPropertySet(Object id) {
++ return false;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.ui.views.properties.IPropertySource#resetPropertyValue(java.lang.Object)
++ */
++ @Override
++ public void resetPropertyValue(Object id) {
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.ui.views.properties.IPropertySource#setPropertyValue(java.lang.Object, java.lang.Object)
++ */
++ @Override
++ public void setPropertyValue(Object id, Object value) {
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.KernelProviderComponent;
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.TextPropertyDescriptor;
++
++/**
++ * <b><u>KernelProviderPropertySource</u></b>
++ * <p>
++ * Property source implementation for the kernl provider component.
++ * </p>
++ */
++public class KernelProviderPropertySource extends BasePropertySource {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The kernel provider 'name' property ID.
++ */
++ public static final String KERNEL_PROVIDER_NAME_PROPERTY_ID = "ust.provider.name"; //$NON-NLS-1$
++ /**
++ * The kernel provider 'name' property name.
++ */
++ public static final String KERNEL_PROVIDER_NAME_PROPERTY_NAME = Messages.TraceControl_ProviderNamePropertyName;
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The kernel provider component which this property source is for.
++ */
++ private KernelProviderComponent fProvider;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param component - the kernel provider component
++ */
++ public KernelProviderPropertySource(KernelProviderComponent component) {
++ fProvider = component;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyDescriptors()
++ */
++ @Override
++ public IPropertyDescriptor[] getPropertyDescriptors() {
++ return new IPropertyDescriptor[] {
++ new TextPropertyDescriptor(KERNEL_PROVIDER_NAME_PROPERTY_ID, KERNEL_PROVIDER_NAME_PROPERTY_NAME)};
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ public Object getPropertyValue(Object id) {
++ if(KERNEL_PROVIDER_NAME_PROPERTY_ID.equals(id)) {
++ return fProvider.getName();
++ }
++ return null;
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TargetNodeComponent;
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.TextPropertyDescriptor;
++
++/**
++ * <b><u>TargetNodePropertySource</u></b>
++ * <p>
++ * Property source implementation for the target node component.
++ * </p>
++ */
++public class TargetNodePropertySource extends BasePropertySource {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The node name property ID.
++ */
++ public static final String TARGET_NODE_NAME_PROPERTY_ID = "target.node.name"; //$NON-NLS-1$
++ /**
++ * The node address property ID.
++ */
++ public static final String TARGET_NODE_ADDRESS_PROPERTY_ID = "target.node.address"; //$NON-NLS-1$
++ /**
++ * The state property ID.
++ */
++ public static final String TARGET_NODE_STATE_PROPERTY_ID = "target.node.state"; //$NON-NLS-1$
++ /**
++ * The node name property name.
++ */
++ public static final String TARGET_NODE_NAME_PROPERTY_NAME = Messages.TraceControl_HostNamePropertyName;
++ /**
++ * The node address property name.
++ */
++ public static final String TARGET_NODE_ADDRESS_PROPERTY_NAME = Messages.TraceControl_HostAddressPropertyName;
++ /**
++ * The state address property name.
++ */
++ public static final String TARGET_NODE_STATE_PROPERTY_NAME = Messages.TraceControl_StatePropertyName;
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The node component which this property source is for.
++ */
++ private final TargetNodeComponent fTargetNode;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param component - the node component
++ */
++ public TargetNodePropertySource(TargetNodeComponent component) {
++ fTargetNode = component;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyDescriptors()
++ */
++ @Override
++ public IPropertyDescriptor[] getPropertyDescriptors() {
++ return new IPropertyDescriptor[] {
++ new TextPropertyDescriptor(TARGET_NODE_NAME_PROPERTY_ID, TARGET_NODE_NAME_PROPERTY_NAME),
++ new TextPropertyDescriptor(TARGET_NODE_ADDRESS_PROPERTY_ID, TARGET_NODE_ADDRESS_PROPERTY_NAME),
++ new TextPropertyDescriptor(TARGET_NODE_STATE_PROPERTY_ID, TARGET_NODE_STATE_PROPERTY_NAME)};
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ public Object getPropertyValue(Object id) {
++ if(TARGET_NODE_NAME_PROPERTY_ID.equals(id)) {
++ return fTargetNode.getName();
++ }
++ if (TARGET_NODE_ADDRESS_PROPERTY_ID.equals(id)) {
++ return fTargetNode.getHostName();
++ }
++ if (TARGET_NODE_STATE_PROPERTY_ID.equals(id)) {
++ return fTargetNode.getTargetNodeState().name();
++ }
++ return null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceChannelComponent;
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.TextPropertyDescriptor;
++
++/**
++ * <b><u>TraceChannelPropertySource</u></b>
++ * <p>
++ * Property source implementation for the trace channel component.
++ * </p>
++ */
++public class TraceChannelPropertySource extends BasePropertySource {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The trace channel 'name' property ID.
++ */
++ public static final String TRACE_CHANNEL_NAME_PROPERTY_ID = "trace.channel.name"; //$NON-NLS-1$
++ /**
++ * The trace channel 'state' ID.
++ */
++ public static final String TRACE_CHANNEL_STATE_PROPERTY_ID = "trace.channel.state"; //$NON-NLS-1$
++ /**
++ * The trace channel 'overwrite mode' property ID.
++ */
++ public static final String TRACE_CHANNEL_OVERWRITE_MODE_PROPERTY_ID = "trace.channel.overwrite.mode"; //$NON-NLS-1$
++ /**
++ * The trace channel 'sub-buffer size' property ID.
++ */
++ public static final String TRACE_CHANNEL_SUBBUFFER_SIZE_PROPERTY_ID = "trace.channel.subbuffer.size"; //$NON-NLS-1$
++ /**
++ * The trace channel 'number of sub-buffers' property ID.
++ */
++ public static final String TRACE_CHANNEL_NO_SUBBUFFERS_PROPERTY_ID = "trace.channel.no.subbuffers"; //$NON-NLS-1$
++ /**
++ * The trace channel 'switch timer interval' property ID.
++ */
++ public static final String TRACE_CHANNEL_SWITCH_TIMER_PROPERTY_ID = "trace.channel.switch.timer"; //$NON-NLS-1$
++ /**
++ * The trace channel 'read timer interval' property ID.
++ */
++ public static final String TRACE_CHANNEL_READ_TIMER_PROPERTY_ID = "trace.channel.read.timer"; //$NON-NLS-1$
++ /**
++ * The trace channel 'output type' property ID.
++ */
++ public static final String TRACE_CHANNEL_OUTPUT_TYPE_PROPERTY_ID = "trace.channel.output.type"; //$NON-NLS-1$
++ /**
++ * The trace channel 'name' property name.
++ */
++ public static final String TRACE_CHANNEL_NAME_PROPERTY_NAME = Messages.TraceControl_ChannelNamePropertyName;
++ /**
++ * The trace channel 'state' property name.
++ */
++ public static final String TRACE_CHANNEL_STATE_PROPERTY_NAME = Messages.TraceControl_StatePropertyName;
++ /**
++ * The trace channel 'overwrite mode' property name.
++ */
++ public static final String TRACE_CHANNEL_OVERWRITE_MODE_PROPERTY_NAME = Messages.TraceControl_OverwriteModePropertyName;
++ /**
++ * The trace channel 'sub-buffer size' property name.
++ */
++ public static final String TRACE_CHANNEL_SUBBUFFER_SIZE_PROPERTY_NAME = Messages.TraceControl_SubBufferSizePropertyName;
++ /**
++ * The trace channel 'sub-buffer size' property name.
++ */
++ public static final String TRACE_CHANNEL_NO_SUBBUFFERS_PROPERTY_NAME = Messages.TraceControl_NbSubBuffersPropertyName;
++ /**
++ * The trace channel 'switch timer interval' property name.
++ */
++ public static final String TRACE_CHANNEL_SWITCH_TIMER_PROPERTY_NAME = Messages.TraceControl_SwitchTimerPropertyName;
++ /**
++ * The trace channel 'read timer interval' property name.
++ */
++ public static final String TRACE_CHANNEL_READ_TIMER_PROPERTY_NAME = Messages.TraceControl_ReadTimerPropertyName;
++ /**
++ * The trace channel 'output type' property name.
++ */
++ public static final String TRACE_CHANNEL_OUTPUT_TYPEPROPERTY_NAME = Messages.TraceControl_OutputTypePropertyName;
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The channel component which this property source is for.
++ */
++ private final TraceChannelComponent fChannel;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param component - the channel component
++ */
++ public TraceChannelPropertySource(TraceChannelComponent component) {
++ fChannel = component;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyDescriptors()
++ */
++ @Override
++ public IPropertyDescriptor[] getPropertyDescriptors() {
++ return new IPropertyDescriptor[] {
++ new TextPropertyDescriptor(TRACE_CHANNEL_NAME_PROPERTY_ID, TRACE_CHANNEL_NAME_PROPERTY_NAME),
++ new TextPropertyDescriptor(TRACE_CHANNEL_STATE_PROPERTY_ID, TRACE_CHANNEL_STATE_PROPERTY_NAME),
++ new TextPropertyDescriptor(TRACE_CHANNEL_OVERWRITE_MODE_PROPERTY_ID, TRACE_CHANNEL_OVERWRITE_MODE_PROPERTY_NAME),
++ new TextPropertyDescriptor(TRACE_CHANNEL_SUBBUFFER_SIZE_PROPERTY_ID, TRACE_CHANNEL_SUBBUFFER_SIZE_PROPERTY_NAME),
++ new TextPropertyDescriptor(TRACE_CHANNEL_NO_SUBBUFFERS_PROPERTY_ID, TRACE_CHANNEL_NO_SUBBUFFERS_PROPERTY_NAME),
++ new TextPropertyDescriptor(TRACE_CHANNEL_SWITCH_TIMER_PROPERTY_ID, TRACE_CHANNEL_SWITCH_TIMER_PROPERTY_NAME),
++ new TextPropertyDescriptor(TRACE_CHANNEL_READ_TIMER_PROPERTY_ID, TRACE_CHANNEL_READ_TIMER_PROPERTY_NAME),
++ new TextPropertyDescriptor(TRACE_CHANNEL_OUTPUT_TYPE_PROPERTY_ID, TRACE_CHANNEL_OUTPUT_TYPEPROPERTY_NAME)};
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ public Object getPropertyValue(Object id) {
++ if(TRACE_CHANNEL_NAME_PROPERTY_ID.equals(id)) {
++ return fChannel.getName();
++ }
++ if (TRACE_CHANNEL_STATE_PROPERTY_ID.equals(id)) {
++ return fChannel.getState().name();
++ }
++ if(TRACE_CHANNEL_OVERWRITE_MODE_PROPERTY_ID.equals(id)) {
++ return String.valueOf(fChannel.isOverwriteMode());
++ }
++ if(TRACE_CHANNEL_SUBBUFFER_SIZE_PROPERTY_ID.equals(id)) {
++ return String.valueOf(fChannel.getSubBufferSize());
++ }
++ if(TRACE_CHANNEL_NO_SUBBUFFERS_PROPERTY_ID.equals(id)) {
++ return String.valueOf(fChannel.getNumberOfSubBuffers());
++ }
++ if(TRACE_CHANNEL_SWITCH_TIMER_PROPERTY_ID.equals(id)) {
++ return String.valueOf(fChannel.getSwitchTimer());
++ }
++ if(TRACE_CHANNEL_READ_TIMER_PROPERTY_ID.equals(id)) {
++ return String.valueOf(fChannel.getReadTimer());
++ }
++ if(TRACE_CHANNEL_OUTPUT_TYPE_PROPERTY_ID.equals(id)) {
++ return fChannel.getOutputType();
++ }
++ return null;
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceDomainComponent;
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.TextPropertyDescriptor;
++
++/**
++ * <b><u>TraceDomainPropertySource</u></b>
++ * <p>
++ * Property source implementation for the trace domain component.
++ * </p>
++ */
++public class TraceDomainPropertySource extends BasePropertySource {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++
++ /**
++ * The trace domain 'name' property ID.
++ */
++ public static final String TRACE_DOMAIN_NAME_PROPERTY_ID = "trace.domain.name"; //$NON-NLS-1$
++ /**
++ * The trace domain 'name' property name.
++ */
++ public static final String TRACE_DOMAIN_NAME_PROPERTY_NAME = Messages.TraceControl_DomainNamePropertyName;
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The trace domain component which this property source is for.
++ */
++ private final TraceDomainComponent fBaseEvent;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param component - the trace domain component
++ */
++ public TraceDomainPropertySource(TraceDomainComponent component) {
++ fBaseEvent = component;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyDescriptors()
++ */
++ @Override
++ public IPropertyDescriptor[] getPropertyDescriptors() {
++ return new IPropertyDescriptor[] {
++ new TextPropertyDescriptor(TRACE_DOMAIN_NAME_PROPERTY_ID, TRACE_DOMAIN_NAME_PROPERTY_NAME)};
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ public Object getPropertyValue(Object id) {
++ if(TRACE_DOMAIN_NAME_PROPERTY_ID.equals(id)) {
++ return fBaseEvent.getName();
++ }
++ return null;
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import java.util.ArrayList;
++import java.util.List;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent;
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.TextPropertyDescriptor;
++
++/**
++ * <b><u>TraceEventPropertySource</u></b>
++ * <p>
++ * Property source implementation for the trace event component.
++ * </p>
++ */
++public class TraceEventPropertySource extends BasePropertySource {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The trace event 'name' property ID.
++ */
++ public static final String TRACE_EVENT_NAME_PROPERTY_ID = "trace.event.name"; //$NON-NLS-1$
++ /**
++ * The trace event 'type' property ID.
++ */
++ public static final String TRACE_EVENT_TYPE_PROPERTY_ID = "trace.event.type"; //$NON-NLS-1$
++ /**
++ * The trace event 'log level' property ID.
++ */
++ public static final String TRACE_EVENT_LOGLEVEL_PROPERTY_ID = "trace.event.loglevel"; //$NON-NLS-1$
++ /**
++ * The trace event 'state' property ID.
++ */
++ public static final String TRACE_EVENT_STATE_PROPERTY_ID = "trace.event.state"; //$NON-NLS-1$
++ /**
++ * The trace event 'name' property name.
++ */
++ public static final String TRACE_EVENT_NAME_PROPERTY_NAME = Messages.TraceControl_EventNamePropertyName;
++ /**
++ * The trace event 'type' property name.
++ */
++ public static final String TRACE_EVENT_TYPE_PROPERTY_NAME = Messages.TraceControl_EventTypePropertyName;
++ /**
++ * The trace event 'log level' property name.
++ */
++ public static final String TRACE_EVENT_LOGLEVEL_PROPERTY_NAME = Messages.TraceControl_LogLevelPropertyName;
++ /**
++ * The trace event 'state' property name.
++ */
++ public static final String TRACE_EVENT_STATE_PROPERTY_NAME = Messages.TraceControl_StatePropertyName;
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The event component which this property source is for.
++ */
++ protected final TraceEventComponent fEvent;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param component - the base event component
++ */
++ public TraceEventPropertySource(TraceEventComponent component) {
++ fEvent = component;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyDescriptors()
++ */
++ @Override
++ public IPropertyDescriptor[] getPropertyDescriptors() {
++ List<IPropertyDescriptor> list = new ArrayList<IPropertyDescriptor> ();
++ list.add(new TextPropertyDescriptor(TRACE_EVENT_NAME_PROPERTY_ID, TRACE_EVENT_NAME_PROPERTY_NAME));
++ list.add(new TextPropertyDescriptor(TRACE_EVENT_TYPE_PROPERTY_ID, TRACE_EVENT_TYPE_PROPERTY_NAME));
++ list.add( new TextPropertyDescriptor(TRACE_EVENT_STATE_PROPERTY_ID, TRACE_EVENT_STATE_PROPERTY_NAME));
++ if (fEvent.getLogLevel() != TraceLogLevel.LEVEL_UNKNOWN) {
++ list.add(new TextPropertyDescriptor(TRACE_EVENT_LOGLEVEL_PROPERTY_ID, TRACE_EVENT_LOGLEVEL_PROPERTY_NAME));
++ }
++ return (IPropertyDescriptor [])list.toArray(new IPropertyDescriptor[list.size()]);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ public Object getPropertyValue(Object id) {
++ if(TRACE_EVENT_NAME_PROPERTY_ID.equals(id)) {
++ return fEvent.getName();
++ }
++ if (TRACE_EVENT_TYPE_PROPERTY_ID.equals(id)) {
++ return fEvent.getEventType().name();
++ }
++ if (TRACE_EVENT_LOGLEVEL_PROPERTY_ID.equals(id)) {
++ return fEvent.getLogLevel().name();
++ }
++ if (TRACE_EVENT_STATE_PROPERTY_ID.equals(id)) {
++ return fEvent.getState().name();
++ }
++ return null;
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import java.util.ArrayList;
++import java.util.List;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceEventComponent;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceProbeEventComponent;
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.TextPropertyDescriptor;
++
++/**
++ * <b><u>TraceEventPropertySource</u></b>
++ * <p>
++ * Property source implementation for the trace probe event component.
++ * </p>
++ */
++public class TraceProbeEventPropertySource extends TraceEventPropertySource {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The trace event 'probe address' property ID.
++ */
++ public static final String TRACE_EVENT_PROBE_ADDRESS_PROPERTY_ID = "trace.event.probe.address"; //$NON-NLS-1$
++ /**
++ * The trace event 'probe offset' property ID.
++ */
++ public static final String TRACE_EVENT_PROBE_OFFSET_PROPERTY_ID = "trace.event.probe.offset"; //$NON-NLS-1$
++ /**
++ * The trace event 'probe symbol' property ID.
++ */
++ public static final String TRACE_EVENT_PROBE_SYMBOL_PROPERTY_ID = "trace.event.probe.symbol"; //$NON-NLS-1$
++ /**
++ * The trace event 'probe address' property name.
++ */
++ public static final String TRACE_EVENT_PROBE_ADDRESS_PROPERTY_NAME = Messages.TraceControl_ProbeAddressPropertyName;
++ /**
++ * The trace event 'probe offset' property ID.
++ */
++ public static final String TRACE_EVENT_PROBE_OFFSET_PROPERTY_NAME = Messages.TraceControl_ProbeOffsetPropertyName;
++ /**
++ * The trace event 'probe symbol' property ID.
++ */
++ public static final String TRACE_EVENT_PROBE_SYMBOL_PROPERTY_NAME = Messages.TraceControl_ProbeSymbolPropertyName;
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ public TraceProbeEventPropertySource(TraceEventComponent component) {
++ super(component);
++ if (component.getClass() != TraceProbeEventComponent.class) {
++ throw new IllegalArgumentException("Invalid type passed. Only class of type TraceProbeEventComponent allowed:\n" + component.getClass()); //$NON-NLS-1$
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyDescriptors()
++ */
++ @Override
++ public IPropertyDescriptor[] getPropertyDescriptors() {
++ IPropertyDescriptor[] superProperties = super.getPropertyDescriptors();
++ List<IPropertyDescriptor> list = new ArrayList<IPropertyDescriptor>();
++ for (int i = 0; i < superProperties.length; i++) {
++ list.add(superProperties[i]);
++ }
++
++ if (fEvent instanceof TraceProbeEventComponent) {
++ TraceProbeEventComponent event = (TraceProbeEventComponent) fEvent;
++ if (event.getAddress() != null) {
++ list.add(new TextPropertyDescriptor(TRACE_EVENT_PROBE_ADDRESS_PROPERTY_ID, TRACE_EVENT_PROBE_ADDRESS_PROPERTY_NAME));
++ }
++
++ if (event.getOffset() != null) {
++ list.add(new TextPropertyDescriptor(TRACE_EVENT_PROBE_OFFSET_PROPERTY_ID, TRACE_EVENT_PROBE_OFFSET_PROPERTY_NAME));
++ }
++
++ if (event.getSymbol() != null) {
++ list.add(new TextPropertyDescriptor(TRACE_EVENT_PROBE_SYMBOL_PROPERTY_ID, TRACE_EVENT_PROBE_SYMBOL_PROPERTY_NAME));
++ }
++ }
++ return (IPropertyDescriptor [])list.toArray(new IPropertyDescriptor[list.size()]);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ public Object getPropertyValue(Object id) {
++ if(TRACE_EVENT_PROBE_ADDRESS_PROPERTY_ID.equals(id)) {
++ return ((TraceProbeEventComponent)fEvent).getAddress();
++ }
++ if (TRACE_EVENT_PROBE_OFFSET_PROPERTY_ID.equals(id)) {
++ return ((TraceProbeEventComponent)fEvent).getOffset();
++ }
++ if (TRACE_EVENT_PROBE_SYMBOL_PROPERTY_ID.equals(id)) {
++ return ((TraceProbeEventComponent)fEvent).getSymbol();
++ }
++ return super.getPropertyValue(id);
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.TraceSessionComponent;
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.TextPropertyDescriptor;
++
++/**
++ * <b><u>TraceSessionPropertySource</u></b>
++ * <p>
++ * Property source implementation for the trace session component.
++ * </p>
++ */
++public class TraceSessionPropertySource extends BasePropertySource {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The trace session name property ID.
++ */
++ public static final String TRACE_SESSION_NAME_PROPERTY_ID = "trace.session.name"; //$NON-NLS-1$
++ /**
++ * The trace session path property ID.
++ */
++ public static final String TRACE_SESSION_PATH_PROPERTY_ID = "trace.session.path"; //$NON-NLS-1$
++ /**
++ * The trace session state ID.
++ */
++ public static final String TRACE_SESSION_STATE_PROPERTY_ID = "trace.session.state"; //$NON-NLS-1$
++ /**
++ * The trace session name property name.
++ */
++ public static final String TRACE_SESSION_NAME_PROPERTY_NAME = Messages.TraceControl_SessionNamePropertyName;
++ /**
++ * The trace session path property name.
++ */
++ public static final String TRACE_SESSION_PATH_PROPERTY_NAME = Messages.TraceControl_SessionPathPropertyName;
++ /**
++ * The trace session state property name.
++ */
++ public static final String TRACE_SESSION_STATE_PROPERTY_NAME = Messages.TraceControl_StatePropertyName;
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The session component which this property source is for.
++ */
++ private final TraceSessionComponent fSession;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param component - the session component
++ */
++ public TraceSessionPropertySource(TraceSessionComponent component) {
++ fSession = component;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.ui.views.properties.IPropertySource#getPropertyDescriptors()
++ */
++ @Override
++ public IPropertyDescriptor[] getPropertyDescriptors() {
++ return new IPropertyDescriptor[] {
++ new TextPropertyDescriptor(TRACE_SESSION_NAME_PROPERTY_ID, TRACE_SESSION_NAME_PROPERTY_NAME),
++ new TextPropertyDescriptor(TRACE_SESSION_PATH_PROPERTY_ID, TRACE_SESSION_PATH_PROPERTY_NAME),
++ new TextPropertyDescriptor(TRACE_SESSION_STATE_PROPERTY_ID, TRACE_SESSION_STATE_PROPERTY_NAME)};
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.ui.views.properties.IPropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ public Object getPropertyValue(Object id) {
++ if(TRACE_SESSION_NAME_PROPERTY_ID.equals(id)) {
++ return fSession.getName();
++ }
++ if(TRACE_SESSION_PATH_PROPERTY_ID.equals(id)) {
++ return fSession.getSessionPath();
++ }
++ if (TRACE_SESSION_STATE_PROPERTY_ID.equals(id)) {
++ return fSession.getSessionState().name();
++ }
++ return null;
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.property;
++
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.UstProviderComponent;
++import org.eclipse.ui.views.properties.IPropertyDescriptor;
++import org.eclipse.ui.views.properties.TextPropertyDescriptor;
++
++/**
++ * <b><u>UstProviderPropertySource</u></b>
++ * <p>
++ * Property source implementation for the UST provider component.
++ * </p>
++ */
++public class UstProviderPropertySource extends BasePropertySource {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ /**
++ * The UST provider 'name' property ID.
++ */
++ public static final String UST_PROVIDER_NAME_PROPERTY_ID = "ust.provider.name"; //$NON-NLS-1$
++ /**
++ * The UST provider 'PID' property ID.
++ */
++ public static final String UST_PROVIDER_PID_PROPERTY_ID = "ust.provider.pid"; //$NON-NLS-1$
++ /**
++ * The UST provider 'name' property name.
++ */
++ public static final String UST_PROVIDER_NAME_PROPERTY_NAME = Messages.TraceControl_ProviderNamePropertyName;
++ /**
++ * The UST provider 'type' property name.
++ */
++ public static final String UST_PROVIDER_PID_PROPERTY_NAME = Messages.TraceControl_ProcessIdPropertyName;
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The UST provider component which this property source is for.
++ */
++ private UstProviderComponent fUstProvider;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ /**
++ * Constructor
++ * @param component - the UST provider component
++ */
++ public UstProviderPropertySource(UstProviderComponent component) {
++ fUstProvider = component;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyDescriptors()
++ */
++ @Override
++ public IPropertyDescriptor[] getPropertyDescriptors() {
++ return new IPropertyDescriptor[] {
++ new TextPropertyDescriptor(UST_PROVIDER_NAME_PROPERTY_ID, UST_PROVIDER_NAME_PROPERTY_NAME),
++ new TextPropertyDescriptor(UST_PROVIDER_PID_PROPERTY_ID, UST_PROVIDER_PID_PROPERTY_NAME)};
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.property.BasePropertySource#getPropertyValue(java.lang.Object)
++ */
++ @Override
++ public Object getPropertyValue(Object id) {
++ if(UST_PROVIDER_NAME_PROPERTY_ID.equals(id)) {
++ return fUstProvider.getName();
++ }
++ if (UST_PROVIDER_PID_PROPERTY_ID.equals(id)) {
++ return String.valueOf(fUstProvider.getPid());
++ }
++ return null;
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.remote;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandShell;
++import org.eclipse.rse.core.model.IRSECallback;
++import org.eclipse.rse.core.subsystems.ICommunicationsListener;
++import org.eclipse.rse.core.subsystems.ISubSystem;
++import org.eclipse.rse.services.shells.IShellService;
++import org.eclipse.rse.services.terminals.ITerminalService;
++import org.eclipse.rse.subsystems.files.core.servicesubsystem.IFileServiceSubSystem;
++
++/**
++ * <b><u>IRemoteSystemProxy</u></b>
++ * <p>
++ * Remote System Proxy interface.
++ * </p>
++ */
++public interface IRemoteSystemProxy {
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /**
++ * Find the first shell service.
++ *
++ * @return shell service object, or <code>null</code> if not found.
++ */
++ public IShellService getShellService();
++
++ /**
++ * Find the first terminal service.
++ *
++ * @return shell service object, or <code>null</code> if not found.
++ */
++ public ITerminalService getTerminalService();
++
++ /**
++ * Find the first IShellServiceSubSystem service.
++ *
++ * @return shell service subsystem, or <code>null</code> if not found.
++ */
++ public ISubSystem getShellServiceSubSystem();
++
++ /**
++ * Find the first ITerminalServiceSubSystem service.
++ *
++ * @param host the connection
++ * @return shell service subsystem, or <code>null</code> if not found.
++ */
++ public ISubSystem getTerminalServiceSubSystem();
++
++ /**
++ * Finds the File Service Subsystem.
++ * @return file service subsystem, or <code>null</code> if not found.
++ */
++ public IFileServiceSubSystem getFileServiceSubSystem();
++
++ /**
++ * Connects the shell service sub system.
++ *
++ * @param callback - call-back method being called when connection was finished
++ * @throws Exception
++ */
++ public void connect(IRSECallback callback) throws ExecutionException;
++
++ /**
++ * Disconnects from the shell service sub system.
++ *
++ * @throws Exception
++ */
++ public void disconnect() throws ExecutionException;
++
++ /**
++ * Creates a command shell.
++ *
++ * @return the command shell implementation
++ * @throws Exception
++ */
++ public ICommandShell createCommandShell() throws ExecutionException;
++
++ /**
++ * Method to add a communication listener to the connector service defined for
++ * the given connection.
++ *
++ * @param listener - listener to add
++ * @throws Exception
++ */
++ public void addCommunicationListener(ICommunicationsListener listener);
++
++ /**
++ * Method to remove a communication listener from the connector service defined for
++ * the given connection.
++ *
++ * @param listener - listener to remove
++ * @throws Exception
++ */
++ public void removeCommunicationListener(ICommunicationsListener listener);
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.remote;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.Status;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.CommandShell;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandShell;
++import org.eclipse.rse.core.model.IHost;
++import org.eclipse.rse.core.model.IRSECallback;
++import org.eclipse.rse.core.subsystems.ICommunicationsListener;
++import org.eclipse.rse.core.subsystems.IConnectorService;
++import org.eclipse.rse.core.subsystems.ISubSystem;
++import org.eclipse.rse.services.IService;
++import org.eclipse.rse.services.shells.IShellService;
++import org.eclipse.rse.services.terminals.ITerminalService;
++import org.eclipse.rse.subsystems.files.core.servicesubsystem.IFileServiceSubSystem;
++
++/**
++ * <b><u>RemoteSystemProxy</u></b>
++ * <p>
++ * RemoteSystemProxy implementation.
++ * </p>
++ */
++public class RemoteSystemProxy implements IRemoteSystemProxy {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ private IHost fHost;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ public RemoteSystemProxy(IHost host) {
++ fHost = host;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.util.IRemoteSystemProxy#getShellService(org.eclipse.rse.core.model.IHost)
++ */
++ @Override
++ public IShellService getShellService() {
++ ISubSystem ss = getShellServiceSubSystem();
++ if (ss != null) {
++ return (IShellService)ss.getSubSystemConfiguration().getService(fHost).getAdapter(IShellService.class);
++ }
++ return null;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.util.IRemoteSystemProxy#getTerminalService()
++ */
++ @Override
++ public ITerminalService getTerminalService() {
++ ISubSystem ss = getTerminalServiceSubSystem();
++ if (ss != null) {
++ return (ITerminalService)ss.getSubSystemConfiguration().getService(fHost).getAdapter(ITerminalService.class);
++ }
++ return null;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.util.IRemoteSystemProxy#getShellServiceSubSystem()
++ */
++ @Override
++ public ISubSystem getShellServiceSubSystem() {
++ if (fHost == null) {
++ return null;
++ }
++ ISubSystem[] subSystems = fHost.getSubSystems();
++ IShellService ssvc = null;
++ for (int i = 0; subSystems != null && i < subSystems.length; i++) {
++ IService svc = subSystems[i].getSubSystemConfiguration().getService(fHost);
++ if (svc!=null) {
++ ssvc = (IShellService)svc.getAdapter(IShellService.class);
++ if (ssvc != null) {
++ return subSystems[i];
++ }
++ }
++ }
++ return null;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.util.IRemoteSystemProxy#getTerminalServiceSubSystem()
++ */
++ @Override
++ public ISubSystem getTerminalServiceSubSystem() {
++ if (fHost == null) {
++ return null;
++ }
++ ISubSystem[] subSystems = fHost.getSubSystems();
++ ITerminalService ssvc = null;
++ for (int i = 0; subSystems != null && i < subSystems.length; i++) {
++ IService svc = subSystems[i].getSubSystemConfiguration().getService(fHost);
++ if (svc!=null) {
++ ssvc = (ITerminalService)svc.getAdapter(ITerminalService.class);
++ if (ssvc != null) {
++ return subSystems[i];
++ }
++ }
++ }
++ return null;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.remote.IRemoteSystemProxy#getFileServiceSubSystem()
++ */
++ @Override
++ public IFileServiceSubSystem getFileServiceSubSystem() {
++ if (fHost == null) {
++ return null;
++ }
++ ISubSystem[] subSystems = fHost.getSubSystems();
++ for (int i = 0; subSystems != null && i < subSystems.length; i++) {
++ if (subSystems[i] instanceof IFileServiceSubSystem) {
++ return (IFileServiceSubSystem)subSystems[i];
++ }
++ }
++ return null;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.util.IRemoteSystemProxy#connect(org.eclipse.rse.core.model.IRSECallback)
++ */
++ @Override
++ public void connect(IRSECallback callback) throws ExecutionException {
++ ISubSystem shellSubSystem = getShellServiceSubSystem();
++ if (shellSubSystem != null) {
++ if (!shellSubSystem.isConnected()) {
++ try {
++ shellSubSystem.connect(false, callback);
++ } catch (Exception e) {
++ throw new ExecutionException(e.toString(), e);
++ }
++ } else {
++ callback.done(Status.OK_STATUS, null);
++ }
++ }
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.util.IRemoteSystemProxy#disconnect()
++ */
++ @Override
++ public void disconnect() throws ExecutionException {
++ ISubSystem shellSubSystem = getShellServiceSubSystem();
++ if (shellSubSystem != null) {
++ try {
++ shellSubSystem.disconnect();
++ } catch (Exception e) {
++ throw new ExecutionException(e.toString(), e);
++ }
++ }
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.util.IRemoteSystemProxy#createCommandShell()
++ */
++ @Override
++ public ICommandShell createCommandShell() throws ExecutionException {
++ ICommandShell shell = new CommandShell(this);
++ shell.connect();
++ return shell;
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.util.IRemoteSystemProxy#addCommunicationListener(org.eclipse.rse.core.subsystems.ICommunicationsListener)
++ */
++ @Override
++ public void addCommunicationListener(ICommunicationsListener listener) {
++ IConnectorService[] css = fHost.getConnectorServices();
++ for (IConnectorService cs : css) {
++ cs.addCommunicationsListener(listener);
++ }
++ }
++
++ /* (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.util.IRemoteSystemProxy#removeCommunicationListener(org.eclipse.rse.core.subsystems.ICommunicationsListener)
++ */
++ @Override
++ public void removeCommunicationListener(ICommunicationsListener listener) {
++ IConnectorService[] css = fHost.getConnectorServices();
++ for (IConnectorService cs : css) {
++ cs.removeCommunicationsListener(listener);
++ }
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.service;
++
++import java.util.Arrays;
++
++/**
++ * <b><u>CommandResult</u></b>
++ * <p>
++ * Class containing command result of remote command execution.
++ * </p>
++ */
++public class CommandResult implements ICommandResult {
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The result of the command. 0 if successful else > 0
++ */
++ private int fResult;
++
++ /**
++ * The output as String array.
++ */
++ private String[] fOutput = new String[0];
++
++ // ------------------------------------------------------------------------
++ // Constructor
++ // ------------------------------------------------------------------------
++ public CommandResult(int result, String[] output) {
++ fResult = result;
++ if (output != null) {
++ fOutput = Arrays.copyOf(output, output.length);
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Accessor
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandResult#getResult()
++ */
++ @Override
++ public int getResult() {
++ return fResult;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandResult#setResult(int)
++ */
++ @Override
++ public void setResult(int result) {
++ fResult = result;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandResult#getOutput()
++ */
++ @Override
++ public String[] getOutput() {
++ return Arrays.copyOf(fOutput, fOutput.length);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandResult#setOutput(java.lang.String[])
++ */
++ @Override
++ public void setOutput(String[] output) {
++ fOutput = new String[0];
++ if (output != null) {
++ fOutput = Arrays.copyOf(output, output.length);
++ }
++ }
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Patrick Tasse - Initial API and implementation
++ * Bernd Hufmann - Updated using Executor Framework
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.service;
++
++import java.io.BufferedReader;
++import java.io.IOException;
++import java.io.InputStreamReader;
++import java.util.ArrayList;
++import java.util.concurrent.Callable;
++import java.util.concurrent.CancellationException;
++import java.util.concurrent.ExecutorService;
++import java.util.concurrent.Executors;
++import java.util.concurrent.FutureTask;
++import java.util.concurrent.TimeUnit;
++import java.util.concurrent.TimeoutException;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.NullProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.remote.IRemoteSystemProxy;
++import org.eclipse.rse.services.shells.HostShellProcessAdapter;
++import org.eclipse.rse.services.shells.IHostShell;
++import org.eclipse.rse.services.shells.IShellService;
++
++/**
++ * <b><u>CommandShell</u></b>
++ * <p>
++ * Implementation of remote command execution using RSE's shell service.
++ * </p>
++ */
++public class CommandShell implements ICommandShell {
++
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++
++ // string to be echo'ed when running command in shell, used to indicate that the command has finished running
++ public final static String DONE_MARKUP_STRING = "--RSE:donedonedone:--"; //$NON-NLS-1$
++
++ //command delimiter for shell
++ public final static String CMD_DELIMITER = "\n"; //$NON-NLS-1$
++
++ public final static String SHELL_ECHO_CMD = " echo "; //$NON-NLS-1$
++
++ private final static int DEFAULT_TIMEOUT_VALUE = 15000; // in milliseconds
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ private IRemoteSystemProxy fProxy = null;
++ private IHostShell fHostShell = null;
++ private BufferedReader fBufferReader = null;
++ private ExecutorService fExecutor = Executors.newFixedThreadPool(1);
++ private boolean fIsConnected = false;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++ public CommandShell(IRemoteSystemProxy proxy) {
++ fProxy = proxy;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandShell#connect()
++ */
++ @Override
++ public void connect() throws ExecutionException {
++ IShellService shellService = fProxy.getShellService();
++ Process p = null;
++ try {
++ fHostShell = shellService.launchShell("", new String[0], new NullProgressMonitor()); //$NON-NLS-1$
++ p = new HostShellProcessAdapter(fHostShell);
++ } catch (Exception e) {
++ throw new ExecutionException(Messages.TraceControl_CommandShellError, e);
++ }
++ fBufferReader = new BufferedReader(new InputStreamReader(p.getInputStream()));
++ fIsConnected = true;
++
++ // Flush Login messages
++ executeCommand(" ", new NullProgressMonitor(), false); //$NON-NLS-1$
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandShell#disconnect()
++ */
++ @Override
++ public void disconnect() {
++ fIsConnected = false;
++ try {
++ fBufferReader.close();
++ } catch (IOException e) {
++ // ignore
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandShell#executeCommand(java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public ICommandResult executeCommand(String command, IProgressMonitor monitor) throws ExecutionException {
++ return executeCommand(command, monitor, true);
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ICommandShell#executeCommand(java.lang.String, org.eclipse.core.runtime.IProgressMonitor, boolean)
++ */
++ @Override
++ public ICommandResult executeCommand(final String command, final IProgressMonitor monitor, final boolean checkReturnValue) throws ExecutionException {
++ if (fIsConnected) {
++ FutureTask<CommandResult> future = new FutureTask<CommandResult>(new Callable<CommandResult>() {
++ @Override
++ public CommandResult call() throws IOException, CancellationException {
++ final ArrayList<String> result = new ArrayList<String>();
++ int returnValue = 0;
++
++ synchronized (fHostShell) {
++ fHostShell.writeToShell(formatShellCommand(command));
++ String nextLine;
++ while ((nextLine = fBufferReader.readLine()) != null) {
++
++ if (monitor.isCanceled()) {
++ flushInput();
++ throw new CancellationException();
++ }
++
++ if (nextLine.contains(DONE_MARKUP_STRING) && nextLine.contains(SHELL_ECHO_CMD)) {
++ break;
++ }
++ }
++
++ while ((nextLine = fBufferReader.readLine()) != null) {
++ // check if job was cancelled
++ if (monitor.isCanceled()) {
++ flushInput();
++ throw new CancellationException();
++ }
++
++ if (!nextLine.contains(DONE_MARKUP_STRING)) {
++ result.add(nextLine);
++ } else {
++ if (checkReturnValue) {
++ returnValue = Integer.valueOf(nextLine.substring(DONE_MARKUP_STRING.length()+1));
++ }
++ break;
++ }
++ }
++
++ flushInput();
++ }
++ return new CommandResult(returnValue, result.toArray(new String[result.size()]));
++ }
++ });
++
++ fExecutor.execute(future);
++
++ try {
++ return future.get(DEFAULT_TIMEOUT_VALUE, TimeUnit.MILLISECONDS);
++ } catch (java.util.concurrent.ExecutionException ex) {
++ throw new ExecutionException(Messages.TraceControl_ExecutionFailure, ex);
++ } catch (InterruptedException ex) {
++ throw new ExecutionException(Messages.TraceControl_ExecutionCancelled, ex);
++ } catch (TimeoutException ex) {
++ throw new ExecutionException(Messages.TraceControl_ExecutionTimeout, ex);
++ }
++ }
++ throw new ExecutionException(Messages.TraceControl_ShellNotConnected, null);
++ }
++
++ // ------------------------------------------------------------------------
++ // Helper methods
++ // ------------------------------------------------------------------------
++ /**
++ * Flushes the buffer reader
++ * @throws IOException
++ */
++ private void flushInput() throws IOException {
++ char[] cbuf = new char[1];
++ while (fBufferReader.ready()) {
++ if (fBufferReader.read(cbuf, 0, 1) == -1) {
++ break;
++ }
++ }
++ }
++
++ /**
++ * format the command to be sent into the shell command with the done markup string.
++ * The done markup string is needed so we can tell that end of output has been reached.
++ *
++ * @param cmd
++ * @return formatted command string
++ */
++ private String formatShellCommand(String cmd) {
++ if (cmd == null || cmd.equals("")) //$NON-NLS-1$
++ return cmd;
++ StringBuffer formattedCommand = new StringBuffer();
++ // Make a multi line command by using \ and \r. This is needed for matching
++ // the DONE_MARKUP_STRING in echoed command when having a long command
++ // (bigger than max SSH line)
++ formattedCommand.append(cmd).append("\\\r;"); //$NON-NLS-1$
++ formattedCommand.append(SHELL_ECHO_CMD).append(DONE_MARKUP_STRING);
++ formattedCommand.append(" $?"); //$NON-NLS-1$
++ formattedCommand.append(CMD_DELIMITER);
++ return formattedCommand.toString();
++ }
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ *********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.service;
++
++/**
++ * <b><u>IommandResult</u></b>
++ * <p>
++ * Interface for providing command execution result.
++ * </p>
++ */
++public interface ICommandResult {
++ /**
++ * The result of the command.
++ * @return 0 if successful else >0
++ */
++ public int getResult() ;
++
++ /**
++ * Sets the command result value.
++ * @param result
++ */
++ public void setResult(int result);
++
++ /**
++ * @return returns the command output.
++ */
++ public String[] getOutput();
++
++ /**
++ * Sets the command output.
++ * @param output
++ */
++ public void setOutput(String[] output);
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.service;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++
++/**
++ * <b><u>ICommandShell</u></b>
++ * <p>
++ * Interface for a command shell implementation
++ * </p>
++ */
++public interface ICommandShell {
++
++ /**
++ * Method to connect the command shell.
++ * @throws ExecutionException
++ */
++ public void connect() throws ExecutionException;
++
++ /**
++ * Method to disconnect the command shell.
++ */
++ public void disconnect();
++
++ /**
++ * Method to execute a command on the command shell.
++ *
++ * @param command - the command to executed
++ * @param monitor - a progress monitor
++ * @return the command result
++ * @throws ExecutionException
++ */
++ public ICommandResult executeCommand(String command, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Method to execute a command on the command shell.
++ *
++ * @param command - the command to executed
++ * @param monitor - a progress monitor
++ * @param checkReturnValue - flag to indicate that the command result should be checked. If false the command result will be always 0.
++ * @return the command result
++ * @throws ExecutionException
++ */
++ public ICommandResult executeCommand(final String command, final IProgressMonitor monitor, final boolean checkReturnValue) throws ExecutionException;
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.service;
++
++import java.util.List;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++
++
++/** <b><u>ILttngControlService</u></b>
++* <p>
++* Interface for LTTng trace control command service.
++* </p>
++*/
++public interface ILttngControlService {
++ /**
++ * Retrieves the existing sessions names from the node.
++ * @param monitor - a progress monitor
++ * @return an array with session names.
++ * @throws ExecutionException
++ */
++ public String[] getSessionNames(IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Retrieves the session information with the given name the node.
++ * @param sessionName - the session name
++ * @param monitor - a progress monitor
++ * @return session information
++ * @throws ExecutionException
++ */
++ public ISessionInfo getSession(String sessionName, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Retrieves the kernel provider information (i.e. the kernel events)
++ * @param monitor - a progress monitor
++ * @return the list of existing kernel events.
++ * @throws ExecutionException
++ */
++ public List<IBaseEventInfo> getKernelProvider(IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Retrieves the UST provider information from the node.
++ * @return - the UST provider information.
++ * @throws ExecutionException
++ */
++ public List<IUstProviderInfo> getUstProvider() throws ExecutionException;
++ /**
++ * Retrieves the UST provider information from the node.
++ * @param monitor - a progress monitor
++ * @return the UST provider information.
++ * @throws ExecutionException
++ */
++ public List<IUstProviderInfo> getUstProvider(IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Creates a session with given session name and location.
++ * @param sessionName - a session name to create
++ * @param sessionPath - a path for storing the traces (use null for default)
++ * @param monitor - a progress monitor
++ * @return the session information
++ * @throws ExecutionException
++ */
++ public ISessionInfo createSession(String sessionName, String sessionPath, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Destroys a session with given session name.
++ * @param sessionName - a session name to destroy
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void destroySession(String sessionName, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Starts a session with given session name.
++ * @param sessionName - a session name to start
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void startSession(String sessionName, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Stops a session with given session name.
++ * @param sessionName - a session name to stop
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void stopSession(String sessionName, IProgressMonitor monitor) throws ExecutionException;
++
++
++ /**
++ * Enables a list of channels for given session and given channel information (configuration).
++ * @param sessionName - a session name to create
++ * @param channelNames - a list of channel names to be enabled
++ * @param isKernel - a flag to indicate Kernel or UST (true for Kernel, false for UST)
++ * @param info - channel information used for creation of a channel (or null for default)
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableChannels(String sessionName, List<String> channelNames, boolean isKernel, IChannelInfo info, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Disables a list of channels for given session and given channel information (configuration).
++ * @param sessionName - a session name to create
++ * @param channelNames - a list of channel names to be enabled
++ * @param isKernel - a flag to indicate Kernel or UST (true for Kernel, false for UST)
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void disableChannels(String sessionName, List<String> channelNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Enables a list of events with no additional parameters.
++ * @param sessionName - a session name
++ * @param channelName - a channel name or null for default channel
++ * @param eventNames - a list of event names to be enabled, or null (list of size = 0)for all events .
++ * @param isKernel - a flag for indicating kernel or UST.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableEvents(String sessionName, String channelName, List<String> eventNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Enables all syscall events.
++ * @param sessionName - a session name
++ * @param channelName - a channel name or null for default channel
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableSyscalls(String sessionName, String channelName, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Enables a dynamic probe or dynamic function entry/return probe.
++ * @param sessionName - a session name
++ * @param channelName - a channel name or null for default channel
++ * @param eventName - a event name
++ * @param isFunction - true for dynamic function entry/return probe else false
++ * @param probe - a dynamic probe information
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableProbe(String sessionName, String channelName, String eventName, boolean isFunction, String probe, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Enables events using log level
++ * @param sessionName - a session name
++ * @param channelName - a channel name (null for default channel)
++ * @param eventName - a event name
++ * @param logLevelType - a log level type
++ * @param level - a log level
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void enableLogLevel(String sessionName, String channelName, String eventName, LogLevelType logLevelType, TraceLogLevel level, IProgressMonitor monitor) throws ExecutionException;
++
++ /**
++ * Disables a list of events with no additional parameters.
++ * @param sessionName - a session name
++ * @param channelName - a channel name (null for default channel)
++ * @param eventNames - a list of event names to enabled.
++ * @param isKernel - a flag for indicating kernel or UST.
++ * @param monitor - a progress monitor
++ * @throws ExecutionException
++ */
++ public void disableEvent(String sessionName, String channelName, List<String> eventNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException;
++
++}
--- /dev/null
--- /dev/null
++/**********************************************************************
++ * Copyright (c) 2012 Ericsson
++ *
++ * All rights reserved. This program and the accompanying materials are
++ * made available under the terms of the Eclipse Public License v1.0 which
++ * accompanies this distribution, and is available at
++ * http://www.eclipse.org/legal/epl-v10.html
++ *
++ * Contributors:
++ * Bernd Hufmann - Initial API and implementation
++ **********************************************************************/
++package org.eclipse.linuxtools.internal.lttng.ui.views.control.service;
++
++import java.util.ArrayList;
++import java.util.Iterator;
++import java.util.List;
++import java.util.regex.Matcher;
++import java.util.regex.Pattern;
++
++import org.eclipse.core.commands.ExecutionException;
++import org.eclipse.core.runtime.IProgressMonitor;
++import org.eclipse.core.runtime.NullProgressMonitor;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.Messages;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IBaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IDomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IProbeEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.ISessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IUstProviderInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceEventType;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.BaseEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.ChannelInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.DomainInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.EventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.ProbeEventInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.SessionInfo;
++import org.eclipse.linuxtools.internal.lttng.ui.views.control.model.impl.UstProviderInfo;
++
++/**
++ * <b><u>LTTngControlService</u></b>
++ * <p>
++ * Service for sending LTTng trace control commands to remote host.
++ * </p>
++ */
++public class LTTngControlService implements ILttngControlService {
++ // ------------------------------------------------------------------------
++ // Constants
++ // ------------------------------------------------------------------------
++ // Command constants
++ /**
++ * The lttng tools command.
++ */
++ private final static String CONTROL_COMMAND = "lttng"; //$NON-NLS-1$
++ /**
++ * Command: lttng list.
++ */
++ private final static String COMMAND_LIST = CONTROL_COMMAND + " list "; //$NON-NLS-1$
++ /**
++ * Command to list kernel tracer information.
++ */
++ private final static String COMMAND_LIST_KERNEL = COMMAND_LIST + "-k"; //$NON-NLS-1$
++ /**
++ * Command to list user space trace information.
++ */
++ private final static String COMMAND_LIST_UST = COMMAND_LIST + "-u"; //$NON-NLS-1$
++ /**
++ * Command to create a session.
++ */
++ private final static String COMMAND_CREATE_SESSION = CONTROL_COMMAND + " create "; //$NON-NLS-1$
++ /**
++ * Command to destroy a session.
++ */
++ private final static String COMMAND_DESTROY_SESSION = CONTROL_COMMAND + " destroy "; //$NON-NLS-1$
++ /**
++ * Command to destroy a session.
++ */
++ private final static String COMMAND_START_SESSION = CONTROL_COMMAND + " start "; //$NON-NLS-1$
++ /**
++ * Command to destroy a session.
++ */
++ private final static String COMMAND_STOP_SESSION = CONTROL_COMMAND + " stop "; //$NON-NLS-1$
++ /**
++ * Command to enable a channel.
++ */
++ private final static String COMMAND_ENABLE_CHANNEL = CONTROL_COMMAND + " enable-channel "; //$NON-NLS-1$
++ /**
++ * Command to disable a channel.
++ */
++ private final static String COMMAND_DISABLE_CHANNEL = CONTROL_COMMAND + " disable-channel "; //$NON-NLS-1$
++ /**
++ * Command to enable a event.
++ */
++ private final static String COMMAND_ENABLE_EVENT = CONTROL_COMMAND + " enable-event "; //$NON-NLS-1$
++ /**
++ * Command to disable a event.
++ */
++ private final static String COMMAND_DISABLE_EVENT = CONTROL_COMMAND + " disable-event "; //$NON-NLS-1$
++
++ // Command options constants
++ /**
++ * Command line option for kernel tracer.
++ */
++ private final static String OPTION_KERNEL = " -k "; //$NON-NLS-1$
++ /**
++ * Command line option for UST tracer.
++ */
++ private final static String OPTION_UST = " -u "; //$NON-NLS-1$
++ /**
++ * Command line option for specifying a session.
++ */
++ private final static String OPTION_SESSION = " -s "; //$NON-NLS-1$
++ /**
++ * Command line option for specifying a channel.
++ */
++ private final static String OPTION_CHANNEL = " -c "; //$NON-NLS-1$
++ /**
++ * Command line option for specifying all events.
++ */
++ private final static String OPTION_ALL = " -a "; //$NON-NLS-1$
++ /**
++ * Command line option for specifying tracepoint events.
++ */
++ private final static String OPTION_TRACEPOINT = " --tracepoint "; //$NON-NLS-1$
++ /**
++ * Command line option for specifying syscall events.
++ */
++ private final static String OPTION_SYSCALL = " --syscall "; //$NON-NLS-1$
++ /**
++ * Command line option for specifying a dynamic probe.
++ */
++ private final static String OPTION_PROBE = " --probe "; //$NON-NLS-1$
++ /**
++ * Command line option for specifying a dynamic function entry/return probe.
++ */
++ private final static String OPTION_FUNCTION_PROBE = " --function "; //$NON-NLS-1$
++ /**
++ * Command line option for specifying a log level range.
++ */
++ private final static String OPTION_LOGLEVEL = " --loglevel "; //$NON-NLS-1$
++ /**
++ * Command line option for specifying a specific log level.
++ */
++ private final static String OPTION_LOGLEVEL_ONLY = " --loglevel-only "; //$NON-NLS-1$
++ /**
++ * Optional command line option for configuring a channel's overwrite mode.
++ */
++ private final static String OPTION_OVERWRITE = " --overwrite "; //$NON-NLS-1$
++ /**
++ * Optional command line option for configuring a channel's number of sub buffers.
++ */
++ private final static String OPTION_NUM_SUB_BUFFERS = " --num-subbuf "; //$NON-NLS-1$
++ /**
++ * Optional command line option for configuring a channel's sub buffer size.
++ */
++ private final static String OPTION_SUB_BUFFER_SIZE = " --subbuf-size "; //$NON-NLS-1$
++ /**
++ * Optional command line option for configuring a channel's switch timer interval.
++ */
++ private final static String OPTION_SWITCH_TIMER = " --switch-timer "; //$NON-NLS-1$
++ /**
++ * Optional command line option for configuring a channel's read timer interval.
++ */
++ private final static String OPTION_READ_TIMER = " --read-timer "; //$NON-NLS-1$
++
++ // Parsing constants
++ /**
++ * Pattern to match for error output
++ */
++ private final static Pattern ERROR_PATTERN = Pattern.compile("\\s*Error\\:.*"); //$NON-NLS-1$
++ /**
++ * Pattern to match for session information (lttng list)
++ */
++ private final static Pattern SESSION_PATTERN = Pattern.compile("\\s+(\\d+)\\)\\s+(.*)\\s+\\((.*)\\)\\s+\\[(active|inactive)\\].*"); //$NON-NLS-1$
++ /**
++ * Pattern to match for session information (lttng list <session>)
++ */
++ private final static Pattern TRACE_SESSION_PATTERN = Pattern.compile("\\s*Tracing\\s+session\\s+(.*)\\:\\s+\\[(active|inactive)\\].*"); //$NON-NLS-1$
++ /**
++ * Pattern to match for session path information (lttng list <session>)
++ */
++ private final static Pattern TRACE_SESSION_PATH_PATTERN = Pattern.compile("\\s*Trace\\s+path\\:\\s+(.*)"); //$NON-NLS-1$
++ /**
++ * Pattern to match for kernel domain information (lttng list <session>)
++ */
++ private final static Pattern DOMAIN_KERNEL_PATTERN = Pattern.compile("=== Domain: Kernel ==="); //$NON-NLS-1$
++ /**
++ * Pattern to match for ust domain information (lttng list <session>)
++ */
++ private final static Pattern DOMAIN_UST_GLOBAL_PATTERN = Pattern.compile("=== Domain: UST global ==="); //$NON-NLS-1$
++ /**
++ * Pattern to match for channels section (lttng list <session>)
++ */
++ private final static Pattern CHANNELS_SECTION_PATTERN = Pattern.compile("\\s*Channels\\:"); //$NON-NLS-1$
++ /**
++ * Pattern to match for channel information (lttng list <session>)
++ */
++ private final static Pattern CHANNEL_PATTERN = Pattern.compile("\\s*-\\s+(.*)\\:\\s+\\[(enabled|disabled)\\]"); //$NON-NLS-1$
++ /**
++ * Pattern to match for events section information (lttng list <session>)
++ */
++ private final static Pattern EVENT_SECTION_PATTERN = Pattern.compile("\\s*Events\\:"); //$NON-NLS-1$
++ /**
++ * Pattern to match for event information (no enabled events) (lttng list <session>)
++ */
++ // private final static String EVENT_NONE_PATTERN = "\\s+None"; //$NON-NLS-1$
++ /**
++ * Pattern to match for event information (lttng list <session>)
++ */
++ private final static Pattern EVENT_PATTERN = Pattern.compile("\\s+(.*)\\s+\\(loglevel:\\s+(.*)\\s+\\(\\d*\\)\\)\\s+\\(type:\\s+(.*)\\)\\s+\\[(enabled|disabled)\\].*"); //$NON-NLS-1$
++ /**
++ * Pattern to match a wildcarded event information (lttng list <session>)
++ */
++ private final static Pattern WILDCARD_EVENT_PATTERN = Pattern.compile("\\s+(.*)\\s+\\(type:\\s+(.*)\\)\\s+\\[(enabled|disabled)\\].*"); //$NON-NLS-1$
++ /**
++ * Pattern to match a probe address information (lttng list <session>)
++ */
++ private final static Pattern PROBE_ADDRESS_PATTERN = Pattern.compile("\\s+(addr)\\:\\s+(0x[0-9a-fA-F]{1,8})"); //$NON-NLS-1$
++ /**
++ * Pattern to match a probe OFFSET information (lttng list <session>)
++ */
++ private final static Pattern PROBE_OFFSET_PATTERN = Pattern.compile("\\s+(offset)\\:\\s+(0x[0-9a-fA-F]{1,8})"); //$NON-NLS-1$
++ /**
++ * Pattern to match a probe SYMBOL information (lttng list <session>)
++ */
++ private final static Pattern PROBE_SYMBOL_PATTERN = Pattern.compile("\\s+(symbol)\\:\\s+(.+)"); //$NON-NLS-1$
++ /**
++ * Pattern to match for channel (overwite mode) information (lttng list
++ * <session>)
++ */
++ private final static Pattern OVERWRITE_MODE_ATTRIBUTE = Pattern.compile("\\s+overwrite\\s+mode\\:.*"); //$NON-NLS-1$
++ /**
++ * Pattern to match indicating false for overwrite mode
++ */
++ private final static String OVERWRITE_MODE_ATTRIBUTE_FALSE = "0"; //$NON-NLS-1$
++ /**
++ * Pattern to match for channel (sub-buffer size) information (lttng list
++ * <session>)
++ */
++ private final static Pattern SUBBUFFER_SIZE_ATTRIBUTE = Pattern.compile("\\s+subbufers\\s+size\\:.*"); //$NON-NLS-1$
++ /**
++ * Pattern to match for channel (number of sub-buffers) information (lttng
++ * list <session>)
++ */
++ private final static Pattern NUM_SUBBUFFERS_ATTRIBUTE = Pattern.compile("\\s+number\\s+of\\s+subbufers\\:.*"); //$NON-NLS-1$
++ /**
++ * Pattern to match for channel (switch timer) information (lttng list
++ * <session>)
++ */
++ private final static Pattern SWITCH_TIMER_ATTRIBUTE = Pattern.compile("\\s+switch\\s+timer\\s+interval\\:.*"); //$NON-NLS-1$
++ /**
++ * Pattern to match for channel (read timer) information (lttng list
++ * <session>)
++ */
++ private final static Pattern READ_TIMER_ATTRIBUTE = Pattern.compile("\\s+read\\s+timer\\s+interval\\:.*"); //$NON-NLS-1$
++ /**
++ * Pattern to match for channel (output type) information (lttng list
++ * <session>)
++ */
++ private final static Pattern OUTPUT_ATTRIBUTE = Pattern.compile("\\s+output\\:.*"); //$NON-NLS-1$
++ /**
++ * Pattern to match for provider information (lttng list -k/-u)
++ */
++ private final static Pattern PROVIDER_EVENT_PATTERN = Pattern.compile("\\s*(.*)\\s+\\(loglevel:\\s+(.*)\\s+\\(\\d*\\)\\)\\s+\\(type:\\s+(.*)\\)"); //$NON-NLS-1$
++ /**
++ * Pattern to match for UST provider information (lttng list -u)
++ */
++ private final static Pattern UST_PROVIDER_PATTERN = Pattern.compile("\\s*PID\\:\\s+(\\d+)\\s+-\\s+Name\\:\\s+(.*)"); //$NON-NLS-1$
++ /**
++ * Pattern to match for session information (lttng create <session name>)
++ */
++ private final static Pattern CREATE_SESSION_NAME_PATTERN = Pattern.compile("\\s*Session\\s+(.*)\\s+created\\."); //$NON-NLS-1$
++ /**
++ * Pattern to match for session path information (lttng create <session name>)
++ */
++ private final static Pattern CREATE_SESSION_PATH_PATTERN = Pattern.compile("\\s*Traces\\s+will\\s+be\\s+written\\s+in\\s+(.*).*"); //$NON-NLS-1$
++ /**
++ * Pattern to match for session command output for "session name not found".
++ */
++ private final static Pattern SESSION_NOT_FOUND_ERROR_PATTERN = Pattern.compile("\\s*Error:\\s+Session\\s+name\\s+not\\s+found"); //$NON-NLS-1$
++
++ // ------------------------------------------------------------------------
++ // Attributes
++ // ------------------------------------------------------------------------
++ /**
++ * The command shell implementation
++ */
++ private ICommandShell fCommandShell = null;
++
++ // ------------------------------------------------------------------------
++ // Constructors
++ // ------------------------------------------------------------------------
++
++ /**
++ * Constructor
++ *
++ * @param shell
++ * - the command shell implementation to use
++ */
++ public LTTngControlService(ICommandShell shell) {
++ fCommandShell = shell;
++ }
++
++ // ------------------------------------------------------------------------
++ // Operations
++ // ------------------------------------------------------------------------
++
++ /*
++ * (non-Javadoc)
++ *
++ * @see
++ * org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService
++ * #getSessionNames(org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public String[] getSessionNames(IProgressMonitor monitor) throws ExecutionException {
++
++ String command = COMMAND_LIST;
++ ICommandResult result = fCommandShell.executeCommand(command, monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++
++ // Output:
++ // Available tracing sessions:
++ // 1) mysession1 (/home/user/lttng-traces/mysession1-20120123-083928)
++ // [inactive]
++ // 2) mysession (/home/user/lttng-traces/mysession-20120123-083318)
++ // [inactive]
++ //
++ // Use lttng list <session_name> for more details
++
++ ArrayList<String> retArray = new ArrayList<String>();
++ int index = 0;
++ while (index < result.getOutput().length) {
++ String line = result.getOutput()[index];
++ Matcher matcher = SESSION_PATTERN.matcher(line);
++ if (matcher.matches()) {
++ retArray.add(matcher.group(2).trim());
++ }
++ index++;
++ }
++ return retArray.toArray(new String[retArray.size()]);
++ }
++
++ /*
++ * (non-Javadoc)
++ *
++ * @see
++ * org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService
++ * #getSession(java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public ISessionInfo getSession(String sessionName, IProgressMonitor monitor) throws ExecutionException {
++
++ String command = COMMAND_LIST + sessionName;
++ ICommandResult result = fCommandShell.executeCommand(command, monitor);
++
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++
++ int index = 0;
++
++ // Output:
++ // Tracing session mysession2: [inactive]
++ // Trace path: /home/eedbhu/lttng-traces/mysession2-20120123-110330
++ ISessionInfo sessionInfo = new SessionInfo(sessionName);
++
++ while (index < result.getOutput().length) {
++ // Tracing session mysession2: [inactive]
++ // Trace path: /home/eedbhu/lttng-traces/mysession2-20120123-110330
++ //
++ // === Domain: Kernel ===
++ //
++ String line = result.getOutput()[index];
++ Matcher matcher = TRACE_SESSION_PATTERN.matcher(line);
++ if (matcher.matches()) {
++ sessionInfo.setSessionState(matcher.group(2));
++ index++;
++ continue;
++ }
++
++ matcher = TRACE_SESSION_PATH_PATTERN.matcher(line);
++ if (matcher.matches()) {
++ sessionInfo.setSessionPath(matcher.group(1).trim());
++ index++;
++ continue;
++ }
++
++ matcher = DOMAIN_KERNEL_PATTERN.matcher(line);
++ if (matcher.matches()) {
++ // Create Domain
++ IDomainInfo domainInfo = new DomainInfo(Messages.TraceControl_KernelDomainDisplayName);
++ sessionInfo.addDomain(domainInfo);
++
++ // in domain kernel
++ ArrayList<IChannelInfo> channels = new ArrayList<IChannelInfo>();
++ index = parseDomain(result.getOutput(), index, channels);
++
++ // set channels
++ domainInfo.setChannels(channels);
++
++ // set kernel flag
++ domainInfo.setIsKernel(true);
++ continue;
++ }
++
++ matcher = DOMAIN_UST_GLOBAL_PATTERN.matcher(line);
++ if (matcher.matches()) {
++ IDomainInfo domainInfo = new DomainInfo(Messages.TraceControl_UstGlobalDomainDisplayName);
++ sessionInfo.addDomain(domainInfo);
++
++ // in domain UST
++ ArrayList<IChannelInfo> channels = new ArrayList<IChannelInfo>();
++ index = parseDomain(result.getOutput(), index, channels);
++
++ // set channels
++ domainInfo.setChannels(channels);
++
++ // set kernel flag
++ domainInfo.setIsKernel(false);
++ continue;
++ }
++ index++;
++ }
++ return sessionInfo;
++ }
++
++ /*
++ * (non-Javadoc)
++ *
++ * @see
++ * org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService
++ * #getKernelProvider(org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public List<IBaseEventInfo> getKernelProvider(IProgressMonitor monitor) throws ExecutionException {
++ String command = COMMAND_LIST_KERNEL;
++ ICommandResult result = fCommandShell.executeCommand(command, monitor);
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++
++ // Kernel events:
++ // -------------
++ // sched_kthread_stop (type: tracepoint)
++ List<IBaseEventInfo> events = new ArrayList<IBaseEventInfo>();
++ getProviderEventInfo(result.getOutput(), 0, events);
++ return events;
++ }
++
++ /*
++ * (non-Javadoc)
++ *
++ * @see
++ * org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService
++ * #getUstProvider()
++ */
++ @Override
++ public List<IUstProviderInfo> getUstProvider() throws ExecutionException {
++ return getUstProvider(new NullProgressMonitor());
++ }
++
++ /*
++ * (non-Javadoc)
++ *
++ * @see
++ * org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService
++ * #getUstProvider(org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public List<IUstProviderInfo> getUstProvider(IProgressMonitor monitor) throws ExecutionException {
++ String command = COMMAND_LIST_UST;
++ ICommandResult result = fCommandShell.executeCommand(command, monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++
++ // UST events:
++ // -------------
++ //
++ // PID: 3635 - Name:
++ // /home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello
++ // ust_tests_hello:tptest_sighandler (loglevel: TRACE_EMERG0) (type:
++ // tracepoint)
++ // ust_tests_hello:tptest (loglevel: TRACE_EMERG0) (type: tracepoint)
++ //
++ // PID: 6459 - Name:
++ // /home/user/git/lttng-ust/tests/hello.cxx/.libs/lt-hello
++ // ust_tests_hello:tptest_sighandler (loglevel: TRACE_EMERG0) (type:
++ // tracepoint)
++ // ust_tests_hello:tptest (loglevel: TRACE_EMERG0) (type: tracepoint)
++
++ List<IUstProviderInfo> allProviders = new ArrayList<IUstProviderInfo>();
++ IUstProviderInfo provider = null;
++
++ int index = 0;
++ while (index < result.getOutput().length) {
++ String line = result.getOutput()[index];
++ Matcher matcher = UST_PROVIDER_PATTERN.matcher(line);
++ if (matcher.matches()) {
++
++ provider = new UstProviderInfo(matcher.group(2).trim());
++ provider.setPid(Integer.valueOf(matcher.group(1).trim()));
++ List<IBaseEventInfo> events = new ArrayList<IBaseEventInfo>();
++ index = getProviderEventInfo(result.getOutput(), ++index, events);
++ provider.setEvents(events);
++ allProviders.add(provider);
++
++ } else {
++ index++;
++ }
++
++ }
++ return allProviders;
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#createSession(java.lang.String, java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public ISessionInfo createSession(String sessionName, String sessionPath, IProgressMonitor monitor) throws ExecutionException {
++
++ String newName = formatParameter(sessionName);
++ String newPath = formatParameter(sessionPath);
++
++ String command = COMMAND_CREATE_SESSION + newName;
++ if (newPath != null && !"".equals(newPath)) { //$NON-NLS-1$
++ command += " -o " + newPath; //$NON-NLS-1$
++ }
++
++ ICommandResult result = fCommandShell.executeCommand(command, monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ //Session myssession2 created.
++ //Traces will be written in /home/user/lttng-traces/myssession2-20120209-095418
++ String[] output = result.getOutput();
++
++ // Get and verify session name
++ Matcher matcher = CREATE_SESSION_NAME_PATTERN.matcher(output[0]);
++ String name = null;
++
++ if (matcher.matches()) {
++ name = String.valueOf(matcher.group(1).trim());
++ } else {
++ // Output format not expected
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + //$NON-NLS-1$ //$NON-NLS-2$
++ Messages.TraceControl_UnexpectedCommnadOutputFormat + ":\n" + //$NON-NLS-1$
++ formatOutput(result.getOutput()));
++ }
++
++ if ((name == null) || (!name.equals(sessionName))) {
++ // Unexpected name returned
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + //$NON-NLS-1$ //$NON-NLS-2$
++ Messages.TraceControl_UnexpectedNameError + ": " + name); //$NON-NLS-1$
++ }
++
++ // Get and verify session path
++ matcher = CREATE_SESSION_PATH_PATTERN.matcher(output[1]);
++ String path = null;
++
++ if (matcher.matches()) {
++ path = String.valueOf(matcher.group(1).trim());
++ } else {
++ // Output format not expected
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + //$NON-NLS-1$ //$NON-NLS-2$
++ Messages.TraceControl_UnexpectedCommnadOutputFormat + ":\n" + //$NON-NLS-1$
++ formatOutput(result.getOutput()));
++ }
++
++ if ((path == null) || ((sessionPath != null) && (!path.contains(sessionPath)))) {
++ // Unexpected path
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + //$NON-NLS-1$ //$NON-NLS-2$
++ Messages.TraceControl_UnexpectedPathError + ": " + name); //$NON-NLS-1$
++ }
++
++ SessionInfo sessionInfo = new SessionInfo(name);
++ sessionInfo.setSessionPath(path);
++
++ return sessionInfo;
++ }
++
++ @Override
++ public void destroySession(String sessionName, IProgressMonitor monitor) throws ExecutionException {
++ String newName = formatParameter(sessionName);
++ String command = COMMAND_DESTROY_SESSION + newName;
++
++ ICommandResult result = fCommandShell.executeCommand(command, monitor);
++ String[] output = result.getOutput();
++
++ if (isError(result)) {
++ // In case "session not found" treat it as success
++ if ((output == null) || (!SESSION_NOT_FOUND_ERROR_PATTERN.matcher(output[0]).matches())) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ }
++ //Session <sessionName> destroyed
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#startSession(java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void startSession(String sessionName, IProgressMonitor monitor) throws ExecutionException {
++
++ String newSessionName = formatParameter(sessionName);
++
++ String command = COMMAND_START_SESSION + newSessionName;
++
++ ICommandResult result = fCommandShell.executeCommand(command, monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ //Session <sessionName> started
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#stopSession(java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void stopSession(String sessionName, IProgressMonitor monitor) throws ExecutionException {
++ String newSessionName = formatParameter(sessionName);
++ String command = COMMAND_STOP_SESSION + newSessionName;
++
++ ICommandResult result = fCommandShell.executeCommand(command, monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ //Session <sessionName> stopped
++
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#enableChannel(java.lang.String, java.util.List, boolean, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.IChannelInfo, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableChannels(String sessionName, List<String> channelNames, boolean isKernel, IChannelInfo info, IProgressMonitor monitor) throws ExecutionException {
++
++ // no channels to enable
++ if (channelNames.size() == 0) {
++ return;
++ }
++
++ String newSessionName = formatParameter(sessionName);
++
++ StringBuffer command = new StringBuffer(COMMAND_ENABLE_CHANNEL);
++
++ for (Iterator<String> iterator = channelNames.iterator(); iterator.hasNext();) {
++ String channel = (String) iterator.next();
++ command.append(channel);
++ if (iterator.hasNext()) {
++ command.append(","); //$NON-NLS-1$
++ }
++ }
++
++ if (isKernel) {
++ command.append(OPTION_KERNEL);
++ } else {
++ command.append(OPTION_UST);
++ }
++
++ command.append(OPTION_SESSION);
++ command.append(newSessionName);
++
++ if (info != null) {
++// --discard Discard event when buffers are full (default)
++
++// --overwrite Flight recorder mode
++ if (info.isOverwriteMode()) {
++ command.append(OPTION_OVERWRITE);
++ }
++// --subbuf-size SIZE Subbuffer size in bytes
++// (default: 4096, kernel default: 262144)
++ command.append(OPTION_SUB_BUFFER_SIZE);
++ command.append(String.valueOf(info.getSubBufferSize()));
++
++// --num-subbuf NUM Number of subbufers
++// (default: 8, kernel default: 4)
++ command.append(OPTION_NUM_SUB_BUFFERS);
++ command.append(String.valueOf(info.getNumberOfSubBuffers()));
++
++// --switch-timer USEC Switch timer interval in usec (default: 0)
++ command.append(OPTION_SWITCH_TIMER);
++ command.append(String.valueOf(info.getSwitchTimer()));
++
++// --read-timer USEC Read timer interval in usec (default: 200)
++ command.append(OPTION_READ_TIMER);
++ command.append(String.valueOf(info.getReadTimer()));
++ }
++
++ ICommandResult result = fCommandShell.executeCommand(command.toString(), monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#disableChannel(java.lang.String, java.util.List, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void disableChannels(String sessionName, List<String> channelNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException {
++
++ // no channels to enable
++ if (channelNames.size() == 0) {
++ return;
++ }
++
++ String newSessionName = formatParameter(sessionName);
++
++ StringBuffer command = new StringBuffer(COMMAND_DISABLE_CHANNEL);
++
++ for (Iterator<String> iterator = channelNames.iterator(); iterator.hasNext();) {
++ String channel = (String) iterator.next();
++ command.append(channel);
++ if (iterator.hasNext()) {
++ command.append(","); //$NON-NLS-1$
++ }
++ }
++
++ if (isKernel) {
++ command.append(OPTION_KERNEL);
++ } else {
++ command.append(OPTION_UST);
++ }
++
++ command.append(OPTION_SESSION);
++ command.append(newSessionName);
++
++ ICommandResult result = fCommandShell.executeCommand(command.toString(), monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#enableEvent(java.lang.String, java.lang.String, java.util.List, boolean, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableEvents(String sessionName, String channelName, List<String> eventNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException {
++
++ String newSessionName = formatParameter(sessionName);
++
++ StringBuffer command = new StringBuffer(COMMAND_ENABLE_EVENT);
++
++ if (eventNames == null || eventNames.size() == 0) {
++ command.append(OPTION_ALL);
++ } else {
++
++ for (Iterator<String> iterator = eventNames.iterator(); iterator.hasNext();) {
++ String event = (String) iterator.next();
++ command.append(event);
++ if (iterator.hasNext()) {
++ command.append(","); //$NON-NLS-1$
++ }
++ }
++ }
++
++ if (isKernel) {
++ command.append(OPTION_KERNEL);
++ } else {
++ command.append(OPTION_UST);
++ }
++
++ command.append(OPTION_SESSION);
++ command.append(newSessionName);
++
++ if (channelName != null) {
++ command.append(OPTION_CHANNEL);
++ command.append(channelName);
++ }
++
++ command.append(OPTION_TRACEPOINT);
++
++ ICommandResult result = fCommandShell.executeCommand(command.toString(), monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#enableSyscalls(java.lang.String, java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableSyscalls(String sessionName, String channelName, IProgressMonitor monitor) throws ExecutionException {
++ String newSessionName = formatParameter(sessionName);
++
++ StringBuffer command = new StringBuffer(COMMAND_ENABLE_EVENT);
++
++ command.append(OPTION_ALL);
++ command.append(OPTION_KERNEL);
++
++ command.append(OPTION_SESSION);
++ command.append(newSessionName);
++
++ if (channelName != null) {
++ command.append(OPTION_CHANNEL);
++ command.append(channelName);
++ }
++
++ command.append(OPTION_SYSCALL);
++
++ ICommandResult result = fCommandShell.executeCommand(command.toString(), monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#enableProbe(java.lang.String, java.lang.String, java.lang.String, java.lang.String, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableProbe(String sessionName, String channelName, String eventName, boolean isFunction, String probe, IProgressMonitor monitor) throws ExecutionException {
++ String newSessionName = formatParameter(sessionName);
++
++ StringBuffer command = new StringBuffer(COMMAND_ENABLE_EVENT);
++
++ command.append(eventName);
++ command.append(OPTION_KERNEL);
++
++ command.append(OPTION_SESSION);
++ command.append(newSessionName);
++
++ if (channelName != null) {
++ command.append(OPTION_CHANNEL);
++ command.append(channelName);
++ }
++ if (isFunction) {
++ command.append(OPTION_FUNCTION_PROBE);
++ } else {
++ command.append(OPTION_PROBE);
++ }
++
++ command.append(probe);
++
++ ICommandResult result = fCommandShell.executeCommand(command.toString(), monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#enableLogLevel(java.lang.String, java.lang.String, java.lang.String, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.LogLevelType, org.eclipse.linuxtools.internal.lttng.ui.views.control.model.TraceLogLevel, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void enableLogLevel(String sessionName, String channelName, String eventName, LogLevelType logLevelType, TraceLogLevel level, IProgressMonitor monitor) throws ExecutionException {
++ String newSessionName = formatParameter(sessionName);
++
++ StringBuffer command = new StringBuffer(COMMAND_ENABLE_EVENT);
++
++ command.append(eventName);
++ command.append(OPTION_UST);
++
++ command.append(OPTION_SESSION);
++ command.append(newSessionName);
++
++ if (channelName != null) {
++ command.append(OPTION_CHANNEL);
++ command.append(channelName);
++ }
++
++ if (logLevelType == LogLevelType.LOGLEVEL) {
++ command.append(OPTION_LOGLEVEL);
++ } else if (logLevelType == LogLevelType.LOGLEVEL_ONLY) {
++ command.append(OPTION_LOGLEVEL_ONLY);
++
++ } else {
++ return;
++ }
++ command.append(level.getInName());
++
++ ICommandResult result = fCommandShell.executeCommand(command.toString(), monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ }
++
++ /*
++ * (non-Javadoc)
++ * @see org.eclipse.linuxtools.internal.lttng.ui.views.control.service.ILttngControlService#disableEvent(java.lang.String, java.lang.String, java.util.List, boolean, org.eclipse.core.runtime.IProgressMonitor)
++ */
++ @Override
++ public void disableEvent(String sessionName, String channelName, List<String> eventNames, boolean isKernel, IProgressMonitor monitor) throws ExecutionException {
++ String newSessionName = formatParameter(sessionName);
++
++ StringBuffer command = new StringBuffer(COMMAND_DISABLE_EVENT);
++ if (eventNames == null) {
++ command.append(OPTION_ALL);
++ } else {
++ // no events to enable
++ if (eventNames.size() == 0) {
++ return;
++ }
++
++ for (Iterator<String> iterator = eventNames.iterator(); iterator.hasNext();) {
++ String event = (String) iterator.next();
++ command.append(event);
++ if (iterator.hasNext()) {
++ command.append(","); //$NON-NLS-1$
++ }
++ }
++ }
++
++ if (isKernel) {
++ command.append(OPTION_KERNEL);
++ } else {
++ command.append(OPTION_UST);
++ }
++
++ command.append(OPTION_SESSION);
++ command.append(newSessionName);
++
++ if (channelName != null) {
++ command.append(OPTION_CHANNEL);
++ command.append(channelName);
++ }
++
++ ICommandResult result = fCommandShell.executeCommand(command.toString(), monitor);
++
++ if (isError(result)) {
++ throw new ExecutionException(Messages.TraceControl_CommandError + " " + command + "\n" + formatOutput(result.getOutput())); //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ }
++
++ // ------------------------------------------------------------------------
++ // Helper methods
++ // ------------------------------------------------------------------------
++ /**
++ * Checks if command result is an error result.
++ *
++ * @param result
++ * - the command result to check
++ * @return true if error else false
++ */
++ private boolean isError(ICommandResult result) {
++ if ((result.getResult()) != 0 || (result.getOutput().length < 1 || ERROR_PATTERN.matcher(result.getOutput()[0]).matches())) {
++ return true;
++ }
++ return false;
++ }
++
++ /**
++ * Formats the output string as single string.
++ *
++ * @param output
++ * - output array
++ * @return - the formatted output
++ */
++ private String formatOutput(String[] output) {
++ if (output == null || output.length == 0) {
++ return ""; //$NON-NLS-1$
++ }
++
++ StringBuffer ret = new StringBuffer();
++ for (int i = 0; i < output.length; i++) {
++ ret.append(output[i] + "\n"); //$NON-NLS-1$
++ }
++ return ret.toString();
++ }
++
++ /**
++ * Parses the domain information.
++ *
++ * @param output
++ * - a command output array
++ * @param currentIndex
++ * - current index in command output array
++ * @param channels
++ * - list for returning channel information
++ * @return the new current index in command output array
++ */
++ private int parseDomain(String[] output, int currentIndex, List<IChannelInfo> channels) {
++ int index = currentIndex;
++
++ // Channels:
++ // -------------
++ // - channnel1: [enabled]
++ //
++ // Attributes:
++ // overwrite mode: 0
++ // subbufers size: 262144
++ // number of subbufers: 4
++ // switch timer interval: 0
++ // read timer interval: 200
++ // output: splice()
++
++ while (index < output.length) {
++ String line = output[index];
++
++ Matcher outerMatcher = CHANNELS_SECTION_PATTERN.matcher(line);
++ if (outerMatcher.matches()) {
++ IChannelInfo channelInfo = null;
++ while (index < output.length) {
++ String subLine = output[index];
++
++ Matcher innerMatcher = CHANNEL_PATTERN.matcher(subLine);
++ if (innerMatcher.matches()) {
++ channelInfo = new ChannelInfo(""); //$NON-NLS-1$
++ // get channel name
++ channelInfo.setName(innerMatcher.group(1));
++
++ // get channel enablement
++ channelInfo.setState(innerMatcher.group(2));
++
++ // add channel
++ channels.add(channelInfo);
++
++ } else if (OVERWRITE_MODE_ATTRIBUTE.matcher(subLine).matches()) {
++ String value = getAttributeValue(subLine);
++ channelInfo.setOverwriteMode(!OVERWRITE_MODE_ATTRIBUTE_FALSE.equals(value));
++ } else if (SUBBUFFER_SIZE_ATTRIBUTE.matcher(subLine).matches()) {
++ channelInfo.setSubBufferSize(Long.valueOf(getAttributeValue(subLine)));
++
++ } else if (NUM_SUBBUFFERS_ATTRIBUTE.matcher(subLine).matches()) {
++ channelInfo.setNumberOfSubBuffers(Integer.valueOf(getAttributeValue(subLine)));
++
++ } else if (SWITCH_TIMER_ATTRIBUTE.matcher(subLine).matches()) {
++ channelInfo.setSwitchTimer(Long.valueOf(getAttributeValue(subLine)));
++
++ } else if (READ_TIMER_ATTRIBUTE.matcher(subLine).matches()) {
++ channelInfo.setReadTimer(Long.valueOf(getAttributeValue(subLine)));
++
++ } else if (OUTPUT_ATTRIBUTE.matcher(subLine).matches()) {
++ channelInfo.setOutputType(getAttributeValue(subLine));
++
++ } else if (EVENT_SECTION_PATTERN.matcher(subLine).matches()) {
++ List<IEventInfo> events = new ArrayList<IEventInfo>();
++ index = parseEvents(output, index, events);
++ channelInfo.setEvents(events);
++ // we want to stay at the current index to be able to
++ // exit the domain
++ continue;
++ } else if (DOMAIN_KERNEL_PATTERN.matcher(subLine).matches()) {
++ return index;
++
++ } else if (DOMAIN_UST_GLOBAL_PATTERN.matcher(subLine).matches()) {
++ return index;
++ }
++ index++;
++ }
++ }
++ index++;
++ }
++ return index;
++ }
++
++ /**
++ * Parses the event information within a domain.
++ *
++ * @param output
++ * - a command output array
++ * @param currentIndex
++ * - current index in command output array
++ * @param events
++ * - list for returning event information
++ * @return the new current index in command output array
++ */
++ private int parseEvents(String[] output, int currentIndex, List<IEventInfo> events) {
++ int index = currentIndex;
++
++ while (index < output.length) {
++ String line = output[index];
++ if (CHANNEL_PATTERN.matcher(line).matches()) {
++ // end of channel
++ return index;
++ } else if (DOMAIN_KERNEL_PATTERN.matcher(line).matches()) {
++ // end of domain
++ return index;
++ } else if (DOMAIN_UST_GLOBAL_PATTERN.matcher(line).matches()) {
++ // end of domain
++ return index;
++ }
++
++ Matcher matcher = EVENT_PATTERN.matcher(line);
++ Matcher matcher2 = WILDCARD_EVENT_PATTERN.matcher(line);
++
++ if (matcher.matches()) {
++ IEventInfo eventInfo = new EventInfo(matcher.group(1).trim());
++ eventInfo.setLogLevel(matcher.group(2).trim());
++ eventInfo.setEventType(matcher.group(3).trim());
++ eventInfo.setState(matcher.group(4));
++ events.add(eventInfo);
++ index++;
++ } else if (matcher2.matches()) {
++ IEventInfo eventInfo = new EventInfo(matcher2.group(1).trim());
++ eventInfo.setLogLevel(TraceLogLevel.LEVEL_UNKNOWN);
++ eventInfo.setEventType(matcher2.group(2).trim());
++ eventInfo.setState(matcher2.group(3));
++
++ if (eventInfo.getEventType() == TraceEventType.PROBE) {
++ IProbeEventInfo probeEvent = new ProbeEventInfo(eventInfo.getName());
++ probeEvent.setLogLevel(eventInfo.getLogLevel());
++ probeEvent.setEventType(eventInfo.getEventType());
++ probeEvent.setState(eventInfo.getState());
++
++ // Overwrite eventinfo
++ eventInfo = probeEvent;
++
++ // myevent2 (type: probe) [enabled]
++ // addr: 0xc0101340
++ // myevent0 (type: probe) [enabled]
++ // offset: 0x0
++ // symbol: init_post
++ index++;
++ while (index < output.length) {
++ String probeLine = output[index];
++ // parse probe
++ Matcher addrMatcher = PROBE_ADDRESS_PATTERN.matcher(probeLine);
++ Matcher offsetMatcher = PROBE_OFFSET_PATTERN.matcher(probeLine);
++ Matcher symbolMatcher = PROBE_SYMBOL_PATTERN.matcher(probeLine);
++ if (addrMatcher.matches()) {
++ String addr = addrMatcher.group(2).trim();
++ probeEvent.setAddress(addr);
++ } else if (offsetMatcher.matches()) {
++ String offset = offsetMatcher.group(2).trim();
++ probeEvent.setOffset(offset);
++ } else if (symbolMatcher.matches()) {
++ String symbol = symbolMatcher.group(2).trim();
++ probeEvent.setSymbol(symbol);
++ } else if ((EVENT_PATTERN.matcher(probeLine).matches()) || (WILDCARD_EVENT_PATTERN.matcher(probeLine).matches())) {
++ break;
++ } else if (CHANNEL_PATTERN.matcher(probeLine).matches()) {
++ break;
++ } else if (DOMAIN_KERNEL_PATTERN.matcher(probeLine).matches()) {
++ // end of domain
++ break;
++ } else if (DOMAIN_UST_GLOBAL_PATTERN.matcher(probeLine).matches()) {
++ // end of domain
++ break;
++ }
++ index++;
++ }
++ events.add(eventInfo);
++ } else {
++ events.add(eventInfo);
++ index++;
++ continue;
++ }
++ } else {
++ index++;
++ }
++// else if (line.matches(EVENT_NONE_PATTERN)) {
++ // do nothing
++// } else
++
++ }
++
++ return index;
++ }
++
++ /**
++ * Parses a line with attributes: <attribute Name>: <attribute value>
++ *
++ * @param line
++ * - attribute line to parse
++ * @return the attribute value as string
++ */
++ private String getAttributeValue(String line) {
++ String[] temp = line.split("\\: "); //$NON-NLS-1$
++ return temp[1];
++ }
++
++ /**
++ * Parses the event information within a provider.
++ *
++ * @param output
++ * - a command output array
++ * @param currentIndex
++ * - current index in command output array
++ * @param events
++ * - list for returning event information
++ * @return the new current index in command output array
++ */
++ private int getProviderEventInfo(String[] output, int currentIndex, List<IBaseEventInfo> events) {
++ int index = currentIndex;
++ while (index < output.length) {
++ String line = output[index];
++ Matcher matcher = PROVIDER_EVENT_PATTERN.matcher(line);
++ if (matcher.matches()) {
++ // sched_kthread_stop (loglevel: TRACE_EMERG0) (type:
++ // tracepoint)
++ IBaseEventInfo eventInfo = new BaseEventInfo(matcher.group(1).trim());
++ eventInfo.setLogLevel(matcher.group(2).trim());
++ eventInfo.setEventType(matcher.group(3).trim());
++ events.add(eventInfo);
++ } else if (UST_PROVIDER_PATTERN.matcher(line).matches()) {
++ return index;
++ }
++ index++;
++ }
++ return index;
++ }
++
++ /**
++ * Formats a command parameter for the command execution i.e. adds quotes
++ * at the beginning and end if necessary.
++ * @param parameter - parameter to format
++ * @return formated parameter
++ */
++ private String formatParameter(String parameter) {
++ if (parameter != null) {
++ String newString = String.valueOf(parameter);
++
++ if (parameter.contains(" ")) { //$NON-NLS-1$
++ newString = "\"" + newString + "\""; //$NON-NLS-1$ //$NON-NLS-2$
++ }
++ return newString;
++ }
++ return null;
++ }
++
++}
projects / deliverable / tracecompass.git / commitdiff
